diff --git a/log/src/logsim.c b/log/src/logsim.c
index 9ea1057e8d4c80436083d3e22432dcb5543caf3c..eccd0e09ae3288563a367cd2aa3dcf9fde3a26c2 100644
--- a/log/src/logsim.c
+++ b/log/src/logsim.c
@@ -11,28 +11,28 @@
Copyright (C) 1985, 1990 John Lazzaro.
Author's address: lazzaro@csvax.caltech.edu; 256-80 Caltech.
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation (any version).
+ This program is free software; you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation (any version).
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
-GNU General Public License for more details.
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
-You should have received a copy of the GNU General Public License
-along with this program; see the file COPYING. If not, write to
-the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+ You should have received a copy of the GNU General Public License
+ along with this program; see the file COPYING. If not, write to
+ the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
/*
- LOG 4.1 Digital logic simulation routines
+ LOG 4.1 Digital logic simulation routines
- David Gillespie 7/13/85
+ David Gillespie 7/13/85
- The following module is subject to change at any time.
-*/
+ The following module is subject to change at any time.
+ */
/* $debug$ {*/
@@ -47,8 +47,8 @@ extern int findprocedure (char *name, void (**start)());
/*$ if debugging $
- $ debug on $
-$ end $*/
+ $ debug on $
+ $ end $*/
@@ -69,14 +69,14 @@ typedef long histcolortabletype[12];
static const ttable bcomb = {
- { log_none, log_zero, log_one },
- { log_zero, log_zero, log_one },
- { log_one, log_one, log_one }
+ { log_none, log_zero, log_one },
+ { log_zero, log_zero, log_one },
+ { log_one, log_one, log_one }
};
static const histcolortabletype histcolortable = {
- log_cyan, log_orange, log_yellow, log_pink, log_green, log_red, log_white,
- log_mred, log_lgray, log_dcyan, log_dyellow, log_dred
+ log_cyan, log_orange, log_yellow, log_pink, log_green, log_red, log_white,
+ log_mred, log_lgray, log_dcyan, log_dyellow, log_dred
};
@@ -97,1343 +97,1325 @@ static log_gattrrec *diggattr;
static short backgrcolor, ledoncolor, ledoffcolor, scopecolor, scopescancolor;
-
-
-
-
/* The following routines are exported so that users' gates can use them. */
-static void log_16_input(lact, n, v)
-log_action_t *lact;
-log_nrec *n;
-log_16_value *v;
+static void log_16_input(log_action_t *lact, log_nrec *n, log_16_value *v)
{
- nodeinfo *ni;
+ nodeinfo *ni;
- ni = (nodeinfo *)n->info;
- *v = ni->v;
+ ni = (nodeinfo *)n->info;
+ *v = ni->v;
}
-
-static void log_16_output(lact, n, v)
-log_action_t *lact;
-log_nrec *n;
-log_16_value v;
+static void log_16_output(log_action_t *lact, log_nrec *n, log_16_value v)
{
- nodeinfo *ni;
-
- ni = (nodeinfo *)n->info;
- if ((int)v > 2)
- v = log_one;
- if (ni->v0 == log_none)
- ni->v0 = v;
- else if (ni->v0 != v && v != log_none)
- (*lact->hook.nodeconflict)(n);
-}
-
+ nodeinfo *ni;
+ ni = (nodeinfo *)n->info;
+ if ((int)v > 2)
+ v = log_one;
-static void log_16_ocoutput(lact, n, v)
-log_action_t *lact;
-log_nrec *n;
-log_16_value v;
-{
- nodeinfo *ni;
-
- if (v != log_zero)
- return;
- ni = (nodeinfo *)n->info;
- if (ni->v0 != log_none)
- (*lact->hook.nodeconflict)(n);
- else
- ni->v0 = v;
+ if (ni->v0 == log_none)
+ ni->v0 = v;
+ else if (ni->v0 != v && v != log_none)
+ (*lact->hook.nodeconflict)(n);
}
-static void getpointmark(num, defx, defy, x, y)
-short num, defx, defy, *x, *y;
+static void log_16_ocoutput(log_action_t *lact, log_nrec *n, log_16_value v)
{
- log_action_t *WITH;
- log_hook2_t *WITH1;
-
- *x = defx;
- *y = defy;
- WITH = logsima_action.lact;
- WITH1 = WITH->hook2;
- (*WITH1->findpointmarker)(WITH->actgate->kind, num, x, y);
-}
+ nodeinfo *ni;
+ if (v != log_zero)
+ return;
+ ni = (nodeinfo *)n->info;
+
+ if (ni->v0 != log_none)
+ (*lact->hook.nodeconflict)(n);
+ else
+ ni->v0 = v;
+}
-static void log_16_led(lact, x, y, v)
-log_action_t *lact;
-short x, y;
-log_16_value v;
+static void getpointmark(short num, short defx, short defy, short *x, short *y)
{
- (*lact->hook.xform)(lact->actgate, &x, &y);
- (*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
- switch (v) {
-
- case log_none:
- m_color((long)lact->color.backgr);
- break;
-
- case log_zero:
- m_color((long)ledoffcolor);
- break;
