From e3b0380db718813082347c64b9e3eb6b62349da4 Mon Sep 17 00:00:00 2001
From: Etienne Brateau <etienne.brateau@ensiie.fr>
Date: Tue, 25 Sep 2018 16:56:33 +0200
Subject: [PATCH] logsim logsimasm logsimh: reindent theses files

---
 log/src/logsim.c    | 3322 ++++++++-------
 log/src/logsimasm.c | 1110 ++---
 log/src/logsimh.c   | 9963 ++++++++++++++++++++++---------------------
 3 files changed, 7371 insertions(+), 7024 deletions(-)

diff --git a/log/src/logsim.c b/log/src/logsim.c
index 9ea1057..eccd0e0 100644
--- a/log/src/logsim.c
+++ b/log/src/logsim.c
@@ -11,28 +11,28 @@
    Copyright (C) 1985, 1990 John Lazzaro.
    Author's address: lazzaro@csvax.caltech.edu; 256-80 Caltech.
 
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation (any version).
+   This program is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation (any version).
 
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-GNU General Public License for more details.
+   This program is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
 
-You should have received a copy of the GNU General Public License
-along with this program; see the file COPYING.  If not, write to
-the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+   You should have received a copy of the GNU General Public License
+   along with this program; see the file COPYING.  If not, write to
+   the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
 
 
 /*
 
-      LOG 4.1   Digital logic simulation routines
+   LOG 4.1   Digital logic simulation routines
 
-      David Gillespie  7/13/85
+   David Gillespie  7/13/85
 
-      The following module is subject to change at any time.
-*/
+   The following module is subject to change at any time.
+   */
 
 
 /* $debug$ {*/
@@ -47,8 +47,8 @@ extern int findprocedure (char *name, void (**start)());
 
 
 /*$ if debugging $
-   $ debug on $
-$ end $*/
+  $ debug on $
+  $ end $*/
 
 
 
@@ -69,14 +69,14 @@ typedef long histcolortabletype[12];
 
 
 static const ttable bcomb = {
-  { log_none, log_zero, log_one },
-  { log_zero, log_zero, log_one },
-  { log_one, log_one, log_one }
+	{ log_none, log_zero, log_one },
+	{ log_zero, log_zero, log_one },
+	{ log_one, log_one, log_one }
 };
 
 static const histcolortabletype histcolortable = {
-  log_cyan, log_orange, log_yellow, log_pink, log_green, log_red, log_white,
-  log_mred, log_lgray, log_dcyan, log_dyellow, log_dred
+	log_cyan, log_orange, log_yellow, log_pink, log_green, log_red, log_white,
+	log_mred, log_lgray, log_dcyan, log_dyellow, log_dred
 };
 
 
@@ -97,1343 +97,1325 @@ static log_gattrrec *diggattr;
 static short backgrcolor, ledoncolor, ledoffcolor, scopecolor, scopescancolor;
 
 
-
-
-
-
 /* The following routines are exported so that users' gates can use them. */
 
 
-static void log_16_input(lact, n, v)
-log_action_t *lact;
-log_nrec *n;
-log_16_value *v;
+static void log_16_input(log_action_t *lact, log_nrec *n, log_16_value *v)
 {
-  nodeinfo *ni;
+	nodeinfo *ni;
 
-  ni = (nodeinfo *)n->info;
-  *v = ni->v;
+	ni = (nodeinfo *)n->info;
+	*v = ni->v;
 }
 
 
-
-static void log_16_output(lact, n, v)
-log_action_t *lact;
-log_nrec *n;
-log_16_value v;
+static void log_16_output(log_action_t *lact, log_nrec *n, log_16_value v)
 {
-  nodeinfo *ni;
-
-  ni = (nodeinfo *)n->info;
-  if ((int)v > 2)
-    v = log_one;
-  if (ni->v0 == log_none)
-    ni->v0 = v;
-  else if (ni->v0 != v && v != log_none)
-    (*lact->hook.nodeconflict)(n);
-}
-
+	nodeinfo *ni;
 
+	ni = (nodeinfo *)n->info;
+	if ((int)v > 2)
+		v = log_one;
 
-static void log_16_ocoutput(lact, n, v)
-log_action_t *lact;
-log_nrec *n;
-log_16_value v;
-{
-  nodeinfo *ni;
-
-  if (v != log_zero)
-    return;
-  ni = (nodeinfo *)n->info;
-  if (ni->v0 != log_none)
-    (*lact->hook.nodeconflict)(n);
-  else
-    ni->v0 = v;
+	if (ni->v0 == log_none)
+		ni->v0 = v;
+	else if (ni->v0 != v && v != log_none)
+		(*lact->hook.nodeconflict)(n);
 }
 
 
 
-static void getpointmark(num, defx, defy, x, y)
-short num, defx, defy, *x, *y;
+static void log_16_ocoutput(log_action_t *lact, log_nrec *n, log_16_value v)
 {
-  log_action_t *WITH;
-  log_hook2_t *WITH1;
-
-  *x = defx;
-  *y = defy;
-  WITH = logsima_action.lact;
-  WITH1 = WITH->hook2;
-  (*WITH1->findpointmarker)(WITH->actgate->kind, num, x, y);
-}
+	nodeinfo *ni;
 
+	if (v != log_zero)
+		return;
 
+	ni = (nodeinfo *)n->info;
+
+	if (ni->v0 != log_none)
+		(*lact->hook.nodeconflict)(n);
+	else
+		ni->v0 = v;
+}
 
 
 
-static void log_16_led(lact, x, y, v)
-log_action_t *lact;
-short x, y;
-log_16_value v;
+static void getpointmark(short num, short defx, short defy, short *x, short *y)
 {
-  (*lact->hook.xform)(lact->actgate, &x, &y);
-  (*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
-  switch (v) {
-
-  case log_none:
-    m_color((long)lact->color.backgr);
-    break;
-
-  case log_zero:
-    m_color((long)ledoffcolor);
-    break;
-
-  case log_one:
-    m_color((long)ledoncolor);
-    break;
-  }
-  m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
-  (*lact->hook.unhidecursor)();
+	log_action_t *WITH;
+	log_hook2_t *WITH1;
+
+	*x = defx;
+	*y = defy;
+	WITH = logsima_action.lact;
+	WITH1 = WITH->hook2;
+	(*WITH1->findpointmarker)(WITH->actgate->kind, num, x, y);
 }
 
 
-
-static void log_16_eraled(lact, x, y)
-log_action_t *lact;
-short x, y;
+static void log_16_led(log_action_t *lact, short x, short y, log_16_value v)
 {
-  (*lact->hook.xform)(lact->actgate, &x, &y);
-  (*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
-  m_color((long)lact->color.backgr);
-  m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
-  (*lact->hook.unhidecursor)();
+	(*lact->hook.xform)(lact->actgate, &x, &y);
+	(*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
+
+	switch (v)
+	{
+		case log_none:
+			m_color((long)lact->color.backgr);
+			break;
+
+		case log_zero:
+			m_color((long)ledoffcolor);
+			break;
+
+		case log_one:
+			m_color((long)ledoncolor);
+			break;
+	}
+
+	m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
+	(*lact->hook.unhidecursor)();
 }
 
 
 
-static void log_16_plotled(lact, x, y, v)
-log_action_t *lact;
-short x, y;
-log_16_value v;
+static void log_16_eraled(log_action_t *lact, short x, short y)
 {
-  na_strlist_t *l1;
-  char STR2[256];
-
-  if (v == log_none)
-    return;
-  switch (v) {
-
-  case log_zero:
-    l1 = strlist_append(&lact->actstrlist, "color offled");
-    break;
-
-  case log_one:
-    l1 = strlist_append(&lact->actstrlist, "color onled");
-    break;
-
-  default:
-    break;
-  }
-  (*lact->hook2->plainxform)(lact->actgate, &x, &y);
-  sprintf(STR2, "fillbox %ld %ld %ld %ld", x - 3L, y - 3L, x + 3L, y + 3L);
-  l1 = strlist_append(&lact->actstrlist, STR2);
+	(*lact->hook.xform)(lact->actgate, &x, &y);
+	(*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
+	m_color((long)lact->color.backgr);
+	m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
+	(*lact->hook.unhidecursor)();
 }
 
 
 
+static void log_16_plotled(log_action_t *lact, short x, short y, log_16_value v)
+{
+	na_strlist_t *l1;
+	char STR2[256];
+
+	if (v == log_none)
+		return;
+	switch (v)
+	{
+		case log_zero:
+			l1 = strlist_append(&lact->actstrlist, "color offled");
+			break;
+
+		case log_one:
+			l1 = strlist_append(&lact->actstrlist, "color onled");
+			break;
+
+		default:
+			break;
+	}
 
+	(*lact->hook2->plainxform)(lact->actgate, &x, &y);
+	sprintf(STR2, "fillbox %ld %ld %ld %ld", x - 3L, y - 3L, x + 3L, y + 3L);
+	l1 = strlist_append(&lact->actstrlist, STR2);
+}
 
 
 /* The following routines control LOG's standard non-GDL gates. */
 
 
-void Log_16_ledgate(act)
-log_16_action *act;
+void Log_16_ledgate(log_16_action *act)
 {
-  nodeinfo *pin1;
-  log_action_t *WITH;
-  log_grec *WITH1;
-  char TEMP;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_sim:
-    pin1 = (nodeinfo *)WITH1->pin[0]->info;
-    P_clrbits_S(*(unsigned long *)&(WITH1->vars), 0, 1);
-    P_putbits_US(*(unsigned long *)&(WITH1->vars), 0,
-		 log_16_vi[(long)pin1->v - (long)log_none], 1);
-    break;
-
-  case act_16_draw:
-    if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
-			  P_getbits_US((unsigned long)WITH1->vars, 1, 1)) {
-      log_16_led(act->lact, 0, 0,
-		 log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
-      TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
-      P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
-      P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
-    }
-    break;
-
-  case act_16_erase:
-    log_16_eraled(act->lact, 0, 0);
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actflag = true;
-    else if (!strcmp(WITH->genfunc, "PLOT"))
-      log_16_plotled(act->lact, 0, 0,
-	log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
-    break;
-
-  default:
-    break;
-  }
+	nodeinfo *pin1;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	char TEMP;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_sim:
+			pin1 = (nodeinfo *)WITH1->pin[0]->info;
+			P_clrbits_S(*(unsigned long *)&(WITH1->vars), 0, 1);
+			P_putbits_US(*(unsigned long *)&(WITH1->vars), 0,
+					log_16_vi[(long)pin1->v - (long)log_none], 1);
+			break;
+
+		case act_16_draw:
+			if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
+					P_getbits_US((unsigned long)WITH1->vars, 1, 1))
+			{
+				log_16_led(act->lact, 0, 0,
+						log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+				TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
+				P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
+				P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
+			}
+			break;
+
+		case act_16_erase:
+			log_16_eraled(act->lact, 0, 0);
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+				WITH->actflag = true;
+			else if (!strcmp(WITH->genfunc, "PLOT"))
+				log_16_plotled(act->lact, 0, 0,
+						log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+			break;
+
+		default:
+			break;
+	}
 }
 
 
 
-void Log_16_ledgate2(act)
-log_16_action *act;
+void Log_16_ledgate2(log_16_action *act)
 {
-  long i;
-  nodeinfo *pin1;
-  log_action_t *WITH;
-  log_grec *WITH1;
-  long FORLIM;
-  char TEMP;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_sim:
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
-    FORLIM = WITH1->kind->numpins;
-    for (i = 0; i < FORLIM; i++) {
-      pin1 = (nodeinfo *)WITH1->pin[i]->info;
-      switch (pin1->v) {
-
-      case log_zero:
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
-	break;
-
-      case log_one:
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 1));
-	break;
-
-      default:
-	break;
-      }
-    }
-    if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 &&
-	(((unsigned long)WITH1->vars) & (1L << 1)) != 0) {
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
-    }
-    break;
-
-  case act_16_draw:
-    if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
-			  P_getbits_US((unsigned long)WITH1->vars, 1, 1)) {
-      log_16_led(act->lact, 0, 0,
-		 log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
-      TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
-      P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
-      P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
-    }
-    break;
-
-  case act_16_erase:
-    log_16_eraled(act->lact, 0, 0);
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actflag = true;
-    else if (!strcmp(WITH->genfunc, "PLOT"))
-      log_16_plotled(act->lact, 0, 0,
-	log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
-    break;
-
-  default:
-    break;
-  }
+	long i;
+	nodeinfo *pin1;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	long FORLIM;
+	char TEMP;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_sim:
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+			FORLIM = WITH1->kind->numpins;
+			for (i = 0; i < FORLIM; i++)
+			{
+				pin1 = (nodeinfo *)WITH1->pin[i]->info;
+				switch (pin1->v)
+				{
+					case log_zero:
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+						break;
+
+					case log_one:
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 1));
+						break;
+
+					default:
+						break;
+				}
+			}
+			
+			if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 &&
+					(((unsigned long)WITH1->vars) & (1L << 1)) != 0)
+			{
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+			}
+			break;
+
+		case act_16_draw:
+			if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
+					P_getbits_US((unsigned long)WITH1->vars, 1, 1))
+			{
+				log_16_led(act->lact, 0, 0,
+						log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+				TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
+				P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
+				P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
+			}
+			break;
+
+		case act_16_erase:
+			log_16_eraled(act->lact, 0, 0);
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+				WITH->actflag = true;
+			else if (!strcmp(WITH->genfunc, "PLOT"))
+				log_16_plotled(act->lact, 0, 0,
+						log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+			break;
+
+		default:
+			break;
+	}
 }
 
 
 
-void Log_16_clock(act)
-log_16_action *act;
+void Log_16_clock(log_16_action *act)
 {
-  log_action_t *WITH;
-  log_grec *WITH1;
-  int TEMP;
-  long TEMP1;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_sim:
-    if (resetcounter > 0)
-      WITH1->info = (na_long)0;
-    if ((isstable || WITH1->attr[0].UU.nv != 2) && (long)WITH1->info < 1) {
-      switch (WITH1->attr[0].UU.nv) {
-
-      case 0:
-	if (WITH1->attr[1].UU.U73.i1 == 0)
-	  WITH1->info = (na_long)0;
-	else
-	  WITH1->info = (na_long)(100 / WITH1->attr[1].UU.U73.i1);
-	break;
-
-      case 1:
-	WITH1->info = (na_long)WITH1->attr[2].UU.U73.i1;
-	break;
-
-      case 2:
-	WITH1->info = (na_long)WITH1->attr[3].UU.U73.i1;
-	break;
-      }
-      if (resetcounter > 0) {
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 2));
-	P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
-      } else {
-	switch (WITH1->attr[4].UU.nv) {
-
-	case 0:
-	  TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-	  WITH1->vars = (na_long)
-			(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
-	  TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
-	  WITH1->vars = (na_long)
-			(((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
-	  if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
-	    WITH1->info = (na_long)((long)WITH1->info / 2);
-	  else
-	    WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 2);
-	  break;
-
-	case 1:
-	  TEMP1 = (P_getbits_US((unsigned long)WITH1->vars, 2, 1) + 1) & 3;
-	  P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
-	  P_putbits_US(*(unsigned long *)&(WITH1->vars), 2, TEMP1, 1);
-	  TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0 &&
-		  (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-	  WITH1->vars = (na_long)
-			(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
-	  TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) == 0 &&
-		  (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
-	  WITH1->vars = (na_long)
-			(((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
-	  if (P_getbits_US((unsigned long)WITH1->vars, 2, 1) > 0 ||
-	      (long)WITH1->info < 4)
-	    WITH1->info = (na_long)((long)WITH1->info / 4);
-	  else
-	    WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 4 * 3);
-	  break;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	int TEMP;
+	long TEMP1;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_sim:
+			if (resetcounter > 0)
+				WITH1->info = (na_long)0;
+
+			if ((isstable || WITH1->attr[0].UU.nv != 2) && (long)WITH1->info < 1)
+			{
+				switch (WITH1->attr[0].UU.nv)
+				{
+					case 0:
+						if (WITH1->attr[1].UU.U73.i1 == 0)
+							WITH1->info = (na_long)0;
+						else
+							WITH1->info = (na_long)(100 / WITH1->attr[1].UU.U73.i1);
+						break;
+
+					case 1:
+						WITH1->info = (na_long)WITH1->attr[2].UU.U73.i1;
+						break;
+
+					case 2:
+						WITH1->info = (na_long)WITH1->attr[3].UU.U73.i1;
+						break;
+				}
+
+				if (resetcounter > 0)
+				{
+					WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+					WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 2));
+					P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
+				}
+				else
+				{
+					switch (WITH1->attr[4].UU.nv)
+					{
+						case 0:
+							TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
+							WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+							WITH1->vars = (na_long)
+								(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+							TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
+							WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+							WITH1->vars = (na_long)
+								(((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
+							if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+								WITH1->info = (na_long)((long)WITH1->info / 2);
+							else
+								WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 2);
+							break;
+
+						case 1:
+							TEMP1 = (P_getbits_US((unsigned long)WITH1->vars, 2, 1) + 1) & 3;
+							P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
+							P_putbits_US(*(unsigned long *)&(WITH1->vars), 2, TEMP1, 1);
+							TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0 &&
+									(((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+							WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+							WITH1->vars = (na_long)
+								(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+							TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) == 0 &&
+									(((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+							WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+							WITH1->vars = (na_long)
+								(((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
+							if (P_getbits_US((unsigned long)WITH1->vars, 2, 1) > 0 ||
+									(long)WITH1->info < 4)
+								WITH1->info = (na_long)((long)WITH1->info / 4);
+							else
+								WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 4 * 3);
+							break;
+					}
+				}
+			}
+
+			switch (WITH1->attr[0].UU.nv)
+			{
+				case 0:
+					if (newsystime > oldsystime && newsystime < oldsystime + 10000)
+						WITH1->info = (na_long)((long)WITH1->info + oldsystime - newsystime);
+					break;
+
+				case 1:
+				case 2:
+					WITH1->info = (na_long)((long)WITH1->info - 1);
+					break;
+			}
+			break;
+
+		case act_16_draw:
+			if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 0)) != 0))
+			{
+				log_16_led(act->lact, 5, -5,
+						log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
+			}
+			
+			if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 2)) != 0))
+			{
+				log_16_led(act->lact, 5, 5,
+						log_16_bv[((((unsigned long)WITH1->vars) & (1L << 2)) != 0) - false]);
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 3));
+			}
+			break;
+
+		case act_16_erase:
+			log_16_eraled(act->lact, 5, -5);
+			log_16_eraled(act->lact, 5, 5);
+			break;
+
+		case act_16_configchgate:
+			switch (WITH->actx)
+			{
+
+				case 2:
+				case 3:
+				case 4:
+					if (WITH1->attr[WITH->actx - 1].UU.U73.i1 <= 0 ||
+							WITH1->attr[WITH->actx - 1].UU.U73.i1 > 32767)
+						WITH->actflag = false;
+					break;
+			}
+			WITH1->info = (na_long)10;
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+				WITH->actflag = true;
+			break;
+
+		default:
+			break;
 	}
-      }
-    }
-    switch (WITH1->attr[0].UU.nv) {
-
-    case 0:
-      if (newsystime > oldsystime && newsystime < oldsystime + 10000)
-	WITH1->info = (na_long)((long)WITH1->info + oldsystime - newsystime);
-      break;
-
-    case 1:
-    case 2:
-      WITH1->info = (na_long)((long)WITH1->info - 1);
-      break;
-    }
-    break;
-
-  case act_16_draw:
-    if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
-			  ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)) {
-      log_16_led(act->lact, 5, -5,
-	log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
-    }
-    if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
-			  ((((unsigned long)WITH1->vars) & (1L << 2)) != 0)) {
-      log_16_led(act->lact, 5, 5,
-	log_16_bv[((((unsigned long)WITH1->vars) & (1L << 2)) != 0) - false]);
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 3));
-    }
-    break;
-
-  case act_16_erase:
-    log_16_eraled(act->lact, 5, -5);
-    log_16_eraled(act->lact, 5, 5);
-    break;
-
-  case act_16_configchgate:
-    switch (WITH->actx) {
-
-    case 2:
-    case 3:
-    case 4:
-      if (WITH1->attr[WITH->actx - 1].UU.U73.i1 <= 0 ||
-	  WITH1->attr[WITH->actx - 1].UU.U73.i1 > 32767)
-	WITH->actflag = false;
-      break;
-    }
-    WITH1->info = (na_long)10;
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actflag = true;
-    break;
-
-  default:
-    break;
-  }
 }
 
 
 
-static void makeconstpin(act, num, val)
-log_16_action *act;
-long num;
-int val;
+static void makeconstpin(log_16_action *act, long num, int val)
 {
-  na_strlist_t *l1;
-  char STR1[256];
-
-  if (act->lact->actgate->pin[num - 1]->ref <= 1)
-    return;
-  sprintf(STR1, "%ld", num);
-  l1 = strlist_append(&act->lact->actstrlist, STR1);
-  if (val)
-    l1->value = (void *)vddsig->np;
-  else
-    l1->value = (void *)gndsig->np;
+	na_strlist_t *l1;
+	char STR1[256];
+
+	if (act->lact->actgate->pin[num - 1]->ref <= 1)
+		return;
+	sprintf(STR1, "%ld", num);
+	l1 = strlist_append(&act->lact->actstrlist, STR1);
+	if (val)
+		l1->value = (void *)vddsig->np;
+	else
+		l1->value = (void *)gndsig->np;
 }
 
 
 
-void Log_16_switch(act)
-log_16_action *act;
+void Log_16_switch(log_16_action *act)
 {
-  short xx, yy;
-  log_action_t *WITH;
-  log_grec *WITH1;
-  int TEMP;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_draw:
-    if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
-			  ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)) {
-      getpointmark(1, 0, 0, &xx, &yy);
-      log_16_led(act->lact, xx, yy,
-	log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
-    }
-    break;
-
-  case act_16_erase:
-    getpointmark(1, 0, 0, &xx, &yy);
-    log_16_eraled(act->lact, xx, yy);
-    break;
-
-  case act_16_touch:
-    TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
-    WITH->actflag = true;
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT")) {
-      WITH->actflag = true;
-      strcpy(WITH->actstr, "P");
-    } else if (!strcmp(WITH->genfunc, "PLOT")) {
-      getpointmark(1, 0, 0, &xx, &yy);
-      log_16_plotled(act->lact, xx, yy,
-	log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
-    } else if (!strcmp(WITH->genfunc, "CONSTPINS"))
-      makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
-    break;
-
-  default:
-    break;
-  }
+	short xx, yy;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	int TEMP;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_draw:
+			if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 0)) != 0))
+			{
+				getpointmark(1, 0, 0, &xx, &yy);
+				log_16_led(act->lact, xx, yy,
+						log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
+			}
+			break;
+
+		case act_16_erase:
+			getpointmark(1, 0, 0, &xx, &yy);
+			log_16_eraled(act->lact, xx, yy);
+			break;
+
+		case act_16_touch:
+			TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+			WITH->actflag = true;
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+			{
+				WITH->actflag = true;
+				strcpy(WITH->actstr, "P");
+			}
+			else if (!strcmp(WITH->genfunc, "PLOT"))
+			{
+				getpointmark(1, 0, 0, &xx, &yy);
+				log_16_plotled(act->lact, xx, yy,
+						log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
+			}
+			else if (!strcmp(WITH->genfunc, "CONSTPINS"))
+			{
+				makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+			}
+			break;
+
+		default:
+			break;
+	}
 }
 
 
 
-void Log_16_pulse(act)
-log_16_action *act;
+void Log_16_pulse(log_16_action *act)
 {
-  log_action_t *WITH;
-  log_grec *WITH1;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  if (act->action != act_16_sim)
-    return;
-  if ((long)WITH1->info <= 0) {
-    if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
-      WITH1->info = (na_long)6;
-    return;
-  }
-  WITH1->info = (na_long)((long)WITH1->info - 1);
-  if ((long)WITH1->info <= 0)
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+	log_action_t *WITH;
+	log_grec *WITH1;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	if (act->action != act_16_sim)
+		return;
+
+	if ((long)WITH1->info <= 0)
+	{
+		if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+			WITH1->info = (na_long)6;
+		return;
+	}
+	WITH1->info = (na_long)((long)WITH1->info - 1);
+	
+	if ((long)WITH1->info <= 0)
+		WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
 }
 
 
 
-void Log_16_break(act)
-log_16_action *act;
+void Log_16_break(log_16_action *act)
 {
-  log_action_t *WITH;
-  log_grec *WITH1;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_sim:
-    if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0) {
-      WITH->pwrflag = false;
-      (*WITH->hook.vmessage)("Simulation is OFF (triggered BREAK gate)");
-    }
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actflag = true;
-    break;
-
-  default:
-    break;
-  }
+	log_action_t *WITH;
+	log_grec *WITH1;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_sim:
+			if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+			{
+				WITH->pwrflag = false;
+				(*WITH->hook.vmessage)("Simulation is OFF (triggered BREAK gate)");
+			}
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+				WITH->actflag = true;
+			break;
+
+		default:
+			break;
+	}
 }
 
 
 
-void Log_16_scope(act)
-log_16_action *act;
+void Log_16_scope(log_16_action *act)
 {
-  int flag;
-  nodeinfo *pin1, *pin2;
-  short tx, ty;
-  log_action_t *WITH;
-  log_grec *WITH1;
-  int TEMP;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_draw:
-    if (WITH->pwrflag && diggattr[digonoff - 1].UU.nv != 0) {
-      pin1 = (nodeinfo *)WITH1->pin[0]->info;
-      pin2 = (nodeinfo *)WITH1->pin[1]->info;
-      flag = (pin1->v == log_one);
-      if ((((unsigned long)WITH1->vars) & (1L << 14)) == 0 || isstable) {
-	TEMP = ((((unsigned long)WITH1->vars) & (1L << 8)) == 0);
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
-	/*need to look at gate attributes*/
-	if ((((unsigned long)WITH1->vars) & (1L << 8)) == 0) {
-	  TEMP = ((((unsigned long)WITH1->vars) & (1L << 9)) == 0);
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
-	  WITH1->vars = (na_long)
-			(((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
-	  if ((((unsigned long)WITH1->vars) & (1L << 9)) == 0) {
-	    TEMP = ((((unsigned long)WITH1->vars) & (1L << 10)) == 0);
-	    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
-	    WITH1->vars =
-	      (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 10));
-	  }
+	int flag;
+	nodeinfo *pin1, *pin2;
+	short tx, ty;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	int TEMP;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_draw:
+			if (WITH->pwrflag && diggattr[digonoff - 1].UU.nv != 0)
+			{
+				pin1 = (nodeinfo *)WITH1->pin[0]->info;
+				pin2 = (nodeinfo *)WITH1->pin[1]->info;
+				flag = (pin1->v == log_one);
+				if ((((unsigned long)WITH1->vars) & (1L << 14)) == 0 || isstable)
+				{
+					TEMP = ((((unsigned long)WITH1->vars) & (1L << 8)) == 0);
+					WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
+					WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
+					/*need to look at gate attributes*/
+					if ((((unsigned long)WITH1->vars) & (1L << 8)) == 0)
+					{
+						TEMP = ((((unsigned long)WITH1->vars) & (1L << 9)) == 0);
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
+						WITH1->vars = (na_long)
+							(((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
+						if ((((unsigned long)WITH1->vars) & (1L << 9)) == 0)
+						{
+							TEMP = ((((unsigned long)WITH1->vars) & (1L << 10)) == 0);
+							WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
+							WITH1->vars =
+								(na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 10));
+						}
+					}
+
+					if (pin2->v == log_one && (((unsigned long)WITH1->vars) & (1L << 2)) == 0)
+					{
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
+					}
+					TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 ||
+							((((unsigned long)WITH1->vars) & (1L << 1)) != 0) != flag);
+					WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+					WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+					if (((((unsigned long)WITH1->vars) & (1L << 11)) == 0 ||
+								(((unsigned long)WITH1->vars) & (1L << 8)) == 0) &&
+							((((unsigned long)WITH1->vars) & (1L << 12)) == 0 ||
+							 (((unsigned long)WITH1->vars) & (1L << 9)) == 0) &&
+							((((unsigned long)WITH1->vars) & (1L << 13)) == 0 ||
+							 (((unsigned long)WITH1->vars) & (1L << 10)) == 0) &&
+							((long)WITH1->info > 0 ||
+							 (pin2->v != log_zero &&
+							  (((unsigned long)WITH1->vars) & (1L << 2)) == 0)))
+					{
+						tx = 0;
+						ty = 0;
+						(*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+						tx += (long)WITH1->info * 2 - 7;
+						(*WITH->hook.hidecursor)();
+						m_color((long)WITH->color.backgr);
+						m_drawline((long)tx, ty - 7L, (long)tx, ty + 6L);
+						m_drawline(tx + 1L, ty - 7L, tx + 1L, ty + 4L);
+						if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+							m_color((long)scopecolor);
+						else
+							m_color((long)WITH->color.backgr);
+						m_drawline((long)tx, ty - 6L, (long)tx, ty + 3L);
+						if (flag)
+							m_color((long)scopecolor);
+						else
+							m_color((long)WITH->color.backgr);
+						m_drawline((long)tx, ty - 7L, tx + 2L, ty - 7L);
+						if (flag)
+							m_color((long)WITH->color.backgr);
+						else
+							m_color((long)scopecolor);
+						m_drawline((long)tx, ty + 4L, tx + 2L, ty + 4L);
+						WITH1->info = (na_long)(((long)WITH1->info + 1) % 13);
+						tx = 0;
+						ty = 0;
+						(*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+						tx += (long)WITH1->info * 2 - 7;
+						m_color((long)scopescancolor);
+						m_drawline((long)tx, ty + 5L, (long)tx, ty + 6L);
+						(*WITH->hook.unhidecursor)();
+						WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+					}
+				}
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
+						(((long)(pin1->v == log_one)) << 1));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
+						(((long)(pin2->v == log_one)) << 2));
+			}
+			break;
+
+		case act_16_erase:
+			m_color((long)WITH->color.backgr);
+			tx = 0;
+			ty = 0;
+			(*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+			m_fillrect(tx - 7L, ty - 7L, tx + 19L, ty + 6L);
+			break;
+
+		case act_16_reset:
+			WITH1->info = (na_long)0;
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+				WITH->actflag = true;
+			break;
+
+		default:
+			break;
 	}
-	if (pin2->v == log_one && (((unsigned long)WITH1->vars) & (1L << 2)) == 0) {
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
-	}
-	TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 ||
-		((((unsigned long)WITH1->vars) & (1L << 1)) != 0) != flag);
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-	WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
-	if (((((unsigned long)WITH1->vars) & (1L << 11)) == 0 ||
-	     (((unsigned long)WITH1->vars) & (1L << 8)) == 0) &&
-	    ((((unsigned long)WITH1->vars) & (1L << 12)) == 0 ||
-	     (((unsigned long)WITH1->vars) & (1L << 9)) == 0) &&
-	    ((((unsigned long)WITH1->vars) & (1L << 13)) == 0 ||
-	     (((unsigned long)WITH1->vars) & (1L << 10)) == 0) &&
-	    ((long)WITH1->info > 0 ||
-	     (pin2->v != log_zero &&
-	      (((unsigned long)WITH1->vars) & (1L << 2)) == 0))) {
-/* p2c: logsim.text, line 599: 
- * Note: Line breaker spent 2.0 seconds, 5000 tries on line 650 [251] */
-	  tx = 0;
-	  ty = 0;
-	  (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
-	  tx += (long)WITH1->info * 2 - 7;
-	  (*WITH->hook.hidecursor)();
-	  m_color((long)WITH->color.backgr);
-	  m_drawline((long)tx, ty - 7L, (long)tx, ty + 6L);
-	  m_drawline(tx + 1L, ty - 7L, tx + 1L, ty + 4L);
-	  if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
-	    m_color((long)scopecolor);
-	  else
-	    m_color((long)WITH->color.backgr);
-	  m_drawline((long)tx, ty - 6L, (long)tx, ty + 3L);
-	  if (flag)
-	    m_color((long)scopecolor);
-	  else
-	    m_color((long)WITH->color.backgr);
-	  m_drawline((long)tx, ty - 7L, tx + 2L, ty - 7L);
-	  if (flag)
-	    m_color((long)WITH->color.backgr);
-	  else
-	    m_color((long)scopecolor);
-	  m_drawline((long)tx, ty + 4L, tx + 2L, ty + 4L);
-	  WITH1->info = (na_long)(((long)WITH1->info + 1) % 13);
-/* p2c: logsim.text, line 566:
- * Note: Using % for possibly-negative arguments [317] */
-	  tx = 0;
-	  ty = 0;
-	  (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
-	  tx += (long)WITH1->info * 2 - 7;
-	  m_color((long)scopescancolor);
-	  m_drawline((long)tx, ty + 5L, (long)tx, ty + 6L);
-	  (*WITH->hook.unhidecursor)();
-	  WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-	}
-      }
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
-			      (((long)(pin1->v == log_one)) << 1));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
-			      (((long)(pin2->v == log_one)) << 2));
-    }
-    break;
-
-  case act_16_erase:
-    m_color((long)WITH->color.backgr);
-    tx = 0;
-    ty = 0;
-    (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
-    m_fillrect(tx - 7L, ty - 7L, tx + 19L, ty + 6L);
-    break;
-
-  case act_16_reset:
-    WITH1->info = (na_long)0;
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actflag = true;
-    break;
-
-  default:
-    break;
-  }
 }
 
 
 /* Local variables for Log_16_7seg: */
-struct LOC_Log_16_7seg {
-  log_16_action *act;
-  na_strlist_t *l1;
+struct LOC_Log_16_7seg
+{
+	log_16_action *act;
+	na_strlist_t *l1;
 } ;
 
-static void plotline(x1, y1, x2, y2, LINK)
-short x1, y1, x2, y2;
-struct LOC_Log_16_7seg *LINK;
+static void plotline(short x1, short y1, short x2, short y2, struct LOC_Log_16_7seg *LINK)
 {
-  char STR2[256];
+	char STR2[256];
 
-  sprintf(STR2, "line %d %d %d %d", x1, y1, x2, y2);
-  LINK->l1 = strlist_append(&LINK->act->lact->actstrlist, STR2);
+	sprintf(STR2, "line %d %d %d %d", x1, y1, x2, y2);
+	LINK->l1 = strlist_append(&LINK->act->lact->actstrlist, STR2);
 }
 
 
 
-void Log_16_7seg(act_)
-log_16_action *act_;
+void Log_16_7seg(log_16_action *act_)
 {
-  struct LOC_Log_16_7seg V;
-  short t1, tx, ty;
-  log_action_t *WITH;
-  log_grec *WITH1;
-  int TEMP;
-
-  V.act = act_;
-  WITH = V.act->lact;
-  WITH1 = WITH->actgate;
-  switch (V.act->action) {
-
-  case act_16_sim:
-    if (((((unsigned long)WITH1->vars) & (1L << 2)) != 0) !=
-	((((unsigned long)WITH1->vars) & (1L << 6)) != 0) ||
-	((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
-	((((unsigned long)WITH1->vars) & (1L << 7)) != 0) ||
-	((((unsigned long)WITH1->vars) & (1L << 4)) != 0) !=
-	((((unsigned long)WITH1->vars) & (1L << 8)) != 0) ||
-	((((unsigned long)WITH1->vars) & (1L << 5)) != 0) !=
-	((((unsigned long)WITH1->vars) & (1L << 9)) != 0)) {
-/* p2c: logsim.text, line 694: 
- * Note: Line breaker spent 3.0 seconds, 5000 tries on line 758 [251] */
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 6)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 6));
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 3)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 7)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 7));
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
-      TEMP = ((((unsigned long)WITH1->vars) & (1L << 5)) != 0);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
-    }
-    break;
-
-  case act_16_draw:
-    if (WITH->refrflag || (((unsigned long)WITH1->vars) & (1L << 0)) != 0) {
-      (*WITH->hook.hidecursor)();
-      tx = 0;
-      ty = 0;
-      (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
-      m_color((long)WITH->color.backgr);
-      m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
-      m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
-      m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
-      m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
-      m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
-      m_color((long)ledoncolor);
-      t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
-	   ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
-	   ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
-	   ((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
-	m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
-	m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
-	m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
-	m_drawline(tx - 5L, ty - 10L, tx - 5L, (long)ty);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
-	m_drawline(tx - 5L, (long)ty, tx - 5L, ty + 10L);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
-	m_drawline(tx + 5L, ty - 10L, tx + 5L, (long)ty);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
-	m_drawline(tx + 5L, (long)ty, tx + 5L, ty + 10L);
-      WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-      (*WITH->hook.unhidecursor)();
-    }
-    break;
-
-  case act_16_erase:
-    tx = 0;
-    ty = 0;
-    (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
-    m_color((long)WITH->color.backgr);
-    m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
-    m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
-    m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
-    m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
-    m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actflag = true;
-    else if (!strcmp(WITH->genfunc, "PLOT")) {
-      V.l1 = strlist_append(&WITH->actstrlist, "color onled");
-      tx = 0;
-      ty = 0;
-      (*WITH->hook2->plainxform)(WITH->actgate, &tx, &ty);
-      t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
-	   ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
-	   ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
-	   ((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
-	plotline(tx - 5, ty - 10, tx + 5, ty - 10, &V);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
-	plotline(tx - 5, ty, tx + 5, ty, &V);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
-	plotline(tx - 5, ty + 10, tx + 5, ty + 10, &V);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
-	plotline(tx - 5, ty - 10, tx - 5, ty, &V);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
-	plotline(tx - 5, ty, tx - 5, ty + 10, &V);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
-	plotline(tx + 5, ty - 10, tx + 5, ty, &V);
-      if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
-	plotline(tx + 5, ty, tx + 5, ty + 10, &V);
-    }
-    break;
-
-  default:
-    break;
-  }
+	struct LOC_Log_16_7seg V;
+	short t1, tx, ty;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	int TEMP;
+
+	V.act = act_;
+	WITH = V.act->lact;
+	WITH1 = WITH->actgate;
+	switch (V.act->action)
+	{
+		case act_16_sim:
+			if (((((unsigned long)WITH1->vars) & (1L << 2)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 6)) != 0) ||
+					((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 7)) != 0) ||
+					((((unsigned long)WITH1->vars) & (1L << 4)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 8)) != 0) ||
+					((((unsigned long)WITH1->vars) & (1L << 5)) != 0) !=
+					((((unsigned long)WITH1->vars) & (1L << 9)) != 0))
+			{
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 6)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 6));
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 3)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 7)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 7));
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
+				TEMP = ((((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
+			}
+			break;
+
+		case act_16_draw:
+			if (WITH->refrflag || (((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+			{
+				(*WITH->hook.hidecursor)();
+				tx = 0;
+				ty = 0;
+				(*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+				m_color((long)WITH->color.backgr);
+				m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
+				m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
+				m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
+				m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
+				m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
+				m_color((long)ledoncolor);
+				t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
+					((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
+					((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
+					((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
+					m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
+					m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
+					m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
+					m_drawline(tx - 5L, ty - 10L, tx - 5L, (long)ty);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
+					m_drawline(tx - 5L, (long)ty, tx - 5L, ty + 10L);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
+					m_drawline(tx + 5L, ty - 10L, tx + 5L, (long)ty);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
+					m_drawline(tx + 5L, (long)ty, tx + 5L, ty + 10L);
+				WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+				(*WITH->hook.unhidecursor)();
+			}
+			break;
+
+		case act_16_erase:
+			tx = 0;
+			ty = 0;
+			(*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+			m_color((long)WITH->color.backgr);
+			m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
+			m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
+			m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
+			m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
+			m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+			{
+				WITH->actflag = true;
+			}
+			else if (!strcmp(WITH->genfunc, "PLOT"))
+			{
+				V.l1 = strlist_append(&WITH->actstrlist, "color onled");
+				tx = 0;
+				ty = 0;
+				(*WITH->hook2->plainxform)(WITH->actgate, &tx, &ty);
+				t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
+					((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
+					((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
+					((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
+					plotline(tx - 5, ty - 10, tx + 5, ty - 10, &V);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
+					plotline(tx - 5, ty, tx + 5, ty, &V);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
+					plotline(tx - 5, ty + 10, tx + 5, ty + 10, &V);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
+					plotline(tx - 5, ty - 10, tx - 5, ty, &V);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
+					plotline(tx - 5, ty, tx - 5, ty + 10, &V);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
+					plotline(tx + 5, ty - 10, tx + 5, ty, &V);
+				if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
+					plotline(tx + 5, ty, tx + 5, ty + 10, &V);
+			}
+			break;
+
+		default:
+			break;
+	}
 }
 
 
 
-void Log_16_keypad(act)
-log_16_action *act;
+void Log_16_keypad(log_16_action *act)
 {
-  short x1, y1, n;
-  log_action_t *WITH;
-  log_grec *WITH1;
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_touch:
-    x1 = (WITH->actx + 4) / 2;
-    y1 = (WITH->acty + 4) / 2;
-    switch (y1 * 10 + x1) {
-
-    case 0:
-      n = 7;
-      break;
-
-    case 1:
-      n = 8;
-      break;
-
-    case 2:
-      n = 9;
-      break;
-
-    case 3:
-      n = 15;
-      break;
-
-    case 10:
-      n = 4;
-      break;
-
-    case 11:
-      n = 5;
-      break;
-
-    case 12:
-      n = 6;
-      break;
-
-    case 13:
-      n = 14;
-      break;
-
-    case 20:
-      n = 1;
-      break;
-
-    case 21:
-      n = 2;
-      break;
-
-    case 22:
-      n = 3;
-      break;
-
-    case 23:
-      n = 13;
-      break;
-
-    case 30:
-      n = 0;
-      break;
-
-    case 31:
-      n = 10;
-      break;
-
-    case 32:
-      n = 11;
-      break;
-
-    case 33:
-      n = 12;
-      break;
-
-    default:
-      n = 0;
-      break;
-    }
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 8L) & 1) << 2));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 4L) & 1) << 3));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 4)));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 2L) & 1) << 4));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 5)));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | ((n & 1L) << 5));
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
-    WITH->actflag = true;
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT")) {
-      WITH->actflag = true;
-      strcpy(WITH->actstr, "KLMNP");
-    } else if (!strcmp(WITH->genfunc, "CONSTPINS")) {
-      makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
-      makeconstpin(act, 2L, (((unsigned long)WITH1->vars) & (1L << 4)) != 0);
-      makeconstpin(act, 3L, (((unsigned long)WITH1->vars) & (1L << 3)) != 0);
-      makeconstpin(act, 4L, (((unsigned long)WITH1->vars) & (1L << 2)) != 0);
-      makeconstpin(act, 5L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
-    }
-    break;
-
-  default:
-    break;
-  }
+	short x1, y1, n;
+	log_action_t *WITH;
+	log_grec *WITH1;
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_touch:
+			x1 = (WITH->actx + 4) / 2;
+			y1 = (WITH->acty + 4) / 2;
+			switch (y1 * 10 + x1)
+			{
+				case 0:
+					n = 7;
+					break;
+
+				case 1:
+					n = 8;
+					break;
+
+				case 2:
+					n = 9;
+					break;
+
+				case 3:
+					n = 15;
+					break;
+
+				case 10:
+					n = 4;
+					break;
+
+				case 11:
+					n = 5;
+					break;
+
+				case 12:
+					n = 6;
+					break;
+
+				case 13:
+					n = 14;
+					break;
+
+				case 20:
+					n = 1;
+					break;
+
+				case 21:
+					n = 2;
+					break;
+
+				case 22:
+					n = 3;
+					break;
+
+				case 23:
+					n = 13;
+					break;
+
+				case 30:
+					n = 0;
+					break;
+
+				case 31:
+					n = 10;
+					break;
+
+				case 32:
+					n = 11;
+					break;
+
+				case 33:
+					n = 12;
+					break;
+
+				default:
+					n = 0;
+					break;
+			}
+
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 8L) & 1) << 2));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 4L) & 1) << 3));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 4)));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 2L) & 1) << 4));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 5)));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | ((n & 1L) << 5));
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+			WITH->actflag = true;
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+			{
+				WITH->actflag = true;
+				strcpy(WITH->actstr, "KLMNP");
+			}
+			else if (!strcmp(WITH->genfunc, "CONSTPINS"))
+			{
+				makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+				makeconstpin(act, 2L, (((unsigned long)WITH1->vars) & (1L << 4)) != 0);
+				makeconstpin(act, 3L, (((unsigned long)WITH1->vars) & (1L << 3)) != 0);
+				makeconstpin(act, 4L, (((unsigned long)WITH1->vars) & (1L << 2)) != 0);
+				makeconstpin(act, 5L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+			}
+			break;
+
+		default:
+			break;
+	}
 }
 
 
 
-
-
-
-
-
-
 /* The following routines run the digital simulation. */
 
 
-static short digglowcol(n, nonecolor)
-log_nrec *n;
-short nonecolor;
+static short digglowcol(log_nrec *n, short nonecolor)
 {
-  short Result;
-  nodeinfo *ni;
-
-  ni = (nodeinfo *)n->info;
-  switch (ni->v) {
+	short Result;
+	nodeinfo *ni;
 
-  case log_none:
-    Result = nonecolor;
-    break;
-
-  case log_zero:
-    Result = ledoffcolor;
-    break;
-
-  case log_one:
-    Result = ledoncolor;
-    break;
-  }
-  return Result;
+	ni = (nodeinfo *)n->info;
+	switch (ni->v)
+	{
+		case log_none:
+			Result = nonecolor;
+			break;
+
+		case log_zero:
+			Result = ledoffcolor;
+			break;
+
+		case log_one:
+			Result = ledoncolor;
+			break;
+	}
+	return Result;
 }
 
 
-static int digtrigger(n)
-log_nrec *n;
+static int digtrigger(log_nrec *n)
 {
-  int Result;
-  nodeinfo *ni;
-
-  ni = (nodeinfo *)n->info;
-  Result = false;
-  if ((ni->v00 == log_zero) && (ni->v == log_one))
-      Result = true;
-  return Result;
+	int Result;
+	nodeinfo *ni;
+
+	ni = (nodeinfo *)n->info;
+	Result = false;
+	if ((ni->v00 == log_zero) && (ni->v == log_one))
+		Result = true;
+	return Result;
 }
 
 
 
-static void callallgates(kind)
-log_16_actionkinds kind;
+static void callallgates(log_16_actionkinds kind)
 {
-  short pg;
-  log_grec *g, *saveactgate;
-  log_action_t *WITH;
-  short FORLIM;
-  log_krec *WITH1;
-
-  WITH = logsima_action.lact;
-  saveactgate = WITH->actgate;
-  FORLIM = WITH->numpages;
-  for (pg = 0; pg < FORLIM; pg++) {
-    g = WITH->gbase[pg];
-    while (g != NULL) {
-      WITH1 = g->kind;
-      if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc) {
-	WITH->actgate = g;
-	callgate(kind);
-      }
-      g = g->next;
-    }
-  }
-  WITH->actgate = saveactgate;
+	short pg;
+	log_grec *g, *saveactgate;
+	log_action_t *WITH;
+	short FORLIM;
+	log_krec *WITH1;
+
+	WITH = logsima_action.lact;
+	saveactgate = WITH->actgate;
+	FORLIM = WITH->numpages;
+	for (pg = 0; pg < FORLIM; pg++)
+	{
+		g = WITH->gbase[pg];
+		while (g != NULL)
+		{
+			WITH1 = g->kind;
+			if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc) {
+				WITH->actgate = g;
+				callgate(kind);
+			}
+			g = g->next;
+		}
+	}
+	WITH->actgate = saveactgate;
 }
 
 
 
-static void callkind(kind)
-log_16_actionkinds kind;
+static void callkind(log_16_actionkinds kind)
 {
-  kindinfo *ki;
-  log_grec *saveactgate;
-  log_action_t *WITH;
-  log_krec *WITH1;
-
-  WITH = logsima_action.lact;
-  WITH1 = WITH->actkind;
-  saveactgate = WITH->actgate;
-  WITH->actgate = (log_grec *)WITH->actkind;
-      /*just to satisfy "with actgate^" statements*/
-  logsima_action.action = kind;
-  ki = (kindinfo *)WITH1->info;
-  (*ki->kindproc)(&logsima_action);
-  WITH->actgate = saveactgate;
+	kindinfo *ki;
+	log_grec *saveactgate;
+	log_action_t *WITH;
+	log_krec *WITH1;
+
+	WITH = logsima_action.lact;
+	WITH1 = WITH->actkind;
+	saveactgate = WITH->actgate;
+	WITH->actgate = (log_grec *)WITH->actkind;
+	/*just to satisfy "with actgate^" statements*/
+	logsima_action.action = kind;
+	ki = (kindinfo *)WITH1->info;
+	(*ki->kindproc)(&logsima_action);
+	WITH->actgate = saveactgate;
 }
 
 
 
-static void callallkinds(kind)
-log_16_actionkinds kind;
+static void callallkinds(log_16_actionkinds kind)
 {
-  kindinfo *ki;
-  log_krec *k;
-  log_action_t *WITH;
-
-  WITH = logsima_action.lact;
-  k = kbase_16;
-  while (k != NULL) {
-    ki = (kindinfo *)k->info;
-    if (ki->hasproc) {
-      WITH->actkind = k;
-      callkind(kind);
-    }
-    k = ki->knext;
-  }
+	kindinfo *ki;
+	log_krec *k;
+	log_action_t *WITH;
+
+	WITH = logsima_action.lact;
+	k = kbase_16;
+	while (k != NULL)
+	{
+		ki = (kindinfo *)k->info;
+		if (ki->hasproc)
+		{
+			WITH->actkind = k;
+			callkind(kind);
+		}
+		k = ki->knext;
+	}
 }
 
 
 
-static void pass_16(act)
-log_16_action *act;
+static void pass_16(log_16_action *act)
 {
-  short pg;
-  log_grec *g;
-  log_action_t *WITH;
-  short FORLIM;
-  log_krec *WITH1;
-
-  WITH = act->lact;
-  oldsystime = newsystime;
-  newsystime = timers_sysclock();
-  if (!passready || WITH->resetflag) {
-    if (vddsig == NULL)
-      (*WITH->hook.getsig)("Vdd", &vddsig);
-    if (gndsig == NULL)
-      (*WITH->hook.getsig)("Gnd", &gndsig);
-    if (resetsig == NULL)
-      (*WITH->hook.getsig)("Reset", &resetsig);
-    if (WITH->resetflag) {
-      callallgates(act_16_reset);
-      resetcounter = 10;
-    }
-    if (WITH->pwrflag) {
-      maketimebid = false;
-      if (diggattr[digonoff - 1].UU.nv != 0) {
-	(*WITH->hook.clearconflicts)(logsima_tool_16);
-	clearnodes(WITH->nbase);
-	if (vddsig->np->simtype == logsima_tool_16)
-	  log_16_output(act->lact, vddsig->np, log_one);
-	if (gndsig->np->simtype == logsima_tool_16)
-	  log_16_output(act->lact, gndsig->np, log_zero);
-	if (resetsig->np->simtype == logsima_tool_16)
-	  log_16_output(act->lact, resetsig->np,
-			log_16_bv[(resetcounter > 0) - false]);
-	FORLIM = WITH->numpages;
-	for (pg = 0; pg < FORLIM; pg++)
-	  executegates(&maketimebid, WITH->gbase[pg]);
-	nexttimebid = diggattr[digtimestep - 1].UU.r;
-      }
-      passready = maketimebid;
-    }
-  }
-  if ( WITH->pwrflag && maketimebid )
-    WITH->busyflag = true;
-  if (maketimebid)
-    logsima_tool_16->nexttstep = nexttimebid;
-  if (stabilizing && (isstable || timers_sysclock() > stabtime))
-    stabilizing = false;
-  if (WITH->showpage > 0) {
-    g = WITH->gbase[WITH->showpage - 1];
-    while (g != NULL) {
-      WITH1 = g->kind;
-      if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc) {
-	WITH->actgate = g;
-	callgate(act_16_draw);
-      }
-      g = g->next;
-    }
-  }
-  if (WITH->probenode != NULL && WITH->probenode->simtype == logsima_tool_16)
-    WITH->baselinecolor = digglowcol(WITH->probenode, WITH->color.wire[0]);
+	short pg;
+	log_grec *g;
+	log_action_t *WITH;
+	short FORLIM;
+	log_krec *WITH1;
+
+	WITH = act->lact;
+	oldsystime = newsystime;
+	newsystime = timers_sysclock();
+	if (!passready || WITH->resetflag)
+	{
+		if (vddsig == NULL)
+			(*WITH->hook.getsig)("Vdd", &vddsig);
+		if (gndsig == NULL)
+			(*WITH->hook.getsig)("Gnd", &gndsig);
+		if (resetsig == NULL)
+			(*WITH->hook.getsig)("Reset", &resetsig);
+		if (WITH->resetflag)
+		{
+			callallgates(act_16_reset);
+			resetcounter = 10;
+		}
+		if (WITH->pwrflag)
+		{
+			maketimebid = false;
+			if (diggattr[digonoff - 1].UU.nv != 0)
+			{
+				(*WITH->hook.clearconflicts)(logsima_tool_16);
+				clearnodes(WITH->nbase);
+				if (vddsig->np->simtype == logsima_tool_16)
+					log_16_output(act->lact, vddsig->np, log_one);
+				if (gndsig->np->simtype == logsima_tool_16)
+					log_16_output(act->lact, gndsig->np, log_zero);
+				if (resetsig->np->simtype == logsima_tool_16)
+					log_16_output(act->lact, resetsig->np,
+							log_16_bv[(resetcounter > 0) - false]);
+				FORLIM = WITH->numpages;
+				for (pg = 0; pg < FORLIM; pg++)
+					executegates(&maketimebid, WITH->gbase[pg]);
+				nexttimebid = diggattr[digtimestep - 1].UU.r;
+			}
+			passready = maketimebid;
+		}
+	}
+	if ( WITH->pwrflag && maketimebid )
+		WITH->busyflag = true;
+	if (maketimebid)
+		logsima_tool_16->nexttstep = nexttimebid;
+	if (stabilizing && (isstable || timers_sysclock() > stabtime))
+		stabilizing = false;
+	if (WITH->showpage > 0)
+	{
+		g = WITH->gbase[WITH->showpage - 1];
+		while (g != NULL)
+		{
+			WITH1 = g->kind;
+			if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc)
+			{
+				WITH->actgate = g;
+				callgate(act_16_draw);
+			}
+			g = g->next;
+		}
+	}
+	if (WITH->probenode != NULL && WITH->probenode->simtype == logsima_tool_16)
+		WITH->baselinecolor = digglowcol(WITH->probenode, WITH->color.wire[0]);
 }
 
 
 
-
-static void tstep_16(act)
-log_16_action *act;
+static void tstep_16(log_16_action *act)
 {
-  log_nrec *n;
-  nodeinfo *ni;
-  int stable;
-  log_action_t *WITH;
-
-  WITH = act->lact;
-  if (!WITH->actflag)
-    return;
-  stable = true;
-  copynodes(WITH->nbase, &stable);
-  if (stabilizing) {
-    n = WITH->nbase;
-    while (n != NULL) {
-      if (n->simtype == logsima_tool_16 && P_rand(&WITH->rndseed, 5L) == 0) {
-	ni = (nodeinfo *)n->info;
-	ni->v = ni->v00;
-      }
-      n = n->next;
-    }
-  }
-  isstable = stable;
-  passready = false;
-  if (resetcounter > 0)
-    resetcounter--;
+	log_nrec *n;
+	nodeinfo *ni;
+	int stable;
+	log_action_t *WITH;
+
+	WITH = act->lact;
+	if (!WITH->actflag)
+		return;
+	stable = true;
+	copynodes(WITH->nbase, &stable);
+	if (stabilizing)
+	{
+		n = WITH->nbase;
+		while (n != NULL)
+		{
+			if (n->simtype == logsima_tool_16 && P_rand(&WITH->rndseed, 5L) == 0)
+			{
+				ni = (nodeinfo *)n->info;
+				ni->v = ni->v00;
+			}
+			n = n->next;
+		}
+	}
+	isstable = stable;
+	passready = false;
+	if (resetcounter > 0)
+		resetcounter--;
 }
 
 
-
-
-
 /* The following procedures are exported for the LOGSIMA module to use. */
 
 
-void log_16_conf(act, n)
-log_16_action *act;
-log_nrec *n;
+void log_16_conf(log_16_action *act, log_nrec *n)
 {
-  (*act->lact->hook.nodeconflict)(n);
+	(*act->lact->hook.nodeconflict)(n);
 }
 
 
-void log_16_noprog(act)
-log_16_action *act;
+void log_16_noprog(log_16_action *act)
 {
-  char STR1[44];
-
-  if (!noprogloaded) {
-    sprintf(STR1, "No program loaded for digital gate %s",
-	    act->lact->actkind->name);
-    (*act->lact->hook.message)(STR1);
-    noprogloaded = true;
-  }
+	char STR1[44];
+
+	if (!noprogloaded) {
+		sprintf(STR1, "No program loaded for digital gate %s",
+				act->lact->actkind->name);
+		(*act->lact->hook.message)(STR1);
+		noprogloaded = true;
+	}
 }
 
 
-static void nullkindproc(act)
-log_16_action *act;
+static void nullkindproc(log_16_action *act)
 {
-  /* ignore all calls */
+	/* ignore all calls */
 }
 
 
 
-
-
-
 /* This procedure runs the "status" screen. */
 
 
-static void status_16(flag)
-int *flag;
+static void status_16(int *flag)
 {
-  char s[256];
-  log_action_t *WITH;
-
-  WITH = logsima_action.lact;
-  nk_gotoxy(0, 4);
-  (*WITH->hook.realunit)(nexttimebid, 4, "s", s);
-  printf("Next time bid: %s\t\n", s);
-  printf("Pass ready:    %5s\n", passready ? "TRUE" : "FALSE");
-  printf("Stabilizing:   %5s\n", stabilizing ? "TRUE" : "FALSE");
-  WITH->actflag = false;
+	char s[256];
+	log_action_t *WITH;
+
+	WITH = logsima_action.lact;
+	nk_gotoxy(0, 4);
+	(*WITH->hook.realunit)(nexttimebid, 4, "s", s);
+	printf("Next time bid: %s\t\n", s);
+	printf("Pass ready:    %5s\n", passready ? "TRUE" : "FALSE");
+	printf("Stabilizing:   %5s\n", stabilizing ? "TRUE" : "FALSE");
+	WITH->actflag = false;
 }
 
 
 
-
-
 /* These routines handle the simtype 16 interface to LOG. */
 
 
-static void parseicommand(lact)
-log_action_t *lact;
+static void parseicommand(log_action_t *lact)
 {
-  int flag;
-  log_action_t *WITH;
-
-  WITH = lact;
-  if (!strcmp(WITH->func, "DIGON")) {
-    (*WITH->hook.clearfunc)();
-    diggattr[digonoff - 1].UU.nv = 1;
-    (*WITH->hook.vmessage)("Digital simulation is ON");
-    return;
-  }
-  if (!strcmp(WITH->func, "DIGOFF")) {
-    (*WITH->hook.clearfunc)();
-    diggattr[digonoff - 1].UU.nv = 0;
-    (*WITH->hook.vmessage)("Digital simulation is OFF");
-    return;
-  }
-  if (!strcmp(WITH->func, "DIGONOFF")) {
-    flag = (diggattr[digonoff - 1].UU.nv != 0);
-    (*WITH->hook.getbool)(WITH->funcarg, &flag);
-    diggattr[digonoff - 1].UU.nv = flag;
-    (*WITH->hook.clearfunc)();
-    (*WITH->hook.vmessageflag)("Digital simulation is ",
-			       diggattr[digonoff - 1].UU.nv != 0);
-    return;
-  }
-  if (!strcmp(WITH->func, "STABILIZE")) {
-    (*WITH->hook.clearfunc)();
-    stabtime = timers_sysclock() +
-	       (long)floor(diggattr[stabdelay - 1].UU.r * 100 + 0.5);
-    stabilizing = true;
-    return;
-  }
-  if (!strcmp(WITH->func, "DIGSTEP")) {
-    (*WITH->hook.getreal)(WITH->funcarg, &diggattr[digtimestep - 1].UU.r,
-			  1e-8);
-    (*WITH->hook.clearfunc)();
-  }
+	int flag;
+	log_action_t *WITH;
+
+	WITH = lact;
+	if (!strcmp(WITH->func, "DIGON"))
+	{
+		(*WITH->hook.clearfunc)();
+		diggattr[digonoff - 1].UU.nv = 1;
+		(*WITH->hook.vmessage)("Digital simulation is ON");
+		return;
+	}
+	if (!strcmp(WITH->func, "DIGOFF"))
+	{
+		(*WITH->hook.clearfunc)();
+		diggattr[digonoff - 1].UU.nv = 0;
+		(*WITH->hook.vmessage)("Digital simulation is OFF");
+		return;
+	}
+	if (!strcmp(WITH->func, "DIGONOFF"))
+	{
+		flag = (diggattr[digonoff - 1].UU.nv != 0);
+		(*WITH->hook.getbool)(WITH->funcarg, &flag);
+		diggattr[digonoff - 1].UU.nv = flag;
+		(*WITH->hook.clearfunc)();
+		(*WITH->hook.vmessageflag)("Digital simulation is ",
+				diggattr[digonoff - 1].UU.nv != 0);
+		return;
+	}
+	if (!strcmp(WITH->func, "STABILIZE"))
+	{
+		(*WITH->hook.clearfunc)();
+		stabtime = timers_sysclock() +
+			(long)floor(diggattr[stabdelay - 1].UU.r * 100 + 0.5);
+		stabilizing = true;
+		return;
+	}
+	if (!strcmp(WITH->func, "DIGSTEP"))
+	{
+		(*WITH->hook.getreal)(WITH->funcarg, &diggattr[digtimestep - 1].UU.r,
+				1e-8);
+		(*WITH->hook.clearfunc)();
+	}
 }
 
 
-static void parsecommand(lact)
-log_action_t *lact;
+static void parsecommand(log_action_t *lact)
 {
-  log_action_t *WITH;
+	log_action_t *WITH;
 
-  WITH = lact;
-  if (!strcmp(WITH->func, "STABDELAY")) {
-    (*WITH->hook.getreal)(WITH->funcarg, &diggattr[stabdelay - 1].UU.r, 5.0);
-    (*WITH->hook.clearfunc)();
-  }
+	WITH = lact;
+	if (!strcmp(WITH->func, "STABDELAY"))
+	{
+		(*WITH->hook.getreal)(WITH->funcarg, &diggattr[stabdelay - 1].UU.r, 5.0);
+		(*WITH->hook.clearfunc)();
+	}
 }
 
 
-static char *log_action_tkinds_NAMES[] = {
-  "ACT_INIT", "ACT_ENDINIT", "ACT_EXIT", "ACT_CLEARMSG", "ACT_STATUS",
-  "ACT_CNF", "ACT_IMMED", "ACT_FUNC", "ACT_COLOR", "ACT_SELECT", "ACT_CLEAR",
-  "ACT_EDIT", "ACT_PASS", "ACT_TSTEP", "ACT_ERASEGATE", "ACT_TOUCHGATE",
-  "ACT_HISTORY", "ACT_HISTVAL", "ACT_HISTSTR", "ACT_TRIGGER", "ACT_GLOWCOL",
-  "ACT_NEWGATE", "ACT_DISPOSEGATE", "ACT_COPYGATE", "ACT_WRITEGATE",
-  "ACT_READGATE", "ACT_CONNECTGATE", "ACT_DISCONNECTGATE", "ACT_CONFIGGATE",
-  "ACT_CONFIGCHGATE", "ACT_CONFIGRELGATE", "ACT_CONFIGNODE",
-  "ACT_CONFIGCHNODE", "ACT_CONFIGRELNODE", "ACT_CONFIGHIST",
-  "ACT_CONFIGCHHIST", "ACT_CONFIGRELHIST", "ACT_NEWKIND", "ACT_DISPOSEKIND",
-  "ACT_NEWNODE", "ACT_DISPOSENODE", "ACT_COPYNODE", "ACT_COMBINENODES",
-  "ACT_COMBINEINTONODE", "ACT_WRITENODE", "ACT_READNODE", "ACT_REFNODES",
-  "ACT_NODEVAL", "ACT_GENERAL", "ACT_GENNODE", "ACT_GENKIND", "ACT_GENGATE"
+static char *log_action_tkinds_NAMES[] =
+{
+	"ACT_INIT", "ACT_ENDINIT", "ACT_EXIT", "ACT_CLEARMSG", "ACT_STATUS",
+	"ACT_CNF", "ACT_IMMED", "ACT_FUNC", "ACT_COLOR", "ACT_SELECT", "ACT_CLEAR",
+	"ACT_EDIT", "ACT_PASS", "ACT_TSTEP", "ACT_ERASEGATE", "ACT_TOUCHGATE",
+	"ACT_HISTORY", "ACT_HISTVAL", "ACT_HISTSTR", "ACT_TRIGGER", "ACT_GLOWCOL",
+	"ACT_NEWGATE", "ACT_DISPOSEGATE", "ACT_COPYGATE", "ACT_WRITEGATE",
+	"ACT_READGATE", "ACT_CONNECTGATE", "ACT_DISCONNECTGATE", "ACT_CONFIGGATE",
+	"ACT_CONFIGCHGATE", "ACT_CONFIGRELGATE", "ACT_CONFIGNODE",
+	"ACT_CONFIGCHNODE", "ACT_CONFIGRELNODE", "ACT_CONFIGHIST",
+	"ACT_CONFIGCHHIST", "ACT_CONFIGRELHIST", "ACT_NEWKIND", "ACT_DISPOSEKIND",
+	"ACT_NEWNODE", "ACT_DISPOSENODE", "ACT_COPYNODE", "ACT_COMBINENODES",
+	"ACT_COMBINEINTONODE", "ACT_WRITENODE", "ACT_READNODE", "ACT_REFNODES",
+	"ACT_NODEVAL", "ACT_GENERAL", "ACT_GENNODE", "ACT_GENKIND", "ACT_GENGATE"
 } ;
 
 
 
-static char *actionname(Result, action)
-char *Result;
-log_actionkinds action;
+static char *actionname(char *Result, log_actionkinds action)
 {
-  long i;
-  char s[33];
-
-/* p2c: logsim.text, line 1069: Note:
- * Line breaker spent 0.0+2.00 seconds, 5000 tries on line 1304 [251] */
-  strcpy(s, log_action_tkinds_NAMES[(long)action]);
-  i = strlen(s) + 1;
-  s[i - 1] = '\0';
-/* p2c: logsim.text, line 1070:
- * Note: Modification of string length may translate incorrectly [146] */
-  return strcpy(Result, s);
+	long i;
+	char s[33];
+
+	strcpy(s, log_action_tkinds_NAMES[(long)action]);
+	i = strlen(s) + 1;
+	s[i - 1] = '\0';
+	return strcpy(Result, s);
 }
 
 
 
-static void showgatepins(g)
-log_grec *g;
+static void showgatepins(log_grec *g)
 {
-  short i, FORLIM;
-  char STR1[256];
-
-  FORLIM = g->kind->numpins;
-  for (i = 1; i <= FORLIM; i++) {
-    sprintf(STR1, "%d", i);
-    (*logsima_action.lact->hook2->showpinname)(g, i,
-      logsima_action.lact->color.backgr, STR1);
-  }
-  FORLIM = g->kind->numpins;
-  for (i = 1; i <= FORLIM; i++) {
-    sprintf(STR1, "%d", i);
-    (*logsima_action.lact->hook2->showpinname)(g, i,
-      logsima_action.lact->color.pinnum, STR1);
-  }
+	short i, FORLIM;
+	char STR1[256];
+
+	FORLIM = g->kind->numpins;
+	for (i = 1; i <= FORLIM; i++)
+	{
+		sprintf(STR1, "%d", i);
+		(*logsima_action.lact->hook2->showpinname)(g, i,
+				logsima_action.lact->color.backgr, STR1);
+	}
+	FORLIM = g->kind->numpins;
+	for (i = 1; i <= FORLIM; i++)
+	{
+		sprintf(STR1, "%d", i);
+		(*logsima_action.lact->hook2->showpinname)(g, i,
+				logsima_action.lact->color.pinnum, STR1);
+	}
 }
 
 
 
-static void newnode_16(lact, n)
-log_action_t *lact;
-log_nrec **n;
+static void newnode_16(log_action_t *lact,log_nrec ** n)
 {
-  log_action_t *WITH;
+	log_action_t *WITH;
 
-  WITH = lact;
-  (*WITH->hook.newnode)(n, log_16_simtype);
-  (*n)->keep = true;
-  (*n)->ref = 1;
+	WITH = lact;
+	(*WITH->hook.newnode)(n, log_16_simtype);
+	(*n)->keep = true;
+	(*n)->ref = 1;
 }
 
 
-static void disposenode_16(lact, n)
-log_action_t *lact;
-log_nrec **n;
+static void disposenode_16(log_action_t *lact, log_nrec **n)
 {
-  log_action_t *WITH;
+	log_action_t *WITH;
 
-  WITH = lact;
-  (*n)->keep = false;
-  (*WITH->hook.switchnode)(n, NULL);
+	WITH = lact;
+	(*n)->keep = false;
+	(*WITH->hook.switchnode)(n, NULL);
 }
 
 
@@ -1445,17 +1427,18 @@ static void digproc1()
 
 static void digproc2()
 {
-  log_gattrrec *WITH;
+	log_gattrrec *WITH;
 
-  WITH = &diggattr[logsima_action.lact->actx - 1];
-  switch (logsima_action.lact->actx) {
+	WITH = &diggattr[logsima_action.lact->actx - 1];
+	switch (logsima_action.lact->actx)
+	{
 
-  case 1:
-  case 2:
-    if (WITH->UU.r <= 0)
-      logsima_action.lact->actflag = false;
-    break;
-  }
+		case 1:
+		case 2:
+			if (WITH->UU.r <= 0)
+				logsima_action.lact->actflag = false;
+			break;
+	}
 }
 
 
@@ -1466,502 +1449,523 @@ static void digproc3()
 
 /* Local variables for Log_16_proc: */
 struct LOC_Log_16_proc {
-  kindinfo *ki;
+	kindinfo *ki;
 } ;
 
-static void setupkindproc(LINK)
-struct LOC_Log_16_proc *LINK;
+static void setupkindproc(struct LOC_Log_16_proc *LINK)
 {
-  short pc, i, len;
-  char procname[256];
-  log_krec *WITH;
-
-  WITH = logsima_action.lact->actkind;
-  pc = 1;
-  while (WITH->proc[pc - 1] != '\0' && WITH->proc[pc - 1] != '\022')
-    pc++;
-  if (WITH->proc[pc - 1] != '\022') {
-    LINK->ki->hasproc = false;
-    LINK->ki->kindproc = nullkindproc;
-    return;
-  }
-  pc += 2;
-  len = WITH->proc[pc - 1] - 128;
-  procname[len] = '\0';
-/* p2c: logsim.text, line 1155:
- * Note: Modification of string length may translate incorrectly [146] */
-  for (i = 0; i < len; i++)
-    procname[i] = WITH->proc[pc + i];
-  LINK->ki->hasproc = newci_findprocedure(procname,
-      (void(**) ())(&LINK->ki->kindproc));
-  if (!LINK->ki->hasproc)
-    LINK->ki->kindproc = log_16_noprog;
+	short pc, i, len;
+	char procname[256];
+	log_krec *WITH;
+
+	WITH = logsima_action.lact->actkind;
+	pc = 1;
+	while (WITH->proc[pc - 1] != '\0' && WITH->proc[pc - 1] != '\022')
+		pc++;
+	if (WITH->proc[pc - 1] != '\022')
+	{
+		LINK->ki->hasproc = false;
+		LINK->ki->kindproc = nullkindproc;
+		return;
+	}
+	pc += 2;
+	len = WITH->proc[pc - 1] - 128;
+	procname[len] = '\0';
+	for (i = 0; i < len; i++)
+		procname[i] = WITH->proc[pc + i];
+	LINK->ki->hasproc = newci_findprocedure(procname,
+			(void(**) ())(&LINK->ki->kindproc));
+	if (!LINK->ki->hasproc)
+		LINK->ki->kindproc = log_16_noprog;
 }
 
 
 
-void Log_16_proc(lact)
-log_action_t *lact;
+void Log_16_proc(log_action_t *lact)
 {
-  struct LOC_Log_16_proc V;
-  nodeinfo *ni, *ni2;
-  log_krec *k2;
-  gateinfo *gi, *gi2;
-  na_strlist_t *l1;
-  short i;
-  double val1, val2;
-  char STR1[33];
-  char STR2[46];
-  char STR3[40];
-  log_action_t *WITH;
-  void (*TEMP) ();
-  void (*TEMP1) ();
-  void (*TEMP2) ();
-  short FORLIM;
-
-  logsima_action.lact = lact;
-  if (lact->traceflag && traceactions && ((unsigned long)lact->action >= 32 ||
-	((1L << ((long)lact->action)) &
-	 ((1L << ((long)act_pass)) | (1L << ((long)act_tstep)))) == 0)) {
-    sprintf(STR2, "log_16 gets %s", actionname(STR1, lact->action));
-    (*lact->hook.trace)(STR2);
-  }
-  WITH = lact;
-  switch (WITH->action) {
-
-  case act_init:
-    logsima_tool_16 = WITH->acttool;
-    WITH->acttool->ready = true;
-    WITH->acttool->simulator = true;
-    strcpy(WITH->acttool->shortname, "Digital");
-    if (*WITH->acttool->comment == '\0')
-      strcpy(WITH->acttool->comment, "Digital simulator");
-    logsima_init();
-    WITH->rndseed = timers_sysclock();
-    newsystime = 0;
-    vddsig = NULL;
-    gndsig = NULL;
-    resetsig = NULL;
-    resetcounter = 0;
-    isstable = false;
-    stabilizing = false;
-    passready = false;
-    maketimebid = false;
-    noprogloaded = false;
-    kbase_16 = NULL;
-    logsima_action.hook_input = log_16_input;
-    logsima_action.hook_output = log_16_output;
-    logsima_action.hook_ocoutput = log_16_ocoutput;
-    logsima_action.hook_led = log_16_led;
-    logsima_action.hook_eraled = log_16_eraled;
-    logsima_action.hook_plotled = log_16_plotled;
-    l1 = strlist_append(&WITH->acttool->hlbl, "Digital signal trace");
-    l1 = strlist_append(&WITH->acttool->hlbl, "");
-    l1 = strlist_append(&WITH->acttool->hlbl,
-	"2VCyan,Orange,Yellow,Pink,Green,Red,White,Medium Red,Light Gray,Dark Cyan,Dark Yellow,Dark Red:Color:");
-    l1 = strlist_append(&WITH->acttool->hlbl, "BY:Phosphor visible:");
-    l1 = strlist_append(&WITH->acttool->hlbl, "");
-    l1 = strlist_append(&WITH->acttool->hlbl, "R.8:Signal height:");
-    strlist_init(&diglbl);
-    l1 = strlist_append(&diglbl, "Digital simulator");
-    l1 = strlist_append(&diglbl, "");
-    l1 = strlist_append(&diglbl, "Us,10ns:Timestep:");
-    l1 = strlist_append(&diglbl, "");
-    l1 = strlist_append(&diglbl, "2R5:Stabilize time:");
-    l1 = strlist_append(&diglbl, "");
-    l1 = strlist_append(&diglbl, "1VOff,On:Digital simulation:");
-    (*WITH->hook.parselabel)(&diglbl, &dignumattrs, &digkattr);
-    (*WITH->hook.newattrs)(&diggattr, dignumattrs, digkattr);
-    break;
-
-  case act_clearmsg:
-    noprogloaded = false;
-    break;
-
-  case act_immed:
-    parseicommand(lact);
-    if (*lact->func != '\0')
-      callallkinds(act_16_immed);
-    break;
-
-  case act_func:
-    parsecommand(lact);
-    if (*lact->func != '\0')
-      callallkinds(act_16_func);
-    break;
-
-  case act_cnf:
-    parsecommand(lact);
-    if (*lact->func != '\0')
-      callallkinds(act_16_cnf);
-    break;
-
-  case act_select:
-    TEMP = digproc1;
-    TEMP1 = digproc2;
-    TEMP2 = digproc3;
-    (*WITH->hook.editattrs)(diggattr, dignumattrs, digkattr, diglbl,
-			    "Digital", TEMP, TEMP1, TEMP2);
-    break;
-
-  case act_status:
-    status_16(&WITH->actflag);
-    break;
-
-  case act_color:
-    backgrcolor = WITH->color.backgr;
-    (*WITH->hook.getcolor)("ONLED", &ledoncolor, log_red);
-    (*WITH->hook.getcolor)("OFFLED", &ledoffcolor, log_black);
-    (*WITH->hook.getcolor)("SCOPE", &scopecolor, log_yellow);
-    (*WITH->hook.getcolor)("SCOPESCAN", &scopescancolor, log_white);
-    break;
-
-  case act_newkind:
-    V.ki = (kindinfo *)Malloc(sizeof(kindinfo));
-    V.ki->info = NULL;
-    V.ki->numppins = 0;
-    V.ki->numpvars = 0;
-    if (WITH->actkind->proc[0] == '\027') {
-      V.ki->instance = true;
-      if (WITH->actkind->proc[1] > '"')
-	V.ki->numppins = (WITH->actkind->proc[3] - 32) * 128 +
-			 WITH->actkind->proc[2] - 64;
-      if (WITH->actkind->proc[1] > '$')
-	V.ki->numpvars = (WITH->actkind->proc[5] - 32) * 128 +
-			 WITH->actkind->proc[4] - 64;
-    } else
-      V.ki->instance = false;
-    setupkindproc(&V);
-    V.ki->knext = kbase_16;
-    kbase_16 = WITH->actkind;
-    WITH->actkind->info = (void *)V.ki;
-    callkind(act_16_newkind);
-    break;
-
-  case act_disposekind:
-    V.ki = (kindinfo *)WITH->actkind->info;
-    if (WITH->actkind == kbase_16)
-      kbase_16 = ((kindinfo *)kbase_16->info)->knext;
-    else {
-      k2 = kbase_16;
-      while (k2 != NULL && ((kindinfo *)k2->info)->knext != WITH->actkind)
-	k2 = ((kindinfo *)k2->info)->knext;
-      if (k2 != NULL)
-	((kindinfo *)k2->info)->knext = V.ki->knext;
-    }
-    callkind(act_16_disposekind);
-    Free(V.ki);
-    break;
-
-  case act_edit:
-    switch (WITH->acty) {
-
-    case 0:
-      edit_16(&WITH->actproc, &WITH->actx, WITH->actstr);
-      break;
-
-    case 1:
-    case 2:
-      dump_16(&WITH->actproc, &WITH->actstrlist, WITH->acty == 1);
-      break;
-
-    case 3:
-      read_16(&WITH->actproc, &WITH->actx, WITH->actstrlist);
-      break;
-    }
-    break;
-
-  case act_pass:
-    pass_16(&logsima_action);
-    break;
-
-  case act_tstep:
-    tstep_16(&logsima_action);
-    break;
-
-  case act_erasegate:
-    callgate(act_16_erase);
-    break;
-
-  case act_glowcol:
-    WITH->actx = digglowcol(WITH->actnode, (int)WITH->actx);
-    break;
-
-  case act_trigger:
-    WITH->actflag = digtrigger(WITH->actnode);
-    break;
-
-  case act_history:
-  case act_nodeval:
-    ni = (nodeinfo *)WITH->actnode->info;
-    if (ni->v == ni->v00 || logsima_tool_16->deltatime == 0.0 || !WITH->pwrflag) {
-      switch (ni->v00) {
-
-      case log_none:
-	WITH->actval = 0.0;
-	break;
-
-      case log_zero:
-	WITH->actval = -0.5;
-	break;
-
-      case log_one:
-	WITH->actval = 0.5;
-	break;
-      }
-    } else {
-      switch (ni->v) {
-
-      case log_none:
-	val1 = 0.0;
-	break;
-
-      case log_zero:
-	val1 = -0.5;
-	break;
-
-      case log_one:
-	val1 = 0.5;
-	break;
-      }
-      switch (ni->v00) {
-
-      case log_none:
-	val2 = 0.0;
-	break;
-
-      case log_zero:
-	val2 = -0.5;
-	break;
-
-      case log_one:
-	val2 = 0.5;
-	break;
-      }
-      WITH->actval = val2 +
-		     (val1 - val2) * logsima_tool_16->deltatime / nexttimebid;
-    }
-    if (WITH->action == act_nodeval)
-      WITH->actval += 0.5;
-    break;
-
-  case act_histval:
-    WITH->actval *= WITH->actgattr[histsize - 1].UU.r;
-    if (!WITH->actgattr[histvis - 1].UU.b)
-      WITH->acty = -1;
-    else
-      WITH->acty = histcolortable[WITH->actgattr[histcolor - 1].UU.nv];
-    break;
-
-  case act_histstr:
-    if ((unsigned long)WITH->acty < 32 && ((1L << WITH->acty) & 0x6) != 0 &&
-	WITH->actval > -1 && WITH->actval < 1) {
-      if (WITH->actval > 0.2)
-	strcpy(WITH->actstr, "One");
-      else if (WITH->actval < -0.2)
-	strcpy(WITH->actstr, "Zero");
-      else
-	strcpy(WITH->actstr, "Not driven");
-    }
-    break;
-
-  case act_touchgate:
-    callgate(act_16_touch);
-    break;
-
-  case act_newgate:
-    V.ki = (kindinfo *)WITH->actgate->kind->info;
-    if (V.ki->instance) {
-      gi = (gateinfo *)Malloc(sizeof(gateinfo));
-      gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
-
-      /* code initializing ppins should go here */
-
-      gi->pvars = (char *)Malloc((long)V.ki->numpvars);
-      if (V.ki->numpvars != 0)
-	memset((void *)gi->pvars, 0, (long)V.ki->numpvars);
-      WITH->actgate->info = (void *)gi;
-
-    }
-    callgate(act_16_new);
-    break;
-
-  case act_disposegate:
-    V.ki = (kindinfo *)WITH->actgate->kind->info;
-    if (V.ki->instance) {
-      gi = (gateinfo *)WITH->actgate->info;
-
-      /* code disposing ppins should go here */
-
-      Free(gi->ppins);
-      Free(gi->pvars);
-      Free(gi);
-    }
-    callgate(act_16_dispose);
-    break;
-
-  case act_copygate:
-    V.ki = (kindinfo *)WITH->actgate->kind->info;
-    if (V.ki->instance) {
-      gi = (gateinfo *)Malloc(sizeof(gateinfo));
-      gi2 = (gateinfo *)WITH->actgate2->info;
-      gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
-
-      /* code initializing ppins should go here */
-
-      gi->pvars = (char *)Malloc((long)V.ki->numpvars);
-      if (V.ki->numpvars != 0)
-	memmove((void *)gi2->pvars, (void *)gi->pvars, (long)V.ki->numpvars);
-      WITH->actgate->info = (void *)gi;
-    }
-    callgate(act_16_copy);
-    break;
-
-  case act_writegate:
-    callgate(act_16_write);
-    break;
-
-  case act_readgate:
-    callgate(act_16_read);
-    break;
-
-  case act_connectgate:
-    callgate(act_16_connect);
-    V.ki = (kindinfo *)WITH->actgate->kind->info;
-    if (V.ki->instance) {
-      gi = (gateinfo *)WITH->actgate->info;
-      FORLIM = V.ki->numppins;
-      for (i = 0; i < FORLIM; i++)   /*this calls Log_16_proc recursively*/
-	newnode_16(lact, &gi->ppins[i]);
-    }
-    break;
-
-  case act_disconnectgate:
-    callgate(act_16_disconnect);
-    V.ki = (kindinfo *)WITH->actgate->kind->info;
-    if (V.ki->instance) {
-      gi = (gateinfo *)WITH->actgate->info;
-      FORLIM = V.ki->numppins;
-      for (i = 0; i < FORLIM; i++)   /*this calls Log_16_proc recursively*/
-	disposenode_16(lact, &gi->ppins[i]);
-    }
-    break;
-
-  case act_configgate:
-    callgate(act_16_configgate);
-    break;
-
-  case act_configchgate:
-    callgate(act_16_configchgate);
-    break;
-
-  case act_configrelgate:
-    callgate(act_16_configrelgate);
-    break;
-
-  case act_configchhist:
-    /* blank case */
-    break;
-
-  case act_newnode:
-    ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
-    WITH->actnode->info = (void *)ni;
-    ni->v = log_none;
-    ni->v0 = log_none;
-    ni->v00 = log_none;
-    ni->defv = log_none;
-    ni->truev = log_none;
-    break;
-
-  case act_disposenode:
-    ni = (nodeinfo *)WITH->actnode->info;
-    Free(ni);
-    break;
-
-  case act_copynode:
-    ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
-    ni2 = (nodeinfo *)WITH->actnode2->info;
-    *ni = *ni2;
-    WITH->actnode->info = (void *)ni;
-    break;
-
-  case act_combineintonode:
-    /* blank case */
-    break;
-
-  case act_combinenodes:
-    ni = (nodeinfo *)WITH->actnode->info;
-    ni2 = (nodeinfo *)WITH->actnode2->info;
-    ni->v = bcomb[(long)ni->v - (long)log_none][(long)ni2->v - (long)log_none];
-    ni->v00 = ni->v;
-    break;
-
-  case act_writenode:
-    ni = (nodeinfo *)WITH->actnode->info;
-    fprintf(*WITH->actfile, "%d\n", (int)ni->v);
-    break;
-
-  case act_readnode:
-    ni = (nodeinfo *)WITH->actnode->info;
-    fscanf(*WITH->actfile, "%hd%*[^\n]", &i);
-    getc(*WITH->actfile);
-    ni->v = log_16_iv[i];
-    ni->v00 = ni->v;
-    break;
-
-  case act_refnodes:
-    callallgates(act_16_refnodes);
-    break;
-
-  case act_general:
-    /* blank case */
-    break;
-
-  /* nothing to do */
-  case act_gennode:
-    break;
-
-  /* nothing to do */
-  case act_genkind:
-    if (WITH->actkind == NULL)
-      callallkinds(act_16_genkind);
-    else if (!strcmp(WITH->genfunc, "DUMPKIND")) {
-      callkind(act_16_genkind);
-      if (WITH->actstrlist == NULL) {
-	sprintf(STR3, "Definition for digital gate %s:", WITH->actkind->name);
-	l1 = strlist_insert(&WITH->actstrlist, STR3);
-	dump_16(&WITH->actkind->proc, &l1->next, true);
-      }
-    } else
-      callkind(act_16_genkind);
-    break;
-
-  case act_gengate:   /*ignore*/
-    if (WITH->actgate == NULL)
-      callallgates(act_16_gengate);
-    else if (!strcmp(WITH->genfunc, "SHOWPINS")) {
-      callgate(act_16_gengate);
-      if (!WITH->actflag) {
-	showgatepins(WITH->actgate);
-	WITH->actflag = true;
-      }
-    } else
-      callgate(act_16_gengate);
-    break;
-
-  default:
-    break;
-  }
+	struct LOC_Log_16_proc V;
+	nodeinfo *ni, *ni2;
+	log_krec *k2;
+	gateinfo *gi, *gi2;
+	na_strlist_t *l1;
+	short i;
+	double val1, val2;
+	char STR1[33];
+	char STR2[46];
+	char STR3[40];
+	log_action_t *WITH;
+	void (*TEMP) ();
+	void (*TEMP1) ();
+	void (*TEMP2) ();
+	short FORLIM;
+
+	logsima_action.lact = lact;
+	if (lact->traceflag && traceactions && ((unsigned long)lact->action >= 32 ||
+				((1L << ((long)lact->action)) &
+				 ((1L << ((long)act_pass)) | (1L << ((long)act_tstep)))) == 0))
+	{
+		sprintf(STR2, "log_16 gets %s", actionname(STR1, lact->action));
+		(*lact->hook.trace)(STR2);
+	}
+	WITH = lact;
+	switch (WITH->action)
+	{
+
+		case act_init:
+			logsima_tool_16 = WITH->acttool;
+			WITH->acttool->ready = true;
+			WITH->acttool->simulator = true;
+			strcpy(WITH->acttool->shortname, "Digital");
+			if (*WITH->acttool->comment == '\0')
+				strcpy(WITH->acttool->comment, "Digital simulator");
+			logsima_init();
+			WITH->rndseed = timers_sysclock();
+			newsystime = 0;
+			vddsig = NULL;
+			gndsig = NULL;
+			resetsig = NULL;
+			resetcounter = 0;
+			isstable = false;
+			stabilizing = false;
+			passready = false;
+			maketimebid = false;
+			noprogloaded = false;
+			kbase_16 = NULL;
+			logsima_action.hook_input = log_16_input;
+			logsima_action.hook_output = log_16_output;
+			logsima_action.hook_ocoutput = log_16_ocoutput;
+			logsima_action.hook_led = log_16_led;
+			logsima_action.hook_eraled = log_16_eraled;
+			logsima_action.hook_plotled = log_16_plotled;
+			l1 = strlist_append(&WITH->acttool->hlbl, "Digital signal trace");
+			l1 = strlist_append(&WITH->acttool->hlbl, "");
+			l1 = strlist_append(&WITH->acttool->hlbl,
+					"2VCyan,Orange,Yellow,Pink,Green,Red,White,Medium Red,Light Gray,Dark Cyan,Dark Yellow,Dark Red:Color:");
+			l1 = strlist_append(&WITH->acttool->hlbl, "BY:Phosphor visible:");
+			l1 = strlist_append(&WITH->acttool->hlbl, "");
+			l1 = strlist_append(&WITH->acttool->hlbl, "R.8:Signal height:");
+			strlist_init(&diglbl);
+			l1 = strlist_append(&diglbl, "Digital simulator");
+			l1 = strlist_append(&diglbl, "");
+			l1 = strlist_append(&diglbl, "Us,10ns:Timestep:");
+			l1 = strlist_append(&diglbl, "");
+			l1 = strlist_append(&diglbl, "2R5:Stabilize time:");
+			l1 = strlist_append(&diglbl, "");
+			l1 = strlist_append(&diglbl, "1VOff,On:Digital simulation:");
+			(*WITH->hook.parselabel)(&diglbl, &dignumattrs, &digkattr);
+			(*WITH->hook.newattrs)(&diggattr, dignumattrs, digkattr);
+			break;
+
+		case act_clearmsg:
+			noprogloaded = false;
+			break;
+
+		case act_immed:
+			parseicommand(lact);
+			if (*lact->func != '\0')
+				callallkinds(act_16_immed);
+			break;
+
+		case act_func:
+			parsecommand(lact);
+			if (*lact->func != '\0')
+				callallkinds(act_16_func);
+			break;
+
+		case act_cnf:
+			parsecommand(lact);
+			if (*lact->func != '\0')
+				callallkinds(act_16_cnf);
+			break;
+
+		case act_select:
+			TEMP = digproc1;
+			TEMP1 = digproc2;
+			TEMP2 = digproc3;
+			(*WITH->hook.editattrs)(diggattr, dignumattrs, digkattr, diglbl,
+					"Digital", TEMP, TEMP1, TEMP2);
+			break;
+
+		case act_status:
+			status_16(&WITH->actflag);
+			break;
+
+		case act_color:
+			backgrcolor = WITH->color.backgr;
+			(*WITH->hook.getcolor)("ONLED", &ledoncolor, log_red);
+			(*WITH->hook.getcolor)("OFFLED", &ledoffcolor, log_black);
+			(*WITH->hook.getcolor)("SCOPE", &scopecolor, log_yellow);
+			(*WITH->hook.getcolor)("SCOPESCAN", &scopescancolor, log_white);
+			break;
+
+		case act_newkind:
+			V.ki = (kindinfo *)Malloc(sizeof(kindinfo));
+			V.ki->info = NULL;
+			V.ki->numppins = 0;
+			V.ki->numpvars = 0;
+			if (WITH->actkind->proc[0] == '\027')
+			{
+				V.ki->instance = true;
+				if (WITH->actkind->proc[1] > '"')
+					V.ki->numppins = (WITH->actkind->proc[3] - 32) * 128 +
+						WITH->actkind->proc[2] - 64;
+				if (WITH->actkind->proc[1] > '$')
+					V.ki->numpvars = (WITH->actkind->proc[5] - 32) * 128 +
+						WITH->actkind->proc[4] - 64;
+			}
+			else
+			{
+				V.ki->instance = false;
+			}
+			setupkindproc(&V);
+			V.ki->knext = kbase_16;
+			kbase_16 = WITH->actkind;
+			WITH->actkind->info = (void *)V.ki;
+			callkind(act_16_newkind);
+			break;
+
+		case act_disposekind:
+			V.ki = (kindinfo *)WITH->actkind->info;
+			if (WITH->actkind == kbase_16)
+			{
+				kbase_16 = ((kindinfo *)kbase_16->info)->knext;
+			}
+			else
+			{
+				k2 = kbase_16;
+				while (k2 != NULL && ((kindinfo *)k2->info)->knext != WITH->actkind)
+					k2 = ((kindinfo *)k2->info)->knext;
+				if (k2 != NULL)
+					((kindinfo *)k2->info)->knext = V.ki->knext;
+			}
+			callkind(act_16_disposekind);
+			Free(V.ki);
+			break;
+
+		case act_edit:
+			switch (WITH->acty)
+			{
+				case 0:
+					edit_16(&WITH->actproc, &WITH->actx, WITH->actstr);
+					break;
+
+				case 1:
+				case 2:
+					dump_16(&WITH->actproc, &WITH->actstrlist, WITH->acty == 1);
+					break;
+
+				case 3:
+					read_16(&WITH->actproc, &WITH->actx, WITH->actstrlist);
+					break;
+			}
+			break;
+
+		case act_pass:
+			pass_16(&logsima_action);
+			break;
+
+		case act_tstep:
+			tstep_16(&logsima_action);
+			break;
+
+		case act_erasegate:
+			callgate(act_16_erase);
+			break;
+
+		case act_glowcol:
+			WITH->actx = digglowcol(WITH->actnode, (int)WITH->actx);
+			break;
+
+		case act_trigger:
+			WITH->actflag = digtrigger(WITH->actnode);
+			break;
+
+		case act_history:
+		case act_nodeval:
+			ni = (nodeinfo *)WITH->actnode->info;
+			if (ni->v == ni->v00 || logsima_tool_16->deltatime == 0.0 || !WITH->pwrflag)
+			{
+				switch (ni->v00)
+				{
+					case log_none:
+						WITH->actval = 0.0;
+						break;
+
+					case log_zero:
+						WITH->actval = -0.5;
+						break;
+
+					case log_one:
+						WITH->actval = 0.5;
+						break;
+				}
+			}
+			else
+			{
+				switch (ni->v)
+				{
+					case log_none:
+						val1 = 0.0;
+						break;
+
+					case log_zero:
+						val1 = -0.5;
+						break;
+
+					case log_one:
+						val1 = 0.5;
+						break;
+				}
+				switch (ni->v00)
+				{
+
+					case log_none:
+						val2 = 0.0;
+						break;
+
+					case log_zero:
+						val2 = -0.5;
+						break;
+
+					case log_one:
+						val2 = 0.5;
+						break;
+				}
+				WITH->actval = val2 +
+					(val1 - val2) * logsima_tool_16->deltatime / nexttimebid;
+			}
+			if (WITH->action == act_nodeval)
+				WITH->actval += 0.5;
+			break;
+
+		case act_histval:
+			WITH->actval *= WITH->actgattr[histsize - 1].UU.r;
+			if (!WITH->actgattr[histvis - 1].UU.b)
+				WITH->acty = -1;
+			else
+				WITH->acty = histcolortable[WITH->actgattr[histcolor - 1].UU.nv];
+			break;
+
+		case act_histstr:
+			if ((unsigned long)WITH->acty < 32 && ((1L << WITH->acty) & 0x6) != 0 &&
+					WITH->actval > -1 && WITH->actval < 1)
+			{
+				if (WITH->actval > 0.2)
+					strcpy(WITH->actstr, "One");
+				else if (WITH->actval < -0.2)
+					strcpy(WITH->actstr, "Zero");
+				else
+					strcpy(WITH->actstr, "Not driven");
+			}
+			break;
+
+		case act_touchgate:
+			callgate(act_16_touch);
+			break;
+
+		case act_newgate:
+			V.ki = (kindinfo *)WITH->actgate->kind->info;
+			if (V.ki->instance)
+			{
+				gi = (gateinfo *)Malloc(sizeof(gateinfo));
+				gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
+
+				/* code initializing ppins should go here */
+
+				gi->pvars = (char *)Malloc((long)V.ki->numpvars);
+				if (V.ki->numpvars != 0)
+					memset((void *)gi->pvars, 0, (long)V.ki->numpvars);
+				WITH->actgate->info = (void *)gi;
+
+			}
+			callgate(act_16_new);
+			break;
+
+		case act_disposegate:
+			V.ki = (kindinfo *)WITH->actgate->kind->info;
+			if (V.ki->instance)
+			{
+				gi = (gateinfo *)WITH->actgate->info;
+
+				/* code disposing ppins should go here */
+
+				Free(gi->ppins);
+				Free(gi->pvars);
+				Free(gi);
+			}
+			callgate(act_16_dispose);
+			break;
+
+		case act_copygate:
+			V.ki = (kindinfo *)WITH->actgate->kind->info;
+			if (V.ki->instance)
+			{
+				gi = (gateinfo *)Malloc(sizeof(gateinfo));
+				gi2 = (gateinfo *)WITH->actgate2->info;
+				gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
+
+				/* code initializing ppins should go here */
+
+				gi->pvars = (char *)Malloc((long)V.ki->numpvars);
+				if (V.ki->numpvars != 0)
+					memmove((void *)gi2->pvars, (void *)gi->pvars, (long)V.ki->numpvars);
+				WITH->actgate->info = (void *)gi;
+			}
+			callgate(act_16_copy);
+			break;
+
+		case act_writegate:
+			callgate(act_16_write);
+			break;
+
+		case act_readgate:
+			callgate(act_16_read);
+			break;
+
+		case act_connectgate:
+			callgate(act_16_connect);
+			V.ki = (kindinfo *)WITH->actgate->kind->info;
+			if (V.ki->instance)
+			{
+				gi = (gateinfo *)WITH->actgate->info;
+				FORLIM = V.ki->numppins;
+				for (i = 0; i < FORLIM; i++)   /*this calls Log_16_proc recursively*/
+					newnode_16(lact, &gi->ppins[i]);
+			}
+			break;
+
+		case act_disconnectgate:
+			callgate(act_16_disconnect);
+			V.ki = (kindinfo *)WITH->actgate->kind->info;
+			if (V.ki->instance)
+			{
+				gi = (gateinfo *)WITH->actgate->info;
+				FORLIM = V.ki->numppins;
+				for (i = 0; i < FORLIM; i++)   /*this calls Log_16_proc recursively*/
+					disposenode_16(lact, &gi->ppins[i]);
+			}
+			break;
+
+		case act_configgate:
+			callgate(act_16_configgate);
+			break;
+
+		case act_configchgate:
+			callgate(act_16_configchgate);
+			break;
+
+		case act_configrelgate:
+			callgate(act_16_configrelgate);
+			break;
+
+		case act_configchhist:
+			/* blank case */
+			break;
+
+		case act_newnode:
+			ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
+			WITH->actnode->info = (void *)ni;
+			ni->v = log_none;
+			ni->v0 = log_none;
+			ni->v00 = log_none;
+			ni->defv = log_none;
+			ni->truev = log_none;
+			break;
+
+		case act_disposenode:
+			ni = (nodeinfo *)WITH->actnode->info;
+			Free(ni);
+			break;
+
+		case act_copynode:
+			ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
+			ni2 = (nodeinfo *)WITH->actnode2->info;
+			*ni = *ni2;
+			WITH->actnode->info = (void *)ni;
+			break;
+
+		case act_combineintonode:
+			/* blank case */
+			break;
+
+		case act_combinenodes:
+			ni = (nodeinfo *)WITH->actnode->info;
+			ni2 = (nodeinfo *)WITH->actnode2->info;
+			ni->v = bcomb[(long)ni->v - (long)log_none][(long)ni2->v - (long)log_none];
+			ni->v00 = ni->v;
+			break;
+
+		case act_writenode:
+			ni = (nodeinfo *)WITH->actnode->info;
+			fprintf(*WITH->actfile, "%d\n", (int)ni->v);
+			break;
+
+		case act_readnode:
+			ni = (nodeinfo *)WITH->actnode->info;
+			fscanf(*WITH->actfile, "%hd%*[^\n]", &i);
+			getc(*WITH->actfile);
+			ni->v = log_16_iv[i];
+			ni->v00 = ni->v;
+			break;
+
+		case act_refnodes:
+			callallgates(act_16_refnodes);
+			break;
+
+		case act_general:
+			/* blank case */
+			break;
+
+			/* nothing to do */
+		case act_gennode:
+			break;
+
+			/* nothing to do */
+		case act_genkind:
+			if (WITH->actkind == NULL)
+			{
+				callallkinds(act_16_genkind);
+			}
+			else if (!strcmp(WITH->genfunc, "DUMPKIND"))
+			{
+				callkind(act_16_genkind);
+				if (WITH->actstrlist == NULL)
+				{
+					sprintf(STR3, "Definition for digital gate %s:", WITH->actkind->name);
+					l1 = strlist_insert(&WITH->actstrlist, STR3);
+					dump_16(&WITH->actkind->proc, &l1->next, true);
+				}
+			}
+			else
+			{
+				callkind(act_16_genkind);
+			}
+			break;
+
+		case act_gengate:   /*ignore*/
+			if (WITH->actgate == NULL)
+			{
+				callallgates(act_16_gengate);
+			}
+			else if (!strcmp(WITH->genfunc, "SHOWPINS"))
+			{
+				callgate(act_16_gengate);
+				if (!WITH->actflag)
+				{
+					showgatepins(WITH->actgate);
+					WITH->actflag = true;
+				}
+			}
+			else
+			{
+				callgate(act_16_gengate);
+			}
+			break;
+
+		default:
+			break;
+	}
 }
 
 
-
-
-
-
-
-
-
-
-
 /* End. */
diff --git a/log/src/logsimasm.c b/log/src/logsimasm.c
index 754a804..eea138a 100644
--- a/log/src/logsimasm.c
+++ b/log/src/logsimasm.c
@@ -7,18 +7,18 @@
    Copyright (C) 1985, 1990 John Lazzaro.
    Author's address: lazzaro@csvax.caltech.edu; 256-80 Caltech.
 
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation (any version).
+   This program is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation (any version).
 
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-GNU General Public License for more details.
+   This program is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
 
-You should have received a copy of the GNU General Public License
-along with this program; see the file COPYING.  If not, write to
-the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+   You should have received a copy of the GNU General Public License
+   along with this program; see the file COPYING.  If not, write to
+   the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
 
 
 /* C equivalent code for the assembly-language portions of logsim.
@@ -50,61 +50,63 @@ static void (*callcache[255-32])(log_16_action *);   /* first 32 are unused */
 
 
 
-static void nullproc_16(act)
-log_16_action *act;
+static void nullproc_16(log_16_action *act)
 {
-  /* do nothing */
+	/* do nothing */
 }
 
 
 void logsima_init()
 {
-  callcache[0] = nullproc_16;
-  callcache_next = 33;
+	callcache[0] = nullproc_16;
+	callcache_next = 33;
 }
 
 
 
-void clearnodes(n)
-register log_nrec *n;
+void clearnodes(log_nrec *n)
 {
-  register log_tool *tool16 = logsima_action.lact->acttool;
-  register nodeinfo *nip;
-
-  while (n) {
-    if (n->simtype == tool16) {
-      nip = (nodeinfo *)n->info;
-      nip->v0 = nip->defv = log_none;
-    }
-    n = n->next;
-  }
+	register log_tool *tool16 = logsima_action.lact->acttool;
+	register nodeinfo *nip;
+
+	while (n)
+	{
+		if (n->simtype == tool16)
+		{
+			nip = (nodeinfo *)n->info;
+			nip->v0 = nip->defv = log_none;
+		}
+		n = n->next;
+	}
 }
 
 
-void copynodes(n, stable)
-register log_nrec *n;
-int *stable;
+void copynodes(log_nrec *n, int *stable)
 {
-  register log_tool *tool16 = logsima_action.lact->acttool;
-  register nodeinfo *nip;
-  register int st = *stable;
-  register log_16_value newv;
-
-  while (n) {
-    if (n->simtype == tool16) {
-      nip = (nodeinfo *)n->info;
-      if ((nip->truev = newv = nip->v0) == log_none)
-	newv = nip->defv;
-      if (TRACE_COPY) printf("Setting node %x to %d\n", (unsigned int)nip, newv);
-      if (newv != (nip->v00 = nip->v)) {
-	nip->v = newv;
-	st = false;
-	n->changed = true;
-      }
-    }
-    n = n->next;
-  }
-  *stable = st;
+	register log_tool *tool16 = logsima_action.lact->acttool;
+	register nodeinfo *nip;
+	register int st = *stable;
+	register log_16_value newv;
+
+	while (n)
+	{
+		if (n->simtype == tool16)
+		{
+			nip = (nodeinfo *)n->info;
+			if ((nip->truev = newv = nip->v0) == log_none)
+				newv = nip->defv;
+			if (TRACE_COPY)
+				printf("Setting node %x to %d\n", (unsigned int)nip, newv);
+			if (newv != (nip->v00 = nip->v))
+			{
+				nip->v = newv;
+				st = false;
+				n->changed = true;
+			}
+		}
+		n = n->next;
+	}
+	*stable = st;
 }
 
 
@@ -116,96 +118,101 @@ static log_nrec **g_pins;
 static gateinfo *g_info;
 
 
-static void processcall(action)
-log_16_actionkinds action;
+static void processcall(log_16_actionkinds action)
 {
-  uchar num;
-  int len;
-  char namebuf[256];
-  void (*myproc)(log_16_action *);
-
-  logsima_action.action = action;
-  logsima_action.lact->actkind = logsima_action.lact->actgate->kind;
-  num = *g_proc++;
-  len = (*g_proc++) - 128;
-  if (num < 255) {
-    (*callcache[num - 32])(&logsima_action);
-  } else {
-    namebuf[len] = 0;
-    strncpy(namebuf, (char *)g_proc, len);
-    if (findprocedure(namebuf, (void(**)())(&myproc))) {
-      if (callcache_next < 254) {
-	num = g_proc[-2] = callcache_next++;
-	callcache[num - 32] = myproc;
-      }
-      (*myproc)(&logsima_action);
-    } else {
-      printf("Could not resolve %s\n", namebuf);
-      g_proc[-2] = 32;
-      log_16_noprog(&logsima_action);
-    }
-  }
-
-
-  g_proc += len;
+	uchar num;
+	int len;
+	char namebuf[256];
+	void (*myproc)(log_16_action *);
+
+	logsima_action.action = action;
+	logsima_action.lact->actkind = logsima_action.lact->actgate->kind;
+	num = *g_proc++;
+	len = (*g_proc++) - 128;
+	if (num < 255)
+	{
+		(*callcache[num - 32])(&logsima_action);
+	}
+	else
+	{
+		namebuf[len] = 0;
+		strncpy(namebuf, (char *)g_proc, len);
+		if (findprocedure(namebuf, (void(**)())(&myproc)))
+		{
+			if (callcache_next < 254)
+			{
+				num = g_proc[-2] = callcache_next++;
+				callcache[num - 32] = myproc;
+			}
+			(*myproc)(&logsima_action);
+		}
+		else
+		{
+			printf("Could not resolve %s\n", namebuf);
+			g_proc[-2] = 32;
+			log_16_noprog(&logsima_action);
+		}
+	}
+
+	g_proc += len;
 
 }
 
 
-void callgate(action)
-log_16_actionkinds action;
+void callgate(log_16_actionkinds action)
 {
-  uchar *save_proc = g_proc;
-  log_krec *kind;
-  kindinfo *kip;
-
-  kind = logsima_action.lact->actgate->kind;
-  g_proc = kind->proc;
-  kip = kind->info;
-  if (kip->hasproc) {
-    while (*g_proc) {
-      if (*g_proc++ == 0x12)
-	processcall(action);
-    }
-  }
-  g_proc = save_proc;
+	uchar *save_proc = g_proc;
+	log_krec *kind;
+	kindinfo *kip;
+
+	kind = logsima_action.lact->actgate->kind;
+	g_proc = kind->proc;
+	kip = kind->info;
+	if (kip->hasproc)
+	{
+		while (*g_proc)
+		{
+			if (*g_proc++ == 0x12)
+				processcall(action);
+		}
+	}
+	g_proc = save_proc;
 }
 
 
 
-static void record_conflict(np)
-log_nrec *np;
+static void record_conflict(log_nrec *np)
 {
-  (*logsima_action.lact->hook.nodeconflict)(np);
+	(*logsima_action.lact->hook.nodeconflict)(np);
 }
 
 
 #define REGMASK(n)  (0x8000 >> (n))
 
 #define case16(n)  case n+0: case n+1: case n+2: case n+3:  \
-                   case n+4: case n+5: case n+6: case n+7:  \
-                   case n+8: case n+9: case n+10: case n+11:  \
-                   case n+12: case n+13: case n+14: case n+15
+	case n+4: case n+5: case n+6: case n+7:  \
+	case n+8: case n+9: case n+10: case n+11:  \
+	case n+12: case n+13: case n+14: case n+15
 
 static int  and_table[3][3] = { { log_none, log_zero, log_one  },
-			    { log_zero, log_zero, log_zero },
-			    { log_one,  log_zero, log_one  } };
+	{ log_zero, log_zero, log_zero },
+	{ log_one,  log_zero, log_one  } };
 
 static int nand_table[3][3] = { { log_none, log_one,  log_zero },
-			    { log_one,  log_one,  log_one  },
-			    { log_zero, log_one,  log_zero } };
+	{ log_one,  log_one,  log_one  },
+	{ log_zero, log_one,  log_zero } };
 
 static int  or_table[3][3] = { { log_none, log_zero, log_one  },
-			    { log_zero, log_zero, log_one  },
-			    { log_one,  log_one,  log_one  } };
+	{ log_zero, log_zero, log_one  },
+	{ log_one,  log_one,  log_one  } };
 
 static int  nor_table[3][3] = { { log_none, log_one,  log_zero },
-			    { log_one,  log_one,  log_zero },
-			    { log_zero, log_zero, log_zero } };
+	{ log_one,  log_one,  log_zero },
+	{ log_zero, log_zero, log_zero } };
 
 static int  xor_table[3][3] = { { log_none, log_zero, log_one  },
-			    { log_zero, log_zero, log_one  },
-			    { log_one,  log_one,  log_zero } };
+	{ log_zero, log_zero, log_one  },
+	{ log_one,  log_one,  log_zero } };
 
 static int not_table[3] = { log_none, log_one,  log_zero };
 static int fix_table[3] = { log_zero, log_zero, log_one  };
@@ -214,468 +221,477 @@ static int fix_table[3] = { log_zero, log_zero, log_one  };
 static char *debug_dasm()
 {
 #define SAFETY_MARGIN 256
-  long pc = 1;
-  static char *buf;
-  char *tmp = NULL;
-  int pc2 = 0;
-
-  if (buf) {
-    Free(buf);
-    buf = NULL;
-  }
-  if (*g_proc) {
-    tmp = (char*)dasm_16(g_proc, &pc);
-    buf = (char*)Malloc(strlen(tmp) + SAFETY_MARGIN); 
-    strcpy(buf, "\"");
-    strcat(buf, tmp);
-    strcat(buf, "\"  <");
-    Free(tmp);
-    pc--;
-  } else {
-    buf = (char*)Malloc(SAFETY_MARGIN);
-    strcpy(buf, "\"<");
-  }
-
-  while (pc2 < pc && pc2 < 8) {
-    sprintf(buf + strlen(buf), "%s%.2x", (pc2 > 0) ? " " : "", g_proc[pc2]);
-    pc2++;
-  }
-  if (pc2 < pc)
-    strcat(buf, "...");
-  strcat(buf, ">");
-  return buf;
+	long pc = 1;
+	static char *buf;
+	char *tmp = NULL;
+	int pc2 = 0;
+
+	if (buf)
+	{
+		Free(buf);
+		buf = NULL;
+	}
+	if (*g_proc)
+	{
+		tmp = (char*)dasm_16(g_proc, &pc);
+		buf = (char*)Malloc(strlen(tmp) + SAFETY_MARGIN); 
+		strcpy(buf, "\"");
+		strcat(buf, tmp);
+		strcat(buf, "\"  <");
+		Free(tmp);
+		pc--;
+	}
+	else
+	{
+		buf = (char*)Malloc(SAFETY_MARGIN);
+		strcpy(buf, "\"<");
+	}
+
+	while (pc2 < pc && pc2 < 8)
+	{
+		sprintf(buf + strlen(buf), "%s%.2x", (pc2 > 0) ? " " : "", g_proc[pc2]);
+		pc2++;
+	}
+	if (pc2 < pc)
+		strcat(buf, "...");
+	strcat(buf, ">");
+	return buf;
 }
 
 
 static log_nrec *g_pinnum()
 {
-  register uchar ch;
-
-  if (TRACE_OPS) printf("g_pinnum: %s\n", debug_dasm());
-  switch ((ch = *g_proc++)) {
+	register uchar ch;
 
-  case 0xab:  /* internal node */
-    ch = *g_proc++;
-    if (ch < 128)
-      return g_info->ppins[ch - 64];
-    else
-      return g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
+	if (TRACE_OPS) printf("g_pinnum: %s\n", debug_dasm());
+	switch ((ch = *g_proc++))
+	{
+		case 0xab:  /* internal node */
+			ch = *g_proc++;
+			if (ch < 128)
+				return g_info->ppins[ch - 64];
+			else
+				return g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
 
-  case 0xb0:  /* high pin */
-    return g_pins[*g_proc++];
+		case 0xb0:  /* high pin */
+			return g_pins[*g_proc++];
 
-  case16(0xc0):  /* pin */
-  case16(0xd0):
-    return g_pins[ch & 0x1f];
+			case16(0xc0):  /* pin */
+				case16(0xd0):
+					return g_pins[ch & 0x1f];
 
-  default:  /* Undefined op codes */
-    return NULL;
+		default:  /* Undefined op codes */
+			return NULL;
 