-
- case log_one:
- m_color((long)ledoncolor);
- break;
- }
- m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
- (*lact->hook.unhidecursor)();
+ log_action_t *WITH;
+ log_hook2_t *WITH1;
+
+ *x = defx;
+ *y = defy;
+ WITH = logsima_action.lact;
+ WITH1 = WITH->hook2;
+ (*WITH1->findpointmarker)(WITH->actgate->kind, num, x, y);
}
-
-static void log_16_eraled(lact, x, y)
-log_action_t *lact;
-short x, y;
+static void log_16_led(log_action_t *lact, short x, short y, log_16_value v)
{
- (*lact->hook.xform)(lact->actgate, &x, &y);
- (*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
- m_color((long)lact->color.backgr);
- m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
- (*lact->hook.unhidecursor)();
+ (*lact->hook.xform)(lact->actgate, &x, &y);
+ (*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
+
+ switch (v)
+ {
+ case log_none:
+ m_color((long)lact->color.backgr);
+ break;
+
+ case log_zero:
+ m_color((long)ledoffcolor);
+ break;
+
+ case log_one:
+ m_color((long)ledoncolor);
+ break;
+ }
+
+ m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
+ (*lact->hook.unhidecursor)();
}
-static void log_16_plotled(lact, x, y, v)
-log_action_t *lact;
-short x, y;
-log_16_value v;
+static void log_16_eraled(log_action_t *lact, short x, short y)
{
- na_strlist_t *l1;
- char STR2[256];
-
- if (v == log_none)
- return;
- switch (v) {
-
- case log_zero:
- l1 = strlist_append(&lact->actstrlist, "color offled");
- break;
-
- case log_one:
- l1 = strlist_append(&lact->actstrlist, "color onled");
- break;
-
- default:
- break;
- }
- (*lact->hook2->plainxform)(lact->actgate, &x, &y);
- sprintf(STR2, "fillbox %ld %ld %ld %ld", x - 3L, y - 3L, x + 3L, y + 3L);
- l1 = strlist_append(&lact->actstrlist, STR2);
+ (*lact->hook.xform)(lact->actgate, &x, &y);
+ (*lact->hook.hidecursorrect)(x - 2L, y - 2L, x + 2L, y + 2L);
+ m_color((long)lact->color.backgr);
+ m_fillrect(x - 2L, y - 2L, x + 2L, y + 2L);
+ (*lact->hook.unhidecursor)();
}
+static void log_16_plotled(log_action_t *lact, short x, short y, log_16_value v)
+{
+ na_strlist_t *l1;
+ char STR2[256];
+
+ if (v == log_none)
+ return;
+ switch (v)
+ {
+ case log_zero:
+ l1 = strlist_append(&lact->actstrlist, "color offled");
+ break;
+
+ case log_one:
+ l1 = strlist_append(&lact->actstrlist, "color onled");
+ break;
+
+ default:
+ break;
+ }
+ (*lact->hook2->plainxform)(lact->actgate, &x, &y);
+ sprintf(STR2, "fillbox %ld %ld %ld %ld", x - 3L, y - 3L, x + 3L, y + 3L);
+ l1 = strlist_append(&lact->actstrlist, STR2);
+}
/* The following routines control LOG's standard non-GDL gates. */
-void Log_16_ledgate(act)
-log_16_action *act;
+void Log_16_ledgate(log_16_action *act)
{
- nodeinfo *pin1;
- log_action_t *WITH;
- log_grec *WITH1;
- char TEMP;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_sim:
- pin1 = (nodeinfo *)WITH1->pin[0]->info;
- P_clrbits_S(*(unsigned long *)&(WITH1->vars), 0, 1);
- P_putbits_US(*(unsigned long *)&(WITH1->vars), 0,
- log_16_vi[(long)pin1->v - (long)log_none], 1);
- break;
-
- case act_16_draw:
- if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
- P_getbits_US((unsigned long)WITH1->vars, 1, 1)) {
- log_16_led(act->lact, 0, 0,
- log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
- TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
- P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
- P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
- }
- break;
-
- case act_16_erase:
- log_16_eraled(act->lact, 0, 0);
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actflag = true;
- else if (!strcmp(WITH->genfunc, "PLOT"))
- log_16_plotled(act->lact, 0, 0,
- log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
- break;
-
- default:
- break;
- }
+ nodeinfo *pin1;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ char TEMP;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_sim:
+ pin1 = (nodeinfo *)WITH1->pin[0]->info;
+ P_clrbits_S(*(unsigned long *)&(WITH1->vars), 0, 1);
+ P_putbits_US(*(unsigned long *)&(WITH1->vars), 0,
+ log_16_vi[(long)pin1->v - (long)log_none], 1);
+ break;
+
+ case act_16_draw:
+ if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
+ P_getbits_US((unsigned long)WITH1->vars, 1, 1))
+ {
+ log_16_led(act->lact, 0, 0,
+ log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+ TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