-  }
+	}
 }
 
 
 static log_16_value g_expr()
 {
-  register uchar ch;
-  register nodeinfo *nip;
-
-  if (TRACE_OPS) printf("g_expr: %s\n", debug_dasm());
-  switch ((ch = *g_proc++)) {
-
-  case 0xa0:  /* AND */
-    ch = (int)g_expr();
-    return and_table[ch][(int)g_expr()];
-
-  case 0xa1:  /* NAND */
-    ch = (int)g_expr();
-    return nand_table[ch][(int)g_expr()];
-
-  case 0xa2:  /* OR */
-    ch = (int)g_expr();
-    return or_table[ch][(int)g_expr()];
-
-  case 0xa3:  /* NOR */
-    ch = (int)g_expr();
-    return nor_table[ch][(int)g_expr()];
-
-  case 0xa4:  /* XOR */
-    ch = (int)g_expr();
-    return xor_table[ch][(int)g_expr()];
-
-  case 0xa5:  /* NOT */
-    return not_table[(int)g_expr()];
-
-  case 0xa6:  /* RISE */
-    nip = g_pinnum()->info;
-    return (nip->v == log_one && nip->v00 == log_zero) ? log_one : log_zero;
-
-  case 0xa7:  /* FALL */
-    nip = g_pinnum()->info;
-    return (nip->v == log_zero && nip->v00 == log_one) ? log_one : log_zero;
-
-  case 0xa8:  /* ZERO */
-    return log_zero;
-
-  case 0xa9:  /* ONE */
-    return log_one;
-
-  case 0xaa:  /* SAME */
-    nip = g_pinnum()->info;
-    return (g_pinnum()->info == nip) ? log_one : log_zero;
-
-  case 0xab:  /* internal node */
-    ch = *g_proc++;
-    if (ch < 128)
-      nip = g_info->ppins[ch - 64]->info;
-    else
-      nip = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)]->info;
-    return nip->v;
-
-  case 0xac:  /* pvar */
-    ch = *g_proc++;
-    if (ch < 128)
-      return g_info->pvars[ch - 64] ? log_one : log_zero;
-    else
-      return g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)]
-	? log_one : log_zero;
-
-  case 0xad:  /* FIX */
-    return fix_table[(int)g_expr()];
-    
-  case 0xb0:  /* high pin */
-    nip = g_pins[*g_proc++]->info;
-    if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
-    return nip->v;
-
-  case 0xb1:  /* STRONG */
-    nip = g_pinnum()->info;
-    return nip->truev;
-
-  case16(0xc0):  /* pin */
-  case16(0xd0):
-    nip = g_pins[ch & 0x1f]->info;
-    if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
-    return nip->v;
-
-  case16(0xe0):  /* var */
-    if (TRACE_VAL) printf(" Value of %c is %d\n",
-			  'A' + (ch % 0x0f),
-			  (g_vars & REGMASK(ch & 0x0f)) != 0);
-    return (g_vars & REGMASK(ch & 0x0f)) ? log_one : log_zero;
-
-  case16(0xf0):  /* NOT var */
-    if (TRACE_VAL) printf(" Value of %c is %d\n",
-			  'A' + (ch % 0x0f),
-			  (g_vars & REGMASK(ch & 0x0f)) != 0);
-    return (g_vars & REGMASK(ch & 0x0f)) ? log_zero : log_one;
-
-  default:  /* Undefined op codes */
-    return log_none;
-
-  }
+	register uchar ch;
+	register nodeinfo *nip;
+
+	if (TRACE_OPS) printf("g_expr: %s\n", debug_dasm());
+	switch ((ch = *g_proc++))
+	{
+		case 0xa0:  /* AND */
+			ch = (int)g_expr();
+			return and_table[ch][(int)g_expr()];
+
+		case 0xa1:  /* NAND */
+			ch = (int)g_expr();
+			return nand_table[ch][(int)g_expr()];
+
+		case 0xa2:  /* OR */
+			ch = (int)g_expr();
+			return or_table[ch][(int)g_expr()];
+
+		case 0xa3:  /* NOR */
+			ch = (int)g_expr();
+			return nor_table[ch][(int)g_expr()];
+
+		case 0xa4:  /* XOR */
+			ch = (int)g_expr();
+			return xor_table[ch][(int)g_expr()];
+
+		case 0xa5:  /* NOT */
+			return not_table[(int)g_expr()];
+
+		case 0xa6:  /* RISE */
+			nip = g_pinnum()->info;
+			return (nip->v == log_one && nip->v00 == log_zero) ? log_one : log_zero;
+
+		case 0xa7:  /* FALL */
+			nip = g_pinnum()->info;
+			return (nip->v == log_zero && nip->v00 == log_one) ? log_one : log_zero;
+
+		case 0xa8:  /* ZERO */
+			return log_zero;
+
+		case 0xa9:  /* ONE */
+			return log_one;
+
+		case 0xaa:  /* SAME */
+			nip = g_pinnum()->info;
+			return (g_pinnum()->info == nip) ? log_one : log_zero;
+
+		case 0xab:  /* internal node */
+			ch = *g_proc++;
+			if (ch < 128)
+				nip = g_info->ppins[ch - 64]->info;
+			else
+				nip = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)]->info;
+			return nip->v;
+
+		case 0xac:  /* pvar */
+			ch = *g_proc++;
+			if (ch < 128)
+				return g_info->pvars[ch - 64] ? log_one : log_zero;
+			else
+				return g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)]
+					? log_one : log_zero;
+
+		case 0xad:  /* FIX */
+			return fix_table[(int)g_expr()];
+
+		case 0xb0:  /* high pin */
+			nip = g_pins[*g_proc++]->info;
+			if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
+			return nip->v;
+
+		case 0xb1:  /* STRONG */
+			nip = g_pinnum()->info;
+			return nip->truev;
+
+			case16(0xc0):  /* pin */
+				case16(0xd0):
+					nip = g_pins[ch & 0x1f]->info;
+			if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
+			return nip->v;
+
+			case16(0xe0):  /* var */
+				if (TRACE_VAL) printf(" Value of %c is %d\n",
+						'A' + (ch % 0x0f),
+						(g_vars & REGMASK(ch & 0x0f)) != 0);
+			return (g_vars & REGMASK(ch & 0x0f)) ? log_one : log_zero;
+
+			case16(0xf0):  /* NOT var */
+				if (TRACE_VAL) printf(" Value of %c is %d\n",
+						'A' + (ch % 0x0f),
+						(g_vars & REGMASK(ch & 0x0f)) != 0);
+			return (g_vars & REGMASK(ch & 0x0f)) ? log_zero : log_one;
+
+		default:  /* Undefined op codes */
+			return log_none;
+
+	}
 }
 
 
 static void g_stmts()
 {
-  register uchar ch, ch2;
-  register int temp;
-  register log_nrec *np;
-  register nodeinfo *nip;
-
-  for (;;) {
-    if (TRACE_OPS) printf("g_stmts: %s\n", debug_dasm());
-    switch ((ch = *g_proc++)) {
-
-    case 0x00:  /* end-of-procedure */
-      return;
-
-    case 0x01:  /* NOP */
-      break;
-
-    case 0x02:	/* END (of IF statement) */
-      break;
-
-    case 0x03:	/* IF */
-      if (g_expr() != log_zero)
-	break;
-
-      /* fall through */
-    case 0x09: case 0x0a: case 0x0b:
-    case 0x0c: case 0x0d: case 0x0e:
-    case 0x0f:  /* ELSE */
-    if_skip:
-      if (TRACE_OPS) printf("Skipping...\n");
-      temp = 0;
-      for (;;) {
-	while (*g_proc++ > 0x0f) ;
-	ch = g_proc[-1];
-	if (ch == 0x02) {   /* END */
-	  if (--temp < 0)
-	    break;
-	} else if (ch == 0x0f)	{   /* ELSE */
-	  if (!temp)
-	    break;
-	} else if (ch > 0x02) {   /* nested IF */
-	  temp++;
-	} else if (ch == 0) {
-	  return;   /* mismatched IF/END's */
+	register uchar ch, ch2;
+	register int temp;
+	register log_nrec *np;
+	register nodeinfo *nip;
+
+	for (;;)
+	{
+		if (TRACE_OPS) printf("g_stmts: %s\n", debug_dasm());
+		switch ((ch = *g_proc++))
+		{
+			case 0x00:  /* end-of-procedure */
+				return;
+
+			case 0x01:  /* NOP */
+				break;
+
+			case 0x02:	/* END (of IF statement) */
+				break;
+
+			case 0x03:	/* IF */
+				if (g_expr() != log_zero)
+					break;
+
+				/* fall through */
+			case 0x09: case 0x0a: case 0x0b:
+			case 0x0c: case 0x0d: case 0x0e:
+			case 0x0f:  /* ELSE */
+if_skip:
+				if (TRACE_OPS) printf("Skipping...\n");
+				temp = 0;
+				for (;;)
+				{
+					while (*g_proc++ > 0x0f) ;
+					ch = g_proc[-1];
+					if (ch == 0x02) {   /* END */
+						if (--temp < 0)
+							break;
+					}
+					else if (ch == 0x0f)	{   /* ELSE */
+						if (!temp)
+							break;
+					}
+					else if (ch > 0x02) {   /* nested IF */
+						temp++;
+					}
+					else if (ch == 0)
+					{
+						return;   /* mismatched IF/END's */
+					}
+				}
+				break;
+
+			case 0x04:	/* IFNONE */
+				if (g_expr() == log_none)
+					break;
+				goto if_skip;
+
+			case 0x05:	/* IFZERO */
+				if (g_expr() == log_zero)
+					break;
+				goto if_skip;
+
+			case 0x06:	/* IFONE */
+				if (g_expr() == log_one)
+					break;
+				goto if_skip;
+
+			case 0x07:	/* IFCONN */
+				if (g_expr() != log_none)
+					break;
+				goto if_skip;
+
+			case 0x08:	/* IFZN */
+				if (g_expr() != log_one)
+					break;
+				goto if_skip;
+
+			case 0x10:  /* Output to internal node */
+				ch = *g_proc++;
+				if (ch < 128)
+					np = g_info->ppins[ch - 64];
+				else
+					np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
+				goto out_node;
+
+			case 0x11:  /* O.C. output to internal node */
+				ch = *g_proc++;
+				if (ch < 128)
+					np = g_info->ppins[ch - 64];
+				else
+					np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
+				goto oc_out_node;
+
+			case 0x12:	/* CALL */
+				g_gate->vars = (na_long)g_vars;
+				logsima_action.lact->actgate = g_gate;
+				processcall(act_16_sim);
+				g_vars = (long)g_gate->vars;
+				break;
+
+			case 0x16:	/* Comment */
+				g_proc += *g_proc - 31;
+				break;
+
+			case 0x17:	/* INST */
+				g_proc += *g_proc - 33;
+				break;
+
+			case 0x18:  /* pvar = x */
+				ch = *g_proc++;
+				if (ch < 128)
+					g_info->pvars[ch - 64] = (g_expr() != log_zero);
+				else {
+					ch2 = *g_proc++;
+					g_info->pvars[ch + (ch2 << 7) - (32*128+64)] =
+						(g_expr() != log_zero);
+				}
+				break;
+
+			case 0x19:  /* pvar = NOT pvar */
+				ch = *g_proc++;
+				if (ch < 128)
+					g_info->pvars[ch - 64] ^= 1;
+				else
+					g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] ^= 1;
+				break;
+
+			case 0x1a:  /* pvar = ZERO */
+				ch = *g_proc++;
+				if (ch < 128)
+					g_info->pvars[ch - 64] = 0;
+				else
+					g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 0;
+				break;
+
+			case 0x1b:  /* pvar = ONE */
+				ch = *g_proc++;
+				if (ch < 128)
+					g_info->pvars[ch - 64] = 1;
+				else
+					g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 1;
+				break;
+
+			case 0x1c:  /* PULLDN */
+				np = g_pinnum();
+				nip = np->info;
+				if (nip->defv == log_one)
+					record_conflict(np);
+				else
+					nip->defv = log_zero;
+				break;
+
+			case 0x1d:  /* PULLUP */
+				np = g_pinnum();
+				nip = np->info;
+				if (nip->defv == log_zero)
+					record_conflict(np);
+				else
+					nip->defv = log_one;
+				break;
+
+			case 0x1e:  /* Output to high pin */
+				np = g_pins[*g_proc++];
+				goto out_node;
+
+			case 0x1f:  /* O.C. output to high pin */
+				np = g_pins[*g_proc++];
+				goto oc_out_node;
+
+				case16(0x20):  /* Output to pin */
+					case16(0x30):
+						np = g_pins[ch & 0x1f];
+
+out_node:
+				switch (g_expr())
+				{
+					case log_zero:
+						nip = np->info;
+						if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
+						if (nip->v0 == log_one)
+							record_conflict(np);
+						else
+							nip->v0 = log_zero;
+						break;
+
+					case log_one:
+						nip = np->info;
+						if (TRACE_VAL) printf(" Output 1 to %x (was %d)\n", (unsigned int)nip, nip->v0);
+						if (nip->v0 == log_zero)
+							record_conflict(np);
+						else
+							nip->v0 = log_one;
+						break;
+
+					default:
+						break;
+				}
+				break;
+
+				case16(0x40):  /* O.C. output to pin */
+					case16(0x50):
+						np = g_pins[ch & 0x1f];
+
+oc_out_node:
+				if (g_expr() == log_zero)
+				{
+					nip = np->info;
+					if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
+					if (nip->v0 == log_one)
+						record_conflict(np);
+					else
+						nip->v0 = log_zero;
+					break;
+				}
+				break;
+
+			case16(0x60):  /* var = x */
+				if (g_expr() != log_zero)
+				{
+					if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
+					g_vars |= REGMASK(ch & 0x0f);
+				}
+				else
+				{
+					if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
+					g_vars &= ~REGMASK(ch & 0x0f);
+				}
+				break;
+
+			case16(0x70):  /* var = NOT var */
+				g_vars ^= REGMASK(ch & 0x0f);
+				if (TRACE_VAL) printf(" Store %d in %c\n",
+					((g_vars & REGMASK(ch & 0x0f)) != 0),
+					'A' + (ch % 0x0f));
+				break;
+
+			case16(0x80):  /* var = ZERO */
+				if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
+				g_vars &= ~REGMASK(ch & 0x0f);
+				break;
+
+			case16(0x90):  /* var = ONE */
+				if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
+				g_vars |= REGMASK(ch & 0x0f);
+				break;
+
+			default:  /* Undefined op codes: ignore */
+				break;
+
+		}
 	}
-      }
-      break;
-
-    case 0x04:	/* IFNONE */
-      if (g_expr() == log_none)
-	break;
-      goto if_skip;
-
-    case 0x05:	/* IFZERO */
-      if (g_expr() == log_zero)
-	break;
-      goto if_skip;
-
-    case 0x06:	/* IFONE */
-      if (g_expr() == log_one)
-	break;
-      goto if_skip;
-
-    case 0x07:	/* IFCONN */
-      if (g_expr() != log_none)
-	break;
-      goto if_skip;
-
-    case 0x08:	/* IFZN */
-      if (g_expr() != log_one)
-	break;
-      goto if_skip;
-
-    case 0x10:  /* Output to internal node */
-      ch = *g_proc++;
-      if (ch < 128)
-	np = g_info->ppins[ch - 64];
-      else
-	np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
-      goto out_node;
-
-    case 0x11:  /* O.C. output to internal node */
-      ch = *g_proc++;
-      if (ch < 128)
-	np = g_info->ppins[ch - 64];
-      else
-	np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
-      goto oc_out_node;
-
-    case 0x12:	/* CALL */
-      g_gate->vars = (na_long)g_vars;
-      logsima_action.lact->actgate = g_gate;
-      processcall(act_16_sim);
-      g_vars = (long)g_gate->vars;
-      break;
-
-    case 0x16:	/* Comment */
-      g_proc += *g_proc - 31;
-      break;
-
-    case 0x17:	/* INST */
-      g_proc += *g_proc - 33;
-      break;
-
-    case 0x18:  /* pvar = x */
-      ch = *g_proc++;
-      if (ch < 128)
-	g_info->pvars[ch - 64] = (g_expr() != log_zero);
-      else {
-	ch2 = *g_proc++;
-	g_info->pvars[ch + (ch2 << 7) - (32*128+64)] =
-	  (g_expr() != log_zero);
-      }
-      break;
-
-    case 0x19:  /* pvar = NOT pvar */
-      ch = *g_proc++;
-      if (ch < 128)
-	g_info->pvars[ch - 64] ^= 1;
-      else
-	g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] ^= 1;
-      break;
-
-    case 0x1a:  /* pvar = ZERO */
-      ch = *g_proc++;
-      if (ch < 128)
-	g_info->pvars[ch - 64] = 0;
-      else
-	g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 0;
-      break;
-
-    case 0x1b:  /* pvar = ONE */
-      ch = *g_proc++;
-      if (ch < 128)
-	g_info->pvars[ch - 64] = 1;
-      else
-	g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 1;
-      break;
-
-    case 0x1c:  /* PULLDN */
-      np = g_pinnum();
-      nip = np->info;
-      if (nip->defv == log_one)
-	record_conflict(np);
-      else
-	nip->defv = log_zero;
-      break;
-
-    case 0x1d:  /* PULLUP */
-      np = g_pinnum();
-      nip = np->info;
-      if (nip->defv == log_zero)
-	record_conflict(np);
-      else
-	nip->defv = log_one;
-      break;
-
-    case 0x1e:  /* Output to high pin */
-      np = g_pins[*g_proc++];
-      goto out_node;
-
-    case 0x1f:  /* O.C. output to high pin */
-      np = g_pins[*g_proc++];
-      goto oc_out_node;
-
-    case16(0x20):  /* Output to pin */
-    case16(0x30):
-      np = g_pins[ch & 0x1f];
-      
-    out_node:
-      switch (g_expr()) {
-
-      case log_zero:
-	nip = np->info;
-	if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
-	if (nip->v0 == log_one)
-	  record_conflict(np);
-	else
-	  nip->v0 = log_zero;
-	break;
-
-      case log_one:
-	nip = np->info;
-	if (TRACE_VAL) printf(" Output 1 to %x (was %d)\n", (unsigned int)nip, nip->v0);
-	if (nip->v0 == log_zero)
-	  record_conflict(np);
-	else
-	  nip->v0 = log_one;
-	break;
-
-      default:
-	break;
-      }
-      break;
-
-    case16(0x40):  /* O.C. output to pin */
-    case16(0x50):
-      np = g_pins[ch & 0x1f];
-      
-    oc_out_node:
-      if (g_expr() == log_zero) {
-	nip = np->info;
-	if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
-	if (nip->v0 == log_one)
-	  record_conflict(np);
-	else
-	  nip->v0 = log_zero;
-	break;
-      }
-      break;
-
-    case16(0x60):  /* var = x */
-      if (g_expr() != log_zero) {
-	if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
-	g_vars |= REGMASK(ch & 0x0f);
-      } else {
-	if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
-	g_vars &= ~REGMASK(ch & 0x0f);
-      }
-      break;
-
-    case16(0x70):  /* var = NOT var */
-      g_vars ^= REGMASK(ch & 0x0f);
-      if (TRACE_VAL) printf(" Store %d in %c\n",
-			    ((g_vars & REGMASK(ch & 0x0f)) != 0),
-			    'A' + (ch % 0x0f));
-      break;
-
-    case16(0x80):  /* var = ZERO */
-      if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
-      g_vars &= ~REGMASK(ch & 0x0f);
-      break;
-
-    case16(0x90):  /* var = ONE */
-      if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
-      g_vars |= REGMASK(ch & 0x0f);
-      break;
-
-    default:  /* Undefined op codes: ignore */
-      break;
-
-    }
-  }
 }
 
 
-void executeprog(pr, pins, ginfo, vars)
-uchar *pr;
-log_nrec **pins;
-gateinfo *ginfo;
-na_long *vars;
+void executeprog(uchar *pr, log_nrec **pins, gateinfo *ginfo, na_long *vars)
 {
-
-  uchar *s_proc = g_proc;
-  long s_vars = g_vars;
-  log_nrec **s_pins = g_pins;
-  gateinfo *s_info = g_info;
-
-  g_proc = pr;
-  g_pins = pins;
-  g_info = ginfo;
-  g_vars = (long)(*vars);
-  g_stmts();
-  *vars = (na_long)g_vars;
-
-  g_proc = s_proc;
-  g_pins = s_pins;
-  g_info = s_info;
-  g_vars = s_vars;
-
-
+	uchar *s_proc = g_proc;
+	long s_vars = g_vars;
+	log_nrec **s_pins = g_pins;
+	gateinfo *s_info = g_info;
+
+	g_proc = pr;
+	g_pins = pins;
+	g_info = ginfo;
+	g_vars = (long)(*vars);
+	g_stmts();
+	*vars = (na_long)g_vars;
+
+	g_proc = s_proc;
+	g_pins = s_pins;
+	g_info = s_info;
+	g_vars = s_vars;
 }
 
 
-void executegates(active, g)
-int *active;
-register log_grec *g;
+void executegates(int *active, log_grec *g)
 {
-  register log_tool *tool16 = logsima_action.lact->acttool;
-
-  while (g && g->kind->simtype != tool16)
-    g = g->next;
-  if (!g)
-    return;
-  if (TRACE_COPY) printf("\n");
-  *active = true;
-
-  while (g) {
-    if (g->kind->simtype == tool16) {
-      if (TRACE_GATES) printf("\nexecutegates: %s\n", g->kind->name);
-      g_proc = g->kind->proc;
-      g_pins = g->pin;
-      g_gate = g;
-      g_info = g->info;
-      g_vars = (long)g->vars;
-      g_stmts();
-      g->vars = (na_long)g_vars;
-    }
-    g = g->next;
-  }
+	register log_tool *tool16 = logsima_action.lact->acttool;
+
+	while (g && g->kind->simtype != tool16)
+		g = g->next;
+	if (!g)
+		return;
+	if (TRACE_COPY) printf("\n");
+	*active = true;
+
+	while (g)
+	{
+		if (g->kind->simtype == tool16)
+		{
+			if (TRACE_GATES) printf("\nexecutegates: %s\n", g->kind->name);
+			g_proc = g->kind->proc;
+			g_pins = g->pin;
+			g_gate = g;
+			g_info = g->info;
+			g_vars = (long)g->vars;
+			g_stmts();
+			g->vars = (na_long)g_vars;
+		}
+		g = g->next;
+	}
 
 }
+
diff --git a/log/src/logsimh.c b/log/src/logsimh.c
index dc9c282..2054386 100644
--- a/log/src/logsimh.c
+++ b/log/src/logsimh.c
@@ -11,28 +11,28 @@
    Copyright (C) 1985, 1990 John Lazzaro.
    Author's address: lazzaro@csvax.caltech.edu; 256-80 Caltech.
 
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation (any version).
+   This program is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation (any version).
 
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-GNU General Public License for more details.
+   This program is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
 
-You should have received a copy of the GNU General Public License
-along with this program; see the file COPYING.  If not, write to
-the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+   You should have received a copy of the GNU General Public License
+   along with this program; see the file COPYING.  If not, write to
+   the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
 
 
 /* caged_process='newcom -g $B$M'
 
-      LOG 4.1   Hierarchical digital logic simulation routines
+   LOG 4.1   Hierarchical digital logic simulation routines
 
-      David Gillespie  7/18/88
+   David Gillespie  7/18/88
 
-      The following module is subject to change at any time.
-*/
+   The following module is subject to change at any time.
+   */
 
 #include <string.h>
 #include <p2c/p2c.h>
@@ -48,67 +48,68 @@ the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
 
 
 typedef enum {
-  dump_none, dump_dump, dump_big, dump_write
+	dump_none, dump_dump, dump_big, dump_write
 } dumpmodes;
+
 typedef enum {
-  opt_always, opt_dump, opt_request
+	opt_always, opt_dump, opt_request
 } optmodes;
 
 typedef struct instinfo {
-  int attrchg, okay, wasokay;
-  struct hdefrec *hdef;
-  long hdefstamp, clearstamp, oldnetstamp, numpins, numppins, numpvars;
-  log_nrec **pins;
-  gateinfo ginfo;
-  long recstamp, oldattrstamp;
-  short instattr, nameattr, dispattr;
-  char *wasdrawn;
+	int attrchg, okay, wasokay;
+	struct hdefrec *hdef;
+	long hdefstamp, clearstamp, oldnetstamp, numpins, numppins, numpvars;
+	log_nrec **pins;
+	gateinfo ginfo;
+	long recstamp, oldattrstamp;
+	short instattr, nameattr, dispattr;
+	char *wasdrawn;
 } instinfo;
 
 typedef struct controlinfo {
-  struct hdefrec *hdef;
-  short pgnum;
-  char message[81], oldmessage[81], message2[81], oldmessage2[81];
-  int welcomeflag;
-  short oldoptcolor, olddumpcolor;
-  dumpmodes olddumpmode;
+	struct hdefrec *hdef;
+	short pgnum;
+	char message[81], oldmessage[81], message2[81], oldmessage2[81];
+	int welcomeflag;
+	short oldoptcolor, olddumpcolor;
+	dumpmodes olddumpmode;
 } controlinfo;
 
 typedef struct pdrec {
-  int isinput, isoutput;
+	int isinput, isoutput;
 } pdrec;
 
 typedef pdrec pdarray[log_million];
 
 typedef struct hdefrec {
-  char *name;
-  struct hdefrec *next;
-  short pgnum;
-  long oldlabelstamp, oldboxstamp, oldpagestamp, curstamp, clearstamp,
-       oldshowstamp;
-  int defined_;
-  log_brec *defbox;
-  log_regrec *defreg;
-  log_grec *gtempl, *gcontrol;
-  struct dependrec *depends;
-  uchar *proc;
-  long proclen;
-  pdrec *pindata;
-  long lastnorth, lasteast, lastsouth, numports;
-      /*north<=south<=west<=numports*/
-  long numppins, numpvars;
-  int wantnote, wantstats;
-  short optlevel;
-  int optflag, nextoptflag, dumphighlight, optdelay;
-  dumpmodes dumpmode;
-  optmodes optmode;
-  char *writefile;
+	char *name;
+	struct hdefrec *next;
+	short pgnum;
+	long oldlabelstamp, oldboxstamp, oldpagestamp, curstamp, clearstamp,
+		 oldshowstamp;
+	int defined_;
+	log_brec *defbox;
+	log_regrec *defreg;
+	log_grec *gtempl, *gcontrol;
+	struct dependrec *depends;
+	uchar *proc;
+	long proclen;
+	pdrec *pindata;
+	long lastnorth, lasteast, lastsouth, numports;
+	/*north<=south<=west<=numports*/
+	long numppins, numpvars;
+	int wantnote, wantstats;
+	short optlevel;
+	int optflag, nextoptflag, dumphighlight, optdelay;
+	dumpmodes dumpmode;
+	optmodes optmode;
+	char *writefile;
 } hdefrec;
 
 typedef struct dependrec {
-  hdefrec *hdef;
-  long hdefstamp;
-  struct dependrec *next;
+	hdefrec *hdef;
+	long hdefstamp;
+	struct dependrec *next;
 } dependrec;
 
 /*if(cond,then,else)*/
@@ -119,29 +120,29 @@ typedef struct dependrec {
 /*rise(val)*/
 /*zero()*/
 typedef enum {
-  op_if, op_ifnone, op_ifzero, op_ifone, op_ifconn, op_ifzn, op_pineq,
-  op_pinoc, op_vareq, op_pullup, op_pulldn, op_iftrue, op_iffalse, op_and,
-  op_nand, op_or, op_nor, op_xor, op_same, op_rise, op_fall, op_not, op_fix0,
-  op_strong, op_zero, op_one, op_pin, op_pinref, op_var, op_none, op_fix1,
-  op_alwaysconn
+	op_if, op_ifnone, op_ifzero, op_ifone, op_ifconn, op_ifzn, op_pineq,
+	op_pinoc, op_vareq, op_pullup, op_pulldn, op_iftrue, op_iffalse, op_and,
+	op_nand, op_or, op_nor, op_xor, op_same, op_rise, op_fall, op_not, op_fix0,
+	op_strong, op_zero, op_one, op_pin, op_pinref, op_var, op_none, op_fix1,
+	op_alwaysconn
 } instrops;   /*for internal use*/
 
 typedef struct instrrec {
-  instrops opcode;
-  short ival;
-  union {
-    struct {
-      struct instrrec *arg1, *arg2, *arg3, *next;
-    } U1;
-    struct instrrec *args[4];
-  } UU;
+	instrops opcode;
+	short ival;
+	union {
+		struct {
+			struct instrrec *arg1, *arg2, *arg3, *next;
+		} U1;
+		struct instrrec *args[4];
+	} UU;
 } instrrec;
 
 typedef log_16_value unarytype[3];
 
 
 static const unarytype unarynot = {
-  log_none, log_one, log_zero
+	log_none, log_one, log_zero
 };
 
 
@@ -159,52 +160,46 @@ static hdefrec *hdefbase;
 
 
 
+static short findgattr(log_grec *g, char *name, char *kinds, short def)
+{
+	na_strlist_t *l1;
 
+	l1 = g->kind->lbl;
+	while (l1 != NULL && l1->kind != '\001')
+		l1 = l1->next;
 
+	if (l1 != NULL)
+		l1 = strlist_find((na_strlist_t *)l1->value, name);
 
-static short findgattr(g, name, kinds, def)
-log_grec *g;
-char *name, *kinds;
-short def;
-{
-  na_strlist_t *l1;
-
-  l1 = g->kind->lbl;
-  while (l1 != NULL && l1->kind != '\001')
-    l1 = l1->next;
-  if (l1 != NULL)
-    l1 = strlist_find((na_strlist_t *)l1->value, name);
-  if (l1 != NULL &&
-      strposc(kinds, g->kind->attr[(long)l1->value - 1].dtype, 1L) != 0)
-    return ((long)l1->value);
-  else if (def >= 1 && def <= g->kind->numattrs &&
-	   strposc(kinds, g->kind->attr[def - 1].dtype, 1L) != 0)
-    return def;
-  else
-    return 0;
+	if (l1 != NULL &&
+			strposc(kinds, g->kind->attr[(long)l1->value - 1].dtype, 1L) != 0)
+		return ((long)l1->value);
+	else if (def >= 1 && def <= g->kind->numattrs &&
+			strposc(kinds, g->kind->attr[def - 1].dtype, 1L) != 0)
+		return def;
+	else
+		return 0;
 }
 
 
 
-static char *namegattr(Result, g, i)
-char *Result;
-log_grec *g;
-short i;
+static char *namegattr(char *Result, log_grec *g, short i)
 {
-  na_strlist_t *l1;
-
-  l1 = g->kind->lbl;
-  while (l1 != NULL && l1->kind != '\001')
-    l1 = l1->next;
-  if (l1 != NULL) {
-    l1 = (na_strlist_t *)l1->value;
-    while (l1 != NULL && (long)l1->value != i)
-      l1 = l1->next;
-  }
-  if (l1 != NULL)
-    return strcpy(Result, l1->s);
-  else
-    return strcpy(Result, "");
+	na_strlist_t *l1;
+
+	l1 = g->kind->lbl;
+	while (l1 != NULL && l1->kind != '\001')
+		l1 = l1->next;
+	if (l1 != NULL)
+	{
+		l1 = (na_strlist_t *)l1->value;
+		while (l1 != NULL && (long)l1->value != i)
+			l1 = l1->next;
+	}
+	if (l1 != NULL)
+		return strcpy(Result, l1->s);
+	else
+		return strcpy(Result, "");
 }
 
 
@@ -217,106 +212,122 @@ short i;
 
 
 
-static void refrcontrol(g, force)
-log_grec *g;
-short force;
+static void refrcontrol(log_grec *g, short force)
 {
-  hdefrec *hdef;
-  short showx, showy;
-  controlinfo *cip;
-  dumpmodes newdumpmode;
-  short newoptcolor, newdumpcolor;
-  log_action_t *WITH;
-  controlinfo *WITH1;
-
-  WITH = logsima_action.lact;
-  if (g == NULL)
-    return;
-  cip = (controlinfo *)g->info;
-  hdef = cip->hdef;
-  WITH1 = cip;
-  if (WITH1->pgnum != WITH->showpage)
-    return;
-  if (WITH1->hdef == NULL || !WITH1->hdef->defined_) {
-    newoptcolor = darkwordcolor;
-    newdumpcolor = darkwordcolor;
-    newdumpmode = dump_none;
-  } else {
-    if (WITH1->hdef->optflag)
-      newoptcolor = WITH->color.selword;
-    else
-      newoptcolor = WITH->color.menuword;
-    if (WITH1->hdef->dumphighlight)
-      newdumpcolor = WITH->color.selword;
-    else if ((long)WITH1->hdef->dumpmode >= (long)dump_dump &&
-	     (WITH1->hdef->dumpmode != dump_write ||
-	      *WITH1->hdef->writefile != '\0'))
-      newdumpcolor = WITH->color.menuword;
-    else
-      newdumpcolor = darkwordcolor;
-    newdumpmode = WITH1->hdef->dumpmode;
-  }
-  if (WITH1->hdef == NULL) {
-    if (WITH1->welcomeflag)
-      strcpy(WITH1->message, "Welcome to Digital LOG");
-    else
-      strcpy(WITH1->message, "Not in a definition");
-    *WITH1->message2 = '\0';
-  } else
-    WITH1->welcomeflag = false;
-  if (newoptcolor != WITH1->oldoptcolor || force != 0) {
-    showx = 0;
-    showy = optlevely;
-    (*WITH->hook.xform)(g, &showx, &showy);
-    (*WITH->hook.hidecursor)();
-    if (force < 0)
-      m_color((long)WITH->color.backgr);
-    else
-      m_color((long)newoptcolor);
-    m_centerstr((long)showx, showy - 4L, NULL, "Optimize");
-    (*WITH->hook.unhidecursor)();
-    WITH1->oldoptcolor = newoptcolor;
-  }
-  if (newdumpmode != WITH1->olddumpmode ||
-      newdumpcolor != WITH1->olddumpcolor || force != 0) {
-    showx = 0;
-    showy = dumpmodey;
-    (*WITH->hook.xform)(g, &showx, &showy);
-    (*WITH->hook.hidecursor)();
-    m_color((long)WITH->color.backgr);
-    if (WITH1->olddumpmode == dump_write)
-      m_centerstr((long)showx, showy - 4L, NULL, "Write");
-    else
-      m_centerstr((long)showx, showy - 4L, NULL, "Dump");
-    if (force >= 0) {
-      m_color((long)newdumpcolor);
-      if (newdumpmode == dump_write)
-	m_centerstr((long)showx, showy - 4L, NULL, "Write");
-      else
-	m_centerstr((long)showx, showy - 4L, NULL, "Dump");
-    }
-    (*WITH->hook.unhidecursor)();
-    WITH1->olddumpmode = newdumpmode;
-    WITH1->olddumpcolor = newdumpcolor;
-  }
-  if (!strcmp(WITH1->message, WITH1->oldmessage) &&
-      !strcmp(WITH1->message2, WITH1->oldmessage2) && force == 0)
-    return;
-  showx = 0;
-  showy = messagey;
-  (*WITH->hook.xform)(g, &showx, &showy);
-  (*WITH->hook.hidecursor)();
-  m_color((long)WITH->color.backgr);
-  m_centerstr((long)showx, showy - 4L, NULL, WITH1->oldmessage);
-  m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->oldmessage2);
-  if (force >= 0) {
-    m_color((long)WITH->color.message);
-    m_centerstr((long)showx, showy - 4L, NULL, WITH1->message);
-    m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->message2);
-  }
-  (*WITH->hook.unhidecursor)();
-  strcpy(WITH1->oldmessage, WITH1->message);
-  strcpy(WITH1->oldmessage2, WITH1->message2);
+	hdefrec *hdef;
+	short showx, showy;
+	controlinfo *cip;
+	dumpmodes newdumpmode;
+	short newoptcolor, newdumpcolor;
+	log_action_t *WITH;
+	controlinfo *WITH1;
+
+	WITH = logsima_action.lact;
+	if (g == NULL)
+		return;
+	cip = (controlinfo *)g->info;
+	hdef = cip->hdef;
+	WITH1 = cip;
+	if (WITH1->pgnum != WITH->showpage)
+		return;
+	if (WITH1->hdef == NULL || !WITH1->hdef->defined_)
+	{
+		newoptcolor = darkwordcolor;
+		newdumpcolor = darkwordcolor;
+		newdumpmode = dump_none;
+	}
+	else
+	{
+		if (WITH1->hdef->optflag)
+			newoptcolor = WITH->color.selword;
+		else
+			newoptcolor = WITH->color.menuword;
+		if (WITH1->hdef->dumphighlight)
+			newdumpcolor = WITH->color.selword;
+		else if ((long)WITH1->hdef->dumpmode >= (long)dump_dump &&
+				(WITH1->hdef->dumpmode != dump_write ||
+				 *WITH1->hdef->writefile != '\0'))
+			newdumpcolor = WITH->color.menuword;
+		else
+			newdumpcolor = darkwordcolor;
+		newdumpmode = WITH1->hdef->dumpmode;
+	}
+
+	if (WITH1->hdef == NULL)
+	{
+		if (WITH1->welcomeflag)
+			strcpy(WITH1->message, "Welcome to Digital LOG");
+		else
+			strcpy(WITH1->message, "Not in a definition");
+		*WITH1->message2 = '\0';
+	}
+	else
+	{
+		WITH1->welcomeflag = false;
+	}
+
+	if (newoptcolor != WITH1->oldoptcolor || force != 0)
+	{
+		showx = 0;
+		showy = optlevely;
+		(*WITH->hook.xform)(g, &showx, &showy);
+		(*WITH->hook.hidecursor)();
+		if (force < 0)
+			m_color((long)WITH->color.backgr);
+		else
+			m_color((long)newoptcolor);
+		m_centerstr((long)showx, showy - 4L, NULL, "Optimize");
+		(*WITH->hook.unhidecursor)();
+		WITH1->oldoptcolor = newoptcolor;
+	}
+
+	if (newdumpmode != WITH1->olddumpmode ||
+			newdumpcolor != WITH1->olddumpcolor || force != 0)
+	{
+		showx = 0;
+		showy = dumpmodey;
+		(*WITH->hook.xform)(g, &showx, &showy);
+		(*WITH->hook.hidecursor)();
+		m_color((long)WITH->color.backgr);
+		if (WITH1->olddumpmode == dump_write)
+			m_centerstr((long)showx, showy - 4L, NULL, "Write");
+		else
+			m_centerstr((long)showx, showy - 4L, NULL, "Dump");
+		if (force >= 0)
+		{
+			m_color((long)newdumpcolor);
+			if (newdumpmode == dump_write)
+				m_centerstr((long)showx, showy - 4L, NULL, "Write");
+			else
+				m_centerstr((long)showx, showy - 4L, NULL, "Dump");
+		}
+		(*WITH->hook.unhidecursor)();
+		WITH1->olddumpmode = newdumpmode;
+		WITH1->olddumpcolor = newdumpcolor;
+	}
+
+	if (!strcmp(WITH1->message, WITH1->oldmessage) &&
+			!strcmp(WITH1->message2, WITH1->oldmessage2) && force == 0)
+		return;
+
+	showx = 0;
+	showy = messagey;
+	(*WITH->hook.xform)(g, &showx, &showy);
+	(*WITH->hook.hidecursor)();
+	m_color((long)WITH->color.backgr);
+	m_centerstr((long)showx, showy - 4L, NULL, WITH1->oldmessage);
+	m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->oldmessage2);
+
+	if (force >= 0)
+	{
+		m_color((long)WITH->color.message);
+		m_centerstr((long)showx, showy - 4L, NULL, WITH1->message);
+		m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->message2);
+	}
+
+	(*WITH->hook.unhidecursor)();
+	strcpy(WITH1->oldmessage, WITH1->message);
+	strcpy(WITH1->oldmessage2, WITH1->message2);
 }
 
 #undef optlevely
@@ -325,375 +336,389 @@ short force;
 #undef messagespc
 
 
-static void showcontrol(hdef, msg)
-hdefrec *hdef;
-char *msg;
+static void showcontrol(hdefrec *hdef, char *msg)
 {
-  controlinfo *cip;
-  long i, j, limit;
-  log_action_t *WITH;
-
-  WITH = logsima_action.lact;
-  if (hdef->gcontrol == NULL)
-    return;
-  cip = (controlinfo *)hdef->gcontrol->info;
-  if (strlen(msg) > 30) {
-    limit = strlen(msg) / 2;
-    i = strposb(msg, " ", limit);
-    j = strposc(msg, ' ', limit);
-    if (i == 0)
-      i = j;
-    else if (i > 0 && limit - i > j - limit)
-      i = j;
-    if (i == 0 || i > 80) {
-      sprintf(cip->message, "%.80s", msg);
-      strsub(cip->message2, msg, 81, 80);
-    } else {
-      sprintf(cip->message, "%.*s", (int)(i - 1), msg);
-      strsub(cip->message2, msg, (int)(i + 1), 80);
-    }
-  } else {
-    strcpy(cip->message, msg);
-    *cip->message2 = '\0';
-  }
-  /*    call(hook.message, 'Showcontrol of "' + msg + '"');   {****/
-  /*    call(hook.message, 'Broken into "' + cip^.message + '" and "' +     {****/
-  /*                                         cip^.message2 + '"');          {****/
-  refrcontrol(hdef->gcontrol, 0);
+	controlinfo *cip;
+	long i, j, limit;
+	log_action_t *WITH;
+
+	WITH = logsima_action.lact;
+	if (hdef->gcontrol == NULL)
+		return;
+	cip = (controlinfo *)hdef->gcontrol->info;
+	if (strlen(msg) > 30)
+	{
+		limit = strlen(msg) / 2;
+		i = strposb(msg, " ", limit);
+		j = strposc(msg, ' ', limit);
+		if (i == 0)
+			i = j;
+		else if (i > 0 && limit - i > j - limit)
+			i = j;
+
+		if (i == 0 || i > 80)
+		{
+			sprintf(cip->message, "%.80s", msg);
+			strsub(cip->message2, msg, 81, 80);
+		}
+		else
+		{
+			sprintf(cip->message, "%.*s", (int)(i - 1), msg);
+			strsub(cip->message2, msg, (int)(i + 1), 80);
+		}
+	}
+	else
+	{
+		strcpy(cip->message, msg);
+		*cip->message2 = '\0';
+	}
+	/*    call(hook.message, 'Showcontrol of "' + msg + '"');   {****/
+	/*    call(hook.message, 'Broken into "' + cip^.message + '" and "' +     {****/
+	/*                                         cip^.message2 + '"');          {****/
+	refrcontrol(hdef->gcontrol, 0);
 }
 
 
-static void showerrormsg(hdef, msg_)
-hdefrec *hdef;
-char *msg_;
+static void showerrormsg(hdefrec *hdef, char *msg_)
 {
-  char msg[256];
-  na_strlist_t *l1;
-
-  strcpy(msg, msg_);
-  if (logsima_action.lact->msgstamp != viserrorstamp) {
-    viserrorstamp = logsima_action.lact->msgstamp;
-    strlist_empty(&viserrors);
-  }
-  if (strlist_find(viserrors, msg) == NULL) {
-    l1 = strlist_append(&viserrors, msg);
-    (*logsima_action.lact->hook.message)(msg);
-  }
-  /* and (act.lact^.showpage > 0) */
-  if (hdef != NULL)
-    showcontrol(hdef, msg);
-}
-
+	char msg[256];
+	na_strlist_t *l1;
+
+	strcpy(msg, msg_);
+	if (logsima_action.lact->msgstamp != viserrorstamp)
+	{
+		viserrorstamp = logsima_action.lact->msgstamp;
+		strlist_empty(&viserrors);
+	}
 
+	if (strlist_find(viserrors, msg) == NULL)
+	{
+		l1 = strlist_append(&viserrors, msg);
+		(*logsima_action.lact->hook.message)(msg);
+	}
+	/* and (act.lact^.showpage > 0) */
+	if (hdef != NULL)
+		showcontrol(hdef, msg);
+}
 
 
-static void dasmhdef(f, hdef, incldef)
-FILE *f;
-hdefrec *hdef;
-int incldef;
+static void dasmhdef(FILE *f, hdefrec *hdef, int incldef)
 {
-  char *buf;
-  long pc, indent;
-
-  pc = 1;
-  indent = 0;
-  while (pc < hdef->proclen) {
-    if (incldef)
-      fprintf(f, "DEF ");
-    if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0x8004L) != 0)
-      indent -= 3;
-    if (indent > 0)
-      fprintf(f, "%*s", (int)indent, "");
-    if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0xfff8L) != 0)
-      indent += 3;
-    buf = dasm_16(hdef->proc, &pc);
-    fprintf(f, "%s\n", buf);
-    Free(buf);
-  }
-  if (hdef->proc[pc - 1] != '\0')
-    fprintf(f, "# Warning: terminator is not #0\n");
-  if (indent != 0)
-    fprintf(f, "# Warning: final indentation level was %ld\n", indent / 3);
-}
-
+	char *buf;
+	long pc, indent;
+
+	pc = 1;
+	indent = 0;
+	while (pc < hdef->proclen)
+	{
+		if (incldef)
+			fprintf(f, "DEF ");
+		if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0x8004L) != 0)
+			indent -= 3;
+		if (indent > 0)
+			fprintf(f, "%*s", (int)indent, "");
+		if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0xfff8L) != 0)
+			indent += 3;
+		buf = dasm_16(hdef->proc, &pc);
+		fprintf(f, "%s\n", buf);
+		Free(buf);
+	}
 
+	if (hdef->proc[pc - 1] != '\0')
+		fprintf(f, "# Warning: terminator is not #0\n");
 
+	if (indent != 0)
+		fprintf(f, "# Warning: final indentation level was %ld\n", indent / 3);
+}
 
 
-static hdefrec *findhdef(name, make)
-char *name;
-int make;
+static hdefrec *findhdef(char *name, int make)
 {
-  hdefrec *hdef;
-
-  if (*name == '\0')
-    return NULL;
-  else {
-    hdef = hdefbase;
-    while (hdef != NULL && strcicmp(name, hdef->name) != 0)
-      hdef = hdef->next;
-    if (!(hdef == NULL && make))
-      return hdef;
-    hdef = (hdefrec *)Malloc(sizeof(hdefrec));
-    hdef->name = strdup(name);
-    hdef->pgnum = 0;
-    hdef->oldlabelstamp = 0;
-    hdef->oldboxstamp = 0;
-    hdef->oldpagestamp = 0;
-    hdef->curstamp = 0;
-    hdef->clearstamp = 0;
-    hdef->oldshowstamp = showstamp;
-    hdef->defined_ = false;
-    hdef->defreg = NULL;
-    hdef->depends = NULL;
-    hdef->proc = NULL;
-    hdef->proclen = 0;
-    hdef->pindata = NULL;
-    hdef->gcontrol = NULL;
-    hdef->optlevel = 1000;
-    hdef->optflag = true;
-    hdef->nextoptflag = false;
-    hdef->dumphighlight = false;
-    hdef->dumpmode = dump_none;
-    hdef->optmode = opt_always;
-    hdef->optdelay = true;
-    hdef->writefile = strdup("");
-    hdef->wantnote = 1;
-    hdef->wantstats = false;
-    hdef->next = hdefbase;
-    hdefbase = hdef;
-    return hdef;
-  }
-}
+	hdefrec *hdef;
 
+	if (*name == '\0')
+	{
+		return NULL;
+	}
+	else
+	{
+		hdef = hdefbase;
+		while (hdef != NULL && strcicmp(name, hdef->name) != 0)
+			hdef = hdef->next;
+		if (!(hdef == NULL && make))
+			return hdef;
+		hdef = (hdefrec *)Malloc(sizeof(hdefrec));
+		hdef->name = strdup(name);
+		hdef->pgnum = 0;
+		hdef->oldlabelstamp = 0;
+		hdef->oldboxstamp = 0;
+		hdef->oldpagestamp = 0;
+		hdef->curstamp = 0;
+		hdef->clearstamp = 0;
+		hdef->oldshowstamp = showstamp;
+		hdef->defined_ = false;
+		hdef->defreg = NULL;
+		hdef->depends = NULL;
+		hdef->proc = NULL;
+		hdef->proclen = 0;
+		hdef->pindata = NULL;
+		hdef->gcontrol = NULL;
+		hdef->optlevel = 1000;
+		hdef->optflag = true;
+		hdef->nextoptflag = false;
+		hdef->dumphighlight = false;
+		hdef->dumpmode = dump_none;
+		hdef->optmode = opt_always;
+		hdef->optdelay = true;
+		hdef->writefile = strdup("");
+		hdef->wantnote = 1;
+		hdef->wantstats = false;
+		hdef->next = hdefbase;
+		hdefbase = hdef;
+		return hdef;
+	}
+}
 
 
-static void grabcontrolattrs(hdef, g)
-hdefrec *hdef;
-log_grec *g;
+static void grabcontrolattrs(hdefrec *hdef, log_grec *g)
 {
-  long num;
-
-  num = findgattr(g, "opt", "I", 0);
-  if (num != 0) {
-    if (g->attr[num - 1].blnk)
-      hdef->optlevel = 1000;
-    else
-      hdef->optlevel = g->attr[num - 1].UU.U73.i1;
-  }
-  num = findgattr(g, "opt-when", "V", 0);
-  if (num != 0) {
-    switch (g->attr[num - 1].UU.nv) {
-
-    case 1:
-      hdef->optmode = opt_dump;
-      break;
-
-    case 2:
-      hdef->optmode = opt_request;
-      break;
-
-    default:
-      hdef->optmode = opt_always;
-      break;
-    }
-  }
-  num = findgattr(g, "opt-delay", "B", 0);
-  if (num != 0)
-    hdef->optdelay = g->attr[num - 1].UU.b;
-  num = findgattr(g, "disp", "B", 0);
-  if (num != 0)
-    hdef->wantnote = g->attr[num - 1].UU.b;
-  num = findgattr(g, "stats", "B", 0);
-  if (num != 0)
-    hdef->wantstats = g->attr[num - 1].UU.b;
-  num = findgattr(g, "dump", "V", 0);
-  if (num != 0) {
-    switch (g->attr[num - 1].UU.nv) {
-
-    case 1:
-      hdef->dumpmode = dump_dump;
-      break;
-
-    case 2:
-      hdef->dumpmode = dump_big;
-      break;
-
-    case 3:
-      hdef->dumpmode = dump_write;
-      break;
-
-    default:
-      hdef->dumpmode = dump_none;
-      break;
-    }
-  }
-  num = findgattr(g, "write-file", "A", 0);
-  if (num != 0 && g->attr[num - 1].UU.sp != NULL)
-    strchange(&hdef->writefile, g->attr[num - 1].UU.sp);
+	long num;
+
+	num = findgattr(g, "opt", "I", 0);
+	if (num != 0)
+	{
+		if (g->attr[num - 1].blnk)
+			hdef->optlevel = 1000;
+		else
+			hdef->optlevel = g->attr[num - 1].UU.U73.i1;
+	}
+	num = findgattr(g, "opt-when", "V", 0);
+
+	if (num != 0)
+	{
+		switch (g->attr[num - 1].UU.nv)
+		{
+			case 1:
+				hdef->optmode = opt_dump;
+				break;
+
+			case 2:
+				hdef->optmode = opt_request;
+				break;
+
+			default:
+				hdef->optmode = opt_always;
+				break;
+		}
+	}
+	num = findgattr(g, "opt-delay", "B", 0);
+	if (num != 0)
+		hdef->optdelay = g->attr[num - 1].UU.b;
+	num = findgattr(g, "disp", "B", 0);
+	if (num != 0)
+		hdef->wantnote = g->attr[num - 1].UU.b;
+	num = findgattr(g, "stats", "B", 0);
+	if (num != 0)
+		hdef->wantstats = g->attr[num - 1].UU.b;
+	num = findgattr(g, "dump", "V", 0);
+	if (num != 0)
+	{
+		switch (g->attr[num - 1].UU.nv)
+		{
+			case 1:
+				hdef->dumpmode = dump_dump;
+				break;
+
+			case 2:
+				hdef->dumpmode = dump_big;
+				break;
+
+			case 3:
+				hdef->dumpmode = dump_write;
+				break;
+
+			default:
+				hdef->dumpmode = dump_none;
+				break;
+		}
+	}
+	num = findgattr(g, "write-file", "A", 0);
+	if (num != 0 && g->attr[num - 1].UU.sp != NULL)
+		strchange(&hdef->writefile, g->attr[num - 1].UU.sp);
 }
 
 
 
-static void storecontrolattrs(hdef, g)
-hdefrec *hdef;
-log_grec *g;
+static void storecontrolattrs(hdefrec *hdef, log_grec *g)
 {
-  long num;
-  log_gattrrec *WITH;
-
-  num = findgattr(g, "opt", "I", 0);
-  if (num != 0) {
-    WITH = &g->attr[num - 1];
-    if (hdef == NULL)
-      WITH->UU.U73.i1 = 1000;
-    else
-      WITH->UU.U73.i1 = hdef->optlevel;
-    WITH->blnk = (WITH->UU.U73.i1 == 1000);
-  }
-  num = findgattr(g, "opt-when", "V", 0);
-  if (num != 0) {
-    if (hdef == NULL)
-      g->attr[num - 1].UU.nv = 0;
-    else {
-      switch (hdef->optmode) {
-
-      case opt_dump:
-	g->attr[num - 1].UU.nv = 1;
-	break;
-
-      case opt_request:
-	g->attr[num - 1].UU.nv = 2;
-	break;
-
-      default:
-	g->attr[num - 1].UU.nv = 0;
-	break;
-      }
-    }
-  }
-  num = findgattr(g, "opt-delay", "B", 0);
-  if (num != 0)
-    g->attr[num - 1].UU.b = (hdef != NULL && hdef->optdelay);
-  num = findgattr(g, "disp", "B", 0);
-  if (num != 0)
-    g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantnote);
-  num = findgattr(g, "stats", "B", 0);
-  if (num != 0)
-    g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantstats);
-  num = findgattr(g, "dump", "V", 0);
-  if (num != 0) {
-    if (hdef == NULL)
-      g->attr[num - 1].UU.nv = 0;
-    else {
-      switch (hdef->dumpmode) {
-
-      case dump_dump:
-	g->attr[num - 1].UU.nv = 1;
-	break;
-
-      case dump_big:
-	g->attr[num - 1].UU.nv = 2;
-	break;
-
-      case dump_write:
-	g->attr[num - 1].UU.nv = 3;
-	break;
-
-      default:
-	g->attr[num - 1].UU.nv = 0;
-	break;
-      }
-    }
-  }
-  num = findgattr(g, "write-file", "A", 0);
-  if (num != 0) {
-    if (hdef != NULL)
-      strchange(&g->attr[num - 1].UU.sp, hdef->writefile);
-  }
+	long num;
+	log_gattrrec *WITH;
+
+	num = findgattr(g, "opt", "I", 0);
+	if (num != 0)
+	{
+		WITH = &g->attr[num - 1];
+		if (hdef == NULL)
+			WITH->UU.U73.i1 = 1000;
+		else
+			WITH->UU.U73.i1 = hdef->optlevel;
+		WITH->blnk = (WITH->UU.U73.i1 == 1000);
+	}
+	num = findgattr(g, "opt-when", "V", 0);
+	if (num != 0)
+	{
+		if (hdef == NULL)
+		{
+			g->attr[num - 1].UU.nv = 0;
+		}
+		else
+		{
+			switch (hdef->optmode)
+			{
+				case opt_dump:
+					g->attr[num - 1].UU.nv = 1;
+					break;
+
+				case opt_request:
+					g->attr[num - 1].UU.nv = 2;
+					break;
+
+				default:
+					g->attr[num - 1].UU.nv = 0;
+					break;
+			}
+		}
+	}
+	num = findgattr(g, "opt-delay", "B", 0);
+	if (num != 0)
+		g->attr[num - 1].UU.b = (hdef != NULL && hdef->optdelay);
+	num = findgattr(g, "disp", "B", 0);
+	if (num != 0)
+		g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantnote);
+	num = findgattr(g, "stats", "B", 0);
+	if (num != 0)
+		g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantstats);
+	num = findgattr(g, "dump", "V", 0);
+	if (num != 0)
+	{
+		if (hdef == NULL)
+		{
+			g->attr[num - 1].UU.nv = 0;
+		}
+		else
+		{
+			switch (hdef->dumpmode)
+			{
+				case dump_dump:
+					g->attr[num - 1].UU.nv = 1;
+					break;
+
+				case dump_big:
+					g->attr[num - 1].UU.nv = 2;
+					break;
+
+				case dump_write:
+					g->attr[num - 1].UU.nv = 3;
+					break;
+
+				default:
+					g->attr[num - 1].UU.nv = 0;
+					break;
+			}
+		}
+	}
+	num = findgattr(g, "write-file", "A", 0);
+	if (num != 0)
+	{
+		if (hdef != NULL)
+			strchange(&g->attr[num - 1].UU.sp, hdef->writefile);
+	}
 }
 
 
 #define want            "LOGSIMH_LOG_16_INST"
 
 
-
-
-static hdefrec *isinstance(g)
-log_grec *g;
+static hdefrec *isinstance(log_grec *g)
 {
-  long i;
-  char STR2[12];
-
-  if (g->kind->simtype != logsima_tool_16 || g->kind->proc[0] != '\022' ||
-      g->kind->proc[2] != strlen(want) + 128)
-    return NULL;
-  else {
-    i = 1;
-    while (i <= strlen(want) && g->kind->proc[i + 2] == want[i - 1])
-      i++;
-    if (i <= strlen(want) || g->kind->proc[i + 2] != '\0')
-      return NULL;
-    else {
-      i = findgattr(g, "inst-of", "CA", 0);
-      if (i > 0)
-	return (findhdef(g->attr[i - 1].UU.c, true));
-      else {
-	sprintf(STR2, "\"%s\"", g->kind->name);
-	return (findhdef(STR2, true));
-      }
-    }
-  }
+	long i;
+	char STR2[12];
+
+	if (g->kind->simtype != logsima_tool_16 || g->kind->proc[0] != '\022' ||
+			g->kind->proc[2] != strlen(want) + 128)
+	{
+		return NULL;
+	}
+	else
+	{
+		i = 1;
+		while (i <= strlen(want) && g->kind->proc[i + 2] == want[i - 1])
+			i++;
+		if (i <= strlen(want) || g->kind->proc[i + 2] != '\0')
+		{
+			return NULL;
+		}
+		else
+		{
+			i = findgattr(g, "inst-of", "CA", 0);
+			if (i > 0)
+			{
+				return (findhdef(g->attr[i - 1].UU.c, true));
+			}
+			else
+			{
+				sprintf(STR2, "\"%s\"", g->kind->name);
+				return (findhdef(STR2, true));
+			}
+		}
+	}
 }
 
 #undef want
 
 
-
-
 static void updateinstance (log_grec *g);
 
 
 #define setmax          200000L   /*was 8000*/
 
 
-
 typedef struct noderec {
-  long poss, nextposs;
-  short isused, wasused, isdef, wasdef;
-  int alwaysconn, strong, wasstrong, loopflag;
-  instrrec *defn;
-  long level;
-  short truenum;
+	long poss, nextposs;
+	short isused, wasused, isdef, wasdef;
+	int alwaysconn, strong, wasstrong, loopflag;
+	instrrec *defn;
+	long level;
+	short truenum;
 } noderec;
 
 typedef noderec nodearr[log_million + 1];
 
 typedef struct trailrec {
-  struct trailrec *next;
-  long num;
-  long oldposs;
-  int oldstrong;
-  long oldlevel;
+	struct trailrec *next;
+	long num;
+	long oldposs;
+	int oldstrong;
+	long oldlevel;
 } trailrec;
 
 
 static char *instrops_NAMES[] = {
-  "OP_IF", "OP_IFNONE", "OP_IFZERO", "OP_IFONE", "OP_IFCONN", "OP_IFZN",
-  "OP_PINEQ", "OP_PINOC", "OP_VAREQ", "OP_PULLUP", "OP_PULLDN", "OP_IFTRUE",
-  "OP_IFFALSE", "OP_AND", "OP_NAND", "OP_OR", "OP_NOR", "OP_XOR", "OP_SAME",
-  "OP_RISE", "OP_FALL", "OP_NOT", "OP_FIX0", "OP_STRONG", "OP_ZERO", "OP_ONE",
-  "OP_PIN", "OP_PINREF", "OP_VAR", "OP_NONE", "OP_FIX1", "OP_ALWAYSCONN"
+	"OP_IF", "OP_IFNONE", "OP_IFZERO", "OP_IFONE", "OP_IFCONN", "OP_IFZN",
+	"OP_PINEQ", "OP_PINOC", "OP_VAREQ", "OP_PULLUP", "OP_PULLDN", "OP_IFTRUE",
+	"OP_IFFALSE", "OP_AND", "OP_NAND", "OP_OR", "OP_NOR", "OP_XOR", "OP_SAME",
+	"OP_RISE", "OP_FALL", "OP_NOT", "OP_FIX0", "OP_STRONG", "OP_ZERO", "OP_ONE",
+	"OP_PIN", "OP_PINREF", "OP_VAR", "OP_NONE", "OP_FIX1", "OP_ALWAYSCONN"
 } ;
 
 
 typedef struct gaterec {
-  log_grec *gp;
-  pdrec *pd;
-  log_nrec **pins;
-  uchar *pproc;
-  short numpins;
-  long *ins, *outs;
+	log_grec *gp;
+	pdrec *pd;
+	log_nrec **pins;
+	uchar *pproc;
+	short numpins;
+	long *ins, *outs;
 } gaterec;
 
 typedef gaterec gatearray[log_million];
@@ -701,3385 +726,3489 @@ typedef gaterec gatearray[log_million];
 
 /* Local variables for compilepage: */
 struct LOC_compilepage {
-  hdefrec *hdef;
-  long starttime;
-  instrrec *ip1, *ipbase;
-  log_grec *g, *gtempl, *gcontrol;
-  log_nrec *n;
-  int okay, truevars, hasstats, isverbose, bigdump;
-  long optlevel;
-  int optdelay;
-  long pc, simppasscount, gatecount, subcount, inertcount, forcecount,
-       instrcount, oldinstrcount, curppin, curpvar, savecurpvar, baseppin,
-       basepvar, numvar, numports, numthings, thingnodes, thingvars;
-  noderec *things;
-  na_strlist_t *inertlist;
-  log_brec *mybox;
-  uchar *proc;
-  log_nrec **gpins;
-  int changed;
+	hdefrec *hdef;
+	long starttime;
+	instrrec *ip1, *ipbase;
+	log_grec *g, *gtempl, *gcontrol;
+	log_nrec *n;
+	int okay, truevars, hasstats, isverbose, bigdump;
+	long optlevel;
+	int optdelay;
+	long pc, simppasscount, gatecount, subcount, inertcount, forcecount,
+		 instrcount, oldinstrcount, curppin, curpvar, savecurpvar, baseppin,
+		 basepvar, numvar, numports, numthings, thingnodes, thingvars;
+	noderec *things;
+	na_strlist_t *inertlist;
+	log_brec *mybox;
+	uchar *proc;
+	log_nrec **gpins;
+	int changed;
 } ;
 
 static instrrec *parseterm (struct LOC_compilepage *LINK);
 
-static void error(msg, LINK)
-char *msg;
-struct LOC_compilepage *LINK;
+static void error(char *msg, struct LOC_compilepage *LINK)
 {
-  /* if act.lact^.curpage = act.lact^.showpage then */
-  showerrormsg(LINK->hdef, msg);
-  LINK->okay = false;
+	/* if act.lact^.curpage = act.lact^.showpage then */
+	showerrormsg(LINK->hdef, msg);
+	LINK->okay = false;
 }
 
-static void newinstr(ip, LINK)
-instrrec **ip;
-struct LOC_compilepage *LINK;
+static void newinstr(instrrec **ip, struct LOC_compilepage *LINK)
 {
-  *ip = (instrrec *)Malloc(sizeof(instrrec));
-  (*ip)->opcode = op_zero;
-  (*ip)->UU.U1.arg1 = NULL;
-  (*ip)->UU.U1.arg2 = NULL;
-  (*ip)->UU.U1.arg3 = NULL;
-  (*ip)->UU.U1.next = NULL;
+	*ip = (instrrec *)Malloc(sizeof(instrrec));
+	(*ip)->opcode = op_zero;
+	(*ip)->UU.U1.arg1 = NULL;
+	(*ip)->UU.U1.arg2 = NULL;
+	(*ip)->UU.U1.arg3 = NULL;
+	(*ip)->UU.U1.next = NULL;
 }
 
-static void disposetree(ip, LINK)
-instrrec **ip;
-struct LOC_compilepage *LINK;
+static void disposetree(instrrec **ip, struct LOC_compilepage *LINK)
 {
-  if (*ip == NULL)
-    return;
-  disposetree(&(*ip)->UU.U1.arg1, LINK);
-  disposetree(&(*ip)->UU.U1.arg2, LINK);
-  disposetree(&(*ip)->UU.U1.arg3, LINK);
-  disposetree(&(*ip)->UU.U1.next, LINK);
-  Free(*ip);
+	if (*ip == NULL)
+		return;
+	disposetree(&(*ip)->UU.U1.arg1, LINK);
+	disposetree(&(*ip)->UU.U1.arg2, LINK);
+	disposetree(&(*ip)->UU.U1.arg3, LINK);
+	disposetree(&(*ip)->UU.U1.next, LINK);
+	Free(*ip);
 }
 
 /* Local variables for dumptree: */
 struct LOC_dumptree {
-  struct LOC_compilepage *LINK;
-  FILE *f;
-  instrrec *iphigh;
-  char buf[256];
-  long i;
+	struct LOC_compilepage *LINK;
+	FILE *f;
+	instrrec *iphigh;
+	char buf[256];
+	long i;
 } ;
 
-static void dump(ip, indent, LINK)
-instrrec *ip;
-long indent;
-struct LOC_dumptree *LINK;
+static void dump(instrrec *ip, long indent, struct LOC_dumptree *LINK)
 {
-  long ind2;
-
-  while (ip != NULL) {
-    if (ip == LINK->iphigh) {
-      putc(140, LINK->f);
-/* p2c: logsimh.text, line 707: Note: character >= 128 encountered [281] */
-    }
-    strcpy(LINK->buf, instrops_NAMES[(long)ip->opcode]);
-    LINK->i = strlen(LINK->buf) + 1;
-    fputs(LINK->buf + 3, LINK->f);
-    ind2 = indent + strlen(LINK->buf) - 3;
-    if (((1L << ((long)ip->opcode)) & ((1L << ((long)op_pineq)) |
-	   (1L << ((long)op_pinoc)) | (1L << ((long)op_vareq)) |
-	   (1L << ((long)op_pin)) | (1L << ((long)op_pinref)) |
-	   (1L << ((long)op_var)) | (1L << ((long)op_alwaysconn)))) != 0) {
-      sprintf(LINK->buf, "%d", ip->ival);
-      fprintf(LINK->f, "[%s]", LINK->buf);
-      ind2 += strlen(LINK->buf) + 2;
-    }
-    if (ip->UU.U1.arg1 != NULL || ip->UU.U1.arg2 != NULL ||
-	ip->UU.U1.arg3 != NULL) {
-      putc('(', LINK->f);
-      ind2++;
-      if (ip->UU.U1.arg1 != NULL)
-	dump(ip->UU.U1.arg1, ind2, LINK);
-      if (ip->UU.U1.arg2 != NULL || ip->UU.U1.arg3 != NULL) {
-	fprintf(LINK->f, ",\n");
-	fprintf(LINK->f, "%*s", (int)ind2, "");
-	if (ip->UU.U1.arg2 != NULL)
-	  dump(ip->UU.U1.arg2, ind2, LINK);
-	if (ip->UU.U1.arg3 != NULL) {
-	  fprintf(LINK->f, ",\n");
-	  fprintf(LINK->f, "%*s", (int)ind2, "");
-	  dump(ip->UU.U1.arg3, ind2, LINK);
+	long ind2;
+
+	while (ip != NULL)
+	{
+		if (ip == LINK->iphigh)
+
+		{
+			putc(140, LINK->f);
+		}
+		strcpy(LINK->buf, instrops_NAMES[(long)ip->opcode]);
+		LINK->i = strlen(LINK->buf) + 1;
+		fputs(LINK->buf + 3, LINK->f);
+		ind2 = indent + strlen(LINK->buf) - 3;
+		if (((1L << ((long)ip->opcode)) & ((1L << ((long)op_pineq)) |
+						(1L << ((long)op_pinoc)) | (1L << ((long)op_vareq)) |
+						(1L << ((long)op_pin)) | (1L << ((long)op_pinref)) |
+						(1L << ((long)op_var)) | (1L << ((long)op_alwaysconn)))) != 0)
+		{
+			sprintf(LINK->buf, "%d", ip->ival);
+			fprintf(LINK->f, "[%s]", LINK->buf);
+			ind2 += strlen(LINK->buf) + 2;
+		}
+
+		if (ip->UU.U1.arg1 != NULL || ip->UU.U1.arg2 != NULL ||
+				ip->UU.U1.arg3 != NULL)
+		{
+			putc('(', LINK->f);
+			ind2++;
+			if (ip->UU.U1.arg1 != NULL)
+				dump(ip->UU.U1.arg1, ind2, LINK);
+			if (ip->UU.U1.arg2 != NULL || ip->UU.U1.arg3 != NULL)
+			{
+				fprintf(LINK->f, ",\n");
+				fprintf(LINK->f, "%*s", (int)ind2, "");
+				if (ip->UU.U1.arg2 != NULL)
+					dump(ip->UU.U1.arg2, ind2, LINK);
+				if (ip->UU.U1.arg3 != NULL) {
+					fprintf(LINK->f, ",\n");
+					fprintf(LINK->f, "%*s", (int)ind2, "");
+					dump(ip->UU.U1.arg3, ind2, LINK);
+				}
+			}
+			putc(')', LINK->f);
+		}
+		if (ip->UU.U1.next != NULL)
+		{
+			fprintf(LINK->f, ";\n");
+			fprintf(LINK->f, "%*s", (int)indent, "");
+		}
+
+		if (ip == LINK->iphigh)
+			putc(136, LINK->f);
+		ip = ip->UU.U1.next;
 	}
-      }
-      putc(')', LINK->f);
-    }
-    if (ip->UU.U1.next != NULL) {
-      fprintf(LINK->f, ";\n");
-      fprintf(LINK->f, "%*s", (int)indent, "");
-    }
-    if (ip == LINK->iphigh)
-      putc(136, LINK->f);
-/* p2c: logsimh.text, line 746: Note: character >= 128 encountered [281] */
-    ip = ip->UU.U1.next;
-  }
 }
 
-static void dumptree(f_, ip, iphigh_, LINK)
-FILE *f_;
-instrrec *ip, *iphigh_;
-struct LOC_compilepage *LINK;
+static void dumptree(FILE *f_, instrrec *ip, instrrec *iphigh_, struct LOC_compilepage *LINK)
 {
-  struct LOC_dumptree V;
+	struct LOC_dumptree V;
 
-  V.LINK = LINK;
-  V.f = f_;
-  V.iphigh = iphigh_;
-  dump(ip, 0L, &V);
-  putc('\n', V.f);
+	V.LINK = LINK;
+	V.f = f_;
+	V.iphigh = iphigh_;
+	dump(ip, 0L, &V);
+	putc('\n', V.f);
 }
 
-static void debugtree(ip, iphigh, LINK)
-instrrec *ip, *iphigh;
-struct LOC_compilepage *LINK;
+static void debugtree(instrrec *ip, instrrec *iphigh, struct LOC_compilepage *LINK)
 {
-  if (ip == NULL)
-    ip = LINK->ipbase;
-  dumptree(stdout, ip, iphigh, LINK);
+	if (ip == NULL)
+		ip = LINK->ipbase;
+	dumptree(stdout, ip, iphigh, LINK);
 }
 
 
-static int isinert(g, LINK)
-log_grec *g;
-struct LOC_compilepage *LINK;
+static int isinert(log_grec *g, struct LOC_compilepage *LINK)
 {
-  return (!strcmp(g->kind->name, "LED") || !strcmp(g->kind->name, "7SEG") ||
-	  strlist_find(LINK->inertlist, g->kind->name) != NULL);
+	return (!strcmp(g->kind->name, "LED") || !strcmp(g->kind->name, "7SEG") ||
+			strlist_find(LINK->inertlist, g->kind->name) != NULL);
 }
 
 /* Local variables for parseterm: */
 struct LOC_parseterm {
-  struct LOC_compilepage *LINK;
-  instrrec *ip;
-  long ins;
-  int done;
+	struct LOC_compilepage *LINK;
+	instrrec *ip;
+	long ins;
+	int done;
 } ;
 
-static void badop(LINK)
-struct LOC_parseterm *LINK;
+static void badop(struct LOC_parseterm *LINK)
 {
-  char STR2[256];
+	char STR2[256];
 
-  sprintf(STR2, "%s: bad opcode (%.2lX)",
-	  LINK->LINK->g->kind->name, LINK->ins & 0xff);
-  error(STR2, LINK->LINK);
+	sprintf(STR2, "%s: bad opcode (%.2lX)",
+			LINK->LINK->g->kind->name, LINK->ins & 0xff);
+	error(STR2, LINK->LINK);
 }
 
-static instrrec *parsepin(LINK)
-struct LOC_parseterm *LINK;
+static instrrec *parsepin(struct LOC_parseterm *LINK)
 {
-  instrrec *ip;
-
-  ip = parseterm(LINK->LINK);
-  if (ip->opcode == op_pin)
-    ip->opcode = op_pinref;
-  else
-    badop(LINK);
-  return ip;
+	instrrec *ip;
+
+	ip = parseterm(LINK->LINK);
+	if (ip->opcode == op_pin)
+		ip->opcode = op_pinref;
+	else
+		badop(LINK);
+	return ip;
 }
 
-static long getpnum(LINK)
-struct LOC_parseterm *LINK;
+static long getpnum(struct LOC_parseterm *LINK)
 {
-  long Result;
-
-  if (LINK->LINK->proc[LINK->LINK->pc - 1] < 128) {
-/* p2c: logsimh.text, line 802: Note: character >= 128 encountered [281] */
-    Result = LINK->LINK->proc[LINK->LINK->pc - 1] - 64;
-    LINK->LINK->pc++;
-  } else {
-    Result = LINK->LINK->proc[LINK->LINK->pc - 1] +
-	     (LINK->LINK->proc[LINK->LINK->pc] - 32) * 128 - 64;
-    LINK->LINK->pc += 2;
-  }
-  return Result;
+	long Result;
+
+	if (LINK->LINK->proc[LINK->LINK->pc - 1] < 128)
+	{
+		Result = LINK->LINK->proc[LINK->LINK->pc - 1] - 64;
+		LINK->LINK->pc++;
+	}
+	else
+	{
+		Result = LINK->LINK->proc[LINK->LINK->pc - 1] +
+			(LINK->LINK->proc[LINK->LINK->pc] - 32) * 128 - 64;
+		LINK->LINK->pc += 2;
+	}
+	return Result;
 }
 
-static long findpin(i, LINK)
-long i;
-struct LOC_parseterm *LINK;
+static long findpin(long i, struct LOC_parseterm *LINK)
 {
-  return ((long)LINK->LINK->gpins[i - 1]->temp);
+	return ((long)LINK->LINK->gpins[i - 1]->temp);
 }
 
-static long findvar(i, LINK)
-long i;
-struct LOC_parseterm *LINK;
+static long findvar(long i, struct LOC_parseterm *LINK)
 {
-  long Result;
+	long Result;
 
-  Result = LINK->LINK->curpvar + i;
-  if (i >= LINK->LINK->numvar)
-    LINK->LINK->numvar = i + 1;
-  return Result;
+	Result = LINK->LINK->curpvar + i;
+	if (i >= LINK->LINK->numvar)
+		LINK->LINK->numvar = i + 1;
+	return Result;
 }
 
-static void checkcomment(LINK)
-struct LOC_parseterm *LINK;
+static void checkcomment(struct LOC_parseterm *LINK)
 {
-  char s[256];
-  long i, FORLIM;
-  char STR1[256], STR2[256];
-
-  s[LINK->LINK->proc[LINK->LINK->pc - 1] - 32] = '\0';
-  FORLIM = strlen(s);
-/* p2c: logsimh.text, line 832:
- * Note: Modification of string length may translate incorrectly [146] */
-  for (i = 0; i < FORLIM; i++)
-    s[i] = LINK->LINK->proc[LINK->LINK->pc + i];
-  LINK->done = false;
-  if (strncmp(s, "FORCE_DRIVEN ", 13L) || strlen(s) <= 13 ||
-      !strsubset(strcpy(STR1, s + 13), "0123456789"))
-    return;
-  LINK->ip->opcode = op_alwaysconn;
-  LINK->ip->ival = findpin(strtol(strcpy(STR2, s + 13), NULL, 0), LINK);
-  LINK->LINK->forcecount++;
-  LINK->done = true;
+	char s[256];
+	long i, FORLIM;
+	char STR1[256], STR2[256];
+
+	s[LINK->LINK->proc[LINK->LINK->pc - 1] - 32] = '\0';
+	FORLIM = strlen(s);
+	for (i = 0; i < FORLIM; i++)
+		s[i] = LINK->LINK->proc[LINK->LINK->pc + i];
+	LINK->done = false;
+	if (strncmp(s, "FORCE_DRIVEN ", 13L) || strlen(s) <= 13 ||
+			!strsubset(strcpy(STR1, s + 13), "0123456789"))
+		return;
+	LINK->ip->opcode = op_alwaysconn;
+	LINK->ip->ival = findpin(strtol(strcpy(STR2, s + 13), NULL, 0), LINK);
+	LINK->LINK->forcecount++;
+	LINK->done = true;
 }
 
 
 /* Parse a GDL definition into a tree */
 
-static instrrec *parseterm(LINK)
-struct LOC_compilepage *LINK;
+static instrrec *parseterm(struct LOC_compilepage *LINK)
 {
-  struct LOC_parseterm V;
-  instrrec *ip1, **ipp;
-  long i;
-  na_long tempvars;
-  char STR1[54];
-
-  V.LINK = LINK;
-  newinstr(&V.ip, LINK);
-  do {
-    V.done = true;
-    V.ins = LINK->proc[LINK->pc - 1];
-    LINK->pc++;
-    switch (V.ins / 16) {
-
-    case 0:
-      switch (V.ins) {
-
-      case 0:   /*stray end-of-program*/
-	V.ip->opcode = op_iffalse;   /*closest thing to a real "nop"*/
-	break;
-
-      case 1:
-      case 2:
-      case 15:   /*NOP, stray END and ELSE*/
-	V.done = false;
-	break;
-
-      case 3:
-      case 4:
-      case 5:
-      case 6:
-      case 7:
-      case 8:   /*IF's*/
-	LINK->oldinstrcount++;
-	switch (V.ins) {
-
-	case 3:
-	  V.ip->opcode = op_if;
-	  break;
-
-	case 4:
-	  V.ip->opcode = op_ifnone;
-	  break;
-
-	case 5:
-	  V.ip->opcode = op_ifzero;
-	  break;
-
-	case 6:
-	  V.ip->opcode = op_ifone;
-	  break;
-
-	case 7:
-	  V.ip->opcode = op_ifconn;
-	  break;
-
-	case 8:
-	  V.ip->opcode = op_ifzn;
-	  break;
-	}
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	V.ip->UU.U1.arg2 = NULL;
-	V.ip->UU.U1.arg3 = NULL;
-	ipp = &V.ip->UU.U1.arg2;
-	while (LINK->proc[LINK->pc - 1] >= 32 ||
-	       ((1L << LINK->proc[LINK->pc - 1]) & 0x8005L) == 0) {
-	  ip1 = parseterm(LINK);
-	  *ipp = ip1;
-	  ipp = &ip1->UU.U1.next;
-	}
-	if (LINK->proc[LINK->pc - 1] == '\017') {
-	  LINK->pc++;
-	  ipp = &V.ip->UU.U1.arg3;
-	  while (LINK->proc[LINK->pc - 1] >= 32 ||
-		 ((1L << LINK->proc[LINK->pc - 1]) & 0x5) == 0) {
-	    ip1 = parseterm(LINK);
-	    *ipp = ip1;
-	    ipp = &ip1->UU.U1.next;
-	  }
-	}
-	if (LINK->proc[LINK->pc - 1] == '\002')
-	  LINK->pc++;
-	break;
-
-      default:
-	badop(&V);
-	break;
-      }
-      break;
-
-    case 1:
-      switch (V.ins & 15) {
-
-      case 0:   /*ppin=x*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_pineq;
-	V.ip->ival = LINK->baseppin + getpnum(&V);
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      case 1:   /*ppin<x*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_pinoc;
-	V.ip->ival = LINK->baseppin + getpnum(&V);
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      case 2:   /*CALL*/
-	logsima_action.lact->actflag = false;
-	*logsima_action.lact->actstr = '\0';
-	logsima_action.lact->actx = 0;
-	(*logsima_action.lact->hook2->send_gengate)(LINK->g, "INERT");
-	if (logsima_action.lact->actflag) {
-	  if (*logsima_action.lact->actstr != '\0') {
-	    tempvars = LINK->g->vars;
-	    V.ip->opcode = op_iftrue;
-	    ipp = &V.ip->UU.U1.arg2;
-	    for (i = 0; i <= 15; i++) {   /*ord('P') - i*/
-	      if (strposc(logsima_action.lact->actstr, (char)(i + 'A'), 1L) !=
-		  0) {
-		LINK->oldinstrcount++;
-		newinstr(ipp, LINK);
-		(*ipp)->opcode = op_vareq;
-		(*ipp)->ival = LINK->basepvar + i;
-		newinstr(&(*ipp)->UU.U1.arg1, LINK);
-		if ((((unsigned long)tempvars) & (1L << (15 - i))) != 0)
-		  (*ipp)->UU.U1.arg1->opcode = op_one;
-		else
-		  (*ipp)->UU.U1.arg1->opcode = op_zero;
-		ipp = &(*ipp)->UU.U1.next;
-	      }
-	    }
-	  } else
-	    V.done = false;
-	} else if (logsima_action.lact->actx == -42) {
-	  LINK->gcontrol = LINK->g;
-	  LINK->inertcount--;
-	  V.done = false;
-	} else {
-	  sprintf(STR1, "Instance cannot contain Pascal-defined gate %s",
-		  LINK->g->kind->name);
-	  error(STR1, LINK);
-	}
-	LINK->pc += LINK->proc[LINK->pc] - 126;
-	break;
-
-      case 6:   /*comment*/
-	checkcomment(&V);
-	LINK->pc += LINK->proc[LINK->pc - 1] - 31;
-	break;
-
-      case 7:   /*INST*/
-	if (LINK->proc[LINK->pc - 1] > '"')
-	  LINK->curppin += (LINK->proc[LINK->pc + 1] - 32) * 128 +
-			   LINK->proc[LINK->pc] - 64;
-	if (LINK->proc[LINK->pc - 1] > '$')
-	  LINK->curpvar += (LINK->proc[LINK->pc + 3] - 32) * 128 +
-			   LINK->proc[LINK->pc + 2] - 64;
-	LINK->pc += LINK->proc[LINK->pc - 1] - 33;
-	V.done = false;
-	break;
-
-      case 8:   /*pvar=x*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_vareq;
-	V.ip->ival = LINK->basepvar + getpnum(&V);
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      case 9:   /*pvar=not pvar*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_vareq;
-	V.ip->ival = LINK->basepvar + getpnum(&V);
-	newinstr(&V.ip->UU.U1.arg1, LINK);
-	V.ip->UU.U1.arg1->opcode = op_not;
-	newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
-	V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
-	V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
-	break;
-
-      case 10:   /*pvar=zero*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_vareq;
-	V.ip->ival = LINK->basepvar + getpnum(&V);
-	newinstr(&V.ip->UU.U1.arg1, LINK);
-	V.ip->UU.U1.arg1->opcode = op_zero;
-	break;
-
-      case 11:   /*pvar=one*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_vareq;
-	V.ip->ival = LINK->basepvar + getpnum(&V);
-	newinstr(&V.ip->UU.U1.arg1, LINK);
-	V.ip->UU.U1.arg1->opcode = op_one;
-	break;
-
-      case 12:   /*pin=PULLDN*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_pulldn;
-	V.ip->UU.U1.arg1 = parsepin(&V);
-	break;
-
-      case 13:   /*pin=PULLUP*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_pullup;
-	V.ip->UU.U1.arg1 = parsepin(&V);
-	break;
-
-      case 14:   /*high pin=x*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_pineq;
-	V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
-	LINK->pc++;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      case 15:   /*high pin<x*/
-	LINK->oldinstrcount++;
-	V.ip->opcode = op_pinoc;
-	V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
-	LINK->pc++;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      default:
-	badop(&V);
-	break;
-      }
-      break;
-
-    case 2:
-    case 3:   /*pin=x*/
-      LINK->oldinstrcount++;
-      V.ip->opcode = op_pineq;
-      V.ip->ival = findpin(V.ins - 31, &V);
-      V.ip->UU.U1.arg1 = parseterm(LINK);
-      break;
-
-    case 4:
-    case 5:   /*pin<x*/
-      LINK->oldinstrcount++;
-      V.ip->opcode = op_pinoc;
-      V.ip->ival = findpin(V.ins - 63, &V);
-      V.ip->UU.U1.arg1 = parseterm(LINK);
-      break;
-
-    case 6:   /*var=x*/
-      LINK->oldinstrcount++;
-      V.ip->opcode = op_vareq;
-      V.ip->ival = findvar(V.ins & 15, &V);
-      V.ip->UU.U1.arg1 = parseterm(LINK);
-      break;
-
-    case 7:   /*var=not var*/
-      LINK->oldinstrcount++;
-      V.ip->opcode = op_vareq;
-      V.ip->ival = findvar(V.ins & 15, &V);
-      newinstr(&V.ip->UU.U1.arg1, LINK);
-      V.ip->UU.U1.arg1->opcode = op_not;
-      newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
-      V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
-      V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
-      break;
-
-    case 8:   /*var=zero*/
-      LINK->oldinstrcount++;
-      V.ip->opcode = op_vareq;
-      V.ip->ival = findvar(V.ins & 15, &V);
-      newinstr(&V.ip->UU.U1.arg1, LINK);
-      V.ip->UU.U1.arg1->opcode = op_zero;
-      break;
-
-    case 9:   /*var=one*/
-      LINK->oldinstrcount++;
-      V.ip->opcode = op_vareq;
-      V.ip->ival = findvar(V.ins & 15, &V);
-      newinstr(&V.ip->UU.U1.arg1, LINK);
-      V.ip->UU.U1.arg1->opcode = op_one;
-      break;
-
-    case 10:
-    case 11:
-      switch (V.ins & 31) {
-
-      case 0:   /*AND*/
-	V.ip->opcode = op_and;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	V.ip->UU.U1.arg2 = parseterm(LINK);
-	break;
-
-      case 1:   /*NAND*/
-	V.ip->opcode = op_nand;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	V.ip->UU.U1.arg2 = parseterm(LINK);
-	break;
-
-      case 2:   /*OR*/
-	V.ip->opcode = op_or;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	V.ip->UU.U1.arg2 = parseterm(LINK);
-	break;
-
-      case 3:   /*NOR*/
-	V.ip->opcode = op_nor;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	V.ip->UU.U1.arg2 = parseterm(LINK);
-	break;
-
-      case 4:   /*XOR*/
-	V.ip->opcode = op_xor;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	V.ip->UU.U1.arg2 = parseterm(LINK);
-	break;
-
-      case 5:   /*NOT*/
-	V.ip->opcode = op_not;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      case 6:   /*RISE*/
-	V.ip->opcode = op_rise;
-	V.ip->UU.U1.arg1 = parsepin(&V);
-	break;
-
-      case 7:   /*FALL*/
-	V.ip->opcode = op_fall;
-	V.ip->UU.U1.arg1 = parsepin(&V);
-	break;
-
-      case 8:   /*ZERO*/
-	V.ip->opcode = op_zero;
-	break;
-
-      case 9:
-      case 15:   /*ONE*/
-	V.ip->opcode = op_one;
-	break;
-
-      case 10:   /*SAME*/
-	V.ip->opcode = op_same;
-	V.ip->UU.U1.arg1 = parsepin(&V);
-	V.ip->UU.U1.arg2 = parsepin(&V);
-	break;
-
-      case 11:   /*ppin*/
-	V.ip->opcode = op_pin;
-	V.ip->ival = LINK->baseppin + getpnum(&V);
-	break;
-
-      case 12:   /*pvar*/
-	V.ip->opcode = op_var;
-	V.ip->ival = LINK->basepvar + getpnum(&V);
-	break;
-
-      case 13:   /*FIX*/
-	V.ip->opcode = op_fix0;
-	V.ip->UU.U1.arg1 = parseterm(LINK);
-	break;
-
-      case 14:   /*AMP*/
-	V.done = false;
-	break;
-
-      case 16:   /*high pin*/
-	V.ip->opcode = op_pin;
-	V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
-	LINK->pc++;
-	break;
-
-      case 17:   /*STRONG*/
-	V.ip->opcode = op_strong;
-	V.ip->UU.U1.arg1 = parsepin(&V);
-	break;
-
-      default:
-	badop(&V);
-	break;
-      }
-      break;
-
-    case 12:
-    case 13:   /*pin*/
-      V.ip->opcode = op_pin;
-      V.ip->ival = findpin(V.ins - 191, &V);
-      break;
-
-    case 14:   /*var*/
-      V.ip->opcode = op_var;
-      V.ip->ival = findvar(V.ins & 15, &V);
-      break;
-
-    case 15:   /*NOT var*/
-      V.ip->opcode = op_not;
-      newinstr(&V.ip->UU.U1.arg1, LINK);
-      V.ip->UU.U1.arg1->opcode = op_var;
-      V.ip->UU.U1.arg1->ival = findvar(V.ins & 15, &V);
-      break;
-
-    default:
-      badop(&V);
-      break;
-    }
-  } while (!V.done);
-  return V.ip;
+	struct LOC_parseterm V;
+	instrrec *ip1, **ipp;
+	long i;
+	na_long tempvars;
+	char STR1[54];
+
+	V.LINK = LINK;
+	newinstr(&V.ip, LINK);
+	do
+	{
+		V.done = true;
+		V.ins = LINK->proc[LINK->pc - 1];
+		LINK->pc++;
+		switch (V.ins / 16)
+		{
+			case 0:
+				switch (V.ins)
+				{
+					case 0:   /*stray end-of-program*/
+						V.ip->opcode = op_iffalse;   /*closest thing to a real "nop"*/
+						break;
+
+					case 1:
+					case 2:
+					case 15:   /*NOP, stray END and ELSE*/
+						V.done = false;
+						break;
+
+					case 3:
+					case 4:
+					case 5:
+					case 6:
+					case 7:
+					case 8:   /*IF's*/
+						LINK->oldinstrcount++;
+						switch (V.ins)
+						{
+							case 3:
+								V.ip->opcode = op_if;
+								break;
+
+							case 4:
+								V.ip->opcode = op_ifnone;
+								break;
+
+							case 5:
+								V.ip->opcode = op_ifzero;
+								break;
+
+							case 6:
+								V.ip->opcode = op_ifone;
+								break;
+
+							case 7:
+								V.ip->opcode = op_ifconn;
+								break;
+
+							case 8:
+								V.ip->opcode = op_ifzn;
+								break;
+						}
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						V.ip->UU.U1.arg2 = NULL;
+						V.ip->UU.U1.arg3 = NULL;
+						ipp = &V.ip->UU.U1.arg2;
+						while (LINK->proc[LINK->pc - 1] >= 32 ||
+								((1L << LINK->proc[LINK->pc - 1]) & 0x8005L) == 0)
+						{
+							ip1 = parseterm(LINK);
+							*ipp = ip1;
+							ipp = &ip1->UU.U1.next;
+						}
+
+						if (LINK->proc[LINK->pc - 1] == '\017')
+						{
+							LINK->pc++;
+							ipp = &V.ip->UU.U1.arg3;
+							while (LINK->proc[LINK->pc - 1] >= 32 ||
+									((1L << LINK->proc[LINK->pc - 1]) & 0x5) == 0)
+							{
+								ip1 = parseterm(LINK);
+								*ipp = ip1;
+								ipp = &ip1->UU.U1.next;
+							}
+						}
+
+						if (LINK->proc[LINK->pc - 1] == '\002')
+							LINK->pc++;
+						break;
+
+					default:
+						badop(&V);
+						break;
+				}
+				break;
+
+			case 1:
+				switch (V.ins & 15)
+				{
+
+					case 0:   /*ppin=x*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_pineq;
+						V.ip->ival = LINK->baseppin + getpnum(&V);
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					case 1:   /*ppin<x*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_pinoc;
+						V.ip->ival = LINK->baseppin + getpnum(&V);
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					case 2:   /*CALL*/
+						logsima_action.lact->actflag = false;
+						*logsima_action.lact->actstr = '\0';
+						logsima_action.lact->actx = 0;
+						(*logsima_action.lact->hook2->send_gengate)(LINK->g, "INERT");
+						if (logsima_action.lact->actflag)
+						{
+							if (*logsima_action.lact->actstr != '\0')
+							{
+								tempvars = LINK->g->vars;
+								V.ip->opcode = op_iftrue;
+								ipp = &V.ip->UU.U1.arg2;
+								for (i = 0; i <= 15; i++)
+								{   /*ord('P') - i*/
+									if (strposc(logsima_action.lact->actstr, (char)(i + 'A'), 1L) != 0)
+									{
+										LINK->oldinstrcount++;
+										newinstr(ipp, LINK);
+										(*ipp)->opcode = op_vareq;
+										(*ipp)->ival = LINK->basepvar + i;
+										newinstr(&(*ipp)->UU.U1.arg1, LINK);
+
+										if ((((unsigned long)tempvars) & (1L << (15 - i))) != 0)
+											(*ipp)->UU.U1.arg1->opcode = op_one;
+										else
+											(*ipp)->UU.U1.arg1->opcode = op_zero;
+										ipp = &(*ipp)->UU.U1.next;
+									}
+								}
+							}
+							else
+							{
+								V.done = false;
+							}
+						}
+						else if (logsima_action.lact->actx == -42)
+						{
+							LINK->gcontrol = LINK->g;
+							LINK->inertcount--;
+							V.done = false;
+						}
+						else
+						{
+							sprintf(STR1, "Instance cannot contain Pascal-defined gate %s",
+									LINK->g->kind->name);
+							error(STR1, LINK);
+						}
+						LINK->pc += LINK->proc[LINK->pc] - 126;
+						break;
+
+					case 6:   /*comment*/
+						checkcomment(&V);
+						LINK->pc += LINK->proc[LINK->pc - 1] - 31;
+						break;
+
+					case 7:   /*INST*/
+						if (LINK->proc[LINK->pc - 1] > '"')
+							LINK->curppin += (LINK->proc[LINK->pc + 1] - 32) * 128 +
+								LINK->proc[LINK->pc] - 64;
+						if (LINK->proc[LINK->pc - 1] > '$')
+							LINK->curpvar += (LINK->proc[LINK->pc + 3] - 32) * 128 +
+								LINK->proc[LINK->pc + 2] - 64;
+						LINK->pc += LINK->proc[LINK->pc - 1] - 33;
+						V.done = false;
+						break;
+
+					case 8:   /*pvar=x*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_vareq;
+						V.ip->ival = LINK->basepvar + getpnum(&V);
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					case 9:   /*pvar=not pvar*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_vareq;
+						V.ip->ival = LINK->basepvar + getpnum(&V);
+						newinstr(&V.ip->UU.U1.arg1, LINK);
+						V.ip->UU.U1.arg1->opcode = op_not;
+						newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
+						V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
+						V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
+						break;
+
+					case 10:   /*pvar=zero*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_vareq;
+						V.ip->ival = LINK->basepvar + getpnum(&V);
+						newinstr(&V.ip->UU.U1.arg1, LINK);
+						V.ip->UU.U1.arg1->opcode = op_zero;
+						break;
+
+					case 11:   /*pvar=one*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_vareq;
+						V.ip->ival = LINK->basepvar + getpnum(&V);
+						newinstr(&V.ip->UU.U1.arg1, LINK);
+						V.ip->UU.U1.arg1->opcode = op_one;
+						break;
+
+					case 12:   /*pin=PULLDN*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_pulldn;
+						V.ip->UU.U1.arg1 = parsepin(&V);
+						break;
+
+					case 13:   /*pin=PULLUP*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_pullup;
+						V.ip->UU.U1.arg1 = parsepin(&V);
+						break;
+
+					case 14:   /*high pin=x*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_pineq;
+						V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
+						LINK->pc++;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					case 15:   /*high pin<x*/
+						LINK->oldinstrcount++;
+						V.ip->opcode = op_pinoc;
+						V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
+						LINK->pc++;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					default:
+						badop(&V);
+						break;
+				}
+				break;
+
+			case 2:
+			case 3:   /*pin=x*/
+				LINK->oldinstrcount++;
+				V.ip->opcode = op_pineq;
+				V.ip->ival = findpin(V.ins - 31, &V);
+				V.ip->UU.U1.arg1 = parseterm(LINK);
+				break;
+
+			case 4:
+			case 5:   /*pin<x*/
+				LINK->oldinstrcount++;
+				V.ip->opcode = op_pinoc;
+				V.ip->ival = findpin(V.ins - 63, &V);
+				V.ip->UU.U1.arg1 = parseterm(LINK);
+				break;
+
+			case 6:   /*var=x*/
+				LINK->oldinstrcount++;
+				V.ip->opcode = op_vareq;
+				V.ip->ival = findvar(V.ins & 15, &V);
+				V.ip->UU.U1.arg1 = parseterm(LINK);
+				break;
+
+			case 7:   /*var=not var*/
+				LINK->oldinstrcount++;
+				V.ip->opcode = op_vareq;
+				V.ip->ival = findvar(V.ins & 15, &V);
+				newinstr(&V.ip->UU.U1.arg1, LINK);
+				V.ip->UU.U1.arg1->opcode = op_not;
+				newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
+				V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
+				V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
+				break;
+
+			case 8:   /*var=zero*/
+				LINK->oldinstrcount++;
+				V.ip->opcode = op_vareq;
+				V.ip->ival = findvar(V.ins & 15, &V);
+				newinstr(&V.ip->UU.U1.arg1, LINK);
+				V.ip->UU.U1.arg1->opcode = op_zero;
+				break;
+
+			case 9:   /*var=one*/
+				LINK->oldinstrcount++;
+				V.ip->opcode = op_vareq;
+				V.ip->ival = findvar(V.ins & 15, &V);
+				newinstr(&V.ip->UU.U1.arg1, LINK);
+				V.ip->UU.U1.arg1->opcode = op_one;
+				break;
+
+			case 10:
+			case 11:
+				switch (V.ins & 31)
+				{
+					case 0:   /*AND*/
+						V.ip->opcode = op_and;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						V.ip->UU.U1.arg2 = parseterm(LINK);
+						break;
+
+					case 1:   /*NAND*/
+						V.ip->opcode = op_nand;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						V.ip->UU.U1.arg2 = parseterm(LINK);
+						break;
+
+					case 2:   /*OR*/
+						V.ip->opcode = op_or;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						V.ip->UU.U1.arg2 = parseterm(LINK);
+						break;
+
+					case 3:   /*NOR*/
+						V.ip->opcode = op_nor;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						V.ip->UU.U1.arg2 = parseterm(LINK);
+						break;
+
+					case 4:   /*XOR*/
+						V.ip->opcode = op_xor;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						V.ip->UU.U1.arg2 = parseterm(LINK);
+						break;
+
+					case 5:   /*NOT*/
+						V.ip->opcode = op_not;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					case 6:   /*RISE*/
+						V.ip->opcode = op_rise;
+						V.ip->UU.U1.arg1 = parsepin(&V);
+						break;
+
+					case 7:   /*FALL*/
+						V.ip->opcode = op_fall;
+						V.ip->UU.U1.arg1 = parsepin(&V);
+						break;
+
+					case 8:   /*ZERO*/
+						V.ip->opcode = op_zero;
+						break;
+
+					case 9:
+					case 15:   /*ONE*/
+						V.ip->opcode = op_one;
+						break;
+
+					case 10:   /*SAME*/
+						V.ip->opcode = op_same;
+						V.ip->UU.U1.arg1 = parsepin(&V);
+						V.ip->UU.U1.arg2 = parsepin(&V);
+						break;
+
+					case 11:   /*ppin*/
+						V.ip->opcode = op_pin;
+						V.ip->ival = LINK->baseppin + getpnum(&V);
+						break;
+
+					case 12:   /*pvar*/
+						V.ip->opcode = op_var;
+						V.ip->ival = LINK->basepvar + getpnum(&V);
+						break;
+
+					case 13:   /*FIX*/
+						V.ip->opcode = op_fix0;
+						V.ip->UU.U1.arg1 = parseterm(LINK);
+						break;
+
+					case 14:   /*AMP*/
+						V.done = false;
+						break;
+
+					case 16:   /*high pin*/
+						V.ip->opcode = op_pin;
+						V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
+						LINK->pc++;
+						break;
+
+					case 17:   /*STRONG*/
+						V.ip->opcode = op_strong;
+						V.ip->UU.U1.arg1 = parsepin(&V);
+						break;
+
+					default:
+						badop(&V);
+						break;
+				}
+				break;
+
+			case 12:
+			case 13:   /*pin*/
+				V.ip->opcode = op_pin;
+				V.ip->ival = findpin(V.ins - 191, &V);
+				break;
+
+			case 14:   /*var*/
+				V.ip->opcode = op_var;
+				V.ip->ival = findvar(V.ins & 15, &V);
+				break;
+
+			case 15:   /*NOT var*/
+				V.ip->opcode = op_not;
+				newinstr(&V.ip->UU.U1.arg1, LINK);
+				V.ip->UU.U1.arg1->opcode = op_var;
+				V.ip->UU.U1.arg1->ival = findvar(V.ins & 15, &V);
+				break;
+
+			default:
+				badop(&V);
+				break;
+		}
+	} while (!V.done);
+	return V.ip;
 }
 
 
 /* Find out which pins are inputs and which are outputs */
-static void getpindata(pindata, numpins, proc, LINK)
-pdrec **pindata;
-long numpins;
-uchar *proc;
-struct LOC_compilepage *LINK;
+static void getpindata(pdrec **pindata, long numpins, uchar *proc, struct LOC_compilepage *LINK)
 {
-  long i, pc;
-  pdrec *WITH;
-
-  if (*pindata != NULL)
-    return;
-  *pindata = (pdrec *)Malloc(numpins * sizeof(pdrec));
-  for (i = 0; i < numpins; i++) {
-    WITH = &(*pindata)[i];
-    WITH->isinput = false;
-    WITH->isoutput = false;
-  }
-  pc = 1;
-  while (proc[pc - 1] != '\0') {
-    switch (proc[pc - 1]) {
-
-    case 30:
-    case 31:   /*output to high-numbered pin*/
-      (*pindata)[proc[pc]].isoutput = true;
-      pc += 2;
-      break;
-
-    case 176:   /*input from high-numbered pin*/
-      (*pindata)[proc[pc]].isinput = true;
-      pc += 2;
-      break;
-
-    case 28:
-    case 29:   /*pull-up or pull-down*/
-      pc++;
-      if (proc[pc - 1] == 176) {
-/* p2c: logsimh.text, line 1244: Note: character >= 128 encountered [281] */
-	(*pindata)[proc[pc]].isoutput = true;
-	pc += 2;
-      } else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223) {
-/* p2c: logsimh.text, line 1249: Note: character >= 128 encountered [281] */
-/* p2c: logsimh.text, line 1249: Note: character >= 128 encountered [281] */
-	(*pindata)[proc[pc - 1] & 31].isoutput = true;
-	pc++;
-      }
-      break;
-
-    case 16:
-    case 17:
-    case 24:
-    case 25:
-    case 26:
-    case 27:
-    case 171:
-    case 172:
-      pc += (proc[pc] >= 128) + 2;
-/* p2c: logsimh.text, line 1256: Note: character >= 128 encountered [281] */
-      break;
-
-    case 18:
-    case 22:
-    case 23:
-    case 170:
-      pc += length_16(proc, pc);
-      break;
-
-    default:
-      if (proc[pc - 1] >= 32 && proc[pc - 1] <= 95) {
-	/*output to low-numbered pin*/
-	(*pindata)[proc[pc - 1] & 31].isoutput = true;
-	pc++;
-      } else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223) {
-	/*input from low-numbered pin*/
-	(*pindata)[proc[pc - 1] & 31].isinput = true;
-	pc++;
-      } else
-	pc++;
-      break;
-    }
-  }
+	long i, pc;
+	pdrec *WITH;
+
+	if (*pindata != NULL)
+		return;
+
+	*pindata = (pdrec *)Malloc(numpins * sizeof(pdrec));
+	for (i = 0; i < numpins; i++)
+	{
+		WITH = &(*pindata)[i];
+		WITH->isinput = false;
+		WITH->isoutput = false;
+	}
+	pc = 1;
+	while (proc[pc - 1] != '\0')
+	{
+		switch (proc[pc - 1])
+		{
+			case 30:
+			case 31:   /*output to high-numbered pin*/
+				(*pindata)[proc[pc]].isoutput = true;
+				pc += 2;
+				break;
+
+			case 176:   /*input from high-numbered pin*/
+				(*pindata)[proc[pc]].isinput = true;
+				pc += 2;
+				break;
+
+			case 28:
+			case 29:   /*pull-up or pull-down*/
+				pc++;
+				if (proc[pc - 1] == 176)
+				{
+					(*pindata)[proc[pc]].isoutput = true;
+					pc += 2;
+				}
+				else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223)
+				{
+					(*pindata)[proc[pc - 1] & 31].isoutput = true;
+					pc++;
+				}
+				break;
+
+			case 16:
+			case 17:
+			case 24:
+			case 25:
+			case 26:
+			case 27:
+			case 171:
+			case 172:
+				pc += (proc[pc] >= 128) + 2;
+				break;
+
+			case 18:
+			case 22:
+			case 23:
+			case 170:
+				pc += length_16(proc, pc);
+				break;
+
+			default:
+				if (proc[pc - 1] >= 32 && proc[pc - 1] <= 95)
+				{
+					/*output to low-numbered pin*/
+					(*pindata)[proc[pc - 1] & 31].isoutput = true;
+					pc++;
+				}
+				else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223)
+				{
+					/*input from low-numbered pin*/
+					(*pindata)[proc[pc - 1] & 31].isinput = true;
+					pc++;
+				}
+				else
+				{
+					pc++;
+				}
+				break;
+		}
+	}
 }
 
 
-static long setbytes(bits, LINK)
-long bits;
-struct LOC_compilepage *LINK;
+static long setbytes(long bits, struct LOC_compilepage *LINK)
 {
-  return ((bits + 63) / 32 * 4);
+	return ((bits + 63) / 32 * 4);
 }
 
 /* Local variables for parsegates: */
 struct LOC_parsegates {
-  struct LOC_compilepage *LINK;
+	struct LOC_compilepage *LINK;
 } ;
 
-static void subupdate(g1, LINK)
-log_grec *g1;
-struct LOC_parsegates *LINK;
+static void subupdate(log_grec *g1, struct LOC_parsegates *LINK)
 {
-  log_nrec **ports;
-  long i;
-  log_action_t *WITH;
-  long FORLIM;
-
-  WITH = logsima_action.lact;
-  ports = (log_nrec **)Malloc(LINK->LINK->numports * sizeof(log_nrec *));
-  LINK->LINK->n = WITH->nbase;
-  while (LINK->LINK->n != NULL)
-  {   /*save global "node^.temp.i" for reentrant code*/
-    if ((long)LINK->LINK->n->temp != LONG_MIN)
-      ports[-(long)LINK->LINK->n->temp - 1] = LINK->LINK->n;
-    LINK->LINK->n = LINK->LINK->n->next;
-  }
-  updateinstance(g1);
-  LINK->LINK->n = WITH->nbase;
-  while (LINK->LINK->n != NULL) {   /*restore "node^.temp.i" information*/
-    LINK->LINK->n->temp = (na_long)LONG_MIN;
-    LINK->LINK->n = LINK->LINK->n->next;
-  }
-  FORLIM = LINK->LINK->numports;
-  for (i = 1; i <= FORLIM; i++)
-    ports[i - 1]->temp = (na_long)(-i);
+	log_nrec **ports;
+	long i;
+	log_action_t *WITH;
+	long FORLIM;
+
+	WITH = logsima_action.lact;
+	ports = (log_nrec **)Malloc(LINK->LINK->numports * sizeof(log_nrec *));
+	LINK->LINK->n = WITH->nbase;
+	while (LINK->LINK->n != NULL)
+	{   /*save global "node^.temp.i" for reentrant code*/
+		if ((long)LINK->LINK->n->temp != LONG_MIN)
+			ports[-(long)LINK->LINK->n->temp - 1] = LINK->LINK->n;
+		LINK->LINK->n = LINK->LINK->n->next;
+	}
+	updateinstance(g1);
+	LINK->LINK->n = WITH->nbase;
+	while (LINK->LINK->n != NULL)
+	{   /*restore "node^.temp.i" information*/
+		LINK->LINK->n->temp = (na_long)LONG_MIN;
+		LINK->LINK->n = LINK->LINK->n->next;
+	}
+	FORLIM = LINK->LINK->numports;
+	for (i = 1; i <= FORLIM; i++)
+		ports[i - 1]->temp = (na_long)(-i);
 }
 
 
-static void parsegates(LINK)
-struct LOC_compilepage *LINK;
+static void parsegates(struct LOC_compilepage *LINK)
 {
-  struct LOC_parsegates V;
-  long i, j, num, best, setsize, first, numg, previnstrcount;
-  long *defs, *tdefs;
-  log_grec *g1;
-  gaterec *glist;
-  instinfo *instii;
-  dependrec *dep;
-  instrrec *ip, **ipp;
-  log_16_kindinfo *ki;
-  int any;
-  gaterec *WITH;
-  char STR2[256];
-  long FORLIM, FORLIM1;
-  long SET[257];
-  long SET1[257];
-  long SET2[257];
-  pdrec *WITH1;
-  long SET3[257];
-  long SET4[257];
-
-
-  V.LINK = LINK;
-  /* Collect a list of all gates in the definition */
-  g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
-  i = 0;
-  while (g1 != NULL) {
-    if (gateinbox(LINK->mybox, g1) && g1 != LINK->gtempl) {
-      if (g1->kind->simtype == logsima_tool_16)
-	i++;
-      LINK->inertcount++;
-    }
-    g1 = g1->next;
-  }
-  glist = (gaterec *)Malloc(i * sizeof(gaterec));
-  numg = 0;
-  g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
-  while (g1 != NULL && LINK->okay) {
-    if (g1 != LINK->gtempl && g1->kind->simtype == logsima_tool_16 &&
-	gateinbox(LINK->mybox, g1) && !isinert(g1, LINK)) {
-      if (isinstance(g1) != NULL) {  /* a sub-instance gate */
-	subupdate(g1, &V);
-	instii = (instinfo *)g1->info;
-	if (instii->hdef->gtempl != g1) {  /* not a template gate */
-	  dep = LINK->hdef->depends;
-	  while (dep != NULL && dep->hdef != instii->hdef)
-	    dep = dep->next;
-	  if (dep == NULL) {
-	    dep = (dependrec *)Malloc(sizeof(dependrec));
-	    dep->hdef = instii->hdef;
-	    dep->hdefstamp = instii->hdef->curstamp;
-	    dep->next = LINK->hdef->depends;
-	    LINK->hdef->depends = dep;
-	  }
-	  if (instii->okay) {
-	    numg++;
-	    WITH = &glist[numg - 1];
-	    WITH->gp = g1;
-	    WITH->numpins = instii->hdef->numports;
-	    WITH->pins = instii->pins;
-	    WITH->pproc = instii->hdef->proc;
-	    if (LINK->optlevel >= 2)
-	      getpindata(&instii->hdef->pindata, (long)WITH->numpins,
-			 WITH->pproc, LINK);
-	    WITH->pd = instii->hdef->pindata;
-	    LINK->subcount++;
-	  } else {
-	    if (instii->hdef != LINK->hdef) {
-	      sprintf(STR2, "Sub-instance %s is not complete",
-		      instii->hdef->name);
-	      showcontrol(LINK->hdef, STR2);
-	    }
-	    LINK->okay = false;
-	  }
+	struct LOC_parsegates V;
+	long i, j, num, best, setsize, first, numg, previnstrcount;
+	long *defs, *tdefs;
+	log_grec *g1;
+	gaterec *glist;
+	instinfo *instii;
+	dependrec *dep;
+	instrrec *ip, **ipp;
+	log_16_kindinfo *ki;
+	int any;
+	gaterec *WITH;
+	char STR2[256];
+	long FORLIM, FORLIM1;
+	long SET[257];
+	long SET1[257];
+	long SET2[257];
+	pdrec *WITH1;
+	long SET3[257];
+	long SET4[257];
+
+
+	V.LINK = LINK;
+	/* Collect a list of all gates in the definition */
+	g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
+	i = 0;
+	while (g1 != NULL)
+	{
+		if (gateinbox(LINK->mybox, g1) && g1 != LINK->gtempl)
+		{
+			if (g1->kind->simtype == logsima_tool_16)
+				i++;
+			LINK->inertcount++;
+		}
+		g1 = g1->next;
 	}
-      } else {
-	numg++;
-	WITH = &glist[numg - 1];
-	WITH->gp = g1;
-	WITH->numpins = g1->kind->numpins;
-	WITH->pins = g1->pin;
-	WITH->pproc = g1->kind->proc;
-	ki = (log_16_kindinfo *)g1->kind->info;
-	if (LINK->optlevel >= 2)
-	  getpindata((pdrec **)(&ki->info), (long)WITH->numpins, WITH->pproc,
-		     LINK);
-	WITH->pd = (pdrec *)ki->info;
-      }
-    }
-    g1 = g1->next;
-  }
-
-  /* Assign numbers for internal nodes */
-  if (LINK->okay) {
-    for (i = 0; i < numg; i++) {
-      WITH = &glist[i];
-      FORLIM1 = WITH->numpins;
-      for (j = 0; j < FORLIM1; j++) {
-	if ((long)WITH->pins[j]->temp == LONG_MIN) {
-	  WITH->pins[j]->temp = (na_long)LINK->curppin;
-	  LINK->curppin++;
+	glist = (gaterec *)Malloc(i * sizeof(gaterec));
+	numg = 0;
+	g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
+	while (g1 != NULL && LINK->okay)
+	{
+		if (g1 != LINK->gtempl && g1->kind->simtype == logsima_tool_16 &&
+				gateinbox(LINK->mybox, g1) && !isinert(g1, LINK))
+		{
+			if (isinstance(g1) != NULL)
+			{  /* a sub-instance gate */
+				subupdate(g1, &V);
+				instii = (instinfo *)g1->info;
+				if (instii->hdef->gtempl != g1)
+				{  /* not a template gate */
+					dep = LINK->hdef->depends;
+					while (dep != NULL && dep->hdef != instii->hdef)
+						dep = dep->next;
+
+					if (dep == NULL)
+					{
+						dep = (dependrec *)Malloc(sizeof(dependrec));
+						dep->hdef = instii->hdef;
+						dep->hdefstamp = instii->hdef->curstamp;
+						dep->next = LINK->hdef->depends;
+						LINK->hdef->depends = dep;
+					}
+
+					if (instii->okay)
+					{
+						numg++;
+						WITH = &glist[numg - 1];
+						WITH->gp = g1;
+						WITH->numpins = instii->hdef->numports;
+						WITH->pins = instii->pins;
+						WITH->pproc = instii->hdef->proc;
+						if (LINK->optlevel >= 2)
+							getpindata(&instii->hdef->pindata, (long)WITH->numpins,
+									WITH->pproc, LINK);
+						WITH->pd = instii->hdef->pindata;
+						LINK->subcount++;
+					}
+					else
+					{
+						if (instii->hdef != LINK->hdef)
+						{
+							sprintf(STR2, "Sub-instance %s is not complete",
+									instii->hdef->name);
+							showcontrol(LINK->hdef, STR2);
+						}
+						LINK->okay = false;
+					}
+				}
+			}
+			else
+			{
+				numg++;
+				WITH = &glist[numg - 1];
+				WITH->gp = g1;
+				WITH->numpins = g1->kind->numpins;
+				WITH->pins = g1->pin;
+				WITH->pproc = g1->kind->proc;
+				ki = (log_16_kindinfo *)g1->kind->info;
+				if (LINK->optlevel >= 2)
+					getpindata((pdrec **)(&ki->info), (long)WITH->numpins, WITH->pproc,
+							LINK);
+				WITH->pd = (pdrec *)ki->info;
+			}
+		}
+		g1 = g1->next;
 	}
-      }
-    }
-  }
-
-  /* Sort gates into mostly "causal" order */
-  if (LINK->optlevel >= 2 && LINK->okay) {
-    setsize = setbytes(LINK->curppin + LINK->numports, LINK);
-    defs = (long *)Malloc(setsize);
-    P_addsetr(P_expset(defs, 0L), 0, (int)(LINK->numports - 1));
-    if (vddsig->np->simtype == logsima_tool_16 &&
-	(long)vddsig->np->temp != LONG_MIN)
-      P_addset(defs, (int)((long)vddsig->np->temp + LINK->numports));
-    if (gndsig->np->simtype == logsima_tool_16 &&
-	(long)gndsig->np->temp != LONG_MIN)
-      P_addset(defs, (int)((long)gndsig->np->temp + LINK->numports));
-    tdefs = (long *)Malloc(setsize);
-    for (i = 0; i < numg; i++) {
-      WITH = &glist[i];
-      WITH->ins = (long *)Malloc(setsize);
-      P_expset(WITH->ins, 0L);
-      WITH->outs = (long *)Malloc(setsize);
-      P_expset(WITH->outs, 0L);
-      FORLIM = WITH->numpins;
-      for (j = 0; j < FORLIM; j++) {
-	WITH1 = &WITH->pd[j];
-	num = (long)WITH->pins[j]->temp + LINK->numports;
-	if (num <= setmax) {
-	  if (WITH1->isinput)
-	    P_addset(WITH->ins, (int)num);
-	  if (WITH1->isoutput) {
-	    P_addset(WITH->outs, (int)num);
-	    if (num < LINK->numports)
-	      P_remset(defs, (int)num);
-	  }
+
+	/* Assign numbers for internal nodes */
+	if (LINK->okay)
+	{
+		for (i = 0; i < numg; i++)
+		{
+			WITH = &glist[i];
+			FORLIM1 = WITH->numpins;
+			for (j = 0; j < FORLIM1; j++)
+			{
+				if ((long)WITH->pins[j]->temp == LONG_MIN)
+				{
+					WITH->pins[j]->temp = (na_long)LINK->curppin;
+					LINK->curppin++;
+				}
+			}
+		}
 	}
-      }
-    }
-    first = 1;
-    while (first < numg) {
-      any = false;
-      i = first;
-      while (i <= numg) {
-	if (!P_subset(glist[i - 1].ins, defs)) {
-	  i++;
-	  continue;
+
+	/* Sort gates into mostly "causal" order */
+	if (LINK->optlevel >= 2 && LINK->okay)
+	{
+		setsize = setbytes(LINK->curppin + LINK->numports, LINK);
+		defs = (long *)Malloc(setsize);
+		P_addsetr(P_expset(defs, 0L), 0, (int)(LINK->numports - 1));
+		if (vddsig->np->simtype == logsima_tool_16 &&
+				(long)vddsig->np->temp != LONG_MIN)
+			P_addset(defs, (int)((long)vddsig->np->temp + LINK->numports));
+		if (gndsig->np->simtype == logsima_tool_16 &&
+				(long)gndsig->np->temp != LONG_MIN)
+			P_addset(defs, (int)((long)gndsig->np->temp + LINK->numports));
+		tdefs = (long *)Malloc(setsize);
+		for (i = 0; i < numg; i++)
+		{
+			WITH = &glist[i];
+			WITH->ins = (long *)Malloc(setsize);
+			P_expset(WITH->ins, 0L);
+			WITH->outs = (long *)Malloc(setsize);
+			P_expset(WITH->outs, 0L);
+			FORLIM = WITH->numpins;
+			for (j = 0; j < FORLIM; j++)
+			{
+				WITH1 = &WITH->pd[j];
+				num = (long)WITH->pins[j]->temp + LINK->numports;
+				if (num <= setmax) {
+					if (WITH1->isinput)
+						P_addset(WITH->ins, (int)num);
+					if (WITH1->isoutput) {
+						P_addset(WITH->outs, (int)num);
+						if (num < LINK->numports)
+							P_remset(defs, (int)num);
+					}
+				}
+			}
+		}
+		first = 1;
+		while (first < numg)
+		{
+			any = false;
+			i = first;
+			while (i <= numg)
+			{
+				if (!P_subset(glist[i - 1].ins, defs))
+				{
+					i++;
+					continue;
+				}
+
+				if (i == first)
+					i++;
+				else
+					na_exch((void *)(&glist[i - 1]), (void *)(&glist[first - 1]),
+							sizeof(gaterec));
+				P_setunion(defs, defs, glist[first - 1].outs);
+				first++;
+				any = true;
+			}
+
+			if (any)
+				continue;
+
+			best = LONG_MAX;
+			for (i = first; i <= numg; i++)
+			{
+				P_setdiff(tdefs, glist[i - 1].ins, defs);
+				num = na_setcard(tdefs);
+				if (num < best)
+				{
+					best = num;
+					j = i;
+				}
+			}
+			na_exch((void *)(&glist[j - 1]), (void *)(&glist[first - 1]),
+					sizeof(gaterec));
+			P_setunion(defs, defs, glist[first - 1].outs);
+			first++;
+		}
 	}
-	if (i == first)
-	  i++;
-	else
-	  na_exch((void *)(&glist[i - 1]), (void *)(&glist[first - 1]),
-		  sizeof(gaterec));
-	P_setunion(defs, defs, glist[first - 1].outs);
-	first++;
-	any = true;
-      }
-      if (any)
-	continue;
-      best = LONG_MAX;
-      for (i = first; i <= numg; i++) {
-	P_setdiff(tdefs, glist[i - 1].ins, defs);
-	num = na_setcard(tdefs);
-	if (num < best) {
-	  best = num;
-	  j = i;
+
+	/* Parse the GDL definitions of the gates */
+	ipp = &LINK->ipbase;
+	if (LINK->okay)
+	{
+		for (i = 0; i < numg; i++)
+		{
+			WITH = &glist[i];
+			LINK->g = WITH->gp;
+			LINK->proc = WITH->pproc;
+			LINK->gpins = WITH->pins;
+			LINK->baseppin = LINK->curppin;
+			LINK->basepvar = LINK->curpvar;
+			LINK->numvar = 0;
+			LINK->pc = 1;
+			while (LINK->okay && LINK->proc[LINK->pc - 1] != '\0')
+			{
+				previnstrcount = LINK->oldinstrcount;
+				LINK->ip1 = parseterm(LINK);
+				if (LINK->oldinstrcount > previnstrcount)
+					LINK->gatecount++;
+				if (LINK->ip1->opcode == op_zero)   /*more suitable "null" stmt*/
+					LINK->ip1->opcode = op_iffalse;
+				if (LINK->isverbose)
+				{
+					printf("parsed: ");
+					dumptree(stdout, LINK->ip1, NULL, LINK);
+				}
+				*ipp = LINK->ip1;
+				ipp = &LINK->ip1->UU.U1.next;
+			}
+			LINK->curpvar += LINK->numvar;
+		}
 	}
-      }
-      na_exch((void *)(&glist[j - 1]), (void *)(&glist[first - 1]),
-	      sizeof(gaterec));
-      P_setunion(defs, defs, glist[first - 1].outs);
-      first++;
-    }
-  }
-
-  /* Parse the GDL definitions of the gates */
-  ipp = &LINK->ipbase;
-  if (LINK->okay) {
-    for (i = 0; i < numg; i++) {
-      WITH = &glist[i];
-      LINK->g = WITH->gp;
-      LINK->proc = WITH->pproc;
-      LINK->gpins = WITH->pins;
-      LINK->baseppin = LINK->curppin;
-      LINK->basepvar = LINK->curpvar;
-      LINK->numvar = 0;
-      LINK->pc = 1;
-      while (LINK->okay && LINK->proc[LINK->pc - 1] != '\0') {
-	previnstrcount = LINK->oldinstrcount;
-	LINK->ip1 = parseterm(LINK);
-	if (LINK->oldinstrcount > previnstrcount)
-	  LINK->gatecount++;
-	if (LINK->ip1->opcode == op_zero)   /*more suitable "null" stmt*/
-	  LINK->ip1->opcode = op_iffalse;
-	if (LINK->isverbose) {
-	  printf("parsed: ");
-	  dumptree(stdout, LINK->ip1, NULL, LINK);
+	LINK->inertcount -= LINK->gatecount;
+	LINK->gatecount -= LINK->subcount;
+
+	/* Create bogus instrs to handle Vdd and Gnd */
+	if (!LINK->okay)
+		return;
+
+	if (vddsig->np->simtype == logsima_tool_16 &&
+			(long)vddsig->np->temp != LONG_MIN)
+	{
+		newinstr(&ip, LINK);
+		ip->UU.U1.next = LINK->ipbase;
+		ip->opcode = op_pineq;
+		ip->ival = (long)vddsig->np->temp;
+		newinstr(&ip->UU.U1.arg1, LINK);
+		ip->UU.U1.arg1->opcode = op_one;
+		LINK->ipbase = ip;
+		LINK->oldinstrcount++;
 	}
-	*ipp = LINK->ip1;
-	ipp = &LINK->ip1->UU.U1.next;
-      }
-      LINK->curpvar += LINK->numvar;
-    }
-  }
-  LINK->inertcount -= LINK->gatecount;
-  LINK->gatecount -= LINK->subcount;
-
-  /* Create bogus instrs to handle Vdd and Gnd */
-  if (!LINK->okay)
-    return;
-  if (vddsig->np->simtype == logsima_tool_16 &&
-      (long)vddsig->np->temp != LONG_MIN) {
-    newinstr(&ip, LINK);
-    ip->UU.U1.next = LINK->ipbase;
-    ip->opcode = op_pineq;
-    ip->ival = (long)vddsig->np->temp;
-    newinstr(&ip->UU.U1.arg1, LINK);
-    ip->UU.U1.arg1->opcode = op_one;
-    LINK->ipbase = ip;
-    LINK->oldinstrcount++;
-  }
-  if (gndsig->np->simtype != logsima_tool_16 ||
-      (long)gndsig->np->temp == LONG_MIN)
-    return;
-  newinstr(&ip, LINK);
-  ip->UU.U1.next = LINK->ipbase;
-  ip->opcode = op_pineq;
-  ip->ival = (long)gndsig->np->temp;
-  newinstr(&ip->UU.U1.arg1, LINK);
-  ip->UU.U1.arg1->opcode = op_zero;
-  LINK->ipbase = ip;
-  LINK->oldinstrcount++;
+
+	if (gndsig->np->simtype != logsima_tool_16 ||
+			(long)gndsig->np->temp == LONG_MIN)
+		return;
+
+	newinstr(&ip, LINK);
+	ip->UU.U1.next = LINK->ipbase;
+	ip->opcode = op_pineq;
+	ip->ival = (long)gndsig->np->temp;
+	newinstr(&ip->UU.U1.arg1, LINK);
+	ip->UU.U1.arg1->opcode = op_zero;
+	LINK->ipbase = ip;
+	LINK->oldinstrcount++;
 }  /*parsegates*/
 
 
 
 /* Simplify a procedure tree */
 
-static int checkconn(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static int checkconn(instrrec *ip, struct LOC_compilepage *LINK)
 {
-  int Result;
-
-  switch (ip->opcode) {
-
-  case op_and:
-  case op_nand:
-  case op_or:
-  case op_nor:
-  case op_xor:
-    Result = (checkconn(ip->UU.U1.arg1, LINK) ||
-	      checkconn(ip->UU.U1.arg2, LINK));
-    break;
-
-  case op_not:
-    Result = checkconn(ip->UU.U1.arg1, LINK);
-    break;
-
-  case op_same:
-  case op_var:
-  case op_fix0:
-  case op_fix1:
-  case op_rise:
-  case op_fall:
-    Result = true;
-    break;
-
-  case op_pin:
-  case op_pinref:
-    Result = (((1L << ((long)log_none)) &
-	       LINK->things[ip->ival + LINK->thingnodes].poss) == 0);
-    break;
-
-  default:
-    Result = false;
-    break;
-  }
-  return Result;
+	int Result;
+
+	switch (ip->opcode)
+	{
+		case op_and:
+		case op_nand:
+		case op_or:
+		case op_nor:
+		case op_xor:
+			Result = (checkconn(ip->UU.U1.arg1, LINK) ||
+					checkconn(ip->UU.U1.arg2, LINK));
+			break;
+
+		case op_not:
+			Result = checkconn(ip->UU.U1.arg1, LINK);
+			break;
+
+		case op_same:
+		case op_var:
+		case op_fix0:
+		case op_fix1:
+		case op_rise:
+		case op_fall:
+			Result = true;
+			break;
+
+		case op_pin:
+		case op_pinref:
+			Result = (((1L << ((long)log_none)) &
+						LINK->things[ip->ival + LINK->thingnodes].poss) == 0);
+			break;
+
+		default:
+			Result = false;
+			break;
+	}
+	return Result;
 }
 
-static int cmptrees(ip1, ip2, LINK)
-instrrec *ip1, *ip2;
-struct LOC_compilepage *LINK;
+static int cmptrees(instrrec *ip1, instrrec *ip2, struct LOC_compilepage *LINK)
 {
-  if (ip1 == NULL)
-    return (ip2 == NULL);
-  else if (ip2 == NULL)
-    return false;
-  else if (ip1->opcode != ip2->opcode)
-    return false;
-  else if (ip1->ival != ip2->ival &&
-	   ((1L << ((long)ip1->opcode)) &
-	    ((1L << ((long)op_pineq)) | (1L << ((long)op_pinoc)) |
-	     (1L << ((long)op_vareq)) | (1L << ((long)op_pin)) |
-	     (1L << ((long)op_pinref)) | (1L << ((long)op_var)))) != 0)
-/* p2c: logsimh.text, line 3879: Note:
- * Line breaker spent 4.0+1.00 seconds, 5000 tries on line 1761 [251] */
-    return false;
-  else if (!cmptrees(ip1->UU.U1.arg1, ip2->UU.U1.arg1, LINK))
-    return false;
-  else if (!cmptrees(ip1->UU.U1.arg2, ip2->UU.U1.arg2, LINK))
-    return false;
-  else if (!cmptrees(ip1->UU.U1.arg3, ip2->UU.U1.arg3, LINK))
-    return false;
-  else
-    return true;
+	if (ip1 == NULL)
+		return (ip2 == NULL);
+	else if (ip2 == NULL)
+		return false;
+	else if (ip1->opcode != ip2->opcode)
+		return false;
+	else if (ip1->ival != ip2->ival &&
+			((1L << ((long)ip1->opcode)) &
+			 ((1L << ((long)op_pineq)) | (1L << ((long)op_pinoc)) |
+			  (1L << ((long)op_vareq)) | (1L << ((long)op_pin)) |
+			  (1L << ((long)op_pinref)) | (1L << ((long)op_var)))) != 0)
+		return false;
+	else if (!cmptrees(ip1->UU.U1.arg1, ip2->UU.U1.arg1, LINK))
+		return false;
+	else if (!cmptrees(ip1->UU.U1.arg2, ip2->UU.U1.arg2, LINK))
+		return false;
+	else if (!cmptrees(ip1->UU.U1.arg3, ip2->UU.U1.arg3, LINK))
+		return false;
+	else
+		return true;
 }
 
-static int treecontains(ip1, ip2, LINK)
-instrrec *ip1, *ip2;
-struct LOC_compilepage *LINK;
+static int treecontains(instrrec *ip1, instrrec *ip2, struct LOC_compilepage *LINK)
 {
-  if (ip1 == NULL)
-    return false;
-  else
-    return (cmptrees(ip1, ip2, LINK) ||
-	    treecontains(ip1->UU.U1.arg1, ip2, LINK) ||
-	    treecontains(ip1->UU.U1.arg2, ip2, LINK) ||
-	    treecontains(ip1->UU.U1.arg3, ip2, LINK));
+	if (ip1 == NULL)
+		return false;
+	else
+		return (cmptrees(ip1, ip2, LINK) ||
+				treecontains(ip1->UU.U1.arg1, ip2, LINK) ||
+				treecontains(ip1->UU.U1.arg2, ip2, LINK) ||
+				treecontains(ip1->UU.U1.arg3, ip2, LINK));
 }
 
-static int treerefers(ip, num, LINK)
-instrrec *ip;
-long num;
-struct LOC_compilepage *LINK;
+static int treerefers(instrrec *ip, long num, struct LOC_compilepage *LINK)
 {
-  int Result;
-
-  if (ip == NULL)
-    return false;
-  if (treerefers(ip->UU.U1.arg1, num, LINK) ||
-      treerefers(ip->UU.U1.arg2, num, LINK) ||
-      treerefers(ip->UU.U1.arg3, num, LINK))
-    return true;
-  switch (ip->opcode) {
-
-  case op_pin:
-  case op_pinref:
-  case op_pineq:
-  case op_pinoc:
-    Result = (num == ip->ival + LINK->thingnodes);
-    break;
-
-  /*$if false$
-               op_pin:
-                  if (num = ip^.ival + thingnodes) then
-                     treerefers := true
-                  else
-                     begin
-                        treerefers := false;
-                        with things^[ip^.ival + thingnodes] do
-                           if hasstats and (defn <> nil) and
-                              optdelay and (wasdef = 1) and
-                              (defn^.opcode = op_pineq) then
-                              begin
-                                 wasdef := 2;   {avoid recursion}
-                                 if treerefers(defn^.arg1, num) then
-                                    treerefers := true;
-                                 wasdef := 1;
-                              end;
-                     end;
+	int Result;
+
+	if (ip == NULL)
+		return false;
+	if (treerefers(ip->UU.U1.arg1, num, LINK) ||
+			treerefers(ip->UU.U1.arg2, num, LINK) ||
+			treerefers(ip->UU.U1.arg3, num, LINK))
+		return true;
+	switch (ip->opcode)
+	{
+		case op_pin:
+		case op_pinref:
+		case op_pineq:
+		case op_pinoc:
+			Result = (num == ip->ival + LINK->thingnodes);
+			break;
+
+			/*$if false$
+op_pin:
+if (num = ip^.ival + thingnodes) then
+treerefers := true
+else
+begin
+treerefers := false;
+with things^[ip^.ival + thingnodes] do
+if hasstats and (defn <> nil) and
+optdelay and (wasdef = 1) and
+(defn^.opcode = op_pineq) then
+begin
+wasdef := 2;   {avoid recursion}
+if treerefers(defn^.arg1, num) then
+treerefers := true;
+wasdef := 1;
+end;
+end;
 $end$*/
-  case op_var:
-  case op_vareq:
-    Result = (num == ip->ival + LINK->thingvars);
-    break;
-
-  default:
-    Result = false;
-    break;
-  }
-  return Result;
+		case op_var:
+		case op_vareq:
+			Result = (num == ip->ival + LINK->thingvars);
+			break;
+
+		default:
+			Result = false;
+			break;
+	}
+	return Result;
 }
 
-int cyclicdefn(ip, num, inside, LINK)
-instrrec *ip;
-long num;
-int inside;
-struct LOC_compilepage *LINK;
+int cyclicdefn(instrrec *ip, long num, int inside, struct LOC_compilepage *LINK)
 {
-  int Result;
-  noderec *WITH;
-
-  if (ip == NULL)
-    return false;
-  if (cyclicdefn(ip->UU.U1.arg1, num, inside, LINK) ||
-      cyclicdefn(ip->UU.U1.arg2, num, inside, LINK) ||
-      cyclicdefn(ip->UU.U1.arg3, num, inside, LINK))
-    return true;
-  switch (ip->opcode) {
-
-  case op_pin:
-    if (ip->ival + LINK->thingnodes == num && inside)
-      Result = true;
-    else {
-      WITH = &LINK->things[ip->ival + LINK->thingnodes];
-      if (LINK->hasstats && WITH->defn != NULL && LINK->optdelay &&
-	  WITH->wasdef == 1 && WITH->defn->opcode == op_pineq) {
-	WITH->wasdef = 2;   /*avoid recursion*/
-	Result = cyclicdefn(WITH->defn->UU.U1.arg1, num, true, LINK);
-	WITH->wasdef = 1;
-      } else
-	Result = false;
-    }
-    break;
-
-  default:
-    Result = false;
-    break;
-  }
-  return Result;
+	int Result;
+	noderec *WITH;
+
+	if (ip == NULL)
+		return false;
+	if (cyclicdefn(ip->UU.U1.arg1, num, inside, LINK) ||
+			cyclicdefn(ip->UU.U1.arg2, num, inside, LINK) ||
+			cyclicdefn(ip->UU.U1.arg3, num, inside, LINK))
+		return true;
+	switch (ip->opcode)
+	{
+		case op_pin:
+			if (ip->ival + LINK->thingnodes == num && inside)
+			{
+				Result = true;
+			}
+			else
+			{
+				WITH = &LINK->things[ip->ival + LINK->thingnodes];
+				if (LINK->hasstats && WITH->defn != NULL && LINK->optdelay &&
+						WITH->wasdef == 1 && WITH->defn->opcode == op_pineq)
+				{
+					WITH->wasdef = 2;   /*avoid recursion*/
+					Result = cyclicdefn(WITH->defn->UU.U1.arg1, num, true, LINK);
+					WITH->wasdef = 1;
+				}
+				else
+				{
+					Result = false;
+				}
+			}
+			break;
+
+		default:
+			Result = false;
+			break;
+	}
+	return Result;
 }
 
-static void swapinstrs(ip1, ip2, LINK)
-instrrec **ip1, **ip2;
-struct LOC_compilepage *LINK;
+static void swapinstrs(instrrec **ip1, instrrec **ip2, struct LOC_compilepage *LINK)
 {
-  instrrec *iptemp;
+	instrrec *iptemp;
 
-  iptemp = *ip1;
-  *ip1 = *ip2;
-  *ip2 = iptemp;
-  LINK->changed = true;
+	iptemp = *ip1;
+	*ip1 = *ip2;
+	*ip2 = iptemp;
+	LINK->changed = true;
 }
 
-static instrrec *makeinstr0(code, LINK)
-instrops code;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr0(instrops code, struct LOC_compilepage *LINK)
 {
-  instrrec *ip;
-
-  ip = (instrrec *)Malloc(sizeof(instrrec));
-  ip->opcode = code;
-  ip->UU.U1.arg1 = NULL;
-  ip->UU.U1.arg2 = NULL;
-  ip->UU.U1.arg3 = NULL;
-  ip->UU.U1.next = NULL;
-  LINK->changed = true;
-  return ip;
+	instrrec *ip;
+
+	ip = (instrrec *)Malloc(sizeof(instrrec));
+	ip->opcode = code;
+	ip->UU.U1.arg1 = NULL;
+	ip->UU.U1.arg2 = NULL;
+	ip->UU.U1.arg3 = NULL;
+	ip->UU.U1.next = NULL;
+	LINK->changed = true;
+	return ip;
 }
 
-static instrrec *makeinstr1(code, a1, LINK)
-instrops code;
-instrrec *a1;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr1(instrops code, instrrec *a1, struct LOC_compilepage *LINK)
 {
-  instrrec *ip;
-
-  ip = (instrrec *)Malloc(sizeof(instrrec));
-  ip->opcode = code;
-  ip->UU.U1.arg1 = a1;
-  ip->UU.U1.arg2 = NULL;
-  ip->UU.U1.arg3 = NULL;
-  ip->UU.U1.next = NULL;
-  LINK->changed = true;
-  return ip;
+	instrrec *ip;
+
+	ip = (instrrec *)Malloc(sizeof(instrrec));
+	ip->opcode = code;
+	ip->UU.U1.arg1 = a1;
+	ip->UU.U1.arg2 = NULL;
+	ip->UU.U1.arg3 = NULL;
+	ip->UU.U1.next = NULL;
+	LINK->changed = true;
+	return ip;
 }
 
-static instrrec *makeinstr2(code, a1, a2, LINK)
-instrops code;
-instrrec *a1, *a2;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr2(instrops code, instrrec *a1, instrrec *a2, struct LOC_compilepage *LINK)
 {
-  instrrec *ip;
-
-  ip = (instrrec *)Malloc(sizeof(instrrec));
-  ip->opcode = code;
-  ip->UU.U1.arg1 = a1;
-  ip->UU.U1.arg2 = a2;
-  ip->UU.U1.arg3 = NULL;
-  ip->UU.U1.next = NULL;
-  LINK->changed = true;
-  return ip;
+	instrrec *ip;
+
+	ip = (instrrec *)Malloc(sizeof(instrrec));
+	ip->opcode = code;
+	ip->UU.U1.arg1 = a1;
+	ip->UU.U1.arg2 = a2;
+	ip->UU.U1.arg3 = NULL;
+	ip->UU.U1.next = NULL;
+	LINK->changed = true;
+	return ip;
 }
 
-static instrrec *makeinstr3(code, a1, a2, a3, LINK)
-instrops code;
-instrrec *a1, *a2, *a3;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr3(instrops code, instrrec *a1, instrrec *a2, instrrec *a3, struct LOC_compilepage *LINK)
 {
-  instrrec *ip;
-
-  ip = (instrrec *)Malloc(sizeof(instrrec));
-  ip->opcode = code;
-  ip->UU.U1.arg1 = a1;
-  ip->UU.U1.arg2 = a2;
-  ip->UU.U1.arg3 = a3;
-  ip->UU.U1.next = NULL;
-  LINK->changed = true;
-  return ip;
+	instrrec *ip;
+
+	ip = (instrrec *)Malloc(sizeof(instrrec));
+	ip->opcode = code;
+	ip->UU.U1.arg1 = a1;
+	ip->UU.U1.arg2 = a2;
+	ip->UU.U1.arg3 = a3;
+	ip->UU.U1.next = NULL;
+	LINK->changed = true;
+	return ip;
 }
 
 static instrrec *makefix0(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+	instrrec *arg;
+	struct LOC_compilepage *LINK;
 {
-  return (makeinstr1(op_fix0, arg, LINK));
+	return (makeinstr1(op_fix0, arg, LINK));
 }
 
 static instrrec *makefix1(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+	instrrec *arg;
+	struct LOC_compilepage *LINK;
 {
-  return (makeinstr1(op_fix1, arg, LINK));
+	return (makeinstr1(op_fix1, arg, LINK));
 }
 
 static instrrec *copytree(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+	instrrec *ip;
+	struct LOC_compilepage *LINK;
 {
-  instrrec *Result, *ip2;
-  noderec *WITH;
-
-  if (ip == NULL)
-    return NULL;
-  ip2 = (instrrec *)Malloc(sizeof(instrrec));
-  ip2->opcode = ip->opcode;
-  ip2->ival = ip->ival;
-  ip2->UU.U1.arg1 = copytree(ip->UU.U1.arg1, LINK);
-  ip2->UU.U1.arg2 = copytree(ip->UU.U1.arg2, LINK);
-  ip2->UU.U1.arg3 = copytree(ip->UU.U1.arg3, LINK);
-  ip2->UU.U1.next = copytree(ip->UU.U1.next, LINK);
-  Result = ip2;
-  switch (ip2->opcode) {
-
-  case op_pin:
-  case op_pinref:
-    WITH = &LINK->things[ip->ival + LINK->thingnodes];
-    WITH->wasused++;
-    break;
-
-  case op_var:
-    WITH = &LINK->things[ip->ival + LINK->thingvars];
-    WITH->wasused++;
-    break;
-
-  default:
-    break;
-  }
-  return Result;
+	instrrec *Result, *ip2;
+	noderec *WITH;
+
+	if (ip == NULL)
+		return NULL;
+	ip2 = (instrrec *)Malloc(sizeof(instrrec));
+	ip2->opcode = ip->opcode;
+	ip2->ival = ip->ival;
+	ip2->UU.U1.arg1 = copytree(ip->UU.U1.arg1, LINK);
+	ip2->UU.U1.arg2 = copytree(ip->UU.U1.arg2, LINK);
+	ip2->UU.U1.arg3 = copytree(ip->UU.U1.arg3, LINK);
+	ip2->UU.U1.next = copytree(ip->UU.U1.next, LINK);
+	Result = ip2;
+	switch (ip2->opcode)
+	{
+		case op_pin:
+		case op_pinref:
+			WITH = &LINK->things[ip->ival + LINK->thingnodes];
+			WITH->wasused++;
+			break;
+
+		case op_var:
+			WITH = &LINK->things[ip->ival + LINK->thingvars];
+			WITH->wasused++;
+			break;
+
+		default:
+			break;
+	}
+	return Result;
 }
 
-static void replacetree(ip, ip2, LINK)
-instrrec **ip, *ip2;
-struct LOC_compilepage *LINK;
+static void replacetree(instrrec **ip, instrrec **ip2, struct LOC_compilepage *LINK)
 {
-  disposetree(ip, LINK);
-  *ip = ip2;
-  LINK->changed = true;
+	disposetree(ip, LINK);
+	*ip = ip2;
+	LINK->changed = true;
 }
 
-static void chgop(ip, opc, LINK)
-instrrec *ip;
-instrops opc;
-struct LOC_compilepage *LINK;
+static void chgop(instrrec *ip, instrops opc, struct LOC_compilepage *LINK)
 {
-  if (ip->opcode != opc) {
-    ip->opcode = opc;
-    LINK->changed = true;
-  }
+	if (ip->opcode != opc)
+	{
+		ip->opcode = opc;
+		LINK->changed = true;
+	}
 }
 
-static void killstmt(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static void killstmt(instrrec *ip, struct LOC_compilepage *LINK)
 {
-  ip->opcode = op_iffalse;
-  LINK->changed = true;
-  disposetree(&ip->UU.U1.arg1, LINK);
-  disposetree(&ip->UU.U1.arg2, LINK);
-  disposetree(&ip->UU.U1.arg3, LINK);
+	ip->opcode = op_iffalse;
+	LINK->changed = true;
+	disposetree(&ip->UU.U1.arg1, LINK);
+	disposetree(&ip->UU.U1.arg2, LINK);
+	disposetree(&ip->UU.U1.arg3, LINK);
 }
 
 /* Change in "goodness" if we did makenot(arg) */
-static long invertable(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+static long invertable(instrrec *arg, struct LOC_compilepage *LINK)
 {
-  long Result;
-
-  switch (arg->opcode) {
-
-  case op_and:
-  case op_nand:
-  case op_or:
-  case op_nor:
-  case op_one:
-  case op_zero:
-  case op_none:
-    Result = 0;
-    break;
-
-  case op_xor:
-    Result = invertable(arg->UU.U1.arg1, LINK) + invertable(arg->UU.U1.arg2, LINK);
-    break;
-
-  case op_not:
-    if (LINK->truevars && arg->UU.U1.arg1->opcode == op_var &&
-	arg->UU.U1.arg1->ival < 16)
-      Result = 0;   /*doesn't help since NOT V is primitive*/
-    else
-      Result = 1;
-    break;
-
-  case op_var:
-    if (LINK->truevars && arg->ival < 16)
-      Result = 0;
-    else
-      Result = -1;
-    break;
-
-  default:
-    Result = -1;
-    break;
-  }
-  return Result;
+	long Result;
+
+	switch (arg->opcode)
+	{
+		case op_and:
+		case op_nand:
+		case op_or:
+		case op_nor:
+		case op_one:
+		case op_zero:
+		case op_none:
+			Result = 0;
+			break;
+
+		case op_xor:
+			Result = invertable(arg->UU.U1.arg1, LINK) + invertable(arg->UU.U1.arg2, LINK);
+			break;
+
+		case op_not:
+			if (LINK->truevars && arg->UU.U1.arg1->opcode == op_var &&
+					arg->UU.U1.arg1->ival < 16)
+				Result = 0;   /*doesn't help since NOT V is primitive*/
+			else
+				Result = 1;
+			break;
+
+		case op_var:
+			if (LINK->truevars && arg->ival < 16)
+				Result = 0;
+			else
+				Result = -1;
+			break;
+
+		default:
+			Result = -1;
+			break;
+	}
+	return Result;
 }
 
-static instrrec *makenot(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+static instrrec *makenot(instrrec *arg, struct LOC_compilepage *LINK)
 {
-  instrrec *Result;
-
-  switch (arg->opcode) {
-
-  case op_not:
-    Result = arg->UU.U1.arg1;
-    Free(arg);
-    break;
-
-  case op_xor:
-    if (invertable(arg->UU.U1.arg1, LINK) >= 0) {
-      arg->UU.U1.arg1 = makenot(arg->UU.U1.arg1, LINK);
-      Result = arg;
-    } else if (invertable(arg->UU.U1.arg2, LINK) >= 0) {
-      arg->UU.U1.arg2 = makenot(arg->UU.U1.arg2, LINK);
-      Result = arg;
-    } else
-      Result = makeinstr1(op_not, arg, LINK);
-    break;
-
-  default:
-    Result = makeinstr1(op_not, arg, LINK);
-    break;
-  }
-  LINK->changed = true;
-  return Result;
+	instrrec *Result;
+
+	switch (arg->opcode)
+	{
+		case op_not:
+			Result = arg->UU.U1.arg1;
+			Free(arg);
+			break;
+
+		case op_xor:
+			if (invertable(arg->UU.U1.arg1, LINK) >= 0)
+			{
+				arg->UU.U1.arg1 = makenot(arg->UU.U1.arg1, LINK);
+				Result = arg;
+			}
+			else if (invertable(arg->UU.U1.arg2, LINK) >= 0)
+			{
+				arg->UU.U1.arg2 = makenot(arg->UU.U1.arg2, LINK);
+				Result = arg;
+			}
+			else
+			{
+				Result = makeinstr1(op_not, arg, LINK);
+			}
+			break;
+
+		default:
+			Result = makeinstr1(op_not, arg, LINK);
+			break;
+	}
+	LINK->changed = true;
+	return Result;
 }
 
-static long exprcost(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static long exprcost(instrrec *ip, struct LOC_compilepage *LINK)
 {
-  long Result;
+	long Result;
 
-  if (ip == NULL)
-    return 0;
-  switch (ip->opcode) {
+	if (ip == NULL)
+		return 0;
 
-  case op_var:
-    Result = 20000;
-    break;
+	switch (ip->opcode)
+	{
+		case op_var:
+			Result = 20000;
+			break;
 
-  default:
-    Result = exprcost(ip->UU.U1.arg1, LINK) + exprcost(ip->UU.U1.arg2, LINK) + 1;
-    break;
-  }
-  return Result;
+		default:
+			Result = exprcost(ip->UU.U1.arg1, LINK) + exprcost(ip->UU.U1.arg2, LINK) + 1;
+			break;
+	}
+	return Result;
 }
 
-static long expansioncost(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static long expansioncost(instrrec *ip, struct LOC_compilepage *LINK)
 {
-  long Result, c;
-
-  c = exprcost(ip, LINK);
-  switch (c) {
-
-  case 0:
-  case 1:
-    Result = 10000;
-    break;
-
-  case 2:
-  case 3:
-    Result = 20;
-    break;
-
-  case 4:
-  case 5:
-    Result = 2;
-    break;
-
-  default:
-    Result = (c < 10000);
-    break;
-  }
-  return Result;
+	long Result, c;
+
+	c = exprcost(ip, LINK);
+	switch (c)
+	{
+		case 0:
+		case 1:
+			Result = 10000;
+			break;
+
+		case 2:
+		case 3:
+			Result = 20;
+			break;
+
+		case 4:
+		case 5:
+			Result = 2;
+			break;
+
+		default:
+			Result = (c < 10000);
+			break;
+	}
+	return Result;
 }
 
 /* Local variables for simplify: */
 struct LOC_simplify {
-  struct LOC_compilepage *LINK;
-  long simplevel;
-  trailrec *tbase;
+	struct LOC_compilepage *LINK;
+	long simplevel;
+	trailrec *tbase;
 } ;
 
-static void chgposs2(i, newposs, newstrong, LINK)
-long i;
-long newposs;
-int newstrong;
-struct LOC_simplify *LINK;
+static void chgposs2(long i, long newposs, int newstrong, struct LOC_simplify *LINK)
 {
-  trailrec *t, **tp;
-  noderec *WITH;
-
-  WITH = &LINK->LINK->things[i];
-  if (WITH->poss == newposs && WITH->strong == newstrong)
-    return;
-  if (WITH->level != LINK->simplevel) {
-    tp = &LINK->tbase;
-    while (*tp != NULL && (*tp)->num < i)
-      tp = &(*tp)->next;
-    t = (trailrec *)Malloc(sizeof(trailrec));
-    t->num = i;
-    t->oldposs = WITH->poss;
-    t->oldstrong = WITH->strong;
-    t->oldlevel = WITH->level;
-    t->next = *tp;
-    *tp = t;
-    WITH->level = LINK->simplevel;
-  }
-  WITH->poss = newposs;
-  WITH->strong = newstrong;
+	trailrec *t, **tp;
+	noderec *WITH;
+
+	WITH = &LINK->LINK->things[i];
+	if (WITH->poss == newposs && WITH->strong == newstrong)
+		return;
+
+	if (WITH->level != LINK->simplevel)
+	{
+		tp = &LINK->tbase;
+		while (*tp != NULL && (*tp)->num < i)
+			tp = &(*tp)->next;
+	
+		t = (trailrec *)Malloc(sizeof(trailrec));
+		t->num = i;
+		t->oldposs = WITH->poss;
+		t->oldstrong = WITH->strong;
+		t->oldlevel = WITH->level;
+		t->next = *tp;
+		*tp = t;
+		WITH->level = LINK->simplevel;
+	}
+
+	WITH->poss = newposs;
+	WITH->strong = newstrong;
 }
 
-static void chgposs(i, newposs, LINK)
-long i;
-long newposs;
-struct LOC_simplify *LINK;
+static void chgposs(long i, long newposs, struct LOC_simplify *LINK)
 {
-  chgposs2(i, newposs, LINK->LINK->things[i].strong, LINK);
+	chgposs2(i, newposs, LINK->LINK->things[i].strong, LINK);
 }
 
-static void arith(ip, ident, LINK)
-instrrec **ip;
-instrops ident;
-struct LOC_simplify *LINK;
+static void arith(instrrec **ip, instrops ident, struct LOC_simplify *LINK)
 {
-  /* Move more complicated argument to arg2 */
-  if ((*ip)->UU.U1.arg1->UU.U1.arg1 != NULL &&
-      (*ip)->UU.U1.arg2->UU.U1.arg1 == NULL)
-    swapinstrs(&(*ip)->UU.U1.arg1, &(*ip)->UU.U1.arg2, LINK->LINK);
-
+	/* Move more complicated argument to arg2 */
+	if ((*ip)->UU.U1.arg1->UU.U1.arg1 != NULL &&
+			(*ip)->UU.U1.arg2->UU.U1.arg1 == NULL)
+		swapinstrs(&(*ip)->UU.U1.arg1, &(*ip)->UU.U1.arg2, LINK->LINK);
 }
 
-static void simplexpr(ip, nonelike, LINK)
-instrrec **ip;
-log_16_value nonelike;
-struct LOC_simplify *LINK;
+static void simplexpr(instrrec **ip, log_16_value nonelike, struct LOC_simplify *LINK)
 {
-  int oldch;
-  long i;
-  noderec *WITH;
-
-  oldch = LINK->LINK->changed;
-  if (*ip != NULL) {
-    do {
-      LINK->LINK->changed = false;
-      switch ((*ip)->opcode) {
-
-      case op_and:
-	simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
-	simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_one)
-	  replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-				   LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_one)
-	  replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				   LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_none)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
-		 (*ip)->UU.U1.arg2->opcode == op_zero)
-	  chgop(*ip, op_zero, LINK->LINK);
-	else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
-		 invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
-	  replacetree(ip, makeinstr2(op_nor,
-	      makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
-	      makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
-	      LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
-	  replacetree(ip, makefix1(makeinstr2(op_and,
-			  copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
-	  replacetree(ip, makefix1(makeinstr2(op_and,
-			  copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	else
-	  arith(ip, op_one, LINK);
-	break;
-
-      case op_nand:
-	simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
-	simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_one)
-	  replacetree(ip,
-	    makenot(makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			     LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-				  LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_one)
-	  replacetree(ip,
-	    makenot(makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			     LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_none)
-	  replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				  LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
-		 (*ip)->UU.U1.arg2->opcode == op_zero)
-	  chgop(*ip, op_one, LINK->LINK);
-	else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
-		 invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
-	  replacetree(ip, makeinstr2(op_or,
-	      makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
-	      makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
-	      LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
-	  replacetree(ip, makefix0(makeinstr2(op_nand,
-			  copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
-	  replacetree(ip, makefix0(makeinstr2(op_nand,
-			  copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
-	  replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				  LINK->LINK), LINK->LINK);
-	else
-	  arith(ip, op_one, LINK);
-	break;
-
-      case op_or:
-	simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
-	simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_zero)
-	  replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-				   LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_zero)
-	  replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				   LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_none)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_one ||
-		 (*ip)->UU.U1.arg2->opcode == op_one)
-	  chgop(*ip, op_one, LINK->LINK);
-	else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
-		 invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
-	  replacetree(ip, makeinstr2(op_nand,
-	      makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
-	      makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
-	      LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
-	  replacetree(ip, makefix0(makeinstr2(op_or,
-			  copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
-	  replacetree(ip, makefix0(makeinstr2(op_or,
-			  copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	else
-	  arith(ip, op_zero, LINK);
-	break;
-
-      case op_nor:
-	simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
-	simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_zero)
-	  replacetree(ip,
-	    makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			     LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-				  LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_zero)
-	  replacetree(ip,
-	    makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			     LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_none)
-	  replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				  LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_one ||
-		 (*ip)->UU.U1.arg2->opcode == op_one)
-	  chgop(*ip, op_zero, LINK->LINK);
-	else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
-		 invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
-	  replacetree(ip, makeinstr2(op_and,
-	      makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
-	      makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
-	      LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
-	  replacetree(ip, makefix1(makeinstr2(op_nor,
-			  copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
-	  replacetree(ip, makefix1(makeinstr2(op_nor,
-			  copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
-	  replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				  LINK->LINK), LINK->LINK);
-	else
-	  arith(ip, op_zero, LINK);
-	break;
-
-      case op_xor:
-	simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
-	simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_zero)
-	  replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-				   LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_one)
-	  replacetree(ip,
-	    makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			     LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_zero)
-	  replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-				   LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_one)
-	  replacetree(ip,
-	    makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			     LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_none)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
-		 invertable((*ip)->UU.U1.arg2, LINK->LINK) > 1)
-	  replacetree(ip, makenot(makeinstr2(op_xor,
-		makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
-		makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
-		LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
-	  replacetree(ip, makefix0(makeinstr2(op_xor,
-			  copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
-	  replacetree(ip, makefix0(makeinstr2(op_xor,
-			  copytree((*ip)->UU.U1.arg1, LINK->LINK),
-			  copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
-			  LINK->LINK), LINK->LINK), LINK->LINK);
-	else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
-	  chgop(*ip, op_zero, LINK->LINK);
-	else
-	  arith(ip, op_zero, LINK);
-	break;
-
-      case op_same:
-	if ((*ip)->UU.U1.arg1->ival == (*ip)->UU.U1.arg2->ival)
-	  chgop(*ip, op_one, LINK->LINK);
-	else if ((*ip)->UU.U1.arg1->ival >= 0 || (*ip)->UU.U1.arg2->ival >= 0)
-	  chgop(*ip, op_zero, LINK->LINK);
-	break;
-
-      case op_rise:
-      case op_fall:
-	WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
-	if ((((1L << ((long)log_zero)) | (1L << ((long)log_one))) &
-	     (~WITH->poss)) != 0)
-	  chgop(*ip, op_zero, LINK->LINK);
-	break;
-
-      case op_not:
-	simplexpr(&(*ip)->UU.U1.arg1, unarynot[(long)nonelike], LINK);
-	switch ((*ip)->UU.U1.arg1->opcode) {
-
-	case op_and:
-	  replacetree(ip, makeinstr2(op_nand,
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
-			LINK->LINK), LINK->LINK);
-	  break;
-
-	case op_nand:
-	  replacetree(ip, makeinstr2(op_and,
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
-			LINK->LINK), LINK->LINK);
-	  break;
-
-	case op_or:
-	  replacetree(ip, makeinstr2(op_nor,
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
-			LINK->LINK), LINK->LINK);
-	  break;
-
-	case op_nor:
-	  replacetree(ip, makeinstr2(op_or,
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-			copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
-			LINK->LINK), LINK->LINK);
-	  break;
-
-	case op_not:
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
-		      LINK->LINK);
-	  break;
-
-	case op_fix0:
-	  replacetree(ip,
-	    makefix1(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
-				      LINK->LINK), LINK->LINK), LINK->LINK),
-	    LINK->LINK);
-	  break;
-
-	case op_fix1:
-	  replacetree(ip,
-	    makefix0(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
-				      LINK->LINK), LINK->LINK), LINK->LINK),
-	    LINK->LINK);
-	  break;
-
-	case op_one:
-	  chgop(*ip, op_zero, LINK->LINK);
-	  break;
-
-	case op_zero:
-	  chgop(*ip, op_one, LINK->LINK);
-	  break;
-
-	case op_none:
-	  chgop(*ip, op_none, LINK->LINK);
-	  break;
-
-	default:
-	  break;
-	}
-	break;
-
-      case op_fix0:
-	simplexpr(&(*ip)->UU.U1.arg1, log_zero, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  chgop(*ip, op_zero, LINK->LINK);
-	else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
-		  ((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
-	  chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
-	else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
-		 nonelike == log_zero)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	break;
-
-      case op_fix1:
-	simplexpr(&(*ip)->UU.U1.arg1, log_one, LINK);
-	if ((*ip)->UU.U1.arg1->opcode == op_none)
-	  chgop(*ip, op_one, LINK->LINK);
-	else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
-		  ((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
-	  chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
-	else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
-		 nonelike == log_one)
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	break;
-
-      case op_strong:
-	WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
-	if (WITH->wasstrong) {
-	  replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	  chgop(*ip, op_pin, LINK->LINK);   /*from op_pinref*/
+	int oldch;
+	long i;
+	noderec *WITH;
+
+	oldch = LINK->LINK->changed;
+	if (*ip != NULL)
+	{
+		do
+		{
+			LINK->LINK->changed = false;
+			switch ((*ip)->opcode)
+			{
+				case op_and:
+					simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+					simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_one)
+						replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_none)
+						replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_one)
+						replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_none)
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
+							(*ip)->UU.U1.arg2->opcode == op_zero)
+						chgop(*ip, op_zero, LINK->LINK);
+					else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+							invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+						replacetree(ip, makeinstr2(op_nor,
+									makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+									makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
+						replacetree(ip, makefix1(makeinstr2(op_and,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
+						replacetree(ip, makefix1(makeinstr2(op_and,
+										copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					else
+						arith(ip, op_one, LINK);
+					break;
+
+				case op_nand:
+					simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+					simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_one)
+						replacetree(ip,
+								makenot(makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_none)
+						replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_one)
+						replacetree(ip,
+								makenot(makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_none)
+						replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
+							(*ip)->UU.U1.arg2->opcode == op_zero)
+						chgop(*ip, op_one, LINK->LINK);
+					else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+							invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+						replacetree(ip, makeinstr2(op_or,
+									makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+									makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
+						replacetree(ip, makefix0(makeinstr2(op_nand,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
+						replacetree(ip, makefix0(makeinstr2(op_nand,
+										copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+						replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else
+						arith(ip, op_one, LINK);
+					break;
+
+				case op_or:
+					simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+					simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_zero)
+						replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_none)
+						replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_zero)
+						replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_none)
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_one ||
+							(*ip)->UU.U1.arg2->opcode == op_one)
+						chgop(*ip, op_one, LINK->LINK);
+					else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+							invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+						replacetree(ip, makeinstr2(op_nand,
+									makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+									makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
+						replacetree(ip, makefix0(makeinstr2(op_or,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
+						replacetree(ip, makefix0(makeinstr2(op_or,
+										copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					else
+						arith(ip, op_zero, LINK);
+					break;
+
+				case op_nor:
+					simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+					simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_zero)
+						replacetree(ip,
+								makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_none)
+						replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_zero)
+						replacetree(ip,
+								makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_none)
+						replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_one ||
+							(*ip)->UU.U1.arg2->opcode == op_one)
+						chgop(*ip, op_zero, LINK->LINK);
+					else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+							invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+						replacetree(ip, makeinstr2(op_and,
+									makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+									makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
+						replacetree(ip, makefix1(makeinstr2(op_nor,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
+						replacetree(ip, makefix1(makeinstr2(op_nor,
+										copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+						replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else
+						arith(ip, op_zero, LINK);
+					break;
+
+				case op_xor:
+					simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+					simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_zero)
+						replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_one)
+						replacetree(ip,
+								makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_none)
+						replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_zero)
+						replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_one)
+						replacetree(ip,
+								makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_none)
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+							invertable((*ip)->UU.U1.arg2, LINK->LINK) > 1)
+						replacetree(ip, makenot(makeinstr2(op_xor,
+										makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+										makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
+						replacetree(ip, makefix0(makeinstr2(op_xor,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
+						replacetree(ip, makefix0(makeinstr2(op_xor,
+										copytree((*ip)->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK), LINK->LINK);
+					else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+						chgop(*ip, op_zero, LINK->LINK);
+					else
+						arith(ip, op_zero, LINK);
+					break;
+
+				case op_same:
+					if ((*ip)->UU.U1.arg1->ival == (*ip)->UU.U1.arg2->ival)
+						chgop(*ip, op_one, LINK->LINK);
+					else if ((*ip)->UU.U1.arg1->ival >= 0 || (*ip)->UU.U1.arg2->ival >= 0)
+						chgop(*ip, op_zero, LINK->LINK);
+					break;
+
+				case op_rise:
+				case op_fall:
+					WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
+					if ((((1L << ((long)log_zero)) | (1L << ((long)log_one))) &
+								(~WITH->poss)) != 0)
+						chgop(*ip, op_zero, LINK->LINK);
+					break;
+
+				case op_not:
+					simplexpr(&(*ip)->UU.U1.arg1, unarynot[(long)nonelike], LINK);
+					switch ((*ip)->UU.U1.arg1->opcode) {
+
+						case op_and:
+							replacetree(ip, makeinstr2(op_nand,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK);
+							break;
+
+						case op_nand:
+							replacetree(ip, makeinstr2(op_and,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK);
+							break;
+
+						case op_or:
+							replacetree(ip, makeinstr2(op_nor,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK);
+							break;
+
+						case op_nor:
+							replacetree(ip, makeinstr2(op_or,
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+										copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+										LINK->LINK), LINK->LINK);
+							break;
+
+						case op_not:
+							replacetree(ip, copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+									LINK->LINK);
+							break;
+
+						case op_fix0:
+							replacetree(ip,
+									makefix1(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
+												LINK->LINK), LINK->LINK), LINK->LINK),
+									LINK->LINK);
+							break;
+
+						case op_fix1:
+							replacetree(ip,
+									makefix0(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
+												LINK->LINK), LINK->LINK), LINK->LINK),
+									LINK->LINK);
+							break;
+
+						case op_one:
+							chgop(*ip, op_zero, LINK->LINK);
+							break;
+
+						case op_zero:
+							chgop(*ip, op_one, LINK->LINK);
+							break;
+
+						case op_none:
+							chgop(*ip, op_none, LINK->LINK);
+							break;
+
+						default:
+							break;
+					}
+					break;
+
+				case op_fix0:
+					simplexpr(&(*ip)->UU.U1.arg1, log_zero, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_none)
+						chgop(*ip, op_zero, LINK->LINK);
+					else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
+								((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
+						chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
+					else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
+							nonelike == log_zero)
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					break;
+
+				case op_fix1:
+					simplexpr(&(*ip)->UU.U1.arg1, log_one, LINK);
+					if ((*ip)->UU.U1.arg1->opcode == op_none)
+						chgop(*ip, op_one, LINK->LINK);
+					else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
+								((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
+						chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
+					else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
+							nonelike == log_one)
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+					break;
+
+				case op_strong:
+					WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
+					if (WITH->wasstrong)
+					{
+						replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+						chgop(*ip, op_pin, LINK->LINK);   /*from op_pinref*/
+					}
+					break;
+
+				case op_zero:
+				case op_one:
+				case op_none:
+					if ((*ip)->opcode == op_none)
+					{
+						switch (nonelike)
+						{
+							case log_none:
+								/* blank case */
+								break;
+
+							case log_one:
+								chgop(*ip, op_one, LINK->LINK);
+								break;
+
+							case log_zero:
+								chgop(*ip, op_zero, LINK->LINK);
+								break;
+						}
+					}
+					disposetree(&(*ip)->UU.U1.arg1, LINK->LINK);
+					disposetree(&(*ip)->UU.U1.arg2, LINK->LINK);
+					disposetree(&(*ip)->UU.U1.arg3, LINK->LINK);
+					break;
+
+				case op_pin:
+					i = (*ip)->ival + LINK->LINK->thingnodes;
+					WITH = &LINK->LINK->things[i];
+					if (WITH->poss == 1L << ((long)log_zero))
+						chgop(*ip, op_zero, LINK->LINK);
+					else if (WITH->poss == 1L << ((long)log_one))
+						chgop(*ip, op_one, LINK->LINK);
+					else if (WITH->poss == 1L << ((long)log_none))
+						chgop(*ip, op_none, LINK->LINK);
+					else if (LINK->LINK->hasstats && WITH->defn != NULL &&
+							LINK->LINK->optdelay && WITH->wasdef == 1 &&
+							WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
+								LINK->LINK) &&
+							WITH->defn->opcode == op_pineq &&
+							((WITH->wasused == 1 && i >= LINK->LINK->numports) ||
+							 !cyclicdefn(WITH->defn->UU.U1.arg1, i, true, LINK->LINK)))
+						replacetree(ip, copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
+								LINK->LINK);
+					break;
+
+				case op_var:
+					WITH = &LINK->LINK->things[(*ip)->ival + LINK->LINK->thingvars];
+					if (WITH->poss == 1L << ((long)log_zero))
+						chgop(*ip, op_zero, LINK->LINK);
+					else if (WITH->poss == 1L << ((long)log_one))
+						chgop(*ip, op_one, LINK->LINK);
+					else if (LINK->LINK->hasstats && WITH->defn != NULL &&
+							LINK->LINK->optlevel >= 3 && WITH->wasdef == 1 &&
+							WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
+								LINK->LINK) &&
+							WITH->defn->opcode == op_vareq)
+						replacetree(ip,
+								makefix1(copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
+									LINK->LINK), LINK->LINK);
+					break;
+
+				default:
+					break;
+			}
+			if (LINK->LINK->changed)
+				oldch = true;
+		} while (LINK->LINK->changed);
 	}
-	break;
-
-      case op_zero:
-      case op_one:
-      case op_none:
-	if ((*ip)->opcode == op_none) {
-	  switch (nonelike) {
-
-	  case log_none:
-	    /* blank case */
-	    break;
-
-	  case log_one:
-	    chgop(*ip, op_one, LINK->LINK);
-	    break;
-
-	  case log_zero:
-	    chgop(*ip, op_zero, LINK->LINK);
-	    break;
-	  }
-	}
-	disposetree(&(*ip)->UU.U1.arg1, LINK->LINK);
-	disposetree(&(*ip)->UU.U1.arg2, LINK->LINK);
-	disposetree(&(*ip)->UU.U1.arg3, LINK->LINK);
-	break;
-
-      case op_pin:
-	i = (*ip)->ival + LINK->LINK->thingnodes;
-	WITH = &LINK->LINK->things[i];
-	if (WITH->poss == 1L << ((long)log_zero))
-	  chgop(*ip, op_zero, LINK->LINK);
-	else if (WITH->poss == 1L << ((long)log_one))
-	  chgop(*ip, op_one, LINK->LINK);
-	else if (WITH->poss == 1L << ((long)log_none))
-	  chgop(*ip, op_none, LINK->LINK);
-	else if (LINK->LINK->hasstats && WITH->defn != NULL &&
-		 LINK->LINK->optdelay && WITH->wasdef == 1 &&
-		 WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
-						LINK->LINK) &&
-		 WITH->defn->opcode == op_pineq &&
-		 ((WITH->wasused == 1 && i >= LINK->LINK->numports) ||
-		  !cyclicdefn(WITH->defn->UU.U1.arg1, i, true, LINK->LINK)))
-	  replacetree(ip, copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
-		      LINK->LINK);
-	break;
-
-      case op_var:
-	WITH = &LINK->LINK->things[(*ip)->ival + LINK->LINK->thingvars];
-	if (WITH->poss == 1L << ((long)log_zero))
-	  chgop(*ip, op_zero, LINK->LINK);
-	else if (WITH->poss == 1L << ((long)log_one))
-	  chgop(*ip, op_one, LINK->LINK);
-	else if (LINK->LINK->hasstats && WITH->defn != NULL &&
-		 LINK->LINK->optlevel >= 3 && WITH->wasdef == 1 &&
-		 WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
-						LINK->LINK) &&
-		 WITH->defn->opcode == op_vareq)
-	  replacetree(ip,
-		      makefix1(copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
-			       LINK->LINK), LINK->LINK);
-	break;
-
-      default:
-	break;
-      }
-      if (LINK->LINK->changed)
-	oldch = true;
-    } while (LINK->LINK->changed);
-  }
-  LINK->LINK->changed = oldch;
+	LINK->LINK->changed = oldch;
 }
 
 /* Local variables for simplstmt: */
 struct LOC_simplstmt {
-  struct LOC_simplify *LINK;
-  instrrec **ipbase, *ip, **ipp;
-} ;
+	struct LOC_simplify *LINK;
+	instrrec **ipbase, *ip, **ipp;
+};
 
-static long iftonumber(ip, LINK)
-instrrec *ip;
-struct LOC_simplstmt *LINK;
+static long iftonumber(instrrec *ip, struct LOC_simplstmt *LINK)
 {
-  long Result;
+	long Result;
 
-  switch (ip->opcode) {
+	switch (ip->opcode)
+	{
+		case op_iffalse:
+			Result = 0;
+			break;
 
-  case op_iffalse:
-    Result = 0;
-    break;
+		case op_ifnone:
+			Result = 1;
+			break;
 
-  case op_ifnone:
-    Result = 1;
-    break;
+		case op_ifzero:
+			Result = 2;
+			break;
 
-  case op_ifzero:
-    Result = 2;
-    break;
+		case op_ifzn:
+			Result = 3;
+			break;
 
-  case op_ifzn:
-    Result = 3;
-    break;
+		case op_ifone:
+			Result = 4;
+			break;
 
-  case op_ifone:
-    Result = 4;
-    break;
+		case op_if:
+			Result = 5;
+			break;
 
-  case op_if:
-    Result = 5;
-    break;
+		case op_ifconn:
+			Result = 6;
+			break;
 
-  case op_ifconn:
-    Result = 6;
-    break;
+		case op_iftrue:
+			Result = 7;
+			break;
 
-  case op_iftrue:
-    Result = 7;
-    break;
-
-  default:
-    break;
-  }
-  return Result;
+		default:
+			break;
+	}
+	return Result;
 }
 
-static instrops numbertoif(i, LINK)
-long i;
-struct LOC_simplstmt *LINK;
+static instrops numbertoif(long i, struct LOC_simplstmt *LINK)
 {
-  instrops Result;
+	instrops Result;
 
-  switch (i & 7) {
+	switch (i & 7)
+	{
+		case 0:
+			Result = op_iffalse;
+			break;
 
-  case 0:
-    Result = op_iffalse;
-    break;
+		case 1:
+			Result = op_ifnone;
+			break;
 
-  case 1:
-    Result = op_ifnone;
-    break;
+		case 2:
+			Result = op_ifzero;
+			break;
 
-  case 2:
-    Result = op_ifzero;
-    break;
+		case 3:
+			Result = op_ifzn;
+			break;
 
-  case 3:
-    Result = op_ifzn;
-    break;
+		case 4:
+			Result = op_ifone;
+			break;
 
-  case 4:
-    Result = op_ifone;
-    break;
+		case 5:
+			Result = op_if;
+			break;
 
-  case 5:
-    Result = op_if;
-    break;
+		case 6:
+			Result = op_ifconn;
+			break;
 
-  case 6:
-    Result = op_ifconn;
-    break;
-
-  case 7:
-    Result = op_iftrue;
-    break;
-  }
-  return Result;
+		case 7:
+			Result = op_iftrue;
+			break;
+	}
+	return Result;
 }
 
-static void untrail(tp, LINK)
-trailrec *tp;
-struct LOC_simplstmt *LINK;
+static void untrail(trailrec *tp, struct LOC_simplstmt *LINK)
 {
-  int tflag;
-  noderec *WITH;
-
-  while (tp != NULL) {
-    WITH = &LINK->LINK->LINK->things[tp->num];
-    na_exch((void *)(&WITH->poss), (void *)(&tp->oldposs), sizeof(long));
-    tflag = WITH->strong;
-    WITH->strong = tp->oldstrong;
-    tp->oldstrong = tflag;
-    P_iswap2(&WITH->level, &tp->oldlevel);
-    WITH->defn = NULL;
-    tp = tp->next;
-  }
+	int tflag;
+	noderec *WITH;
+
+	while (tp != NULL)
+	{
+		WITH = &LINK->LINK->LINK->things[tp->num];
+		na_exch((void *)(&WITH->poss), (void *)(&tp->oldposs), sizeof(long));
+		tflag = WITH->strong;
+		WITH->strong = tp->oldstrong;
+		tp->oldstrong = tflag;
+		P_iswap2(&WITH->level, &tp->oldlevel);
+		WITH->defn = NULL;
+		tp = tp->next;
+	}
 }
 
-static void eattrail(tb, LINK)
-trailrec **tb;
-struct LOC_simplstmt *LINK;
+static void eattrail(trailrec **tb, struct LOC_simplstmt *LINK)
 {
-  trailrec *tp;
+	trailrec *tp;
 
-  tp = (*tb)->next;
-  Free(*tb);
-  *tb = tp;
+	tp = (*tb)->next;
+	Free(*tb);
+	*tb = tp;
 }
 
 /* Append list ip2 to end of list ip */
-static void appendlist(ip, ip2, LINK)
-instrrec **ip, *ip2;
-struct LOC_simplstmt *LINK;
+static void appendlist(instrrec **ip, instrrec *ip2, struct LOC_simplstmt *LINK)
 {
-  instrrec *ip3;
-
-  if (ip2 == NULL)
-    return;
-  if (*ip == NULL) {
-    *ip = ip2;
-    return;
-  }
-  ip3 = *ip;
-  while (ip3->UU.U1.next != NULL)
-    ip3 = ip3->UU.U1.next;
-  ip3->UU.U1.next = ip2;
+	instrrec *ip3;
+
+	if (ip2 == NULL)
+		return;
+
+	if (*ip == NULL)
+	{
+		*ip = ip2;
+		return;
+	}
+
+	ip3 = *ip;
+	while (ip3->UU.U1.next != NULL)
+		ip3 = ip3->UU.U1.next;
+	ip3->UU.U1.next = ip2;
 }
 
 /* Insert list ip2 at front of list ip */
-static void insertlist(ip, ip2, LINK)
-instrrec **ip, *ip2;
-struct LOC_simplstmt *LINK;
+static void insertlist(instrrec **ip, instrrec *ip2, struct LOC_simplstmt *LINK)
 {
-  instrrec *ip3;
-
-  if (ip2 == NULL)
-    return;
-  ip3 = ip2;
-  while (ip3->UU.U1.next != NULL)
-    ip3 = ip3->UU.U1.next;
-  ip3->UU.U1.next = *ip;
-  *ip = ip2;
+	instrrec *ip3;
+
+	if (ip2 == NULL)
+		return;
+
+	ip3 = ip2;
+	while (ip3->UU.U1.next != NULL)
+		ip3 = ip3->UU.U1.next;
+	ip3->UU.U1.next = *ip;
+	*ip = ip2;
 }
 
-static void cleanpineq(ip, ival, LINK)
-instrrec *ip;
-long ival;
-struct LOC_simplstmt *LINK;
+static void cleanpineq(instrrec *ip, long ival, struct LOC_simplstmt *LINK)
 {
-  while (ip != NULL) {
-    if (ip->opcode == op_pineq && ip->ival == ival)
-      killstmt(ip, LINK->LINK->LINK);
-    ip = ip->UU.U1.next;
-  }
+	while (ip != NULL)
+	{
+		if (ip->opcode == op_pineq && ip->ival == ival)
+			killstmt(ip, LINK->LINK->LINK);
+		ip = ip->UU.U1.next;
+	}
 }
 
-static void builddefvusev(ip, defv, usev, LINK)
-instrrec *ip;
-long *defv, *usev;
-struct LOC_simplstmt *LINK;
+static void builddefvusev(instrrec *ip, long *defv, long *usev, struct LOC_simplstmt *LINK)
 {
-  instrrec *ip2;
-  long i;
-  long SET[257];
-  long SET1[257];
-
-  for (i = 0; i <= 2; i++) {
-    ip2 = ip->UU.args[i];
-    while (ip2 != NULL) {
-      builddefvusev(ip2, defv, usev, LINK);
-      ip2 = ip2->UU.U1.next;
-    }
-  }
-  switch (ip->opcode) {
-
-  case op_var:
-    P_addset(usev, ip->ival);
-    break;
-
-  case op_vareq:
-    P_addset(defv, ip->ival);
-    break;
-
-  default:
-    break;
-  }
+	instrrec *ip2;
+	long i;
+	long SET[257];
+	long SET1[257];
+
+	for (i = 0; i <= 2; i++)
+	{
+		ip2 = ip->UU.args[i];
+		while (ip2 != NULL)
+		{
+			builddefvusev(ip2, defv, usev, LINK);
+			ip2 = ip2->UU.U1.next;
+		}
+	}
+	switch (ip->opcode)
+	{
+		case op_var:
+			P_addset(usev, ip->ival);
+			break;
+
+		case op_vareq:
+			P_addset(defv, ip->ival);
+			break;
+
+		default:
+			break;
+	}
 }
 
-static void checkdefvusev(ip, defv, usev, good, LINK)
-instrrec *ip;
-long *defv, *usev;
-int *good;
-struct LOC_simplstmt *LINK;
+static void checkdefvusev(instrrec *ip, long *defv, long *usev, uint *good, struct LOC_simplstmt *LINK)
 {
-  instrrec *ip2;
-  long i;
-
-  if (!*good)
-    return;
-  for (i = 0; i <= 2; i++) {
-    ip2 = ip->UU.args[i];
-    while (ip2 != NULL) {
-      checkdefvusev(ip2, defv, usev, good, LINK);
-      ip2 = ip2->UU.U1.next;
-    }
-  }
-  switch (ip->opcode) {
-
-  case op_var:
-    if (P_inset(ip->ival, defv))
-      *good = false;
-    break;
-
-  case op_vareq:
-    if (P_inset(ip->ival, defv) || P_inset(ip->ival, usev))
-      *good = false;
-    break;
-
-  default:
-    break;
-  }
+	instrrec *ip2;
+	long i;
+
+	if (!*good)
+		return;
+
+	for (i = 0; i <= 2; i++)
+	{
+		ip2 = ip->UU.args[i];
+		while (ip2 != NULL)
+		{
+			checkdefvusev(ip2, defv, usev, good, LINK);
+			ip2 = ip2->UU.U1.next;
+		}
+	}
+
+	switch (ip->opcode)
+	{
+		case op_var:
+			if (P_inset(ip->ival, defv))
+				*good = false;
+			break;
+
+		case op_vareq:
+			if (P_inset(ip->ival, defv) || P_inset(ip->ival, usev))
+				*good = false;
+			break;
+
+		default:
+			break;
+	}
 }
 
 /*try to combine two "if x"'s into one*/
-static void trymoveif(LINK)
-struct LOC_simplstmt *LINK;
+static void trymoveif(struct LOC_simplstmt *LINK)
 {
-  instrrec *ip2, *ip3, **ipp2;
-  long *defv1, *usev1, *defv2, *usev2;
-  int good1, good2, localchg;
-  instrops otherif;
-  long i;
-
-  otherif = numbertoif(~iftonumber(LINK->ip, LINK), LINK);
-  defv1 = NULL;
-  ipp2 = LINK->ipbase;
-  while (*ipp2 != LINK->ip) {
-    ip2 = *ipp2;
-    localchg = false;
-    if ((ip2->opcode == LINK->ip->opcode || ip2->opcode == otherif) &&
-	cmptrees(ip2->UU.U1.arg1, LINK->ip->UU.U1.arg1, LINK->LINK->LINK))
-    {  /*possible candidate for combination*/
-      if (defv1 == NULL) {
-	i = setbytes(LINK->LINK->LINK->savecurpvar, LINK->LINK->LINK);
-	defv1 = (long *)Malloc(i);
-	usev1 = (long *)Malloc(i);
-	defv2 = (long *)Malloc(i);
-	usev2 = (long *)Malloc(i);
-	P_expset(defv2, 0L);
-	P_expset(usev2, 0L);
-	builddefvusev(LINK->ip, defv2, usev2, LINK);
-      }
-      P_expset(defv1, 0L);
-      P_expset(usev1, 0L);
-      builddefvusev(ip2, defv1, usev1, LINK);
-      ip3 = ip2->UU.U1.next;
-      good1 = true;
-      good2 = true;
-      while (ip3 != LINK->ip && (good1 || good2)) {
-	checkdefvusev(ip3, defv1, usev1, &good1, LINK);
-	checkdefvusev(ip3, defv2, usev2, &good2, LINK);
-	ip3 = ip3->UU.U1.next;
-      }
-      if (good1) {   /*move earlier one later*/
-	*ipp2 = ip2->UU.U1.next;
-	if (ip2->opcode == otherif) {
-	  insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg3, LINK);
-	  insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg2, LINK);
-	} else {
-	  insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg2, LINK);
-	  insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg3, LINK);
-	}
-	if (ip2->UU.U1.next == LINK->ip)
-	  LINK->ipp = ipp2;
-	disposetree(&ip2->UU.U1.arg1, LINK->LINK->LINK);
-	Free(ip2);
-	LINK->LINK->LINK->changed = true;
-	localchg = true;
-      } else if (good2) {
-	*LINK->ipp = LINK->ip->UU.U1.next;
-	if (ip2->opcode == otherif) {
-	  appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg3, LINK);
-	  appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg2, LINK);
-	} else {
-	  appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg2, LINK);
-	  appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg3, LINK);
+	instrrec *ip2, *ip3, **ipp2;
+	long *defv1, *usev1, *defv2, *usev2;
+	int good1, good2, localchg;
+	instrops otherif;
+	long i;
+
+	otherif = numbertoif(~iftonumber(LINK->ip, LINK), LINK);
+	defv1 = NULL;
+	ipp2 = LINK->ipbase;
+	while (*ipp2 != LINK->ip)
+	{
+		ip2 = *ipp2;
+		localchg = false;
+		if ((ip2->opcode == LINK->ip->opcode || ip2->opcode == otherif) &&
+				cmptrees(ip2->UU.U1.arg1, LINK->ip->UU.U1.arg1, LINK->LINK->LINK))
+		{  /*possible candidate for combination*/
+			if (defv1 == NULL)
+			{
+				i = setbytes(LINK->LINK->LINK->savecurpvar, LINK->LINK->LINK);
+				defv1 = (long *)Malloc(i);
+				usev1 = (long *)Malloc(i);
+				defv2 = (long *)Malloc(i);
+				usev2 = (long *)Malloc(i);
+				P_expset(defv2, 0L);
+				P_expset(usev2, 0L);
+				builddefvusev(LINK->ip, defv2, usev2, LINK);
+			}
+			
+			P_expset(defv1, 0L);
+			P_expset(usev1, 0L);
+			builddefvusev(ip2, defv1, usev1, LINK);
+			ip3 = ip2->UU.U1.next;
+			good1 = true;
+			good2 = true;
+			
+			while (ip3 != LINK->ip && (good1 || good2))
+			{
+				checkdefvusev(ip3, defv1, usev1, &good1, LINK);
+				checkdefvusev(ip3, defv2, usev2, &good2, LINK);
+				ip3 = ip3->UU.U1.next;
+			}
+			
+			if (good1)
+			{   /*move earlier one later*/
+				*ipp2 = ip2->UU.U1.next;
+				if (ip2->opcode == otherif)
+				{
+					insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg3, LINK);
+					insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg2, LINK);
+				}
+				else
+				{
+					insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg2, LINK);
+					insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg3, LINK);
+				}
+				
+				if (ip2->UU.U1.next == LINK->ip)
+					LINK->ipp = ipp2;
+				disposetree(&ip2->UU.U1.arg1, LINK->LINK->LINK);
+				Free(ip2);
+				LINK->LINK->LINK->changed = true;
+				localchg = true;
+			}
+			else if (good2)
+			{
+				*LINK->ipp = LINK->ip->UU.U1.next;
+				if (ip2->opcode == otherif)
+				{
+					appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg3, LINK);
+					appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg2, LINK);
+				}
+				else
+				{
+					appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg2, LINK);
+					appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg3, LINK);
+				}
+				
+				disposetree(&LINK->ip->UU.U1.arg1, LINK->LINK->LINK);
+				Free(LINK->ip);
+				LINK->ipp = ipp2;
+				LINK->ip = ip2;
+				LINK->LINK->LINK->changed = true;
+				localchg = true;
+			}
+		}
+		if (!localchg)
+			ipp2 = &ip2->UU.U1.next;
 	}
-	disposetree(&LINK->ip->UU.U1.arg1, LINK->LINK->LINK);
-	Free(LINK->ip);
-	LINK->ipp = ipp2;
-	LINK->ip = ip2;
-	LINK->LINK->LINK->changed = true;
-	localchg = true;
-      }
-    }
-    if (!localchg)
-      ipp2 = &ip2->UU.U1.next;
-  }
-
-  /*move later one earlier*/
+	/*move later one earlier*/
 }
 
 /*try to factor common statements out of "if" and "else" branches*/
-static void tryfactorif(LINK)
-struct LOC_simplstmt *LINK;
+static void tryfactorif(struct LOC_simplstmt *LINK)
 {
-  instrrec *ip2, *ip3, *ip4;
-
-  ip2 = LINK->ip->UU.U1.arg2;
-  ip3 = LINK->ip->UU.U1.arg3;
-  if (ip2 == NULL || ip3 == NULL)
-    return;
-  /*for now, we examine only the final stmts of the branches,*/
-  /*thus avoiding all variable-side-effect problems*/
-  while (ip2->UU.U1.next != NULL)
-    ip2 = ip2->UU.U1.next;
-  while (ip3->UU.U1.next != NULL)
-    ip3 = ip3->UU.U1.next;
-  if (!(cmptrees(ip2, ip3, LINK->LINK->LINK) && ip2->opcode != op_iffalse))
-    return;
-  ip4 = copytree(ip3, LINK->LINK->LINK);
-  ip4->UU.U1.next = LINK->ip->UU.U1.next;
-  LINK->ip->UU.U1.next = ip4;
-  killstmt(ip2, LINK->LINK->LINK);
-  killstmt(ip3, LINK->LINK->LINK);
+	instrrec *ip2, *ip3, *ip4;
+
+	ip2 = LINK->ip->UU.U1.arg2;
+	ip3 = LINK->ip->UU.U1.arg3;
+	if (ip2 == NULL || ip3 == NULL)
+		return;
+	/*for now, we examine only the final stmts of the branches,*/
+	/*thus avoiding all variable-side-effect problems*/
+	while (ip2->UU.U1.next != NULL)
+		ip2 = ip2->UU.U1.next;
+	while (ip3->UU.U1.next != NULL)
+		ip3 = ip3->UU.U1.next;
+
+	if (!(cmptrees(ip2, ip3, LINK->LINK->LINK) && ip2->opcode != op_iffalse))
+		return;
+	
+	ip4 = copytree(ip3, LINK->LINK->LINK);
+	ip4->UU.U1.next = LINK->ip->UU.U1.next;
+	LINK->ip->UU.U1.next = ip4;
+	killstmt(ip2, LINK->LINK->LINK);
+	killstmt(ip3, LINK->LINK->LINK);
 }
 
-static void simplstmt(ipbase_, LINK)
-instrrec **ipbase_;
-struct LOC_simplify *LINK;
+static void simplstmt(instrrec **ipbase_, struct LOC_simplify *LINK)
 {
-  struct LOC_simplstmt V;
-  int oldch;
-  instrrec *ip1;
-  trailrec *oldtrail, *thentrail, *elsetrail;
-  long num, ifnum;
-  noderec *WITH;
-
-  V.LINK = LINK;
-  V.ipbase = ipbase_;
-  oldch = LINK->LINK->changed;
-  V.ipp = V.ipbase;
-  while (*V.ipp != NULL) {
-    LINK->LINK->changed = false;
-    V.ip = *V.ipp;
-    switch (V.ip->opcode) {
-
-    case op_if:
-    case op_ifnone:
-    case op_ifzero:
-    case op_ifone:
-    case op_ifconn:
-    case op_ifzn:
-      ifnum = iftonumber(V.ip, &V);
-      switch (V.ip->opcode) {
-
-      case op_if:
-      case op_ifzero:
-	simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
-	break;
-
-      case op_ifzn:
-      case op_ifone:
-	simplexpr(&V.ip->UU.U1.arg1, log_zero, LINK);
-	break;
-
-      default:
-	simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
-	break;
-      }
-      oldtrail = LINK->tbase;
-      LINK->simplevel++;
-
-      LINK->tbase = NULL;   /*simplify the "then" part*/
-      simplstmt(&V.ip->UU.U1.arg2, LINK);
-      thentrail = LINK->tbase;
-      untrail(thentrail, &V);
-
-      LINK->tbase = NULL;   /*simplify the "else" part*/
-      simplstmt(&V.ip->UU.U1.arg3, LINK);
-      elsetrail = LINK->tbase;
-      untrail(elsetrail, &V);
-
-      LINK->simplevel--;
-      LINK->tbase = oldtrail;
-      while (thentrail != NULL || elsetrail != NULL) {
-	if (thentrail != NULL &&
-	    (elsetrail == NULL || thentrail->num < elsetrail->num))
-	{  /*"then" part only*/
-	  num = thentrail->num;
-	  /* if num < thingvars then
-	      chgposs(num, things^[num].poss * thentrail^.oldposs)
-	   else */
-	  chgposs(num, LINK->LINK->things[num].poss | thentrail->oldposs,
-		  LINK);
-	  eattrail(&thentrail, &V);
-	  continue;
-	}
-	if (thentrail == NULL || thentrail->num > elsetrail->num)
-	{  /*"else" part only*/
-	  num = elsetrail->num;
-	  /* if num < thingvars then
-	      chgposs(num, things^[num].poss * elsetrail^.oldposs)
-	   else */
-	  chgposs(num, LINK->LINK->things[num].poss | elsetrail->oldposs,
-		  LINK);
-	  eattrail(&elsetrail, &V);
-	  continue;
-	}
-	num = thentrail->num;
-	if (num < LINK->LINK->thingvars &&
-	    ((1L << ((long)V.ip->opcode)) &
-	     ((1L << ((long)op_if)) | (1L << ((long)op_ifone)) |
-	      (1L << ((long)op_ifzn)) | (1L << ((long)op_ifzero)))) != 0 &&
-	    ((thentrail->oldposs == 1L << ((long)log_zero) &&
-	      elsetrail->oldposs == 1L << ((long)log_one)) ||
-	     (thentrail->oldposs == 1L << ((long)log_one) &&
-	      elsetrail->oldposs == 1L << ((long)log_zero))))
-	{  /*found an inverter or buffer*/
-	  ip1 = copytree(V.ip->UU.U1.arg1, LINK->LINK);
-	  switch (V.ip->opcode) {
-
-	  case op_if:
-	    ip1 = makefix1(ip1, LINK->LINK);
-	    break;
-
-	  case op_ifone:
-	    ip1 = makefix0(ip1, LINK->LINK);
-	    break;
-
-	  case op_ifzn:
-	    ip1 = makenot(makefix0(ip1, LINK->LINK), LINK->LINK);
-	    break;
-
-	  case op_ifzero:
-	    ip1 = makenot(makefix1(ip1, LINK->LINK), LINK->LINK);
-	    break;
-
-	  default:
-	    break;
-	  }
-	  if (thentrail->oldposs == 1L << ((long)log_zero))
-	    ip1 = makenot(ip1, LINK->LINK);
-	  ip1 = makeinstr1(op_pineq, ip1, LINK->LINK);
-	  ip1->ival = num - LINK->LINK->thingnodes;
-	  cleanpineq(V.ip->UU.U1.arg2, (long)ip1->ival, &V);
-	  cleanpineq(V.ip->UU.U1.arg3, (long)ip1->ival, &V);
-	  insertlist(V.ipp, ip1, &V);
-	  V.ipp = &ip1->UU.U1.next;
-	}
-	chgposs(num, thentrail->oldposs | elsetrail->oldposs, LINK);
-	if (thentrail->oldstrong && elsetrail->oldstrong)
-	  LINK->LINK->things[num].strong = true;
-	eattrail(&thentrail, &V);
-	eattrail(&elsetrail, &V);
-      }
-      if (V.ip->UU.U1.arg2 == NULL) {   /*THEN part is empty*/
-	if (V.ip->UU.U1.arg3 == NULL)   /*both parts are empty!*/
-	  killstmt(V.ip, LINK->LINK);
-	else {
-	  chgop(V.ip, numbertoif(~ifnum, &V), LINK->LINK);
-	  swapinstrs(&V.ip->UU.U1.arg2, &V.ip->UU.U1.arg3, LINK->LINK);
-	}
-      } else {
-	ip1 = V.ip->UU.U1.arg1;
-	switch (ip1->opcode) {
-
-	case op_not:
-	case op_nand:
-	case op_nor:
-	  replacetree(&V.ip->UU.U1.arg1,
-		      makenot(copytree(V.ip->UU.U1.arg1, LINK->LINK),
-			      LINK->LINK), LINK->LINK);
-	  switch (V.ip->opcode) {
-
-	  case op_if:
-	    chgop(V.ip, op_ifzn, LINK->LINK);
-	    break;
-
-	  case op_ifzero:
-	    chgop(V.ip, op_ifone, LINK->LINK);
-	    break;
-
-	  case op_ifone:
-	    chgop(V.ip, op_ifzero, LINK->LINK);
-	    break;
-
-	  case op_ifzn:
-	    chgop(V.ip, op_if, LINK->LINK);
-	    break;
-
-	  case op_ifnone:
-	  case op_ifconn:
-	    /* blank case */
-	    break;
-
-	  default:
-	    break;
-	  }
-	  break;
-
-	case op_fix0:
-	  replacetree(&V.ip->UU.U1.arg1,
-		      copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	  switch (V.ip->opcode) {
-
-	  case op_if:
-	    chgop(V.ip, op_ifone, LINK->LINK);
-	    break;
-
-	  case op_ifzero:
-	    chgop(V.ip, op_ifzn, LINK->LINK);
-	    break;
-
-	  case op_ifnone:
-	    chgop(V.ip, op_iffalse, LINK->LINK);
-	    break;
-
-	  case op_ifconn:
-	    chgop(V.ip, op_iftrue, LINK->LINK);
-	    break;
-
-	  case op_ifone:
-	  case op_ifzn:
-	    /* blank case */
-	    break;
-
-	  default:
-	    break;
-	  }
-	  break;
-
-	case op_fix1:
-	  replacetree(&V.ip->UU.U1.arg1,
-		      copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
-	  switch (V.ip->opcode) {
-
-	  case op_ifone:
-	    chgop(V.ip, op_if, LINK->LINK);
-	    break;
-
-	  case op_ifzn:
-	    chgop(V.ip, op_ifzero, LINK->LINK);
-	    break;
-
-	  case op_ifnone:
-	    chgop(V.ip, op_iffalse, LINK->LINK);
-	    break;
-
-	  case op_ifconn:
-	    chgop(V.ip, op_iftrue, LINK->LINK);
-	    break;
-
-	  case op_if:
-	  case op_ifzero:
-	    /* blank case */
-	    break;
-
-	  default:
-	    break;
-	  }
-	  break;
-
-	case op_one:
-	  if ((ifnum & (1L << 2)) != 0)
-	    chgop(V.ip, op_iftrue, LINK->LINK);
-	  else
-	    chgop(V.ip, op_iffalse, LINK->LINK);
-	  break;
-
-	case op_zero:
-	  if ((ifnum & (1L << 1)) != 0)
-	    chgop(V.ip, op_iftrue, LINK->LINK);
-	  else
-	    chgop(V.ip, op_iffalse, LINK->LINK);
-	  break;
-
-	case op_none:
-	  if ((ifnum & (1L << 0)) != 0)
-	    chgop(V.ip, op_iftrue, LINK->LINK);
-	  else
-	    chgop(V.ip, op_iffalse, LINK->LINK);
-	  break;
-
-	default:
-	  break;
+	struct LOC_simplstmt V;
+	int oldch;
+	instrrec *ip1;
+	trailrec *oldtrail, *thentrail, *elsetrail;
+	long num, ifnum;
+	noderec *WITH;
+
+	V.LINK = LINK;
+	V.ipbase = ipbase_;
+	oldch = LINK->LINK->changed;
+	V.ipp = V.ipbase;
+	while (*V.ipp != NULL)
+	{
+		LINK->LINK->changed = false;
+		V.ip = *V.ipp;
+		switch (V.ip->opcode)
+		{
+			case op_if:
+			case op_ifnone:
+			case op_ifzero:
+			case op_ifone:
+			case op_ifconn:
+			case op_ifzn:
+				ifnum = iftonumber(V.ip, &V);
+				switch (V.ip->opcode)
+				{
+					case op_if:
+					case op_ifzero:
+						simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
+						break;
+
+					case op_ifzn:
+					case op_ifone:
+						simplexpr(&V.ip->UU.U1.arg1, log_zero, LINK);
+						break;
+
+					default:
+						simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
+						break;
+				}
+				
+				oldtrail = LINK->tbase;
+				LINK->simplevel++;
+
+				LINK->tbase = NULL;   /*simplify the "then" part*/
+				simplstmt(&V.ip->UU.U1.arg2, LINK);
+				thentrail = LINK->tbase;
+				untrail(thentrail, &V);
+
+				LINK->tbase = NULL;   /*simplify the "else" part*/
+				simplstmt(&V.ip->UU.U1.arg3, LINK);
+				elsetrail = LINK->tbase;
+				untrail(elsetrail, &V);
+
+				LINK->simplevel--;
+				LINK->tbase = oldtrail;
+				while (thentrail != NULL || elsetrail != NULL)
+				{
+					if (thentrail != NULL &&
+							(elsetrail == NULL || thentrail->num < elsetrail->num))
+					{  /*"then" part only*/
+						num = thentrail->num;
+						/* if num < thingvars then
+						   chgposs(num, things^[num].poss * thentrail^.oldposs)
+						   else */
+						chgposs(num, LINK->LINK->things[num].poss | thentrail->oldposs,
+								LINK);
+						eattrail(&thentrail, &V);
+						continue;
+					}
+				
+					if (thentrail == NULL || thentrail->num > elsetrail->num)
+					{  /*"else" part only*/
+						num = elsetrail->num;
+						/* if num < thingvars then
+						   chgposs(num, things^[num].poss * elsetrail^.oldposs)
+						   else */
+						chgposs(num, LINK->LINK->things[num].poss | elsetrail->oldposs,
+								LINK);
+						eattrail(&elsetrail, &V);
+						continue;
+					}
+					
+					num = thentrail->num;
+					if (num < LINK->LINK->thingvars &&
+							((1L << ((long)V.ip->opcode)) &
+							 ((1L << ((long)op_if)) | (1L << ((long)op_ifone)) |
+							  (1L << ((long)op_ifzn)) | (1L << ((long)op_ifzero)))) != 0 &&
+							((thentrail->oldposs == 1L << ((long)log_zero) &&
+							  elsetrail->oldposs == 1L << ((long)log_one)) ||
+							 (thentrail->oldposs == 1L << ((long)log_one) &&
+							  elsetrail->oldposs == 1L << ((long)log_zero))))
+					{  /*found an inverter or buffer*/
+						ip1 = copytree(V.ip->UU.U1.arg1, LINK->LINK);
+						switch (V.ip->opcode)
+						{
+							case op_if:
+								ip1 = makefix1(ip1, LINK->LINK);
+								break;
+
+							case op_ifone:
+								ip1 = makefix0(ip1, LINK->LINK);
+								break;
+
+							case op_ifzn:
+								ip1 = makenot(makefix0(ip1, LINK->LINK), LINK->LINK);
+								break;
+
+							case op_ifzero:
+								ip1 = makenot(makefix1(ip1, LINK->LINK), LINK->LINK);
+								break;
+
+							default:
+								break;
+						}
+						
+						if (thentrail->oldposs == 1L << ((long)log_zero))
+							ip1 = makenot(ip1, LINK->LINK);
+						ip1 = makeinstr1(op_pineq, ip1, LINK->LINK);
+						ip1->ival = num - LINK->LINK->thingnodes;
+						cleanpineq(V.ip->UU.U1.arg2, (long)ip1->ival, &V);
+						cleanpineq(V.ip->UU.U1.arg3, (long)ip1->ival, &V);
+						insertlist(V.ipp, ip1, &V);
+						V.ipp = &ip1->UU.U1.next;
+					}
+					
+					chgposs(num, thentrail->oldposs | elsetrail->oldposs, LINK);
+					
+					if (thentrail->oldstrong && elsetrail->oldstrong)
+						LINK->LINK->things[num].strong = true;
+					
+					eattrail(&thentrail, &V);
+					eattrail(&elsetrail, &V);
+				}
+				if (V.ip->UU.U1.arg2 == NULL)
+				{   /*THEN part is empty*/
+					if (V.ip->UU.U1.arg3 == NULL)   /*both parts are empty!*/
+					{
+						killstmt(V.ip, LINK->LINK);
+					}
+					else
+					{
+						chgop(V.ip, numbertoif(~ifnum, &V), LINK->LINK);
+						swapinstrs(&V.ip->UU.U1.arg2, &V.ip->UU.U1.arg3, LINK->LINK);
+					}
+				}
+				else
+				{
+					ip1 = V.ip->UU.U1.arg1;
+					switch (ip1->opcode)
+					{
+						case op_not:
+						case op_nand:
+						case op_nor:
+							replacetree(&V.ip->UU.U1.arg1,
+									makenot(copytree(V.ip->UU.U1.arg1, LINK->LINK),
+										LINK->LINK), LINK->LINK);
+							switch (V.ip->opcode)
+							{
+								case op_if:
+									chgop(V.ip, op_ifzn, LINK->LINK);
+									break;
+
+								case op_ifzero:
+									chgop(V.ip, op_ifone, LINK->LINK);
+									break;
+
+								case op_ifone:
+									chgop(V.ip, op_ifzero, LINK->LINK);
+									break;
+
+								case op_ifzn:
+									chgop(V.ip, op_if, LINK->LINK);
+									break;
+
+								case op_ifnone:
+								case op_ifconn:
+									/* blank case */
+									break;
+
+								default:
+									break;
+							}
+							break;
+
+						case op_fix0:
+							replacetree(&V.ip->UU.U1.arg1,
+									copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
+							switch (V.ip->opcode)
+							{
+								case op_if:
+									chgop(V.ip, op_ifone, LINK->LINK);
+									break;
+
+								case op_ifzero:
+									chgop(V.ip, op_ifzn, LINK->LINK);
+									break;
+
+								case op_ifnone:
+									chgop(V.ip, op_iffalse, LINK->LINK);
+									break;
+
+								case op_ifconn:
+									chgop(V.ip, op_iftrue, LINK->LINK);
+									break;
+
+								case op_ifone:
+								case op_ifzn:
+									/* blank case */
+									break;
+
+								default:
+									break;
+							}
+							break;
+
+						case op_fix1:
+							replacetree(&V.ip->UU.U1.arg1,
+									copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
+							switch (V.ip->opcode)
+							{
+								case op_ifone:
+									chgop(V.ip, op_if, LINK->LINK);
+									break;
+
+								case op_ifzn:
+									chgop(V.ip, op_ifzero, LINK->LINK);
+									break;
+
+								case op_ifnone:
+									chgop(V.ip, op_iffalse, LINK->LINK);
+									break;
+
+								case op_ifconn:
+									chgop(V.ip, op_iftrue, LINK->LINK);
+									break;
+
+								case op_if:
+								case op_ifzero:
+									/* blank case */
+									break;
+
+								default:
+									break;
+							}
+							break;
+
+						case op_one:
+							if ((ifnum & (1L << 2)) != 0)
+								chgop(V.ip, op_iftrue, LINK->LINK);
+							else
+								chgop(V.ip, op_iffalse, LINK->LINK);
+							break;
+
+						case op_zero:
+							if ((ifnum & (1L << 1)) != 0)
+								chgop(V.ip, op_iftrue, LINK->LINK);
+							else
+								chgop(V.ip, op_iffalse, LINK->LINK);
+							break;
+
+						case op_none:
+							if ((ifnum & (1L << 0)) != 0)
+								chgop(V.ip, op_iftrue, LINK->LINK);
+							else
+								chgop(V.ip, op_iffalse, LINK->LINK);
+							break;
+
+						default:
+							break;
+					}
+
+					if (!LINK->LINK->changed && checkconn(V.ip->UU.U1.arg1, LINK->LINK))
+					{
+						switch (V.ip->opcode)
+						{
+
+							case op_ifone:
+								chgop(V.ip, op_if, LINK->LINK);
+								break;
+
+							case op_ifzn:
+								chgop(V.ip, op_ifzero, LINK->LINK);
+								break;
+
+							case op_ifconn:
+								chgop(V.ip, op_iftrue, LINK->LINK);
+								break;
+
+							case op_ifnone:
+								chgop(V.ip, op_iffalse, LINK->LINK);
+								break;
+
+							default:
+								break;
+						}
+					}
+
+					if (!LINK->LINK->changed && LINK->LINK->optlevel >= 3)
+					{
+						trymoveif(&V);
+						if (!LINK->LINK->changed)
+							tryfactorif(&V);
+					}
+				}
+				break;
+
+			case op_iftrue:
+			case op_iffalse:
+				disposetree(&V.ip->UU.U1.arg1, LINK->LINK);
+				if (V.ip->opcode == op_iftrue)
+				{
+					disposetree(&V.ip->UU.U1.arg3, LINK->LINK);
+					ip1 = V.ip->UU.U1.arg2;
+				}
+				else
+				{
+					disposetree(&V.ip->UU.U1.arg2, LINK->LINK);
+					ip1 = V.ip->UU.U1.arg3;
+				}
+				
+				*V.ipp = V.ip->UU.U1.next;
+				insertlist(V.ipp, ip1, &V);
+				Free(V.ip);
+				LINK->LINK->changed = true;
+				break;
+
+			case op_pineq:
+				num = V.ip->ival + LINK->LINK->thingnodes;
+				WITH = &LINK->LINK->things[num];
+				if (!LINK->LINK->hasstats || num < LINK->LINK->numports ||
+						(WITH->wasused > 0 &&
+						 !(WITH->wasused == 1 &&
+							 treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))))
+				{
+					ip1 = WITH->defn;
+					WITH->defn = NULL;   /*don't recursively expand!*/
+					simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
+					if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
+						WITH->defn = V.ip;
+					if (V.ip->UU.U1.arg1->opcode == op_one)
+						chgposs2(num, 1L << ((long)log_one), true, LINK);
+					else if (V.ip->UU.U1.arg1->opcode == op_zero)
+						chgposs2(num, 1L << ((long)log_zero), true, LINK);
+					else if (V.ip->UU.U1.arg1->opcode == op_none)
+					{
+						WITH->defn = NULL;
+						killstmt(V.ip, LINK->LINK);
+					}
+					else if (checkconn(V.ip->UU.U1.arg1, LINK->LINK))
+					{
+						chgposs2(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
+								true, LINK);
+					}
+				}
+				else
+				{
+					killstmt(V.ip, LINK->LINK);
+				}
+				break;
+
+			case op_pinoc:
+				num = V.ip->ival + LINK->LINK->thingnodes;
+				WITH = &LINK->LINK->things[num];
+				if (!LINK->LINK->hasstats || WITH->wasused > 0 ||
+						num < LINK->LINK->numports)
+				{
+					ip1 = WITH->defn;
+					WITH->defn = NULL;   /*don't recursively expand!*/
+					simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
+					if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
+						WITH->defn = V.ip;
+					if (V.ip->UU.U1.arg1->opcode == op_one ||
+							V.ip->UU.U1.arg1->opcode == op_none)
+					{
+						WITH->defn = NULL;
+						killstmt(V.ip, LINK->LINK);
+					}
+					else if (V.ip->UU.U1.arg1->opcode == op_zero)
+						chgposs(num, 1L << ((long)log_zero), LINK);
+				}
+				else
+				{
+					killstmt(V.ip, LINK->LINK);
+				}
+				break;
+
+			case op_pullup:
+				num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
+				WITH = &LINK->LINK->things[num];
+				if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
+							num < LINK->LINK->numports) && !WITH->wasstrong)
+				{
+					/*true*/
+					/**/
+					if (LINK->LINK->hasstats && WITH->wasdef == 1)
+					{
+						chgop(V.ip, op_pineq, LINK->LINK);
+						V.ip->ival = V.ip->UU.U1.arg1->ival;
+						chgop(V.ip->UU.U1.arg1, op_one, LINK->LINK);
+					}
+					else
+					{
+						chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
+						ip1 = V.ip->UU.U1.next;
+						while (ip1 != NULL)   /*eliminate redundant pullup's*/
+						{  /* (useful for compiling transistors) */
+							if (ip1->opcode == op_pullup && cmptrees(V.ip, ip1, LINK->LINK))
+								/*optimized for speed*/
+								killstmt(ip1, LINK->LINK);
+							ip1 = ip1->UU.U1.next;
+						}
+					}
+				}
+				else
+				{
+					killstmt(V.ip, LINK->LINK);
+				}
+				break;
+
+			case op_pulldn:
+				num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
+				WITH = &LINK->LINK->things[num];
+				if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
+							num < LINK->LINK->numports) && !WITH->wasstrong)
+				{
+					/*true*/
+					/**/
+					if (LINK->LINK->hasstats && WITH->wasdef == 1)
+					{
+						chgop(V.ip, op_pineq, LINK->LINK);
+						V.ip->ival = V.ip->UU.U1.arg1->ival;
+						chgop(V.ip->UU.U1.arg1, op_zero, LINK->LINK);
+					}
+					else
+					{
+						chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
+						ip1 = V.ip->UU.U1.next;
+						while (ip1 != NULL)   /*eliminate redundant pulldn's*/
+						{  /* (useful for compiling transistors) */
+							if (ip1->opcode == op_pulldn && cmptrees(V.ip, ip1, LINK->LINK))
+								/*optimized for speed*/
+								killstmt(ip1, LINK->LINK);
+							ip1 = ip1->UU.U1.next;
+						}
+					}
+				}
+				else
+				{
+					killstmt(V.ip, LINK->LINK);
+				}
+				break;
+
+			case op_vareq:
+				num = V.ip->ival + LINK->LINK->thingvars;
+				WITH = &LINK->LINK->things[num];
+				if (!LINK->LINK->hasstats ||
+						(WITH->wasused > 0 &&
+						 !(WITH->wasused == 1 &&
+							 treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))))
+				{
+					simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
+					if (V.ip->UU.U1.arg1->opcode == op_one)
+						chgposs(num, 1L << ((long)log_one), LINK);
+					else if (V.ip->UU.U1.arg1->opcode == op_zero)
+						chgposs(num, 1L << ((long)log_zero), LINK);
+					else
+						chgposs(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
+								LINK);
+				}
+				else
+				{
+					killstmt(V.ip, LINK->LINK);
+				}
+				break;
+
+			case op_alwaysconn:
+				num = V.ip->ival + LINK->LINK->thingnodes;
+				LINK->LINK->things[num].alwaysconn = true;
+				*V.ipp = V.ip->UU.U1.next;
+				Free(V.ip);
+				LINK->LINK->changed = true;
+				break;
+
+			default:
+				break;
+		}
+		if (LINK->LINK->changed)
+			oldch = true;
+		else
+			V.ipp = &V.ip->UU.U1.next;
 	}
-	if (!LINK->LINK->changed && checkconn(V.ip->UU.U1.arg1, LINK->LINK)) {
-	  switch (V.ip->opcode) {
-
-	  case op_ifone:
-	    chgop(V.ip, op_if, LINK->LINK);
-	    break;
+	LINK->LINK->changed = oldch;
 
-	  case op_ifzn:
-	    chgop(V.ip, op_ifzero, LINK->LINK);
-	    break;
-
-	  case op_ifconn:
-	    chgop(V.ip, op_iftrue, LINK->LINK);
-	    break;
-
-	  case op_ifnone:
-	    chgop(V.ip, op_iffalse, LINK->LINK);
-	    break;
-
-	  default:
-	    break;
-	  }
-	}
-	if (!LINK->LINK->changed && LINK->LINK->optlevel >= 3) {
-	  trymoveif(&V);
-	  if (!LINK->LINK->changed)
-	    tryfactorif(&V);
-	}
-      }
-      break;
-
-    case op_iftrue:
-    case op_iffalse:
-      disposetree(&V.ip->UU.U1.arg1, LINK->LINK);
-      if (V.ip->opcode == op_iftrue) {
-	disposetree(&V.ip->UU.U1.arg3, LINK->LINK);
-	ip1 = V.ip->UU.U1.arg2;
-      } else {
-	disposetree(&V.ip->UU.U1.arg2, LINK->LINK);
-	ip1 = V.ip->UU.U1.arg3;
-      }
-      *V.ipp = V.ip->UU.U1.next;
-      insertlist(V.ipp, ip1, &V);
-      Free(V.ip);
-      LINK->LINK->changed = true;
-      break;
-
-    case op_pineq:
-      num = V.ip->ival + LINK->LINK->thingnodes;
-      WITH = &LINK->LINK->things[num];
-      if (!LINK->LINK->hasstats || num < LINK->LINK->numports ||
-	  (WITH->wasused > 0 &&
-	   !(WITH->wasused == 1 &&
-	     treerefers(V.ip->UU.U1.arg1, num, LINK->LINK)))) {
-	ip1 = WITH->defn;
-	WITH->defn = NULL;   /*don't recursively expand!*/
-	simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
-	if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
-	  WITH->defn = V.ip;
-	if (V.ip->UU.U1.arg1->opcode == op_one)
-	  chgposs2(num, 1L << ((long)log_one), true, LINK);
-	else if (V.ip->UU.U1.arg1->opcode == op_zero)
-	  chgposs2(num, 1L << ((long)log_zero), true, LINK);
-	else if (V.ip->UU.U1.arg1->opcode == op_none) {
-	  WITH->defn = NULL;
-	  killstmt(V.ip, LINK->LINK);
-	} else if (checkconn(V.ip->UU.U1.arg1, LINK->LINK))
-	  chgposs2(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
-		   true, LINK);
-      } else
-	killstmt(V.ip, LINK->LINK);
-      break;
-
-    case op_pinoc:
-      num = V.ip->ival + LINK->LINK->thingnodes;
-      WITH = &LINK->LINK->things[num];
-      if (!LINK->LINK->hasstats || WITH->wasused > 0 ||
-	  num < LINK->LINK->numports) {
-	ip1 = WITH->defn;
-	WITH->defn = NULL;   /*don't recursively expand!*/
-	simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
-	if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
-	  WITH->defn = V.ip;
-	if (V.ip->UU.U1.arg1->opcode == op_one ||
-	    V.ip->UU.U1.arg1->opcode == op_none) {
-	  WITH->defn = NULL;
-	  killstmt(V.ip, LINK->LINK);
-	} else if (V.ip->UU.U1.arg1->opcode == op_zero)
-	  chgposs(num, 1L << ((long)log_zero), LINK);
-      } else
-	killstmt(V.ip, LINK->LINK);
-      break;
-
-    case op_pullup:
-      num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
-      WITH = &LINK->LINK->things[num];
-      if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
-	   num < LINK->LINK->numports) && !WITH->wasstrong) {
-	/*true*/
-	/**/
-	if (LINK->LINK->hasstats && WITH->wasdef == 1) {
-	  chgop(V.ip, op_pineq, LINK->LINK);
-	  V.ip->ival = V.ip->UU.U1.arg1->ival;
-	  chgop(V.ip->UU.U1.arg1, op_one, LINK->LINK);
-	} else {
-	  chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
-	  ip1 = V.ip->UU.U1.next;
-	  while (ip1 != NULL)   /*eliminate redundant pullup's*/
-	  {  /* (useful for compiling transistors) */
-	    if (ip1->opcode == op_pullup && cmptrees(V.ip, ip1, LINK->LINK))
-		  /*optimized for speed*/
-		    killstmt(ip1, LINK->LINK);
-	    ip1 = ip1->UU.U1.next;
-	  }
-	}
-      } else
-	killstmt(V.ip, LINK->LINK);
-      break;
-
-    case op_pulldn:
-      num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
-      WITH = &LINK->LINK->things[num];
-      if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
-	   num < LINK->LINK->numports) && !WITH->wasstrong) {
-	/*true*/
-	/**/
-	if (LINK->LINK->hasstats && WITH->wasdef == 1) {
-	  chgop(V.ip, op_pineq, LINK->LINK);
-	  V.ip->ival = V.ip->UU.U1.arg1->ival;
-	  chgop(V.ip->UU.U1.arg1, op_zero, LINK->LINK);
-	} else {
-	  chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
-	  ip1 = V.ip->UU.U1.next;
-	  while (ip1 != NULL)   /*eliminate redundant pulldn's*/
-	  {  /* (useful for compiling transistors) */
-	    if (ip1->opcode == op_pulldn && cmptrees(V.ip, ip1, LINK->LINK))
-		  /*optimized for speed*/
-		    killstmt(ip1, LINK->LINK);
-	    ip1 = ip1->UU.U1.next;
-	  }
-	}
-      } else
-	killstmt(V.ip, LINK->LINK);
-      break;
-
-    case op_vareq:
-      num = V.ip->ival + LINK->LINK->thingvars;
-      WITH = &LINK->LINK->things[num];
-      if (!LINK->LINK->hasstats ||
-	  (WITH->wasused > 0 &&
-	   !(WITH->wasused == 1 &&
-	     treerefers(V.ip->UU.U1.arg1, num, LINK->LINK)))) {
-	simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
-	if (V.ip->UU.U1.arg1->opcode == op_one)
-	  chgposs(num, 1L << ((long)log_one), LINK);
-	else if (V.ip->UU.U1.arg1->opcode == op_zero)
-	  chgposs(num, 1L << ((long)log_zero), LINK);
-	else
-	  chgposs(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
-		  LINK);
-      } else
-	killstmt(V.ip, LINK->LINK);
-      break;
-
-    case op_alwaysconn:
-      num = V.ip->ival + LINK->LINK->thingnodes;
-      LINK->LINK->things[num].alwaysconn = true;
-      *V.ipp = V.ip->UU.U1.next;
-      Free(V.ip);
-      LINK->LINK->changed = true;
-      break;
-
-    default:
-      break;
-    }
-    if (LINK->LINK->changed)
-      oldch = true;
-    else
-      V.ipp = &V.ip->UU.U1.next;
-  }
-  LINK->LINK->changed = oldch;
-
-  /*both parts*/
+	/*both parts*/
 }
 
-static void simplify(ipbase, LINK)
-instrrec **ipbase;
-struct LOC_compilepage *LINK;
+static void simplify(instrrec **ipbase, struct LOC_compilepage *LINK)
 {
-  struct LOC_simplify V;
-  char STR2[256];
-
-  V.LINK = LINK;
-  LINK->simppasscount++;
-  sprintf(STR2, "Optimization pass #%ld", LINK->simppasscount);
-  showcontrol(LINK->hdef, STR2);
-  LINK->changed = false;
-  V.tbase = NULL;
-  V.simplevel = 1;
-  simplstmt(ipbase, &V);
+	struct LOC_simplify V;
+	char STR2[256];
+
+	V.LINK = LINK;
+	LINK->simppasscount++;
+	sprintf(STR2, "Optimization pass #%ld", LINK->simppasscount);
+	showcontrol(LINK->hdef, STR2);
+	LINK->changed = false;
+	V.tbase = NULL;
+	V.simplevel = 1;
+	simplstmt(ipbase, &V);
 }
 
 
 
 /* Scan to find usage of variables and nodes */
-static void scan(ip, scanlevel, LINK)
-instrrec *ip;
-long scanlevel;
-struct LOC_compilepage *LINK;
+static void scan(instrrec *ip, long scanlevel, struct LOC_compilepage *LINK)
 {
-  noderec *WITH;
-
-  while (ip != NULL) {
-    if (ip->UU.U1.arg1 != NULL)
-      scan(ip->UU.U1.arg1, scanlevel + 1, LINK);
-    if (ip->UU.U1.arg2 != NULL)
-      scan(ip->UU.U1.arg2, scanlevel + 1, LINK);
-    if (ip->UU.U1.arg3 != NULL)
-      scan(ip->UU.U1.arg3, scanlevel + 1, LINK);
-    switch (ip->opcode) {
-
-    case op_pin:
-    case op_pinref:
-      WITH = &LINK->things[ip->ival + LINK->thingnodes];
-      WITH->isused++;
-      break;
-
-    case op_var:
-      WITH = &LINK->things[ip->ival + LINK->thingvars];
-      WITH->isused++;
-      break;
-
-    case op_pineq:
-    case op_pinoc:
-      WITH = &LINK->things[ip->ival + LINK->thingnodes];
-      WITH->isdef++;
-      if (ip->UU.U1.arg1->opcode == op_one)
-	WITH->nextposs |= 1L << ((long)log_one);
-      else if (ip->UU.U1.arg1->opcode == op_zero)
-	WITH->nextposs |= 1L << ((long)log_zero);
-      else
-	WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
-      if (scanlevel == 1 &&
-	  !treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingnodes, LINK))
-	WITH->defn = ip;
-      else
-	WITH->defn = NULL;
-      break;
-
-    case op_pullup:
-    case op_pulldn:
-      WITH = &LINK->things[ip->UU.U1.arg1->ival + LINK->thingnodes];
-      WITH->isused--;   /*counteract recursive call*/
-      WITH->isdef++;
-      WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
-      if (scanlevel == 1) {
-	WITH->defn = ip;
-	WITH->alwaysconn = true;
-      } else
-	WITH->defn = NULL;
-      break;
-
-    case op_vareq:
-      WITH = &LINK->things[ip->ival + LINK->thingvars];
-      WITH->isdef++;
-      if (ip->UU.U1.arg1->opcode == op_one)
-	WITH->nextposs |= 1L << ((long)log_one);
-      else if (ip->UU.U1.arg1->opcode == op_zero)
-	WITH->nextposs |= 1L << ((long)log_zero);
-      else
-	WITH->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
-      if (scanlevel == 1 &&
-	  !treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingvars, LINK))
-	WITH->defn = ip;
-      else
-	WITH->defn = NULL;
-      break;
-
-    default:
-      break;
-    }
-    ip = ip->UU.U1.next;
-  }
+	noderec *WITH;
+
+	while (ip != NULL)
+	{
+		if (ip->UU.U1.arg1 != NULL)
+			scan(ip->UU.U1.arg1, scanlevel + 1, LINK);
+		if (ip->UU.U1.arg2 != NULL)
+			scan(ip->UU.U1.arg2, scanlevel + 1, LINK);
+		if (ip->UU.U1.arg3 != NULL)
+			scan(ip->UU.U1.arg3, scanlevel + 1, LINK);
+		switch (ip->opcode)
+		{
+			case op_pin:
+			case op_pinref:
+				WITH = &LINK->things[ip->ival + LINK->thingnodes];
+				WITH->isused++;
+				break;
+
+			case op_var:
+				WITH = &LINK->things[ip->ival + LINK->thingvars];
+				WITH->isused++;
+				break;
+
+			case op_pineq:
+			case op_pinoc:
+				WITH = &LINK->things[ip->ival + LINK->thingnodes];
+				WITH->isdef++;
+				if (ip->UU.U1.arg1->opcode == op_one)
+					WITH->nextposs |= 1L << ((long)log_one);
+				else if (ip->UU.U1.arg1->opcode == op_zero)
+					WITH->nextposs |= 1L << ((long)log_zero);
+				else
+					WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
+				if (scanlevel == 1 &&
+						!treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingnodes, LINK))
+					WITH->defn = ip;
+				else
+					WITH->defn = NULL;
+				break;
+
+			case op_pullup:
+			case op_pulldn:
+				WITH = &LINK->things[ip->UU.U1.arg1->ival + LINK->thingnodes];
+				WITH->isused--;   /*counteract recursive call*/
+				WITH->isdef++;
+				WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
+				if (scanlevel == 1)
+				{
+					WITH->defn = ip;
+					WITH->alwaysconn = true;
+				}
+				else
+				{
+					WITH->defn = NULL;
+				}
+				break;
+
+			case op_vareq:
+				WITH = &LINK->things[ip->ival + LINK->thingvars];
+				WITH->isdef++;
+				if (ip->UU.U1.arg1->opcode == op_one)
+					WITH->nextposs |= 1L << ((long)log_one);
+				else if (ip->UU.U1.arg1->opcode == op_zero)
+					WITH->nextposs |= 1L << ((long)log_zero);
+				else
+					WITH->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
+				if (scanlevel == 1 &&
+						!treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingvars, LINK))
+					WITH->defn = ip;
+				else
+					WITH->defn = NULL;
+				break;
+
+			default:
+				break;
+		}
+		ip = ip->UU.U1.next;
+	}
 }
 
 
 
 /* Assign optimal variable names; also assign internal node numbers */
 /* Concentrates most often-used variables in the faster A through P */
-static void assignvars(LINK)
-struct LOC_compilepage *LINK;
+static void assignvars(struct LOC_compilepage *LINK)
 {
-  long i, max, done, FORLIM;
-  noderec *WITH;
-
-  LINK->curppin = 0;
-  LINK->curpvar = 0;
-  FORLIM = LINK->thingvars;
-  for (i = LINK->thingnodes; i < FORLIM; i++) {
-    WITH = &LINK->things[i];
-    if (WITH->wasused > 0 || WITH->wasdef > 0) {
-      WITH->truenum = LINK->curppin;
-      LINK->curppin++;
-    }
-  }
-  FORLIM = LINK->numthings;
-  for (i = LINK->thingvars; i < FORLIM; i++) {
-    WITH = &LINK->things[i];
-    if (WITH->wasused > 0 || WITH->wasdef > 0) {
-      WITH->truenum = -1;
-      LINK->curpvar++;
-    } else
-      WITH->truenum = 0;
-  }
-  done = 0;
-  while (done < LINK->curpvar) {
-    max = 0;
-    FORLIM = LINK->numthings;
-    for (i = LINK->thingvars; i < FORLIM; i++) {
-      WITH = &LINK->things[i];
-      if (WITH->truenum < 0 && WITH->wasused > max)
-	max = WITH->wasused;
-    }
-    FORLIM = LINK->numthings;
-    for (i = LINK->thingvars; i < FORLIM; i++) {
-      WITH = &LINK->things[i];
-      if (WITH->truenum < 0 && WITH->wasused >= max) {
-	WITH->truenum = done;
-	done++;
-      }
-    }
-  }
+	long i, max, done, FORLIM;
+	noderec *WITH;
+
+	LINK->curppin = 0;
+	LINK->curpvar = 0;
+	FORLIM = LINK->thingvars;
+	for (i = LINK->thingnodes; i < FORLIM; i++)
+	{
+		WITH = &LINK->things[i];
+		if (WITH->wasused > 0 || WITH->wasdef > 0)
+		{
+			WITH->truenum = LINK->curppin;
+			LINK->curppin++;
+		}
+	}
+	FORLIM = LINK->numthings;
+	for (i = LINK->thingvars; i < FORLIM; i++)
+	{
+		WITH = &LINK->things[i];
+		if (WITH->wasused > 0 || WITH->wasdef > 0)
+		{
+			WITH->truenum = -1;
+			LINK->curpvar++;
+		} else
+			WITH->truenum = 0;
+	}
+	done = 0;
+	while (done < LINK->curpvar)
+	{
+		max = 0;
+		FORLIM = LINK->numthings;
+		for (i = LINK->thingvars; i < FORLIM; i++)
+		{
+			WITH = &LINK->things[i];
+			if (WITH->truenum < 0 && WITH->wasused > max)
+				max = WITH->wasused;
+		}
+		FORLIM = LINK->numthings;
+		for (i = LINK->thingvars; i < FORLIM; i++)
+		{
+			WITH = &LINK->things[i];
+			if (WITH->truenum < 0 && WITH->wasused >= max)
+			{
+				WITH->truenum = done;
+				done++;
+			}
+		}
+	}
 }
 
 
 
 /* Clean up node and variable numbers */
 
-static void clean(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static void clean(instrrec *ip, struct LOC_compilepage *LINK)
 {
-  while (ip != NULL) {
-    if (ip->UU.U1.arg1 != NULL)
-      clean(ip->UU.U1.arg1, LINK);
-    if (ip->UU.U1.arg2 != NULL)
-      clean(ip->UU.U1.arg2, LINK);
-    if (ip->UU.U1.arg3 != NULL)
-      clean(ip->UU.U1.arg3, LINK);
-    switch (ip->opcode) {
-
-    case op_pin:
-    case op_pinref:
-    case op_pineq:
-    case op_pinoc:
-      ip->ival = LINK->things[ip->ival + LINK->thingnodes].truenum;
-      break;
-
-    case op_var:
-    case op_vareq:
-      ip->ival = LINK->things[ip->ival + LINK->thingvars].truenum;
-      break;
-
-    case op_fix1:
-      ip->opcode = op_not;
-      ip->UU.U1.arg1 = makeinstr1(op_fix0, makenot(ip->UU.U1.arg1, LINK), LINK);
-      break;
-
-    case op_none:   /*should never occur*/
-      ip->opcode = op_one;
-      break;
-
-    default:
-      break;
-    }
-    ip = ip->UU.U1.next;
-  }
+	while (ip != NULL)
+	{
+		if (ip->UU.U1.arg1 != NULL)
+			clean(ip->UU.U1.arg1, LINK);
+		if (ip->UU.U1.arg2 != NULL)
+			clean(ip->UU.U1.arg2, LINK);
+		if (ip->UU.U1.arg3 != NULL)
+			clean(ip->UU.U1.arg3, LINK);
+		switch (ip->opcode)
+		{
+			case op_pin:
+			case op_pinref:
+			case op_pineq:
+			case op_pinoc:
+				ip->ival = LINK->things[ip->ival + LINK->thingnodes].truenum;
+				break;
+
+			case op_var:
+			case op_vareq:
+				ip->ival = LINK->things[ip->ival + LINK->thingvars].truenum;
+				break;
+
+			case op_fix1:
+				ip->opcode = op_not;
+				ip->UU.U1.arg1 = makeinstr1(op_fix0, makenot(ip->UU.U1.arg1, LINK), LINK);
+				break;
+
+			case op_none:   /*should never occur*/
+				ip->opcode = op_one;
+				break;
+
+			default:
+				break;
+		}
+		ip = ip->UU.U1.next;
+	}
 }
 
 /* Local  variables for codegen: */
 struct LOC_codegen {
-  struct LOC_compilepage *LINK;
-  int genflag;
-  uchar *proc;
+	struct LOC_compilepage *LINK;
+	int genflag;
+	uchar *proc;
 } ;
 
-static void store(b, LINK)
-long b;
-struct LOC_codegen *LINK;
+static void store(long b, struct LOC_codegen *LINK)
 {
-  LINK->LINK->pc++;
-  if (LINK->genflag)
-    LINK->proc[LINK->LINK->pc - 1] = (char)b;
+	LINK->LINK->pc++;
+	if (LINK->genflag)
+		LINK->proc[LINK->LINK->pc - 1] = (char)b;
 }
 
-static void storepnum(i, twobytes, LINK)
-long i;
-int twobytes;
-struct LOC_codegen *LINK;
+static void storepnum(long i, int twobytes, struct LOC_codegen *LINK)
 {
-  if (i >= 64) {
-    store(((i - 64) & 127) + 128, LINK);
-    store((i - 64) / 128 + 32, LINK);
-    return;
-  }
-  store(i + 64, LINK);
-  if (twobytes)
-    store(32L, LINK);
+	if (i >= 64)
+	{
+		store(((i - 64) & 127) + 128, LINK);
+		store((i - 64) / 128 + 32, LINK);
+		return;
+	}
+	store(i + 64, LINK);
+	if (twobytes)
+		store(32L, LINK);
 }
 
-static void genlist(ip, LINK)
-instrrec *ip;
-struct LOC_codegen *LINK;
+static void genlist(instrrec *ip, struct LOC_codegen *LINK)
 {
-  char STR2[256];
-
-  while (ip != NULL) {
-    switch (ip->opcode) {
-
-    case op_if:
-    case op_ifnone:
-    case op_ifzero:
-    case op_ifone:
-    case op_ifconn:
-    case op_ifzn:
-      LINK->LINK->instrcount++;
-      switch (ip->opcode) {
-
-      case op_if:
-	store(3L, LINK);
-	break;
-
-      case op_ifnone:
-	store(4L, LINK);
-	break;
-
-      case op_ifzero:
-	store(5L, LINK);
-	break;
-
-      case op_ifone:
-	store(6L, LINK);
-	break;
-
-      case op_ifconn:
-	store(7L, LINK);
-	break;
-
-      case op_ifzn:
-	store(8L, LINK);
-	break;
-
-      default:
-	break;
-      }
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      if (ip->UU.U1.arg3 != NULL) {
-	store(15L, LINK);   /*ELSE*/
-	genlist(ip->UU.U1.arg3, LINK);
-      }
-      store(2L, LINK);   /*END*/
-      break;
-
-    case op_iftrue:   /*if simplify was not called enough times*/
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_iffalse:
-      genlist(ip->UU.U1.arg3, LINK);
-      break;
-
-    case op_pineq:
-      LINK->LINK->instrcount++;
-      if (ip->ival >= 0) {
-	store(16L, LINK);
-	storepnum((long)ip->ival, false, LINK);
-      } else if (ip->ival < -32) {
-	store(30L, LINK);
-	store(-ip->ival - 1L, LINK);
-      } else
-	store(31L - ip->ival, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_pinoc:
-      LINK->LINK->instrcount++;
-      if (ip->ival >= 0) {
-	store(17L, LINK);
-	storepnum((long)ip->ival, false, LINK);
-      } else if (ip->ival < -32) {
-	store(31L, LINK);
-	store(-ip->ival - 1L, LINK);
-      } else
-	store(63L - ip->ival, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_vareq:
-      LINK->LINK->instrcount++;
-      if (ip->ival < 16) {
-	if (ip->UU.U1.arg1->opcode == op_not &&
-	    ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
-	    ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival)
-	  store(ip->ival + 112L, LINK);
-	else if (ip->UU.U1.arg1->opcode == op_zero)
-	  store(ip->ival + 128L, LINK);
-	else if (ip->UU.U1.arg1->opcode == op_one)
-	  store(ip->ival + 144L, LINK);
-	else {
-	  store(ip->ival + 96L, LINK);
-	  genlist(ip->UU.U1.arg1, LINK);
-	}
-      } else {
-	if (ip->UU.U1.arg1->opcode == op_not &&
-	    ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
-	    ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival) {
-	  store(25L, LINK);
-	  storepnum(ip->ival - 16L, false, LINK);
-	} else if (ip->UU.U1.arg1->opcode == op_zero) {
-	  store(26L, LINK);
-	  storepnum(ip->ival - 16L, false, LINK);
-	} else if (ip->UU.U1.arg1->opcode == op_one) {
-	  store(27L, LINK);
-	  storepnum(ip->ival - 16L, false, LINK);
-	} else {
-	  store(24L, LINK);
-	  storepnum(ip->ival - 16L, false, LINK);
-	  genlist(ip->UU.U1.arg1, LINK);
+	char STR2[256];
+
+	while (ip != NULL)
+	{
+		switch (ip->opcode)
+		{
+			case op_if:
+			case op_ifnone:
+			case op_ifzero:
+			case op_ifone:
+			case op_ifconn:
+			case op_ifzn:
+				LINK->LINK->instrcount++;
+				switch (ip->opcode)
+				{
+					case op_if:
+						store(3L, LINK);
+						break;
+
+					case op_ifnone:
+						store(4L, LINK);
+						break;
+
+					case op_ifzero:
+						store(5L, LINK);
+						break;
+
+					case op_ifone:
+						store(6L, LINK);
+						break;
+
+					case op_ifconn:
+						store(7L, LINK);
+						break;
+
+					case op_ifzn:
+						store(8L, LINK);
+						break;
+
+					default:
+						break;
+				}
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				if (ip->UU.U1.arg3 != NULL)
+				{
+					store(15L, LINK);   /*ELSE*/
+					genlist(ip->UU.U1.arg3, LINK);
+				}
+				store(2L, LINK);   /*END*/
+				break;
+
+			case op_iftrue:   /*if simplify was not called enough times*/
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_iffalse:
+				genlist(ip->UU.U1.arg3, LINK);
+				break;
+
+			case op_pineq:
+				LINK->LINK->instrcount++;
+				if (ip->ival >= 0)
+				{
+					store(16L, LINK);
+					storepnum((long)ip->ival, false, LINK);
+				}
+				else if (ip->ival < -32)
+				{
+					store(30L, LINK);
+					store(-ip->ival - 1L, LINK);
+				}
+				else
+				{
+					store(31L - ip->ival, LINK);
+				}
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_pinoc:
+				LINK->LINK->instrcount++;
+				if (ip->ival >= 0)
+				{
+					store(17L, LINK);
+					storepnum((long)ip->ival, false, LINK);
+				}
+				else if (ip->ival < -32)
+				{
+					store(31L, LINK);
+					store(-ip->ival - 1L, LINK);
+				}
+				else
+				{
+					store(63L - ip->ival, LINK);
+				}
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_vareq:
+				LINK->LINK->instrcount++;
+				if (ip->ival < 16)
+				{
+					if (ip->UU.U1.arg1->opcode == op_not &&
+							ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
+							ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival)
+						store(ip->ival + 112L, LINK);
+					else if (ip->UU.U1.arg1->opcode == op_zero)
+						store(ip->ival + 128L, LINK);
+					else if (ip->UU.U1.arg1->opcode == op_one)
+						store(ip->ival + 144L, LINK);
+					else
+					{
+						store(ip->ival + 96L, LINK);
+						genlist(ip->UU.U1.arg1, LINK);
+					}
+				}
+				else
+				{
+					if (ip->UU.U1.arg1->opcode == op_not &&
+							ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
+							ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival)
+					{
+						store(25L, LINK);
+						storepnum(ip->ival - 16L, false, LINK);
+					}
+					else if (ip->UU.U1.arg1->opcode == op_zero)
+					{
+						store(26L, LINK);
+						storepnum(ip->ival - 16L, false, LINK);
+					}
+					else if (ip->UU.U1.arg1->opcode == op_one)
+					{
+						store(27L, LINK);
+						storepnum(ip->ival - 16L, false, LINK);
+					}
+					else
+					{
+						store(24L, LINK);
+						storepnum(ip->ival - 16L, false, LINK);
+						genlist(ip->UU.U1.arg1, LINK);
+					}
+				}
+				break;
+
+			case op_pulldn:
+				LINK->LINK->instrcount++;
+				store(28L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_pullup:
+				LINK->LINK->instrcount++;
+				store(29L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_and:
+				store(160L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_nand:
+				store(161L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_or:
+				store(162L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_nor:
+				store(163L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_xor:
+				store(164L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_not:
+				if (ip->UU.U1.arg1->opcode == op_var && ip->UU.U1.arg1->ival < 16)
+					store(ip->UU.U1.arg1->ival + 240L, LINK);
+				else
+				{
+					store(165L, LINK);
+					genlist(ip->UU.U1.arg1, LINK);
+				}
+				break;
+
+			case op_rise:
+				store(166L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_fall:
+				store(167L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_zero:
+				store(168L, LINK);
+				break;
+
+			case op_one:
+				store(169L, LINK);
+				break;
+
+			case op_same:
+				store(170L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				genlist(ip->UU.U1.arg2, LINK);
+				break;
+
+			case op_fix0:
+				store(173L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_strong:
+				store(177L, LINK);
+				genlist(ip->UU.U1.arg1, LINK);
+				break;
+
+			case op_pin:
+			case op_pinref:
+				if (ip->ival >= 0)
+				{
+					store(171L, LINK);
+					storepnum((long)ip->ival, false, LINK);
+				}
+				else if (ip->ival < -32)
+				{
+					store(176L, LINK);
+					store(-ip->ival - 1L, LINK);
+				}
+				else
+					store(191L - ip->ival, LINK);
+				break;
+
+			case op_var:
+				if (ip->ival < 16)
+					store(ip->ival + 224L, LINK);
+				else
+				{
+					store(172L, LINK);
+					storepnum(ip->ival - 16L, false, LINK);
+				}
+				break;
+
+			case op_alwaysconn:
+				/* blank case */
+				break;
+
+			default:
+				sprintf(STR2, "Internal error in code generator, opcode=%ld",
+						(long)ip->opcode);
+				/*nothing to store*/
+				error(STR2, LINK->LINK);
+				break;
+		}
+		ip = ip->UU.U1.next;
 	}
-      }
-      break;
-
-    case op_pulldn:
-      LINK->LINK->instrcount++;
-      store(28L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_pullup:
-      LINK->LINK->instrcount++;
-      store(29L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_and:
-      store(160L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_nand:
-      store(161L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_or:
-      store(162L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_nor:
-      store(163L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_xor:
-      store(164L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_not:
-      if (ip->UU.U1.arg1->opcode == op_var && ip->UU.U1.arg1->ival < 16)
-	store(ip->UU.U1.arg1->ival + 240L, LINK);
-      else {
-	store(165L, LINK);
-	genlist(ip->UU.U1.arg1, LINK);
-      }
-      break;
-
-    case op_rise:
-      store(166L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_fall:
-      store(167L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_zero:
-      store(168L, LINK);
-      break;
-
-    case op_one:
-      store(169L, LINK);
-      break;
-
-    case op_same:
-      store(170L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      genlist(ip->UU.U1.arg2, LINK);
-      break;
-
-    case op_fix0:
-      store(173L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_strong:
-      store(177L, LINK);
-      genlist(ip->UU.U1.arg1, LINK);
-      break;
-
-    case op_pin:
-    case op_pinref:
-      if (ip->ival >= 0) {
-	store(171L, LINK);
-	storepnum((long)ip->ival, false, LINK);
-      } else if (ip->ival < -32) {
-	store(176L, LINK);
-	store(-ip->ival - 1L, LINK);
-      } else
-	store(191L - ip->ival, LINK);
-      break;
-
-    case op_var:
-      if (ip->ival < 16)
-	store(ip->ival + 224L, LINK);
-      else {
-	store(172L, LINK);
-	storepnum(ip->ival - 16L, false, LINK);
-      }
-      break;
-
-    case op_alwaysconn:
-      /* blank case */
-      break;
-
-    default:
-      sprintf(STR2, "Internal error in code generator, opcode=%ld",
-	      (long)ip->opcode);
-      /*nothing to store*/
-      error(STR2, LINK->LINK);
-      break;
-    }
-    ip = ip->UU.U1.next;
-  }
 }
 
 
-
 /* Generate a GDL definition from a tree */
 
-static void codegen(genflag_, LINK)
-int genflag_;
-struct LOC_compilepage *LINK;
+static void codegen(int genflag_, struct LOC_compilepage *LINK)
 {
-  struct LOC_codegen V;
-
-  V.LINK = LINK;
-  V.genflag = genflag_;
-  V.proc = LINK->hdef->proc;
-  if (LINK->hdef->numpvars > 0) {
-    store(23L, &V);   /*INST*/
-    store(38L, &V);
-    storepnum(LINK->hdef->numppins, true, &V);
-    storepnum(LINK->hdef->numpvars, true, &V);
-  } else if (LINK->hdef->numppins > 0) {
-    store(23L, &V);   /*INST*/
-    store(36L, &V);
-    storepnum(LINK->hdef->numppins, true, &V);
-  }
-  genlist(LINK->ipbase, &V);
-  if (LINK->pc == 0) {
-    store(23L, &V);   /*INST*/
-    store(34L, &V);
-  }
-  store(0L, &V);
-
-  /*  store(23);  {INST*/
-  /*  store(34);  {*/
+	struct LOC_codegen V;
+
+	V.LINK = LINK;
+	V.genflag = genflag_;
+	V.proc = LINK->hdef->proc;
+	if (LINK->hdef->numpvars > 0)
+	{
+		store(23L, &V);   /*INST*/
+		store(38L, &V);
+		storepnum(LINK->hdef->numppins, true, &V);
+		storepnum(LINK->hdef->numpvars, true, &V);
+	}
+	else if (LINK->hdef->numppins > 0)
+	{
+		store(23L, &V);   /*INST*/
+		store(36L, &V);
+		storepnum(LINK->hdef->numppins, true, &V);
+	}
+	
+	genlist(LINK->ipbase, &V);
+	if (LINK->pc == 0)
+	{
+		store(23L, &V);   /*INST*/
+		store(34L, &V);
+	}
+	store(0L, &V);
+
+	/*  store(23);  {INST*/
+	/*  store(34);  {*/
 }  /*codegen*/
 
 
-static void writestats(f, pref, LINK)
-FILE *f;
-char *pref;
-struct LOC_compilepage *LINK;
+static void writestats(FILE *f, char *pref, struct LOC_compilepage *LINK)
 {
-  char STR2[256];
-
-  fprintf(f, "%sDump of %s on %s by %s\n",
-	  pref, LINK->hdef->name, strdate(STR2, "$X"), cuserid(NULL));
-  fprintf(f, "%sLOG digital hierarchy compiler version of %s\n\n",
-	  pref, lastmoddate);
-  fprintf(f, "%sCompilation time:     %1.2f sec\n",
-	  pref, LINK->starttime / 100.0);
-  fprintf(f, "%sOptimization steps:   %ld\n", pref, LINK->simppasscount);
-  fprintf(f, "%sOptimization limit:   ", pref);
-  if (LINK->optlevel < 1000)
-    fprintf(f, "%ld\n", LINK->optlevel);
-  else
-    fprintf(f, "Infinite\n");
-  fprintf(f,
-	  "\n%sDefinition gates:     %ld active, %ld instance, %ld inert\n",
-	  pref, LINK->gatecount, LINK->subcount, LINK->inertcount);
-  if (LINK->forcecount > 0)
-    fprintf(f, "%sForce-driven nodes:   %ld\n", pref, LINK->forcecount);
-  fprintf(f, "%sTotal instructions:   %ld", pref, LINK->instrcount);
-  if (LINK->simppasscount > 0)
-    fprintf(f, " (from %ld)", LINK->oldinstrcount);
-  fprintf(f, "\n%sProgram bytes:        %ld\n", pref, LINK->pc);
-  fprintf(f, "%sState variables:      ", pref);
-  if (LINK->curpvar > 16) {
-    fprintf(f, "A-P, V0");
-    if (LINK->curpvar > 17)
-      fprintf(f, "-V%ld", LINK->curpvar - 17);
-  } else if (LINK->curpvar > 1)
-    fprintf(f, "A-%c", (char)(LINK->curpvar + 64));
-  else if (LINK->curpvar == 1)
-    putc('A', f);
-  else
-    fprintf(f, "None");
-  fprintf(f, "\n%sInternal nodes:       ", pref);
-  if (LINK->curppin > 1)
-    fprintf(f, "##0-##%ld", LINK->curppin - 1);
-  else if (LINK->curppin == 1)
-    fprintf(f, "##0");
-  else
-    fprintf(f, "None");
-  putc('\n', f);
-  fprintf(f, "%sExternal pins:        %d\n", pref, LINK->numports);
+	char STR2[256];
+
+	fprintf(f, "%sDump of %s on %s by %s\n",
+			pref, LINK->hdef->name, strdate(STR2, "$X"), cuserid(NULL));
+	fprintf(f, "%sLOG digital hierarchy compiler version of %s\n\n",
+			pref, lastmoddate);
+	fprintf(f, "%sCompilation time:     %1.2f sec\n",
+			pref, LINK->starttime / 100.0);
+	fprintf(f, "%sOptimization steps:   %ld\n", pref, LINK->simppasscount);
+	fprintf(f, "%sOptimization limit:   ", pref);
+	if (LINK->optlevel < 1000)
+		fprintf(f, "%ld\n", LINK->optlevel);
+	else
+		fprintf(f, "Infinite\n");
+	fprintf(f,
+			"\n%sDefinition gates:     %ld active, %ld instance, %ld inert\n",
+			pref, LINK->gatecount, LINK->subcount, LINK->inertcount);
+	if (LINK->forcecount > 0)
+		fprintf(f, "%sForce-driven nodes:   %ld\n", pref, LINK->forcecount);
+	fprintf(f, "%sTotal instructions:   %ld", pref, LINK->instrcount);
+	if (LINK->simppasscount > 0)
+		fprintf(f, " (from %ld)", LINK->oldinstrcount);
+	fprintf(f, "\n%sProgram bytes:        %ld\n", pref, LINK->pc);
+	fprintf(f, "%sState variables:      ", pref);
+	if (LINK->curpvar > 16)
+	{
+		fprintf(f, "A-P, V0");
+		if (LINK->curpvar > 17)
+			fprintf(f, "-V%ld", LINK->curpvar - 17);
+	}
+	else if (LINK->curpvar > 1)
+		fprintf(f, "A-%c", (char)(LINK->curpvar + 64));
+	else if (LINK->curpvar == 1)
+		putc('A', f);
+	else
+		fprintf(f, "None");
+	fprintf(f, "\n%sInternal nodes:       ", pref);
+	if (LINK->curppin > 1)
+		fprintf(f, "##0-##%ld", LINK->curppin - 1);
+	else if (LINK->curppin == 1)
+		fprintf(f, "##0");
+	else
+		fprintf(f, "None");
+	putc('\n', f);
+	fprintf(f, "%sExternal pins:        %d\n", pref, LINK->numports);
 }
 
 
-static void dodump(LINK)
-struct LOC_compilepage *LINK;
+static void dodump(struct LOC_compilepage *LINK)
 {
-  FILE *f;
-  char buf[256];
-  char STR2[256];
-
-  f = NULL;
-  sprintf(buf, "/spool/apple.text/dig%ld", ma_rand2(1000L, 9999L));
-  sprintf(STR2, "Writing to dump file %s", buf);
-  (*logsima_action.lact->hook.vmessage)(STR2);
-  if (f != NULL)
-    f = freopen(buf, "w", f);
-  else
-    f = fopen(buf, "w");
-  if (f == NULL)
-    _EscIO(FileNotFound);
-  writestats(f, "", LINK);
-  fprintf(f, "\n\n");
-  if (LINK->bigdump) {
-    dumptree(f, LINK->ipbase, NULL, LINK);
-    putc('\n', f);
-  }
-  dasmhdef(f, LINK->hdef, false);
-  if (f != NULL)
-    fclose(f);
-  f = NULL;
-  if (f != NULL)
-    fclose(f);
+	FILE *f;
+	char buf[256];
+	char STR2[256];
+
+	f = NULL;
+	sprintf(buf, "/spool/apple.text/dig%ld", ma_rand2(1000L, 9999L));
+	sprintf(STR2, "Writing to dump file %s", buf);
+	(*logsima_action.lact->hook.vmessage)(STR2);
+	if (f != NULL)
+		f = freopen(buf, "w", f);
+	else
+		f = fopen(buf, "w");
+
+	if (f == NULL)
+		_EscIO(FileNotFound);
+	writestats(f, "", LINK);
+	fprintf(f, "\n\n");
+	if (LINK->bigdump)
+	{
+		dumptree(f, LINK->ipbase, NULL, LINK);
+		putc('\n', f);
+	}
+	dasmhdef(f, LINK->hdef, false);
+	
+	if (f != NULL)
+		fclose(f);
+	f = NULL;
+	
+	if (f != NULL)
+		fclose(f);
 }
 
 
-static void dowritefile(fn_, LINK)
-char *fn_;
-struct LOC_compilepage *LINK;
+static void dowritefile(char *fn_, struct LOC_compilepage *LINK)
 {
-  char fn[256];
-  FILE *f;
-  char STR1[256];
-
-  strcpy(fn, fn_);
-  f = NULL;
-  sprintf(STR1, "Writing definition to file %s", fn);
-  (*logsima_action.lact->hook.vmessage)(STR1);
-  if (f != NULL)
-    f = freopen(fn, "w", f);
-  else
-    f = fopen(fn, "w");
-  if (f == NULL)
-    _EscIO(FileNotFound);
-  writestats(f, "# ", LINK);
-  fprintf(f, "\nUPDATEKIND\n");
-  fprintf(f, "SIMTYPE 16\n\n");
-  dasmhdef(f, LINK->hdef, true);
-  putc('\n', f);
-  if (f != NULL)
-    fclose(f);
-  f = NULL;
-  if (f != NULL)
-    fclose(f);
+	char fn[256];
+	FILE *f;
+	char STR1[256];
+
+	strcpy(fn, fn_);
+	f = NULL;
+	sprintf(STR1, "Writing definition to file %s", fn);
+	(*logsima_action.lact->hook.vmessage)(STR1);
+	if (f != NULL)
+		f = freopen(fn, "w", f);
+	else
+		f = fopen(fn, "w");
+
+	if (f == NULL)
+		_EscIO(FileNotFound);
+
+	writestats(f, "# ", LINK);
+	fprintf(f, "\nUPDATEKIND\n");
+	fprintf(f, "SIMTYPE 16\n\n");
+	dasmhdef(f, LINK->hdef, true);
+	putc('\n', f);
+	
+	if (f != NULL)
+		fclose(f);
+	f = NULL;
+	
+	if (f != NULL)
+		fclose(f);
 }
 
 
-static void showstats(LINK)
-struct LOC_compilepage *LINK;
+static void showstats(struct LOC_compilepage *LINK)
 {
-  char buf[256];
-  log_action_t *WITH;
-  char STR1[256];
-  char STR2[256];
-
-  WITH = logsima_action.lact;
-  sprintf(buf, "Compilation of %s took %s seconds",
-	  LINK->hdef->name,
-	  ma_strfmtreal(STR1, LINK->starttime / 100.0, -1L, 2L));
-  if (LINK->simppasscount > 0)
-    sprintf(buf + strlen(buf), " in %ld optimization steps",
-	    LINK->simppasscount);
-  sprintf(STR2, "%s.", buf);
-  (*WITH->hook.message)(STR2);
-  sprintf(buf, "Gate program is %ld bytes = %ld instructions long",
-	  LINK->pc, LINK->instrcount);
-  (*WITH->hook.message)(buf);
-  sprintf(buf, "Program uses %ld state variable", LINK->curpvar);
-  if (LINK->curpvar != 1)
-    strcat(buf, "s");
-  sprintf(buf + strlen(buf), " and %ld internal node", LINK->curppin);
-  if (LINK->curppin != 1)
-    strcat(buf, "s");
-  sprintf(STR2, "%s.", buf);
-  (*WITH->hook.message)(STR2);
+	char buf[256];
+	log_action_t *WITH;
+	char STR1[256];
+	char STR2[256];
+
+	WITH = logsima_action.lact;
+	sprintf(buf, "Compilation of %s took %s seconds",
+			LINK->hdef->name,
+			ma_strfmtreal(STR1, LINK->starttime / 100.0, -1L, 2L));
+
+	if (LINK->simppasscount > 0)
+		sprintf(buf + strlen(buf), " in %ld optimization steps",
+				LINK->simppasscount);
+	
+	sprintf(STR2, "%s.", buf);
+	(*WITH->hook.message)(STR2);
+	sprintf(buf, "Gate program is %ld bytes = %ld instructions long",
+			LINK->pc, LINK->instrcount);
+	(*WITH->hook.message)(buf);
+	sprintf(buf, "Program uses %ld state variable", LINK->curpvar);
+	
+	if (LINK->curpvar != 1)
+		strcat(buf, "s");
+	sprintf(buf + strlen(buf), " and %ld internal node", LINK->curppin);
+	
+	if (LINK->curppin != 1)
+		strcat(buf, "s");
+	sprintf(STR2, "%s.", buf);
+	(*WITH->hook.message)(STR2);
 }
 
 
@@ -4088,790 +4217,939 @@ struct LOC_compilepage *LINK;
    It works by converting each GDL procedure into tree form, combining the
    trees, simplifying, then converting the resulting tree back into GDL. */
 
-static void compilepage(hdef_)
-hdefrec *hdef_;
+static void compilepage(hdefrec *hdef_)
 {
-  struct LOC_compilepage V;
-  controlinfo *cip;
-  int wantstats, dumpflag;
-  char writefile[256];
-  long i, extrarpt;
-  log_nrec **templs;
-  short *pnumlist;
-  na_strlist_t *l1;
-  dependrec *dep;
-  log_lrec *lp;
-  char buf[256], wrd[256];
-  log_sigrec *sig;
-  log_action_t *WITH;
-  char STR1[256];
-  char STR2[256];
-  char STR3[256];
-  long FORLIM;
-  noderec *WITH1;
-
-
-  V.instrcount = 0;
-  V.pc = 0;
-  V.hdef = hdef_;
-  WITH = logsima_action.lact;
-  if (V.hdef->gcontrol != NULL)
-    cip = (controlinfo *)V.hdef->gcontrol->info;
-  else
-    cip = NULL;
-  V.starttime = timers_sysclock();
-  if (V.hdef->wantnote) {
-    if (V.hdef->proclen == 0) {   /*****/
-      sprintf(STR1, "Compiling %s", V.hdef->name);
-      (*WITH->hook.vmessage)(STR1);
-    } else {  /*****/
-      sprintf(STR1, "Recompiling %s", V.hdef->name);
-      (*WITH->hook.vmessage)(STR1);
-    }
-    /*****/
-    /*****/
-  }
-  if (V.hdef->pindata != NULL)
-    Free(V.hdef->pindata);
-  V.okay = true;
-  V.numports = -1;
-  if (vddsig == NULL)
-    (*WITH->hook.getsig)("Vdd", &vddsig);
-  if (gndsig == NULL)
-    (*WITH->hook.getsig)("Gnd", &gndsig);
-  V.n = WITH->nbase;
-  while (V.n != NULL) {
-    V.n->temp = (na_long)LONG_MIN;
-    V.n = V.n->next;
-  }
-  while (V.hdef->depends != NULL) {
-    dep = V.hdef->depends;
-    V.hdef->depends = dep->next;
-    Free(dep);
-  }
-  V.inertlist = NULL;
-  V.isverbose = false;
-  wantstats = V.hdef->wantstats;
-  dumpflag = false;
-  *writefile = '\0';
-  V.bigdump = (V.hdef->dumpmode == dump_big);
-  if (V.hdef->dumphighlight) {
-    if (V.hdef->dumpmode == dump_write)
-      strcpy(writefile, V.hdef->writefile);
-    else
-      dumpflag = true;
-  }
-  V.hdef->optflag = (V.hdef->nextoptflag || V.hdef->optmode == opt_always);
-  if (V.hdef->optflag)
-    V.optlevel = V.hdef->optlevel;
-  else
-    V.optlevel = 0;
-  V.optdelay = (V.hdef->optdelay && V.optlevel >= 3);
-  V.hdef->nextoptflag = false;
-  V.mybox = V.hdef->defbox;
-  lp = WITH->lbase[V.hdef->pgnum - 1];
-  while (lp != NULL && V.okay) {
-    if (labelinbox(V.mybox, lp) && commandlabel(lp, wrd, buf)) {
-      if (!strcmp(wrd, "INERT")) {
-	while (*buf != '\0') {
-	  strword(buf, wrd);
-	  l1 = strlist_add(&V.inertlist, strupper(STR2, wrd));
-	}
-      } else if (!strcmp(wrd, "VERBOSE"))
-	V.isverbose = true;
-      else if (!strcmp(wrd, "TIMING"))
-	wantstats = true;
-      else if (!strcmp(wrd, "DUMP")) {
-	dumpflag = true;
-	if (strcicmp(buf, "BIG") == 0)
-	  V.bigdump = true;
-      } else if (!strcmp(wrd, "WRITEDEF")) {
-	if (*buf == '\0')
-	  strpart(writefile, V.hdef->name, 2,
-		  (int)(strlen(V.hdef->name) - 1L));
+	struct LOC_compilepage V;
+	controlinfo *cip;
+	int wantstats, dumpflag;
+	char writefile[256];
+	long i, extrarpt;
+	log_nrec **templs;
+	short *pnumlist;
+	na_strlist_t *l1;
+	dependrec *dep;
+	log_lrec *lp;
+	char buf[256], wrd[256];
+	log_sigrec *sig;
+	log_action_t *WITH;
+	char STR1[256];
+	char STR2[256];
+	char STR3[256];
+	long FORLIM;
+	noderec *WITH1;
+
+
+	V.instrcount = 0;
+	V.pc = 0;
+	V.hdef = hdef_;
+	WITH = logsima_action.lact;
+
+	if (V.hdef->gcontrol != NULL)
+		cip = (controlinfo *)V.hdef->gcontrol->info;
 	else
-	  strcpy(writefile, buf);
-	newci_fixfname(writefile, "def", "");
-      } else if (!strcmp(wrd, "OPT") || !strcmp(wrd, "OPTIMIZE")) {
-	if (*buf != '\0' && strsubset(buf, "0123456789"))
-	  V.optlevel = strtol(buf, NULL, 0);
+		cip = NULL;
+	
+	V.starttime = timers_sysclock();
+	
+	if (V.hdef->wantnote)
+	{
+		if (V.hdef->proclen == 0)
+		{   /*****/
+			sprintf(STR1, "Compiling %s", V.hdef->name);
+			(*WITH->hook.vmessage)(STR1);
+		}
+		else
+		{  /*****/
+			sprintf(STR1, "Recompiling %s", V.hdef->name);
+			(*WITH->hook.vmessage)(STR1);
+		}
+		/*****/
+		/*****/
+	}
+	if (V.hdef->pindata != NULL)
+		Free(V.hdef->pindata);
+	
+	V.okay = true;
+	V.numports = -1;
+	
+	if (vddsig == NULL)
+		(*WITH->hook.getsig)("Vdd", &vddsig);
+	
+	if (gndsig == NULL)
+		(*WITH->hook.getsig)("Gnd", &gndsig);
+	V.n = WITH->nbase;
+	
+	while (V.n != NULL)
+	{
+		V.n->temp = (na_long)LONG_MIN;
+		V.n = V.n->next;
+	}
+	
+	while (V.hdef->depends != NULL)
+	{
+		dep = V.hdef->depends;
+		V.hdef->depends = dep->next;
+		Free(dep);
+	}
+	
+	V.inertlist = NULL;
+	V.isverbose = false;
+	wantstats = V.hdef->wantstats;
+	dumpflag = false;
+	*writefile = '\0';
+	V.bigdump = (V.hdef->dumpmode == dump_big);
+	
+	if (V.hdef->dumphighlight)
+	{
+		if (V.hdef->dumpmode == dump_write)
+			strcpy(writefile, V.hdef->writefile);
+		else
+			dumpflag = true;
+	}
+	V.hdef->optflag = (V.hdef->nextoptflag || V.hdef->optmode == opt_always);
+	
+	if (V.hdef->optflag)
+		V.optlevel = V.hdef->optlevel;
 	else
-	  error("Syntax error in <OPTIMIZE>", &V);
-      } else if (!strcmp(wrd, "PORT") || !strcmp(wrd, "PORTS")) {
-	if (V.numports >= 0) {
-	  sprintf(STR1, "More than one <port> declaration exists for %s",
-		  V.hdef->name);
-	  error(STR1, &V);
-	} else {
-	  i = 0;
-	  while (*buf != '\0') {
-	    strword(buf, wrd);
-	    if (strcicmp(wrd, "VDD") == 0 || strcicmp(wrd, "GND") == 0)
-	      continue;
-	    i++;
-	    (*WITH->hook.getsig)(wrd, &sig);
-	    if ((long)sig->np->temp == LONG_MIN || (long)sig->np->temp == 0)
-		  /*newly created*/
-		    sig->np->temp = (na_long)(-i);
-	    else {
-	      sprintf(STR3, "Node %s appears as more than one port", wrd);
-	      error(STR3, &V);
-	    }
-	  }
-	  V.numports = i;
+		V.optlevel = 0;
+	
+	V.optdelay = (V.hdef->optdelay && V.optlevel >= 3);
+	V.hdef->nextoptflag = false;
+	V.mybox = V.hdef->defbox;
+	lp = WITH->lbase[V.hdef->pgnum - 1];
+	while (lp != NULL && V.okay)
+	{
+		if (labelinbox(V.mybox, lp) && commandlabel(lp, wrd, buf))
+		{
+			if (!strcmp(wrd, "INERT"))
+			{
+				while (*buf != '\0')
+				{
+					strword(buf, wrd);
+					l1 = strlist_add(&V.inertlist, strupper(STR2, wrd));
+				}
+			}
+			else if (!strcmp(wrd, "VERBOSE"))
+				V.isverbose = true;
+			else if (!strcmp(wrd, "TIMING"))
+				wantstats = true;
+			else if (!strcmp(wrd, "DUMP")) {
+				dumpflag = true;
+				if (strcicmp(buf, "BIG") == 0)
+					V.bigdump = true;
+			}
+			else if (!strcmp(wrd, "WRITEDEF"))
+			{
+				if (*buf == '\0')
+					strpart(writefile, V.hdef->name, 2,
+							(int)(strlen(V.hdef->name) - 1L));
+				else
+					strcpy(writefile, buf);
+				newci_fixfname(writefile, "def", "");
+			}
+			else if (!strcmp(wrd, "OPT") || !strcmp(wrd, "OPTIMIZE"))
+			{
+				if (*buf != '\0' && strsubset(buf, "0123456789"))
+					V.optlevel = strtol(buf, NULL, 0);
+				else
+					error("Syntax error in <OPTIMIZE>", &V);
+			}
+			else if (!strcmp(wrd, "PORT") || !strcmp(wrd, "PORTS"))
+			{
+				if (V.numports >= 0)
+				{
+					sprintf(STR1, "More than one <port> declaration exists for %s",
+							V.hdef->name);
+					error(STR1, &V);
+				}
+				else
+				{
+					i = 0;
+					while (*buf != '\0')
+					{
+						strword(buf, wrd);
+						if (strcicmp(wrd, "VDD") == 0 || strcicmp(wrd, "GND") == 0)
+							continue;
+						i++;
+						(*WITH->hook.getsig)(wrd, &sig);
+						
+						if ((long)sig->np->temp == LONG_MIN || (long)sig->np->temp == 0)
+							/*newly created*/
+							sig->np->temp = (na_long)(-i);
+						else
+						{
+							sprintf(STR3, "Node %s appears as more than one port", wrd);
+							error(STR3, &V);
+						}
+					}
+					V.numports = i;
+				}
+			}
+		}
+		lp = lp->next;
 	}
-      }
-    }
-    lp = lp->next;
-  }
-  if (V.okay) {
-    if (V.numports >= 0) {
-      V.hdef->lastnorth = -1;
-      V.hdef->lasteast = -1;
-      V.hdef->lastsouth = -1;
-      V.hdef->gtempl = NULL;
-    } else {
-      V.gtempl = WITH->gbase[V.hdef->pgnum - 1];
-      while (V.gtempl != NULL && (isinstance(V.gtempl) != V.hdef ||
-				  !gateinbox(V.mybox, V.gtempl)))
-	V.gtempl = V.gtempl->next;
-      V.hdef->gtempl = V.gtempl;
-      if (V.gtempl != NULL) {
-	templs = (log_nrec **)Malloc(V.gtempl->kind->numpins * sizeof(log_nrec *));
-	pnumlist = NULL;
-	examinetemplate(V.gtempl, templs, (long)V.gtempl->kind->numpins, isgenericinstgate(V.gtempl),
-			&pnumlist, &V.hdef->lastnorth, &V.hdef->lasteast,
-			&V.hdef->lastsouth, &V.numports);
-	Free(pnumlist);
-	FORLIM = V.numports;
-	for (i = 1; i <= FORLIM; i++) {
-	  if ((long)templs[i - 1]->temp == LONG_MIN)
-	    templs[i - 1]->temp = (na_long)(-i);
-	  else {
-	    sprintf(STR3, "Template \"%s\" pin %ld is shorted",V.hdef->name,i);
-	    error(STR3, &V);
-	  }
+
+	if (V.okay)
+	{
+		if (V.numports >= 0)
+		{
+			V.hdef->lastnorth = -1;
+			V.hdef->lasteast = -1;
+			V.hdef->lastsouth = -1;
+			V.hdef->gtempl = NULL;
+		}
+		else
+		{
+			V.gtempl = WITH->gbase[V.hdef->pgnum - 1];
+		
+			while (V.gtempl != NULL && (isinstance(V.gtempl) != V.hdef ||
+						!gateinbox(V.mybox, V.gtempl)))
+				V.gtempl = V.gtempl->next;
+			V.hdef->gtempl = V.gtempl;
+			
+			if (V.gtempl != NULL)
+			{
+				templs = (log_nrec **)Malloc(V.gtempl->kind->numpins * sizeof(log_nrec *));
+				pnumlist = NULL;
+				examinetemplate(V.gtempl, templs, (long)V.gtempl->kind->numpins, isgenericinstgate(V.gtempl),
+						&pnumlist, &V.hdef->lastnorth, &V.hdef->lasteast,
+						&V.hdef->lastsouth, &V.numports);
+				Free(pnumlist);
+				FORLIM = V.numports;
+			
+				for (i = 1; i <= FORLIM; i++)
+				{
+					if ((long)templs[i - 1]->temp == LONG_MIN)
+						templs[i - 1]->temp = (na_long)(-i);
+					else
+					{
+						sprintf(STR3, "Template \"%s\" pin %ld is shorted",V.hdef->name,i);
+						error(STR3, &V);
+					}
+				}
+				Free(templs);
+			}
+			else
+			{
+				sprintf(STR3, "No port list or template gate for %s", V.hdef->name);
+				error(STR3, &V);
+			}
+		}
+
+		V.hdef->numports = V.numports;
+		V.curppin = 0;
+		V.curpvar = 0;
+		V.oldinstrcount = 0;
+		V.gatecount = 0;
+		V.subcount = 0;
+		V.inertcount = 0;
+		V.forcecount = 0;
 	}
-	Free(templs);
-      } else {
-	sprintf(STR3, "No port list or template gate for %s", V.hdef->name);
-	error(STR3, &V);
-      }
-    }
-    V.hdef->numports = V.numports;
-    V.curppin = 0;
-    V.curpvar = 0;
-    V.oldinstrcount = 0;
-    V.gatecount = 0;
-    V.subcount = 0;
-    V.inertcount = 0;
-    V.forcecount = 0;
-  }
-  V.gcontrol = NULL;
-  if (V.isverbose)
-    printf("\f");
-  V.ipbase = NULL;
-  if (V.okay) {
-    sprintf(STR3, "Compiling %s", V.hdef->name);
-    showcontrol(V.hdef, STR3);
-    parsegates(&V);
-  }
-  if (V.gcontrol != V.hdef->gcontrol && (V.okay || V.gcontrol != NULL)) {
-    if (V.hdef->gcontrol != NULL) {
-      cip->hdef = NULL;   /*disconnect old gate*/
-      refrcontrol(V.hdef->gcontrol, 0);
-    }
-    V.hdef->gcontrol = V.gcontrol;
-    if (V.gcontrol != NULL) {
-      cip = (controlinfo *)V.gcontrol->info;
-      cip->hdef = V.hdef;   /*connect new one*/
-      if ((((unsigned long)V.gcontrol->vars) & (1L << 0)) != 0)
-	grabcontrolattrs(V.hdef, V.gcontrol);
-      else
-	storecontrolattrs(V.hdef, V.gcontrol);
-      V.gcontrol->vars = (na_long)
-			 (((unsigned long)V.gcontrol->vars) & (~(1L << 0)));
-      refrcontrol(V.gcontrol, 0);
-    } else
-      cip = NULL;
-  }
-  if (V.okay) {
-    /* "things" array consists of NUMPORTS external nodes, */
-    /*                followed by CURPPIN internal nodes, */
-    /*                followed by CURPVAR state variables */
-    V.savecurpvar = V.curpvar;
-    V.numthings = V.curppin + V.numports + V.curpvar;
-    V.thingnodes = V.numports;
-    V.thingvars = V.curppin + V.numports;
-    V.things = (noderec *)Malloc(V.numthings * sizeof(noderec));
-    FORLIM = V.thingnodes;
-    for (i = 0; i < FORLIM; i++) {   /*external nodes*/
-      WITH1 = &V.things[i];
-      WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
-		    (1L << ((long)log_one));
-      WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
-			(1L << ((long)log_one));
-      WITH1->alwaysconn = false;
-      WITH1->strong = false;
-      WITH1->wasstrong = false;
-      WITH1->isdef = 0;
-      WITH1->isused = 0;
-      WITH1->level = 1;
-      WITH1->truenum = i - V.thingnodes;
-      WITH1->defn = NULL;
-      WITH1->loopflag = false;
-    }
-    FORLIM = V.thingvars;
-    for (i = V.thingnodes; i < FORLIM; i++) {   /*internal nodes*/
-      WITH1 = &V.things[i];
-      WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
-		    (1L << ((long)log_one));
-      WITH1->nextposs = 1L << ((long)log_none);
-      WITH1->alwaysconn = false;
-      WITH1->strong = false;
-      WITH1->wasstrong = false;
-      WITH1->isdef = 0;
-      WITH1->isused = 0;
-      WITH1->level = 1;
-      WITH1->truenum = i - V.thingnodes;
-      WITH1->defn = NULL;
-      WITH1->loopflag = false;
-    }
-    FORLIM = V.numthings;
-    for (i = V.thingvars; i < FORLIM; i++) {   /*state variables*/
-      WITH1 = &V.things[i];
-      WITH1->poss = (1L << ((long)log_zero)) | (1L << ((long)log_one));
-      WITH1->nextposs = 0;
-      WITH1->strong = true;
-      WITH1->wasstrong = true;
-      WITH1->isdef = 0;
-      WITH1->isused = 0;
-      WITH1->level = 1;
-      WITH1->truenum = i - V.thingvars;
-      WITH1->defn = NULL;
-      WITH1->loopflag = false;
-    }
-  }
-  V.simppasscount = 0;
-  if (V.optlevel >= 1 && V.okay) {
-    V.truevars = false;
-    V.hasstats = false;
-    simplify(&V.ipbase, &V);
-    scan(V.ipbase, 1L, &V);
-    if (V.isverbose) {
-      printf("after simplify:\n");
-      dumptree(stdout, V.ipbase, NULL, &V);
-      putchar('\n');
-    }
-  }
-  if (V.optlevel >= 2 && V.okay) {
-    FORLIM = V.thingnodes;
-    for (i = 0; i < FORLIM; i++) {
-      WITH1 = &V.things[i];
-      WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
-			(1L << ((long)log_one));
-      WITH1->wasdef = WITH1->isdef;
-      WITH1->isdef = 0;
-      WITH1->wasused = WITH1->isused;
-      WITH1->isused = 0;
-      WITH1->wasstrong = WITH1->strong;
-      WITH1->strong = false;
-    }
-    FORLIM = V.thingvars;
-    for (i = V.thingnodes; i < FORLIM; i++) {
-      WITH1 = &V.things[i];
-      WITH1->poss &= WITH1->nextposs;
-      /*   if (isdef = 0) then
-            poss := [log_none];   */
-      WITH1->nextposs = 1L << ((long)log_none);
-      WITH1->wasdef = WITH1->isdef;
-      WITH1->isdef = 0;
-      WITH1->wasused = WITH1->isused;
-      WITH1->isused = 0;
-      WITH1->wasstrong = WITH1->strong;
-      WITH1->strong = false;
-    }
-    FORLIM = V.numthings;
-    for (i = V.thingvars; i < FORLIM; i++) {
-      WITH1 = &V.things[i];
-      if (WITH1->isdef == 0 ||
-	  ((1L << ((long)log_one)) & WITH1->nextposs) == 0)
-	WITH1->poss = 1L << ((long)log_zero);
-      else if (WITH1->nextposs == 1L << ((long)log_one))
-	WITH1->poss = 1L << ((long)log_one);
-      WITH1->nextposs = 0;
-      WITH1->wasdef = WITH1->isdef;
-      WITH1->isdef = 0;
-      WITH1->wasused = WITH1->isused;
-      WITH1->isused = 0;
-    }
-    V.hasstats = true;
-    extrarpt = 2;
-    do {
-      simplify(&V.ipbase, &V);
-      scan(V.ipbase, 1L, &V);
-      FORLIM = V.thingnodes;
-      for (i = 0; i < FORLIM; i++) {
-	WITH1 = &V.things[i];
-	if (WITH1->alwaysconn) {
-	  if (WITH1->poss != 1L << ((long)log_none))
-	    WITH1->poss &= ~(1L << ((long)log_none));
-	  WITH1->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
-	} else
-	  WITH1->nextposs = (1L << ((long)log_none)) |
-	      (1L << ((long)log_zero)) | (1L << ((long)log_one));
-	WITH1->wasdef = WITH1->isdef;
-	WITH1->isdef = 0;
-	WITH1->wasused = WITH1->isused;
-	WITH1->isused = 0;
-	WITH1->wasstrong = WITH1->strong;
-	WITH1->strong = false;
-      }
-      FORLIM = V.thingvars;
-      for (i = V.thingnodes; i < FORLIM; i++) {
-	WITH1 = &V.things[i];
-	WITH1->poss &= WITH1->nextposs;
-	if (WITH1->alwaysconn && WITH1->poss != 1L << ((long)log_none))
-	  WITH1->poss &= ~(1L << ((long)log_none));
-	WITH1->nextposs = 1L << ((long)log_none);
-	WITH1->wasdef = WITH1->isdef;
-	WITH1->isdef = 0;
-	WITH1->wasused = WITH1->isused;
-	WITH1->isused = 0;
-	WITH1->wasstrong = WITH1->strong;
-	WITH1->strong = false;
-      }
-      FORLIM = V.numthings;
-      for (i = V.thingvars; i < FORLIM; i++) {
-	WITH1 = &V.things[i];
-	WITH1->poss &= WITH1->nextposs;
-	if (WITH1->poss == 0)
-	  WITH1->poss = 1L << ((long)log_zero);
-	WITH1->nextposs = 0;
-	WITH1->wasdef = WITH1->isdef;
-	WITH1->isdef = 0;
-	WITH1->wasused = WITH1->isused;
-	WITH1->isused = 0;
-      }
-      if (V.changed)
-	extrarpt = 2;
-      else if (extrarpt > 0)
-	extrarpt--;
-    } while (V.okay && extrarpt > 0 && V.simppasscount < V.optlevel);
-    /*   until not okay or ((curppin = oldcurppin) and
-                          (curpvar = oldcurpvar) and
-                          ((not changed and
-                            (rptcount >= optlevel div 2)) or
-                           (rptcount >= optlevel)));    */
-    if (V.okay)
-      assignvars(&V);
-    if (V.optlevel >= 3 && V.simppasscount < V.optlevel) {
-      V.truevars = true;
-      simplify(&V.ipbase, &V);
-    }
-  }
-  if (V.okay) {
-    clean(V.ipbase, &V);
-    V.hdef->numppins = V.curppin;
-    V.hdef->numpvars = P_imax2((long)(V.curpvar - 16), 0L);
-    V.pc = 0;
-    V.instrcount = 0;
-    codegen(false, &V);   /*find out how long it will be*/
-    if (V.pc != V.hdef->proclen) {
-      if (V.hdef->proc != NULL)
-	Free(V.hdef->proc);
-      V.hdef->proc = (uchar *)Malloc(V.pc);
-      V.hdef->proclen = V.pc;
-    }
-    V.pc = 0;
-    V.instrcount = 0;
-    codegen(true, &V);   /*actually generate the code*/
-  }
-  V.starttime = timers_sysclock() - V.starttime;
-  if (wantstats)
-    showstats(&V);
-  if (V.okay) {
-    if (dumpflag) {
-      showcontrol(V.hdef, "Dumping...");
-      if (V.hdef->oldshowstamp != showstamp) {
-	V.hdef->oldshowstamp = showstamp;
-	dodump(&V);
-      }
-    } else
-      V.hdef->oldshowstamp = 0;
-    if (V.isverbose)
-      dasmhdef(stdout, V.hdef, false);
-    if (*writefile != '\0') {
-      sprintf(STR1, "Writing to \"%s\"", writefile);
-      showcontrol(V.hdef, STR1);
-      dowritefile(writefile, &V);
-    }
-  }
-  disposetree(&V.ipbase, &V);
-  strlist_empty(&V.inertlist);
-  V.hdef->defined_ = V.okay;
-  V.hdef->dumphighlight = false;
-  if (V.optlevel > 0) {
-    WITH->curstamp++;
-    V.hdef->clearstamp = WITH->curstamp;
-  }
-  refrcontrol(V.hdef->gcontrol, 0);
-}  /*compilepage*/
 
-#undef setmax
+	V.gcontrol = NULL;
+	
+	if (V.isverbose)
+		printf("\f");
+	V.ipbase = NULL;
+	
+	if (V.okay)
+	{
+		sprintf(STR3, "Compiling %s", V.hdef->name);
+		showcontrol(V.hdef, STR3);
+		parsegates(&V);
+	}
+	
+	if (V.gcontrol != V.hdef->gcontrol && (V.okay || V.gcontrol != NULL))
+	{
+		if (V.hdef->gcontrol != NULL)
+		{
+			cip->hdef = NULL;   /*disconnect old gate*/
+			refrcontrol(V.hdef->gcontrol, 0);
+		}
+		
+		V.hdef->gcontrol = V.gcontrol;
+		if (V.gcontrol != NULL)
+		{
+			cip = (controlinfo *)V.gcontrol->info;
+			cip->hdef = V.hdef;   /*connect new one*/
+			if ((((unsigned long)V.gcontrol->vars) & (1L << 0)) != 0)
+				grabcontrolattrs(V.hdef, V.gcontrol);
+			else
+				storecontrolattrs(V.hdef, V.gcontrol);
+			V.gcontrol->vars = (na_long)
+				(((unsigned long)V.gcontrol->vars) & (~(1L << 0)));
+			refrcontrol(V.gcontrol, 0);
+		}
+		else
+			cip = NULL;
+	}
+
+	if (V.okay)
+	{
+		/* "things" array consists of NUMPORTS external nodes, */
+		/*                followed by CURPPIN internal nodes, */
+		/*                followed by CURPVAR state variables */
+		V.savecurpvar = V.curpvar;
+		V.numthings = V.curppin + V.numports + V.curpvar;
+		V.thingnodes = V.numports;
+		V.thingvars = V.curppin + V.numports;
+		V.things = (noderec *)Malloc(V.numthings * sizeof(noderec));
+		FORLIM = V.thingnodes;
+		
+		for (i = 0; i < FORLIM; i++)
+		{   /*external nodes*/
+			WITH1 = &V.things[i];
+			WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+				(1L << ((long)log_one));
+			WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+				(1L << ((long)log_one));
+			WITH1->alwaysconn = false;
+			WITH1->strong = false;
+			WITH1->wasstrong = false;
+			WITH1->isdef = 0;
+			WITH1->isused = 0;
+			WITH1->level = 1;
+			WITH1->truenum = i - V.thingnodes;
+			WITH1->defn = NULL;
+			WITH1->loopflag = false;
+		}
+		
+		FORLIM = V.thingvars;
+		
+		for (i = V.thingnodes; i < FORLIM; i++)
+		{   /*internal nodes*/
+			WITH1 = &V.things[i];
+			WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+				(1L << ((long)log_one));
+			WITH1->nextposs = 1L << ((long)log_none);
+			WITH1->alwaysconn = false;
+			WITH1->strong = false;
+			WITH1->wasstrong = false;
+			WITH1->isdef = 0;
+			WITH1->isused = 0;
+			WITH1->level = 1;
+			WITH1->truenum = i - V.thingnodes;
+			WITH1->defn = NULL;
+			WITH1->loopflag = false;
+		}
+		FORLIM = V.numthings;
+		
+		for (i = V.thingvars; i < FORLIM; i++)
+		{   /*state variables*/
+			WITH1 = &V.things[i];
+			WITH1->poss = (1L << ((long)log_zero)) | (1L << ((long)log_one));
+			WITH1->nextposs = 0;
+			WITH1->strong = true;
+			WITH1->wasstrong = true;
+			WITH1->isdef = 0;
+			WITH1->isused = 0;
+			WITH1->level = 1;
+			WITH1->truenum = i - V.thingvars;
+			WITH1->defn = NULL;
+			WITH1->loopflag = false;
+		}
+	}
+
+	V.simppasscount = 0;
+	if (V.optlevel >= 1 && V.okay)
+	{
+		V.truevars = false;
+		V.hasstats = false;
+		simplify(&V.ipbase, &V);
+		scan(V.ipbase, 1L, &V);
+		if (V.isverbose)
+		{
+			printf("after simplify:\n");
+			dumptree(stdout, V.ipbase, NULL, &V);
+			putchar('\n');
+		}
+	}
+
+	if (V.optlevel >= 2 && V.okay)
+	{
+		FORLIM = V.thingnodes;
+		for (i = 0; i < FORLIM; i++)
+		{
+			WITH1 = &V.things[i];
+			WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+				(1L << ((long)log_one));
+			WITH1->wasdef = WITH1->isdef;
+			WITH1->isdef = 0;
+			WITH1->wasused = WITH1->isused;
+			WITH1->isused = 0;
+			WITH1->wasstrong = WITH1->strong;
+			WITH1->strong = false;
+		}
+		FORLIM = V.thingvars;
+		for (i = V.thingnodes; i < FORLIM; i++)
+		{
+			WITH1 = &V.things[i];
+			WITH1->poss &= WITH1->nextposs;
+			/*   if (isdef = 0) then
+poss := [log_none];   */
+			WITH1->nextposs = 1L << ((long)log_none);
+			WITH1->wasdef = WITH1->isdef;
+			WITH1->isdef = 0;
+			WITH1->wasused = WITH1->isused;
+			WITH1->isused = 0;
+			WITH1->wasstrong = WITH1->strong;
+			WITH1->strong = false;
+		}
+		FORLIM = V.numthings;
+		for (i = V.thingvars; i < FORLIM; i++)
+		{
+			WITH1 = &V.things[i];
+			if (WITH1->isdef == 0 ||
+					((1L << ((long)log_one)) & WITH1->nextposs) == 0)
+				WITH1->poss = 1L << ((long)log_zero);
+			else if (WITH1->nextposs == 1L << ((long)log_one))
+				WITH1->poss = 1L << ((long)log_one);
+			WITH1->nextposs = 0;
+			WITH1->wasdef = WITH1->isdef;
+			WITH1->isdef = 0;
+			WITH1->wasused = WITH1->isused;
+			WITH1->isused = 0;
+		}
+		
+		V.hasstats = true;
+		extrarpt = 2;
+		do
+		{
+			simplify(&V.ipbase, &V);
+			scan(V.ipbase, 1L, &V);
+			FORLIM = V.thingnodes;
+			for (i = 0; i < FORLIM; i++)
+			{
+				WITH1 = &V.things[i];
+				if (WITH1->alwaysconn)
+				{
+					if (WITH1->poss != 1L << ((long)log_none))
+						WITH1->poss &= ~(1L << ((long)log_none));
+					WITH1->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
+				}
+				else
+					WITH1->nextposs = (1L << ((long)log_none)) |
+						(1L << ((long)log_zero)) | (1L << ((long)log_one));
+				
+				WITH1->wasdef = WITH1->isdef;
+				WITH1->isdef = 0;
+				WITH1->wasused = WITH1->isused;
+				WITH1->isused = 0;
+				WITH1->wasstrong = WITH1->strong;
+				WITH1->strong = false;
+			}
+
+			FORLIM = V.thingvars;
+			for (i = V.thingnodes; i < FORLIM; i++)
+			{
+				WITH1 = &V.things[i];
+				WITH1->poss &= WITH1->nextposs;
+				if (WITH1->alwaysconn && WITH1->poss != 1L << ((long)log_none))
+					WITH1->poss &= ~(1L << ((long)log_none));
+				WITH1->nextposs = 1L << ((long)log_none);
+				WITH1->wasdef = WITH1->isdef;
+				WITH1->isdef = 0;
+				WITH1->wasused = WITH1->isused;
+				WITH1->isused = 0;
+				WITH1->wasstrong = WITH1->strong;
+				WITH1->strong = false;
+			}
+			
+			FORLIM = V.numthings;
+			for (i = V.thingvars; i < FORLIM; i++)
+			{
+				WITH1 = &V.things[i];
+				WITH1->poss &= WITH1->nextposs;
+				if (WITH1->poss == 0)
+					WITH1->poss = 1L << ((long)log_zero);
+				WITH1->nextposs = 0;
+				WITH1->wasdef = WITH1->isdef;
+				WITH1->isdef = 0;
+				WITH1->wasused = WITH1->isused;
+				WITH1->isused = 0;
+			}
+			
+			if (V.changed)
+				extrarpt = 2;
+			else if (extrarpt > 0)
+				extrarpt--;
+		} while (V.okay && extrarpt > 0 && V.simppasscount < V.optlevel);
+		/*   until not okay or ((curppin = oldcurppin) and
+			 (curpvar = oldcurpvar) and
+			 ((not changed and
+			 (rptcount >= optlevel div 2)) or
+			 (rptcount >= optlevel)));    */
+		if (V.okay)
+			assignvars(&V);
+
+		if (V.optlevel >= 3 && V.simppasscount < V.optlevel)
+		{
+			V.truevars = true;
+			simplify(&V.ipbase, &V);
+		}
+	}
 
+	if (V.okay)
+	{
+		clean(V.ipbase, &V);
+		V.hdef->numppins = V.curppin;
+		V.hdef->numpvars = P_imax2((long)(V.curpvar - 16), 0L);
+		V.pc = 0;
+		V.instrcount = 0;
+		codegen(false, &V);   /*find out how long it will be*/
+		if (V.pc != V.hdef->proclen)
+		{
+			if (V.hdef->proc != NULL)
+				Free(V.hdef->proc);
+			V.hdef->proc = (uchar *)Malloc(V.pc);
+			V.hdef->proclen = V.pc;
+		}
+		V.pc = 0;
+		V.instrcount = 0;
+		codegen(true, &V);   /*actually generate the code*/
+	}
+	V.starttime = timers_sysclock() - V.starttime;
+	
+	if (wantstats)
+		showstats(&V);
+	
+	if (V.okay)
+	{
+		if (dumpflag)
+		{
+			showcontrol(V.hdef, "Dumping...");
+			if (V.hdef->oldshowstamp != showstamp) {
+				V.hdef->oldshowstamp = showstamp;
+				dodump(&V);
+			}
+		}
+		else
+		{
+			V.hdef->oldshowstamp = 0;
+		}
+
+		if (V.isverbose)
+			dasmhdef(stdout, V.hdef, false);
+		
+		if (*writefile != '\0') {
+			sprintf(STR1, "Writing to \"%s\"", writefile);
+			showcontrol(V.hdef, STR1);
+			dowritefile(writefile, &V);
+		}
+	}
+	disposetree(&V.ipbase, &V);
+	strlist_empty(&V.inertlist);
+	V.hdef->defined_ = V.okay;
+	V.hdef->dumphighlight = false;
+
+	if (V.optlevel > 0)
+	{
+		WITH->curstamp++;
+		V.hdef->clearstamp = WITH->curstamp;
+	}
+	refrcontrol(V.hdef->gcontrol, 0);
+}  /*compilepage*/
 
+#undef setmax
 
 
 /* Make sure hdef's compiled information is up-to-date */
 
-static void updatehdef(hdef)
-hdefrec *hdef;
+static void updatehdef(hdefrec *hdef)
 {
-  char buf[256], wrd[256];
-  long i, j, newstamp;
-  dependrec *dep;
-  log_lrec *lp, *mylabel;
-  log_brec *mybox;
-  int chglabels, wasdefined;
-  log_grec *g1;
-  instinfo *ii1;
-  log_action_t *WITH;
-  long FORLIM;
-  char STR1[256], STR2[256];
-
-  WITH = logsima_action.lact;
-  chglabels = (WITH->labelstamp != hdef->oldlabelstamp ||
-	       WITH->boxstamp != hdef->oldboxstamp);
-  if (chglabels) {
-    hdef->oldlabelstamp = WITH->labelstamp;
-    hdef->oldboxstamp = WITH->boxstamp;
-    j = 0;
-    FORLIM = WITH->numpages;
-    for (i = 0; i < FORLIM; i++) {
-      lp = WITH->lbase[i];
-      while (lp != NULL) {
-	if (commandlabel(lp, wrd, buf) && !strcmp(wrd, "NAME") &&
-	    strcicmp((sprintf(STR2, "\"%s\"", buf), STR2), hdef->name) == 0) {
-	  if (j != 0) {
-	    sprintf(STR1, "%s defined in more than one place", hdef->name);
-	    showerrormsg(hdef, STR1);
-	  } else {
-	    mylabel = lp;
-	    j = i + 1;
-	  }
-	}
-	lp = lp->next;
-      }
-    }
-    if (j != 0) {
-      if (commandlabel(mylabel, wrd, buf) &&
-	  strcmp((sprintf(STR1, "\"%s\"", buf), STR1), hdef->name)) {
-	sprintf(hdef->name, "\"%s\"", buf);   /*fix capitalization*/
-	FORLIM = WITH->numpages;
-	for (i = 0; i < FORLIM; i++) {
-	  g1 = WITH->gbase[i];
-	  while (g1 != NULL) {
-	    if (isinstance(g1) == hdef) {
-	      ii1 = (instinfo *)g1->info;
-	      ii1->attrchg = true;
-	    }
-	    g1 = g1->next;
-	  }
+	char buf[256], wrd[256];
+	long i, j, newstamp;
+	dependrec *dep;
+	log_lrec *lp, *mylabel;
+	log_brec *mybox;
+	int chglabels, wasdefined;
+	log_grec *g1;
+	instinfo *ii1;
+	log_action_t *WITH;
+	long FORLIM;
+	char STR1[256], STR2[256];
+
+	WITH = logsima_action.lact;
+	chglabels = (WITH->labelstamp != hdef->oldlabelstamp ||
+			WITH->boxstamp != hdef->oldboxstamp);
+	if (chglabels)
+	{
+		hdef->oldlabelstamp = WITH->labelstamp;
+		hdef->oldboxstamp = WITH->boxstamp;
+		j = 0;
+		FORLIM = WITH->numpages;
+		for (i = 0; i < FORLIM; i++)
+		{
+			lp = WITH->lbase[i];
+			while (lp != NULL)
+			{
+				if (commandlabel(lp, wrd, buf) && !strcmp(wrd, "NAME") &&
+						strcicmp((sprintf(STR2, "\"%s\"", buf), STR2), hdef->name) == 0) {
+					if (j != 0)
+					{
+						sprintf(STR1, "%s defined in more than one place", hdef->name);
+						showerrormsg(hdef, STR1);
+					}
+					else
+					{
+						mylabel = lp;
+						j = i + 1;
+					}
+				}
+				lp = lp->next;
+			}
+		}
+
+		if (j != 0)
+		{
+			if (commandlabel(mylabel, wrd, buf) &&
+					strcmp((sprintf(STR1, "\"%s\"", buf), STR1), hdef->name))
+			{
+				sprintf(hdef->name, "\"%s\"", buf);   /*fix capitalization*/
+				FORLIM = WITH->numpages;
+				for (i = 0; i < FORLIM; i++)
+				{
+					g1 = WITH->gbase[i];
+					while (g1 != NULL)
+					{
+						if (isinstance(g1) == hdef)
+						{
+							ii1 = (instinfo *)g1->info;
+							ii1->attrchg = true;
+						}
+						g1 = g1->next;
+					}
+				}
+			}
+			mybox = labelbox(mylabel, (int)j);
+			hdef->defbox = mybox;
+
+			if (j != 0)
+			{
+				if (mybox == NULL)
+				{
+					if (hdef->defreg != NULL)
+						(*WITH->hook.setupregion)(&hdef->defreg, 0);
+				} 
+				else
+				{
+					if (hdef->defreg == NULL)
+						(*WITH->hook.setupregion)(&hdef->defreg, (int)j);
+					hdef->defreg->x1 = mybox->x1;
+					hdef->defreg->y1 = mybox->y1;
+					hdef->defreg->x2 = mybox->x2;
+					hdef->defreg->y2 = mybox->y2;
+				}
+			}
+		}
+	} else
+		j = hdef->pgnum;
+
+	if (j == 0)
+	{
+		hdef->pgnum = 0;
+		hdef->defined_ = false;
+		if (hdef->defreg != NULL)
+			(*WITH->hook.setupregion)(&hdef->defreg, 0);
+		return;
 	}
-      }
-      mybox = labelbox(mylabel, (int)j);
-      hdef->defbox = mybox;
-      if (j != 0) {
-	if (mybox == NULL) {
-	  if (hdef->defreg != NULL)
-	    (*WITH->hook.setupregion)(&hdef->defreg, 0);
-	} else {
-	  if (hdef->defreg == NULL)
-	    (*WITH->hook.setupregion)(&hdef->defreg, (int)j);
-	  hdef->defreg->x1 = mybox->x1;
-	  hdef->defreg->y1 = mybox->y1;
-	  hdef->defreg->x2 = mybox->x2;
-	  hdef->defreg->y2 = mybox->y2;
+
+	if (hdef->defreg != NULL)
+		newstamp = hdef->defreg->regstamp;
+	else
+		newstamp = WITH->pagestamp[j - 1];
+	
+	dep = hdef->depends;
+	while (dep != NULL && dep->hdefstamp == dep->hdef->curstamp)
+		dep = dep->next;
+	
+	if (hdef->pgnum == j && newstamp == hdef->oldpagestamp && dep == NULL)
+		/*definition moved to a new page?*/
+		return;
+	/*has definition been edited?*/
+	/*depends on an hdef which has changed?*/
+	hdef->pgnum = j;
+	hdef->oldpagestamp = newstamp;
+	wasdefined = hdef->defined_;
+	compilepage(hdef);
+	
+	if (hdef->defined_ || wasdefined)
+	{
+		WITH->curstamp++;
+		hdef->curstamp = WITH->curstamp;
 	}
-      }
-    }
-  } else
-    j = hdef->pgnum;
-  if (j == 0) {
-    hdef->pgnum = 0;
-    hdef->defined_ = false;
-    if (hdef->defreg != NULL)
-      (*WITH->hook.setupregion)(&hdef->defreg, 0);
-    return;
-  }
-  if (hdef->defreg != NULL)
-    newstamp = hdef->defreg->regstamp;
-  else
-    newstamp = WITH->pagestamp[j - 1];
-  dep = hdef->depends;
-  while (dep != NULL && dep->hdefstamp == dep->hdef->curstamp)
-    dep = dep->next;
-  if (hdef->pgnum == j && newstamp == hdef->oldpagestamp && dep == NULL)
-	/*definition moved to a new page?*/
-	  return;
-  /*has definition been edited?*/
-  /*depends on an hdef which has changed?*/
-  hdef->pgnum = j;
-  hdef->oldpagestamp = newstamp;
-  wasdefined = hdef->defined_;
-  compilepage(hdef);
-  if (hdef->defined_ || wasdefined) {
-    WITH->curstamp++;
-    hdef->curstamp = WITH->curstamp;
-  }
 }
 
 
 
-
 /* Reallocate if necessary a gate's ports, internal nodes, and internal variables */
 
-static char *instname(Result, g)
-char *Result;
-log_grec *g;
+static char *instname(char *Result, log_grec *g)
 {
-  short i;
-
-  i = findgattr(g, "gate-name", "CA", 0);
-  if (i == 0 || *g->attr[i - 1].UU.c == '\0')
-    i = findgattr(g, "inst-of", "CA", 0);
-  if (i == 0 || *g->attr[i - 1].UU.c == '\0')
-    return strcpy(Result, g->kind->name);
-  else
-    return strcpy(Result, g->attr[i - 1].UU.c);
+	short i;
+
+	i = findgattr(g, "gate-name", "CA", 0);
+	if (i == 0 || *g->attr[i - 1].UU.c == '\0')
+		i = findgattr(g, "inst-of", "CA", 0);
+	if (i == 0 || *g->attr[i - 1].UU.c == '\0')
+		return strcpy(Result, g->kind->name);
+	else
+		return strcpy(Result, g->attr[i - 1].UU.c);
 }
 
 
-static void reallocgate(g, clearit)
-log_grec *g;
-int clearit;
+static void reallocgate(log_grec *g, int clearit)
 {
-  instinfo *ii;
-  hdefrec *hdef;
-  long i;
-  log_nrec **newpins;
-  log_action_t *WITH;
-  long FORLIM;
-  char STR1[256];
-  char STR4[256];
-
-  WITH = logsima_action.lact;
-  ii = (instinfo *)g->info;
-  hdef = ii->hdef;
-  if (clearit)
-    g->vars = (na_long)0;
-  if (hdef->numppins != ii->numppins) {
-    if (hdef->numppins > 0) {
-      newpins = (log_nrec **)Malloc(hdef->numppins * sizeof(log_nrec *));
-      FORLIM = hdef->numppins;
-      for (i = ii->numppins; i < FORLIM; i++) {
-	(*WITH->hook.newnode)(&newpins[i], log_16_simtype);
-	newpins[i]->ref = 1;
-      }
-    } else
-      newpins = NULL;
-    if (ii->numppins > 0) {
-      FORLIM = P_imin2((long)hdef->numppins, (long)ii->numppins);
-      for (i = 0; i < FORLIM; i++)
-	newpins[i] = ii->ginfo.ppins[i];
-      FORLIM = ii->numppins;
-      for (i = hdef->numppins; i < FORLIM; i++)
-	(*WITH->hook.switchnode)(&ii->ginfo.ppins[i], NULL);
-      Free(ii->ginfo.ppins);
-    }
-    ii->ginfo.ppins = newpins;
-    ii->numppins = hdef->numppins;
-  }
-  if (hdef->numpvars != ii->numpvars) {
-    if (ii->numpvars > 0)
-      Free(ii->ginfo.pvars);
-    if (hdef->numpvars > 0) {
-      ii->ginfo.pvars = (char *)Malloc(hdef->numpvars);
-      clearit = true;
-    }
-    ii->numpvars = hdef->numpvars;
-    g->vars = (na_long)0;   /*just to be consistent*/
-  }
-  if (clearit && hdef->numpvars > 0)
-    memset((void *)ii->ginfo.pvars, 0, hdef->numpvars);
-  if (hdef->gtempl == NULL) {  /*defined by port list*/
-    if (ii->numpins > 0)
-      Free(ii->pins);
-    ii->numpins = 0;
-    if (hdef->numports != g->kind->numpins) {
-      sprintf(STR4, "Gate %s has %d pins but %ld ports",
-	      instname(STR1, g), g->kind->numpins, hdef->numports);
-      /* if curpage = showpage then */
-      showerrormsg(hdef, STR4);
-      ii->okay = false;
-    }
-    return;
-  }
-  if (hdef->numports == ii->numpins)
-    return;
-  if (ii->numpins > 0)
-    Free(ii->pins);
-  if (hdef->numports > 0)
-    ii->pins = (log_nrec **)Malloc(hdef->numports * sizeof(log_nrec *));
-  ii->numpins = hdef->numports;
-  ii->oldnetstamp = 0;   /*force re-connection*/
-
-  /*defined by template*/
+	instinfo *ii;
+	hdefrec *hdef;
+	long i;
+	log_nrec **newpins;
+	log_action_t *WITH;
+	long FORLIM;
+	char STR1[256];
+	char STR4[256];
+
+	WITH = logsima_action.lact;
+	ii = (instinfo *)g->info;
+	hdef = ii->hdef;
+
+	if (clearit)
+		g->vars = (na_long)0;
+
+	if (hdef->numppins != ii->numppins)
+	{
+		if (hdef->numppins > 0)
+		{
+			newpins = (log_nrec **)Malloc(hdef->numppins * sizeof(log_nrec *));
+			FORLIM = hdef->numppins;
+			for (i = ii->numppins; i < FORLIM; i++)
+			{
+				(*WITH->hook.newnode)(&newpins[i], log_16_simtype);
+				newpins[i]->ref = 1;
+			}
+		}
+		else
+			newpins = NULL;
+
+		if (ii->numppins > 0)
+		{
+			FORLIM = P_imin2((long)hdef->numppins, (long)ii->numppins);
+			for (i = 0; i < FORLIM; i++)
+				newpins[i] = ii->ginfo.ppins[i];
+			FORLIM = ii->numppins;
+			
+			for (i = hdef->numppins; i < FORLIM; i++)
+				(*WITH->hook.switchnode)(&ii->ginfo.ppins[i], NULL);
+			Free(ii->ginfo.ppins);
+		}
+		ii->ginfo.ppins = newpins;
+		ii->numppins = hdef->numppins;
+	}
+	
+	if (hdef->numpvars != ii->numpvars)
+	{
+		if (ii->numpvars > 0)
+			Free(ii->ginfo.pvars);
+		if (hdef->numpvars > 0)
+		{
+			ii->ginfo.pvars = (char *)Malloc(hdef->numpvars);
+			clearit = true;
+		}
+		ii->numpvars = hdef->numpvars;
+		g->vars = (na_long)0;   /*just to be consistent*/
+	}
+
+	if (clearit && hdef->numpvars > 0)
+		memset((void *)ii->ginfo.pvars, 0, hdef->numpvars);
+	if (hdef->gtempl == NULL)
+	{  /*defined by port list*/
+		if (ii->numpins > 0)
+			Free(ii->pins);
+		ii->numpins = 0;
+		if (hdef->numports != g->kind->numpins)
+		{
+			sprintf(STR4, "Gate %s has %d pins but %ld ports",
+					instname(STR1, g), g->kind->numpins, hdef->numports);
+			/* if curpage = showpage then */
+			showerrormsg(hdef, STR4);
+			ii->okay = false;
+		}
+		return;
+	}
+	if (hdef->numports == ii->numpins)
+		return;
+
+	if (ii->numpins > 0)
+		Free(ii->pins);
+
+	if (hdef->numports > 0)
+		ii->pins = (log_nrec **)Malloc(hdef->numports * sizeof(log_nrec *));
+
+	ii->numpins = hdef->numports;
+	ii->oldnetstamp = 0;   /*force re-connection*/
+
+	/*defined by template*/
 }
 
 
 /* Local variables for reconnectgate: */
 struct LOC_reconnectgate {
-  log_grec *g;
-  instinfo *ii;
-  long lastwest;
-} ;
+	log_grec *g;
+	instinfo *ii;
+	long lastwest;
+};
 
-static void check(dir, conn, port, LINK)
-char *dir;
-long conn, port;
-struct LOC_reconnectgate *LINK;
+static void check(char *dir, long conn, long port, struct LOC_reconnectgate *LINK)
 {
-  char buf[256], STR1[256];
-
-  if (conn == port)
-    return;
-  if (LINK->lastwest != 0) {   /*and*/
-    /* (act.lact^.curpage = act.lact^.showpage) */
-    sprintf(buf, "Gate %s has %ld %s connection",
-	    instname(STR1, LINK->g), conn, dir);
-    if (conn != 1)
-      strcat(buf, "s");
-    sprintf(buf + strlen(buf), " but %ld %s port", port, dir);
-    if (port != 1)
-      strcat(buf, "s");
-    showerrormsg(NULL, buf);   /*nil to prevent flashing message in hdef*/
-  }
-  /*no message if totally unconnected*/
-  LINK->ii->okay = false;
+	char buf[256], STR1[256];
+
+	if (conn == port)
+		return;
+	if (LINK->lastwest != 0)
+	{   /*and*/
+		/* (act.lact^.curpage = act.lact^.showpage) */
+		sprintf(buf, "Gate %s has %ld %s connection",
+				instname(STR1, LINK->g), conn, dir);
+		if (conn != 1)
+			strcat(buf, "s");
+		sprintf(buf + strlen(buf), " but %ld %s port", port, dir);
+		if (port != 1)
+			strcat(buf, "s");
+		showerrormsg(NULL, buf);   /*nil to prevent flashing message in hdef*/
+	}
+	/*no message if totally unconnected*/
+	LINK->ii->okay = false;
 }
 
 
-
-
 /* Reconnect a gate's ports to its pins */
 
-static void reconnectgate(g_)
-log_grec *g_;
+static void reconnectgate(log_grec *g_)
 {
-  struct LOC_reconnectgate V;
-  hdefrec *hdef;
-  long lastnorth, lasteast, lastsouth;
-  short *pnum;
-  log_action_t *WITH;
-
-  V.g = g_;
-  WITH = logsima_action.lact;
-  V.ii = (instinfo *)V.g->info;
-  hdef = V.ii->hdef;
-  if (hdef->gtempl == NULL) {
-    V.ii->pins = V.g->pin;   /*easy one-to-one mapping*/
-    return;
-  }
-  pnum = NULL;
-  examinetemplate(V.g, V.ii->pins, hdef->numports, isgenericinstgate(V.g), &pnum, &lastnorth,
-		  &lasteast, &lastsouth, &V.lastwest);
-  check("north", lastnorth, hdef->lastnorth, &V);
-  check("east", lasteast - lastnorth, hdef->lasteast - hdef->lastnorth, &V);
-  check("south", lastsouth - lasteast, hdef->lastsouth - hdef->lasteast, &V);
-  check("west", V.lastwest - lastsouth, hdef->numports - hdef->lastsouth, &V);
-  Free(pnum);
+	struct LOC_reconnectgate V;
+	hdefrec *hdef;
+	long lastnorth, lasteast, lastsouth;
+	short *pnum;
+	log_action_t *WITH;
+
+	V.g = g_;
+	WITH = logsima_action.lact;
+	V.ii = (instinfo *)V.g->info;
+	hdef = V.ii->hdef;
+
+	if (hdef->gtempl == NULL)
+	{
+		V.ii->pins = V.g->pin;   /*easy one-to-one mapping*/
+		return;
+	}
+	
+	pnum = NULL;
+	examinetemplate(V.g, V.ii->pins, hdef->numports, isgenericinstgate(V.g), &pnum, &lastnorth,
+			&lasteast, &lastsouth, &V.lastwest);
+	check("north", lastnorth, hdef->lastnorth, &V);
+	check("east", lasteast - lastnorth, hdef->lasteast - hdef->lastnorth, &V);
+	check("south", lastsouth - lasteast, hdef->lastsouth - hdef->lasteast, &V);
+	check("west", V.lastwest - lastsouth, hdef->numports - hdef->lastsouth, &V);
+	Free(pnum);
 }
 
 
 
-
-
 /* Make sure an instance gate is up-to-date */
 
-static void updateinstance(g)
-log_grec *g;
+static void updateinstance(log_grec *g)
 {
-  instinfo *ii;
-  hdefrec *hdef;
-  long i;
-  log_action_t *WITH;
-  char STR2[12];
-  char STR3[38];
-
-  WITH = logsima_action.lact;
-  ii = (instinfo *)g->info;
-  if (ii->recstamp == currecstamp) {
-    sprintf(STR3, "Gate %s is recursively defined", g->kind->name);
-    /* if curpage = showpage then */
-    showerrormsg(ii->hdef, STR3);
-    ii->okay = false;
-    return;
-  }
-  ii->recstamp = currecstamp;
-  if (ii->attrchg) {  /*circuit has changed*/
-    i = findgattr(g, "inst-of", "CA", 0);
-    if (i == 0) {
-      sprintf(STR2, "\"%s\"", g->kind->name);
-      ii->hdef = findhdef(STR2, true);
-    } else {
-      ii->hdef = findhdef(g->attr[i - 1].UU.c, true);
-      if (ii->hdef != NULL && strcmp(ii->hdef->name, g->attr[i - 1].UU.c)) {
-	strcpy(g->attr[i - 1].UU.c, ii->hdef->name);
-	g->attr[i - 1].changed = true;
-	ii->oldattrstamp = 0;
-      }
-    }
-    ii->attrchg = false;
-  }
-  hdef = ii->hdef;
-  if (hdef != NULL) {
-    updatehdef(hdef);
-    if (hdef->defined_) {
-      ii->okay = true;
-      if (hdef->gtempl != g) {   /*not the template*/
-	if (ii->hdefstamp != hdef->curstamp) {  /*rewire the gate*/
-	  reallocgate(g, ii->clearstamp != hdef->clearstamp);
-	  if (ii->okay) {
-	    ii->hdefstamp = hdef->curstamp;
-	    ii->clearstamp = hdef->clearstamp;
-	    ii->oldnetstamp = 0;
-	  }
+	instinfo *ii;
+	hdefrec *hdef;
+	long i;
+	log_action_t *WITH;
+	char STR2[12];
+	char STR3[38];
+
+	WITH = logsima_action.lact;
+	ii = (instinfo *)g->info;
+	if (ii->recstamp == currecstamp)
+	{
+		sprintf(STR3, "Gate %s is recursively defined", g->kind->name);
+		/* if curpage = showpage then */
+		showerrormsg(ii->hdef, STR3);
+		ii->okay = false;
+		return;
 	}
-	if (ii->oldnetstamp != logsima_tool_16->netstamp && ii->okay) {
-	  reconnectgate(g);
-	  if (ii->okay)
-	    ii->oldnetstamp = logsima_tool_16->netstamp;
+	
+	ii->recstamp = currecstamp;
+	if (ii->attrchg)
+	{  /*circuit has changed*/
+		i = findgattr(g, "inst-of", "CA", 0);
+		if (i == 0)
+		{
+			sprintf(STR2, "\"%s\"", g->kind->name);
+			ii->hdef = findhdef(STR2, true);
+		}
+		else
+		{
+			ii->hdef = findhdef(g->attr[i - 1].UU.c, true);
+			if (ii->hdef != NULL && strcmp(ii->hdef->name, g->attr[i - 1].UU.c))
+			{
+				strcpy(g->attr[i - 1].UU.c, ii->hdef->name);
+				g->attr[i - 1].changed = true;
+				ii->oldattrstamp = 0;
+			}
+		}
+		ii->attrchg = false;
+	}
+	hdef = ii->hdef;
+	if (hdef != NULL)
+	{
+		updatehdef(hdef);
+		if (hdef->defined_)
+		{
+			ii->okay = true;
+			if (hdef->gtempl != g)
+			{   /*not the template*/
+				if (ii->hdefstamp != hdef->curstamp)
+				{  /*rewire the gate*/
+					reallocgate(g, ii->clearstamp != hdef->clearstamp);
+					if (ii->okay)
+					{
+						ii->hdefstamp = hdef->curstamp;
+						ii->clearstamp = hdef->clearstamp;
+						ii->oldnetstamp = 0;
+					}
+				}
+
+				if (ii->oldnetstamp != logsima_tool_16->netstamp && ii->okay)
+				{
+					reconnectgate(g);
+					if (ii->okay)
+						ii->oldnetstamp = logsima_tool_16->netstamp;
+				}
+			}
+		}
+		else
+		{
+			ii->okay = false;
+		}
+	}
+	else
+	{
+		ii->okay = false;
 	}
-      }
-    } else
-      ii->okay = false;
-  } else
-    ii->okay = false;
-  ii->recstamp = 0;
+	ii->recstamp = 0;
 }
 
 
-
-
-
 static void initcolors_h()
 {
-  log_action_t *WITH;
-
-  WITH = logsima_action.lact;
-  if (WITH->colorstamp == oldcolorstamp)
-    return;
-  (*WITH->hook.getcolor)("TEMPLATE", &templatecolor, log_pink);
-  (*WITH->hook.getcolor)("INSTANCE", &kindcolor, log_dyellow);
-  (*WITH->hook.getcolor)("DARKWORD", &darkwordcolor, log_lgray);
-  oldcolorstamp = WITH->colorstamp;
+	log_action_t *WITH;
+
+	WITH = logsima_action.lact;
+	if (WITH->colorstamp == oldcolorstamp)
+		return;
+	(*WITH->hook.getcolor)("TEMPLATE", &templatecolor, log_pink);
+	(*WITH->hook.getcolor)("INSTANCE", &kindcolor, log_dyellow);
+	(*WITH->hook.getcolor)("DARKWORD", &darkwordcolor, log_lgray);
+	oldcolorstamp = WITH->colorstamp;
 }
 
 
@@ -4879,510 +5157,559 @@ static void initcolors_h()
 
 
 
-static void showinstpins(g)
-log_grec *g;
+static void showinstpins(log_grec *g)
 {
-  instinfo *ii;
-  short i;
-  log_krec *k;
-  short *pnum;
-  long lastnorth, lasteast, lastsouth, numports;
-  short FORLIM;
-  char STR1[256];
-
-  k = g->kind;
-  ii = (instinfo *)g->info;
-  pnum = (short *)Malloc(k->numpins * 2);
-  examinetemplate(g, NULL, (long)k->numpins, isgenericinstgate(g), &pnum, &lastnorth,
-		  &lasteast, &lastsouth, &numports);
-  FORLIM = numports;
-  for (i = 1; i <= FORLIM; i++) {
-    sprintf(STR1, "%d", i);
-    (*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
-      logsima_action.lact->color.backgr, STR1);
-  }
-  FORLIM = numports;
-  for (i = 1; i <= FORLIM; i++) {
-    sprintf(STR1, "%d", i);
-    (*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
-      logsima_action.lact->color.pinnum, STR1);
-  }
-  Free(pnum);
+	instinfo *ii;
+	short i;
+	log_krec *k;
+	short *pnum;
+	long lastnorth, lasteast, lastsouth, numports;
+	short FORLIM;
+	char STR1[256];
+
+	k = g->kind;
+	ii = (instinfo *)g->info;
+	pnum = (short *)Malloc(k->numpins * 2);
+	examinetemplate(g, NULL, (long)k->numpins, isgenericinstgate(g), &pnum, &lastnorth,
+			&lasteast, &lastsouth, &numports);
+	FORLIM = numports;
+	for (i = 1; i <= FORLIM; i++)
+	{
+		sprintf(STR1, "%d", i);
+		(*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
+				logsima_action.lact->color.backgr, STR1);
+	}
+	FORLIM = numports;
+	for (i = 1; i <= FORLIM; i++)
+	{
+		sprintf(STR1, "%d", i);
+		(*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
+				logsima_action.lact->color.pinnum, STR1);
+	}
+	Free(pnum);
 }
 
 #undef nummap
 
 
-
-
-void Log_16_inst(act)
-log_16_action *act;
+void Log_16_inst(log_16_action *act)
 {
-  log_grec *curgate;
-  instinfo *ii, *ii2;
-  long i, j;
-  short drawx, drawy;
-  int drawflag, attr2;
-  char attr1[256];
-  hdefrec *hdef;
-  na_strlist_t *sl1;
-  log_action_t *WITH;
-  log_grec *WITH1;
-  log_gattrrec *WITH2;
-  char STR1[256];
-  char STR2[256];
-  long FORLIM;
-  log_nrec *WITH3;
-  char STR3[256];
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_newkind:
-    if (WITH->runstamp != currunstamp) {
-      currunstamp = WITH->runstamp;
-      WITH->curstamp = 0;
-      currecstamp = 0;
-      hdefbase = NULL;
-      viserrorstamp = 0;
-      viserrors = NULL;
-      vddsig = NULL;
-      gndsig = NULL;
-      oldcolorstamp = 0;
-      showstamp = 1;
-      hier_init(act->lact);
-    }
-    break;
-
-  case act_16_new:
-  case act_16_copy:
-    ii = (instinfo *)Malloc(sizeof(instinfo));
-    ii->attrchg = true;
-    ii->okay = false;
-    ii->wasokay = true;
-    ii->hdef = NULL;
-    ii->hdefstamp = 0;
-    ii->clearstamp = 0;
-    ii->oldnetstamp = 0;
-    ii->numppins = 0;
-    ii->numpins = 0;
-    ii->wasdrawn = NULL;
-    ii->oldattrstamp = 0;
-    ii->instattr = findgattr(WITH->actgate, "inst-of", "CA", 0);
-    ii->nameattr = findgattr(WITH->actgate, "gate-name", "CA", 0);
-    ii->dispattr = findgattr(WITH->actgate, "disp-inst-name", "B", 0);
-    if (act->action == act_16_copy) {
-      ii2 = (instinfo *)WITH->actgate2->info;
-      ii->numpvars = ii2->numpvars;
-      if (ii->numpvars > 0) {
-	ii->ginfo.pvars = (char *)Malloc(ii->numpvars);
-	memmove((void *)ii->ginfo.pvars, (void *)ii2->ginfo.pvars,
-		ii->numpvars);
-      }
-    } else
-      ii->numpvars = 0;
-    ii->recstamp = 0;
-    WITH1->info = (void *)ii;
-    initcolors_h();
-    break;
-
-  case act_16_dispose:
-    ii = (instinfo *)WITH1->info;
-    if (ii->numppins > 0)
-      Free(ii->ginfo.ppins);
-    if (ii->numpvars > 0)
-      Free(ii->ginfo.pvars);
-    if (ii->numpins > 0)
-      Free(ii->pins);
-    Free(ii);
-    break;
-
-  case act_16_configgate:
-    break;
-    /*first pass only*/
-    /* update display of attributes */
-
-  case act_16_configchgate:
-    WITH2 = &WITH1->attr[WITH->actx - 1];
-    ii = (instinfo *)WITH1->info;
-    ii->attrchg = true;
-    if (WITH->actx == ii->instattr) {
-      if (*WITH2->UU.c != '\0' && *WITH2->UU.c != '"' &&
-	  !strends(WITH2->UU.c, "\"")) {
-	sprintf(STR2, "\"%s\"", WITH2->UU.c);
-	(*WITH->hook2->setgattr)(WITH->actgate, (int)WITH->actx, STR2);
-      }
-    }
-    break;
-
-  case act_16_configrelgate:
-    /* blank case */
-    break;
-
-  /* nothing to do */
-  case act_16_sim:
-    curgate = WITH->actgate;   /*save because of reentrancy*/
-    currecstamp++;
-    updateinstance(curgate);
-    ii = (instinfo *)WITH1->info;
-    if (ii->okay && ii->hdef->gtempl != curgate)
-      executeprog(ii->hdef->proc, ii->pins, &ii->ginfo, &WITH1->vars);
-    if (ii->okay != ii->wasokay) {
-      (*WITH->hook.setdimgate)(curgate, !ii->okay);
-      ii->wasokay = ii->okay;
-      ii->oldattrstamp = 0;
-    }
-    break;
-
-  case act_16_draw:
-    ii = (instinfo *)WITH1->info;
-    if (ii->instattr > 0 || ii->nameattr > 0) {
-      if (WITH->gattrstamp != ii->oldattrstamp) {
-	ii->oldattrstamp = WITH->gattrstamp;
-	j = ii->nameattr;
-	if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0')
-	  strcpy(attr1, WITH1->attr[j - 1].UU.c);
-	else {
-	  j = ii->instattr;
-	  if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0') {
-	    strcpy(attr1, WITH1->attr[j - 1].UU.c);
-	    if (*attr1 == '"' && strends(attr1, "\""))
-	      strcpy(attr1,
-		     strpart(STR1, attr1, 2, (int)(strlen(attr1) - 1L)));
-	  } else
-	    *attr1 = '\0';
+	log_grec *curgate;
+	instinfo *ii, *ii2;
+	long i, j;
+	short drawx, drawy;
+	int drawflag, attr2;
+	char attr1[256];
+	hdefrec *hdef;
+	na_strlist_t *sl1;
+	log_action_t *WITH;
+	log_grec *WITH1;
+	log_gattrrec *WITH2;
+	char STR1[256];
+	char STR2[256];
+	long FORLIM;
+	log_nrec *WITH3;
+	char STR3[256];
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+
+		case act_16_newkind:
+			if (WITH->runstamp != currunstamp)
+			{
+				currunstamp = WITH->runstamp;
+				WITH->curstamp = 0;
+				currecstamp = 0;
+				hdefbase = NULL;
+				viserrorstamp = 0;
+				viserrors = NULL;
+				vddsig = NULL;
+				gndsig = NULL;
+				oldcolorstamp = 0;
+				showstamp = 1;
+				hier_init(act->lact);
+			}
+			break;
+
+		case act_16_new:
+		case act_16_copy:
+			ii = (instinfo *)Malloc(sizeof(instinfo));
+			ii->attrchg = true;
+			ii->okay = false;
+			ii->wasokay = true;
+			ii->hdef = NULL;
+			ii->hdefstamp = 0;
+			ii->clearstamp = 0;
+			ii->oldnetstamp = 0;
+			ii->numppins = 0;
+			ii->numpins = 0;
+			ii->wasdrawn = NULL;
+			ii->oldattrstamp = 0;
+			ii->instattr = findgattr(WITH->actgate, "inst-of", "CA", 0);
+			ii->nameattr = findgattr(WITH->actgate, "gate-name", "CA", 0);
+			ii->dispattr = findgattr(WITH->actgate, "disp-inst-name", "B", 0);
+			if (act->action == act_16_copy)
+			{
+				ii2 = (instinfo *)WITH->actgate2->info;
+				ii->numpvars = ii2->numpvars;
+				if (ii->numpvars > 0)
+				{
+					ii->ginfo.pvars = (char *)Malloc(ii->numpvars);
+					memmove((void *)ii->ginfo.pvars, (void *)ii2->ginfo.pvars,
+							ii->numpvars);
+				}
+			}
+			else
+				ii->numpvars = 0;
+
+			ii->recstamp = 0;
+			WITH1->info = (void *)ii;
+			initcolors_h();
+			break;
+
+		case act_16_dispose:
+			ii = (instinfo *)WITH1->info;
+			if (ii->numppins > 0)
+				Free(ii->ginfo.ppins);
+			if (ii->numpvars > 0)
+				Free(ii->ginfo.pvars);
+			if (ii->numpins > 0)
+				Free(ii->pins);
+			Free(ii);
+			break;
+
+		case act_16_configgate:
+			break;
+			/*first pass only*/
+			/* update display of attributes */
+
+		case act_16_configchgate:
+			WITH2 = &WITH1->attr[WITH->actx - 1];
+			ii = (instinfo *)WITH1->info;
+			ii->attrchg = true;
+			if (WITH->actx == ii->instattr)
+			{
+				if (*WITH2->UU.c != '\0' && *WITH2->UU.c != '"' &&
+						!strends(WITH2->UU.c, "\""))
+				{
+					sprintf(STR2, "\"%s\"", WITH2->UU.c);
+					(*WITH->hook2->setgattr)(WITH->actgate, (int)WITH->actx, STR2);
+				}
+			}
+			break;
+
+		case act_16_configrelgate:
+			/* blank case */
+			break;
+
+			/* nothing to do */
+		case act_16_sim:
+			curgate = WITH->actgate;   /*save because of reentrancy*/
+			currecstamp++;
+			updateinstance(curgate);
+			ii = (instinfo *)WITH1->info;
+			if (ii->okay && ii->hdef->gtempl != curgate)
+				executeprog(ii->hdef->proc, ii->pins, &ii->ginfo, &WITH1->vars);
+			if (ii->okay != ii->wasokay)
+			{
+				(*WITH->hook.setdimgate)(curgate, !ii->okay);
+				ii->wasokay = ii->okay;
+				ii->oldattrstamp = 0;
+			}
+			break;
+
+		case act_16_draw:
+			ii = (instinfo *)WITH1->info;
+			if (ii->instattr > 0 || ii->nameattr > 0)
+			{
+				if (WITH->gattrstamp != ii->oldattrstamp)
+				{
+					ii->oldattrstamp = WITH->gattrstamp;
+					j = ii->nameattr;
+					if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0')
+					{
+						strcpy(attr1, WITH1->attr[j - 1].UU.c);
+					}
+					else
+					{
+						j = ii->instattr;
+						if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0')
+						{
+							strcpy(attr1, WITH1->attr[j - 1].UU.c);
+							if (*attr1 == '"' && strends(attr1, "\""))
+								strcpy(attr1,
+										strpart(STR1, attr1, 2, (int)(strlen(attr1) - 1L)));
+						}
+						else
+						{
+							*attr1 = '\0';
+						}
+					}
+					if (*attr1 == '\0')
+					{
+						attr2 = false;
+					}
+					else
+					{
+						j = ii->dispattr;
+						if (j == 0 || WITH1->attr[j - 1].blnk)
+						{
+							if (WITH1->rot & 1)
+								attr2 = (m_strwidth(NULL, attr1) <=
+										WITH1->kind->y2 - WITH1->kind->y1 - 3);
+							else
+								attr2 = (m_strwidth(NULL, attr1) <=
+										WITH1->kind->x2 - WITH1->kind->x1 - 3);
+						}
+						else
+						{
+							attr2 = WITH1->attr[j - 1].UU.b;
+						}
+					}
+
+					if (!attr2)
+						drawflag = (ii->wasdrawn != NULL);
+					else
+						drawflag = (ii->wasdrawn == NULL || strcmp(ii->wasdrawn, attr1));
+					
+					if (drawflag && ii->wasdrawn != NULL)
+					{
+						drawx = 0;
+						drawy = 0;
+						(*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
+						(*WITH->hook.hidecursor)();
+						m_color((long)WITH->color.backgr);
+						m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
+						(*WITH->hook.unhidecursor)();
+					}
+					
+					if (attr2)
+						strchange(&ii->wasdrawn, attr1);
+					else
+						strdispose(&ii->wasdrawn);
+				}
+				else
+				{
+					drawflag = false;
+				}
+
+				if ((WITH->refrflag || drawflag) && ii->wasdrawn != NULL)
+				{
+					drawx = 0;
+					drawy = 0;
+					(*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
+					initcolors_h();
+					(*WITH->hook.hidecursor)();
+					if (ii->hdef != NULL && ii->hdef->gtempl == WITH->actgate)
+						m_color((long)templatecolor);
+					else
+						m_color((long)kindcolor);
+					m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
+					(*WITH->hook.unhidecursor)();
+				}
+			}
+			break;
+
+		case act_16_erase:
+			ii = (instinfo *)WITH1->info;
+			if (ii->wasdrawn != NULL)
+			{
+				drawx = 0;
+				drawy = 0;
+				(*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
+				(*WITH->hook.hidecursor)();
+				m_color((long)WITH->color.backgr);
+				m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
+				(*WITH->hook.unhidecursor)();
+			}
+			break;
+
+		case act_16_refnodes:   /*garbage collection*/
+			ii = (instinfo *)WITH1->info;
+			FORLIM = ii->numppins;
+			for (i = 0; i < FORLIM; i++)
+			{
+				WITH3 = ii->ginfo.ppins[i];
+				WITH3->ref++;
+			}
+			break;
+
+		case act_16_func:
+			if (!strcmp(WITH->func, "DS"))
+			{   /*show debugging stuff*/
+				showstamp++;
+				hdef = hdefbase;
+				while (hdef != NULL)
+				{
+					hdef->oldpagestamp = 0;   /*force recompile*/
+					hdef = hdef->next;
+				}
+				(*WITH->hook.clearfunc)();
+			}
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "PLOT"))
+			{
+				ii = (instinfo *)WITH1->info;
+				if (ii->wasdrawn != NULL)
+				{
+					sl1 = strlist_append(&WITH->actstrlist, "color gate");
+					drawx = 0;
+					drawy = 0;
+					(*WITH->hook2->plainxform)(WITH->actgate, &drawx, &drawy);
+					sprintf(STR3, "text %d %d 60 CC \"%s\"", drawx, drawy, ii->wasdrawn);
+					sl1 = strlist_append(&WITH->actstrlist, STR3);
+				}
+			}
+			else if (!strcmp(WITH->genfunc, "DUMPKIND"))
+			{
+				ii = (instinfo *)WITH1->info;
+				if (ii->hdef != NULL)
+				{
+					sprintf(STR2, "Digital hierarchical definition %s:", ii->hdef->name);
+					sl1 = strlist_append(&WITH->actstrlist, STR2);
+					if (ii->okay)
+						dump_16(&ii->hdef->proc, &sl1->next, true);
+					else
+						sl1 = strlist_append(&WITH->actstrlist,
+								"(Definition is not complete)");
+				}
+			}
+			else if (!strcmp(WITH->genfunc, "SHOWPINS"))
+			{
+				ii = (instinfo *)WITH1->info;
+				if (ii->hdef != NULL && ii->hdef->gtempl != NULL)
+				{
+					showinstpins(WITH->actgate);   /* show special pin numbering */
+					WITH->actflag = true;
+				}
+			}
+			break;
+
+		default:
+			break;
 	}
-	if (*attr1 == '\0')
-	  attr2 = false;
-	else {
-	  j = ii->dispattr;
-	  if (j == 0 || WITH1->attr[j - 1].blnk) {
-	    if (WITH1->rot & 1)
-	      attr2 = (m_strwidth(NULL, attr1) <=
-		       WITH1->kind->y2 - WITH1->kind->y1 - 3);
-	    else
-	      attr2 = (m_strwidth(NULL, attr1) <=
-		       WITH1->kind->x2 - WITH1->kind->x1 - 3);
-	  } else
-	    attr2 = WITH1->attr[j - 1].UU.b;
-	}
-	if (!attr2)
-	  drawflag = (ii->wasdrawn != NULL);
-	else
-	  drawflag = (ii->wasdrawn == NULL || strcmp(ii->wasdrawn, attr1));
-	if (drawflag && ii->wasdrawn != NULL) {
-	  drawx = 0;
-	  drawy = 0;
-	  (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
-	  (*WITH->hook.hidecursor)();
-	  m_color((long)WITH->color.backgr);
-	  m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
-	  (*WITH->hook.unhidecursor)();
-	}
-	if (attr2)
-	  strchange(&ii->wasdrawn, attr1);
-	else
-	  strdispose(&ii->wasdrawn);
-      } else
-	drawflag = false;
-      if ((WITH->refrflag || drawflag) && ii->wasdrawn != NULL) {
-	drawx = 0;
-	drawy = 0;
-	(*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
-	initcolors_h();
-	(*WITH->hook.hidecursor)();
-	if (ii->hdef != NULL && ii->hdef->gtempl == WITH->actgate)
-	  m_color((long)templatecolor);
-	else
-	  m_color((long)kindcolor);
-	m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
-	(*WITH->hook.unhidecursor)();
-      }
-    }
-    break;
-
-  case act_16_erase:
-    ii = (instinfo *)WITH1->info;
-    if (ii->wasdrawn != NULL) {
-      drawx = 0;
-      drawy = 0;
-      (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
-      (*WITH->hook.hidecursor)();
-      m_color((long)WITH->color.backgr);
-      m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
-      (*WITH->hook.unhidecursor)();
-    }
-    break;
-
-  case act_16_refnodes:   /*garbage collection*/
-    ii = (instinfo *)WITH1->info;
-    FORLIM = ii->numppins;
-    for (i = 0; i < FORLIM; i++) {
-      WITH3 = ii->ginfo.ppins[i];
-      WITH3->ref++;
-    }
-    break;
-
-  case act_16_func:
-    if (!strcmp(WITH->func, "DS")) {   /*show debugging stuff*/
-      showstamp++;
-      hdef = hdefbase;
-      while (hdef != NULL) {
-	hdef->oldpagestamp = 0;   /*force recompile*/
-	hdef = hdef->next;
-      }
-      (*WITH->hook.clearfunc)();
-    }
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "PLOT")) {
-      ii = (instinfo *)WITH1->info;
-      if (ii->wasdrawn != NULL) {
-	sl1 = strlist_append(&WITH->actstrlist, "color gate");
-	drawx = 0;
-	drawy = 0;
-	(*WITH->hook2->plainxform)(WITH->actgate, &drawx, &drawy);
-	sprintf(STR3, "text %d %d 60 CC \"%s\"", drawx, drawy, ii->wasdrawn);
-	sl1 = strlist_append(&WITH->actstrlist, STR3);
-      }
-    } else if (!strcmp(WITH->genfunc, "DUMPKIND")) {
-      ii = (instinfo *)WITH1->info;
-      if (ii->hdef != NULL) {
-	sprintf(STR2, "Digital hierarchical definition %s:", ii->hdef->name);
-	sl1 = strlist_append(&WITH->actstrlist, STR2);
-	if (ii->okay)
-	  dump_16(&ii->hdef->proc, &sl1->next, true);
-	else
-	  sl1 = strlist_append(&WITH->actstrlist,
-			       "(Definition is not complete)");
-      }
-    } else if (!strcmp(WITH->genfunc, "SHOWPINS")) {
-      ii = (instinfo *)WITH1->info;
-      if (ii->hdef != NULL && ii->hdef->gtempl != NULL) {
-	showinstpins(WITH->actgate);   /* show special pin numbering */
-	WITH->actflag = true;
-      }
-    }
-    break;
-
-  default:
-    break;
-  }
 }
 
 
-
-void Log_dig_inst(act)
-log_16_action *act;
+void Log_dig_inst(log_16_action *act)
 {
-  Log_16_inst(act);
+	Log_16_inst(act);
 }
 
 
-void Log_16_digh(act)
-log_16_action *act;
+void Log_16_digh(log_16_action *act)
 {
-  controlinfo *cip;
-  char aname[256];
-  log_action_t *WITH;
-  log_grec *WITH1;
-  log_gattrrec *WITH2;
-  char STR1[256];
-
-  WITH = act->lact;
-  WITH1 = WITH->actgate;
-  switch (act->action) {
-
-  case act_16_newkind:
-    hier_init(act->lact);
-    break;
-
-  case act_16_new:
-  case act_16_copy:
-    cip = (controlinfo *)Malloc(sizeof(controlinfo));
-    WITH1->info = (void *)cip;
-    cip->hdef = NULL;
-    cip->pgnum = -99;
-    *cip->message = '\0';
-    *cip->oldmessage = '\0';
-    *cip->message2 = '\0';
-    *cip->oldmessage2 = '\0';
-    cip->oldoptcolor = -1;
-    cip->olddumpcolor = -1;
-    cip->olddumpmode = dump_none;
-    cip->welcomeflag = true;
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
-    break;
-
-  case act_16_read:
-    WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
-    break;
-
-  case act_16_dispose:
-    cip = (controlinfo *)WITH1->info;
-    if (cip->hdef != NULL) {
-      cip->hdef->gcontrol = NULL;
-      cip->hdef = NULL;
-    }
-    Free(cip);
-    break;
-
-  case act_16_connect:
-    cip = (controlinfo *)WITH1->info;
-    cip->pgnum = WITH->curpage;
-    break;
-
-  case act_16_disconnect:
-    cip = (controlinfo *)WITH1->info;
-    if (cip->hdef != NULL) {
-      cip->hdef->gcontrol = NULL;
-      cip->hdef = NULL;
-    }
-    cip->pgnum = -99;
-    break;
-
-  case act_16_draw:
-    cip = (controlinfo *)WITH1->info;
-    if (cip->hdef != NULL && cip->hdef->defined_) {
-      sprintf(STR1, "Definition for %s", cip->hdef->name);
-      strcpy(cip->message, STR1);
-      *cip->message2 = '\0';
-    }
-    if (WITH->refrflag)
-      refrcontrol(WITH->actgate, 1);
-    else
-      refrcontrol(WITH->actgate, 0);
-    break;
-
-  case act_16_erase:
-    refrcontrol(WITH->actgate, -1);
-    break;
-
-  case act_16_touch:
-    cip = (controlinfo *)WITH1->info;
-    if (WITH->actx >= -3 && WITH->actx <= 3 && WITH->acty >= -2 &&
-	WITH->acty <= 2) {
-      if (cip->hdef != NULL && cip->hdef->defined_) {
-	if (WITH->acty <= 0) {
-	  cip->hdef->nextoptflag = true;
-	  cip->hdef->optflag = true;
-	  refrcontrol(WITH->actgate, 0);
-	  sprintf(STR1, "Optimizing %s", cip->hdef->name);
-	  (*WITH->hook.vmessage)(STR1);
-	  cip->hdef->oldpagestamp = 0;   /*force recompile*/
-	  /*   updatehdef(cip^.hdef);   */
-	} else {
-	  if (cip->hdef->dumpmode == dump_write &&
-	      *cip->hdef->writefile == '\0')
-	    (*WITH->hook.message)("No file name specified");
-	  else if (cip->hdef->dumpmode == dump_none)
-	    (*WITH->hook.message)("Dumping is not enabled");
-	  else {
-	    cip->hdef->dumphighlight = true;
-	    cip->hdef->oldshowstamp = -1;
-	    if (cip->hdef->optmode == opt_dump)
-	      cip->hdef->optflag = true;
-	    cip->hdef->nextoptflag = cip->hdef->optflag;
-	    refrcontrol(WITH->actgate, 0);
-	    /*  call(hook.vmessage, 'Dumping ' + cip^.hdef^.name^);  */
-	    cip->hdef->oldpagestamp = 0;   /*force recompile*/
-	  }
-	}
-      } else
-	(*WITH->hook.message)("Definition is not complete");
-      WITH->actflag = true;
-    }
-    break;
-
-  case act_16_configgate:
-    cip = (controlinfo *)WITH1->info;
-    if (WITH->actflag)   /*first pass only*/
-      storecontrolattrs(cip->hdef, WITH->actgate);
-    break;
-
-  case act_16_configchgate:
-    WITH2 = &WITH1->attr[WITH->actx - 1];
-    cip = (controlinfo *)WITH1->info;
-    if (cip->hdef == NULL)
-      WITH->actflag = false;
-    else {
-      namegattr(aname, WITH->actgate, (int)WITH->actx);
-      if (!strcmp(aname, "opt")) {
-	if (WITH2->UU.U73.i1 < 0)
-	  WITH2->UU.U73.i1 = 0;
-	if (WITH2->UU.U73.i1 >= 1000)
-	  WITH2->blnk = true;
-	if (WITH2->blnk)
-	  WITH2->UU.U73.i1 = 1000;
-	cip->hdef->optlevel = WITH2->UU.U73.i1;
-      } else if (!strcmp(aname, "opt-when")) {
-	switch (WITH2->UU.nv) {
-
-	case 1:
-	  cip->hdef->optmode = opt_dump;
-	  break;
-
-	case 2:
-	  cip->hdef->optmode = opt_request;
-	  break;
-
-	default:
-	  cip->hdef->optmode = opt_always;
-	  break;
-	}
-      } else if (!strcmp(aname, "opt-delay"))
-	cip->hdef->optdelay = WITH2->UU.b;
-      else if (!strcmp(aname, "disp"))
-	cip->hdef->wantnote = WITH2->UU.b;
-      else if (!strcmp(aname, "stats"))
-	cip->hdef->wantstats = WITH2->UU.b;
-      else if (!strcmp(aname, "dump")) {
-	switch (WITH2->UU.nv) {
-
-	case 1:
-	  cip->hdef->dumpmode = dump_dump;
-	  break;
-
-	case 2:
-	  cip->hdef->dumpmode = dump_big;
-	  break;
-
-	case 3:
-	  cip->hdef->dumpmode = dump_write;
-	  break;
-
-	default:
-	  cip->hdef->dumpmode = dump_none;
-	  break;
+	controlinfo *cip;
+	char aname[256];
+	log_action_t *WITH;
+	log_grec *WITH1;
+	log_gattrrec *WITH2;
+	char STR1[256];
+
+	WITH = act->lact;
+	WITH1 = WITH->actgate;
+	switch (act->action)
+	{
+		case act_16_newkind:
+			hier_init(act->lact);
+			break;
+
+		case act_16_new:
+		case act_16_copy:
+			cip = (controlinfo *)Malloc(sizeof(controlinfo));
+			WITH1->info = (void *)cip;
+			cip->hdef = NULL;
+			cip->pgnum = -99;
+			*cip->message = '\0';
+			*cip->oldmessage = '\0';
+			*cip->message2 = '\0';
+			*cip->oldmessage2 = '\0';
+			cip->oldoptcolor = -1;
+			cip->olddumpcolor = -1;
+			cip->olddumpmode = dump_none;
+			cip->welcomeflag = true;
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+			break;
+
+		case act_16_read:
+			WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+			break;
+
+		case act_16_dispose:
+			cip = (controlinfo *)WITH1->info;
+			if (cip->hdef != NULL) {
+				cip->hdef->gcontrol = NULL;
+				cip->hdef = NULL;
+			}
+			Free(cip);
+			break;
+
+		case act_16_connect:
+			cip = (controlinfo *)WITH1->info;
+			cip->pgnum = WITH->curpage;
+			break;
+
+		case act_16_disconnect:
+			cip = (controlinfo *)WITH1->info;
+			if (cip->hdef != NULL) {
+				cip->hdef->gcontrol = NULL;
+				cip->hdef = NULL;
+			}
+			cip->pgnum = -99;
+			break;
+
+		case act_16_draw:
+			cip = (controlinfo *)WITH1->info;
+			if (cip->hdef != NULL && cip->hdef->defined_) {
+				sprintf(STR1, "Definition for %s", cip->hdef->name);
+				strcpy(cip->message, STR1);
+				*cip->message2 = '\0';
+			}
+			if (WITH->refrflag)
+				refrcontrol(WITH->actgate, 1);
+			else
+				refrcontrol(WITH->actgate, 0);
+			break;
+
+		case act_16_erase:
+			refrcontrol(WITH->actgate, -1);
+			break;
+
+		case act_16_touch:
+			cip = (controlinfo *)WITH1->info;
+			if (WITH->actx >= -3 && WITH->actx <= 3 && WITH->acty >= -2 &&
+					WITH->acty <= 2)
+			{
+				if (cip->hdef != NULL && cip->hdef->defined_)
+				{
+					if (WITH->acty <= 0)
+					{
+						cip->hdef->nextoptflag = true;
+						cip->hdef->optflag = true;
+						refrcontrol(WITH->actgate, 0);
+						sprintf(STR1, "Optimizing %s", cip->hdef->name);
+						(*WITH->hook.vmessage)(STR1);
+						cip->hdef->oldpagestamp = 0;   /*force recompile*/
+						/*   updatehdef(cip^.hdef);   */
+					}
+					else
+					{
+						if (cip->hdef->dumpmode == dump_write &&
+								*cip->hdef->writefile == '\0')
+							(*WITH->hook.message)("No file name specified");
+						else if (cip->hdef->dumpmode == dump_none)
+							(*WITH->hook.message)("Dumping is not enabled");
+						else
+						{
+							cip->hdef->dumphighlight = true;
+							cip->hdef->oldshowstamp = -1;
+							if (cip->hdef->optmode == opt_dump)
+								cip->hdef->optflag = true;
+							cip->hdef->nextoptflag = cip->hdef->optflag;
+							refrcontrol(WITH->actgate, 0);
+							/*  call(hook.vmessage, 'Dumping ' + cip^.hdef^.name^);  */
+							cip->hdef->oldpagestamp = 0;   /*force recompile*/
+						}
+					}
+				}
+				else
+					(*WITH->hook.message)("Definition is not complete");
+				WITH->actflag = true;
+			}
+			break;
+
+		case act_16_configgate:
+			cip = (controlinfo *)WITH1->info;
+			if (WITH->actflag)   /*first pass only*/
+				storecontrolattrs(cip->hdef, WITH->actgate);
+			break;
+
+		case act_16_configchgate:
+			WITH2 = &WITH1->attr[WITH->actx - 1];
+			cip = (controlinfo *)WITH1->info;
+			if (cip->hdef == NULL)
+				WITH->actflag = false;
+			else
+			{
+				namegattr(aname, WITH->actgate, (int)WITH->actx);
+				if (!strcmp(aname, "opt"))
+				{
+					if (WITH2->UU.U73.i1 < 0)
+						WITH2->UU.U73.i1 = 0;
+					if (WITH2->UU.U73.i1 >= 1000)
+						WITH2->blnk = true;
+					if (WITH2->blnk)
+						WITH2->UU.U73.i1 = 1000;
+					cip->hdef->optlevel = WITH2->UU.U73.i1;
+				}
+				else if (!strcmp(aname, "opt-when"))
+				{
+					switch (WITH2->UU.nv)
+					{
+						case 1:
+							cip->hdef->optmode = opt_dump;
+							break;
+
+						case 2:
+							cip->hdef->optmode = opt_request;
+							break;
+
+						default:
+							cip->hdef->optmode = opt_always;
+							break;
+					}
+				}
+				else if (!strcmp(aname, "opt-delay"))
+					cip->hdef->optdelay = WITH2->UU.b;
+				else if (!strcmp(aname, "disp"))
+					cip->hdef->wantnote = WITH2->UU.b;
+				else if (!strcmp(aname, "stats"))
+					cip->hdef->wantstats = WITH2->UU.b;
+				else if (!strcmp(aname, "dump"))
+				{
+					switch (WITH2->UU.nv)
+					{
+
+						case 1:
+							cip->hdef->dumpmode = dump_dump;
+							break;
+
+						case 2:
+							cip->hdef->dumpmode = dump_big;
+							break;
+
+						case 3:
+							cip->hdef->dumpmode = dump_write;
+							break;
+
+						default:
+							cip->hdef->dumpmode = dump_none;
+							break;
+					}
+				}
+				else if (!strcmp(aname, "write-file"))
+				{
+					strcpy(aname, WITH2->UU.sp);
+					newci_fixfname(aname, "def", "");
+					strchange(&WITH2->UU.sp, aname);
+					strchange(&cip->hdef->writefile, aname);
+				}
+			}
+			break;
+
+		case act_16_gengate:
+			if (!strcmp(WITH->genfunc, "INERT"))
+				WITH->actx = -42;   /*kludge!*/
+			break;
+
+		default:
+			break;
 	}
-      } else if (!strcmp(aname, "write-file")) {
-	strcpy(aname, WITH2->UU.sp);
-	newci_fixfname(aname, "def", "");
-	strchange(&WITH2->UU.sp, aname);
-	strchange(&cip->hdef->writefile, aname);
-      }
-    }
-    break;
-
-  case act_16_gengate:
-    if (!strcmp(WITH->genfunc, "INERT"))
-      WITH->actx = -42;   /*kludge!*/
-    break;
-
-  default:
-    break;
-  }
 }
 
 
-
-
-
-
-
-
-
-
 /* End. */
-- 
GitLab