+ P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
+ P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
+ }
+ break;
+
+ case act_16_erase:
+ log_16_eraled(act->lact, 0, 0);
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ WITH->actflag = true;
+ else if (!strcmp(WITH->genfunc, "PLOT"))
+ log_16_plotled(act->lact, 0, 0,
+ log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+ break;
+
+ default:
+ break;
+ }
}
-void Log_16_ledgate2(act)
-log_16_action *act;
+void Log_16_ledgate2(log_16_action *act)
{
- long i;
- nodeinfo *pin1;
- log_action_t *WITH;
- log_grec *WITH1;
- long FORLIM;
- char TEMP;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_sim:
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
- FORLIM = WITH1->kind->numpins;
- for (i = 0; i < FORLIM; i++) {
- pin1 = (nodeinfo *)WITH1->pin[i]->info;
- switch (pin1->v) {
-
- case log_zero:
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
- break;
-
- case log_one:
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 1));
- break;
-
- default:
- break;
- }
- }
- if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 &&
- (((unsigned long)WITH1->vars) & (1L << 1)) != 0) {
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
- }
- break;
-
- case act_16_draw:
- if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
- P_getbits_US((unsigned long)WITH1->vars, 1, 1)) {
- log_16_led(act->lact, 0, 0,
- log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
- TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
- P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
- P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
- }
- break;
-
- case act_16_erase:
- log_16_eraled(act->lact, 0, 0);
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actflag = true;
- else if (!strcmp(WITH->genfunc, "PLOT"))
- log_16_plotled(act->lact, 0, 0,
- log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
- break;
-
- default:
- break;
- }
+ long i;
+ nodeinfo *pin1;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ long FORLIM;
+ char TEMP;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_sim:
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+ FORLIM = WITH1->kind->numpins;
+ for (i = 0; i < FORLIM; i++)
+ {
+ pin1 = (nodeinfo *)WITH1->pin[i]->info;
+ switch (pin1->v)
+ {
+ case log_zero:
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+ break;
+
+ case log_one:
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 1));
+ break;
+
+ default:
+ break;
+ }
+ }
+
+ if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 &&
+ (((unsigned long)WITH1->vars) & (1L << 1)) != 0)
+ {
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+ }
+ break;
+
+ case act_16_draw:
+ if (WITH->refrflag || P_getbits_US((unsigned long)WITH1->vars, 0, 1) !=
+ P_getbits_US((unsigned long)WITH1->vars, 1, 1))
+ {
+ log_16_led(act->lact, 0, 0,
+ log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+ TEMP = P_getbits_US((unsigned long)WITH1->vars, 0, 1);
+ P_clrbits_S(*(unsigned long *)&(WITH1->vars), 1, 1);
+ P_putbits_US(*(unsigned long *)&(WITH1->vars), 1, TEMP, 1);
+ }
+ break;
+
+ case act_16_erase:
+ log_16_eraled(act->lact, 0, 0);
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ WITH->actflag = true;
+ else if (!strcmp(WITH->genfunc, "PLOT"))
+ log_16_plotled(act->lact, 0, 0,
+ log_16_iv[P_getbits_US((unsigned long)WITH1->vars, 0, 1)]);
+ break;
+
+ default:
+ break;
+ }
}
-void Log_16_clock(act)
-log_16_action *act;
+void Log_16_clock(log_16_action *act)
{
- log_action_t *WITH;
- log_grec *WITH1;
- int TEMP;
- long TEMP1;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_sim:
- if (resetcounter > 0)
- WITH1->info = (na_long)0;
- if ((isstable || WITH1->attr[0].UU.nv != 2) && (long)WITH1->info < 1) {
- switch (WITH1->attr[0].UU.nv) {
-
- case 0:
- if (WITH1->attr[1].UU.U73.i1 == 0)
- WITH1->info = (na_long)0;
- else
- WITH1->info = (na_long)(100 / WITH1->attr[1].UU.U73.i1);
- break;
-
- case 1:
- WITH1->info = (na_long)WITH1->attr[2].UU.U73.i1;
- break;
-
- case 2:
- WITH1->info = (na_long)WITH1->attr[3].UU.U73.i1;
- break;
- }
- if (resetcounter > 0) {
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 2));
- P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
- } else {
- switch (WITH1->attr[4].UU.nv) {
-
- case 0:
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)
- (((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
- WITH1->vars = (na_long)
- (((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
- if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
- WITH1->info = (na_long)((long)WITH1->info / 2);
- else
- WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 2);
- break;
-
- case 1:
- TEMP1 = (P_getbits_US((unsigned long)WITH1->vars, 2, 1) + 1) & 3;
- P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
- P_putbits_US(*(unsigned long *)&(WITH1->vars), 2, TEMP1, 1);
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0 &&
- (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)
- (((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) == 0 &&
- (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
- WITH1->vars = (na_long)
- (((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
- if (P_getbits_US((unsigned long)WITH1->vars, 2, 1) > 0 ||
- (long)WITH1->info < 4)
- WITH1->info = (na_long)((long)WITH1->info / 4);
- else
- WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 4 * 3);
- break;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ int TEMP;
+ long TEMP1;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_sim:
+ if (resetcounter > 0)
+ WITH1->info = (na_long)0;
+
+ if ((isstable || WITH1->attr[0].UU.nv != 2) && (long)WITH1->info < 1)
+ {
+ switch (WITH1->attr[0].UU.nv)
+ {
+ case 0:
+ if (WITH1->attr[1].UU.U73.i1 == 0)
+ WITH1->info = (na_long)0;
+ else
+ WITH1->info = (na_long)(100 / WITH1->attr[1].UU.U73.i1);
+ break;
+
+ case 1:
+ WITH1->info = (na_long)WITH1->attr[2].UU.U73.i1;
+ break;
+
+ case 2:
+ WITH1->info = (na_long)WITH1->attr[3].UU.U73.i1;
+ break;
+ }
+
+ if (resetcounter > 0)
+ {
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 2));
+ P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
+ }
+ else
+ {
+ switch (WITH1->attr[4].UU.nv)
+ {
+ case 0:
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)
+ (((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+ WITH1->vars = (na_long)
+ (((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
+ if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+ WITH1->info = (na_long)((long)WITH1->info / 2);
+ else
+ WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 2);
+ break;
+
+ case 1:
+ TEMP1 = (P_getbits_US((unsigned long)WITH1->vars, 2, 1) + 1) & 3;
+ P_clrbits_S(*(unsigned long *)&(WITH1->vars), 2, 1);
+ P_putbits_US(*(unsigned long *)&(WITH1->vars), 2, TEMP1, 1);
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0 &&
+ (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)
+ (((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) == 0 &&
+ (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+ WITH1->vars = (na_long)
+ (((unsigned long)WITH1->vars) | (((long)TEMP) << 2));
+ if (P_getbits_US((unsigned long)WITH1->vars, 2, 1) > 0 ||
+ (long)WITH1->info < 4)
+ WITH1->info = (na_long)((long)WITH1->info / 4);
+ else
+ WITH1->info = (na_long)((long)WITH1->info - (long)WITH1->info / 4 * 3);
+ break;
+ }
+ }
+ }
+
+ switch (WITH1->attr[0].UU.nv)
+ {
+ case 0:
+ if (newsystime > oldsystime && newsystime < oldsystime + 10000)
+ WITH1->info = (na_long)((long)WITH1->info + oldsystime - newsystime);
+ break;
+
+ case 1:
+ case 2:
+ WITH1->info = (na_long)((long)WITH1->info - 1);
+ break;
+ }
+ break;
+
+ case act_16_draw:
+ if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 0)) != 0))
+ {
+ log_16_led(act->lact, 5, -5,
+ log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
+ }
+
+ if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 2)) != 0))
+ {
+ log_16_led(act->lact, 5, 5,
+ log_16_bv[((((unsigned long)WITH1->vars) & (1L << 2)) != 0) - false]);
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 3));
+ }
+ break;
+
+ case act_16_erase:
+ log_16_eraled(act->lact, 5, -5);
+ log_16_eraled(act->lact, 5, 5);
+ break;
+
+ case act_16_configchgate:
+ switch (WITH->actx)
+ {
+
+ case 2:
+ case 3:
+ case 4:
+ if (WITH1->attr[WITH->actx - 1].UU.U73.i1 <= 0 ||
+ WITH1->attr[WITH->actx - 1].UU.U73.i1 > 32767)
+ WITH->actflag = false;
+ break;
+ }
+ WITH1->info = (na_long)10;
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ WITH->actflag = true;
+ break;
+
+ default:
+ break;
}
- }
- }
- switch (WITH1->attr[0].UU.nv) {
-
- case 0:
- if (newsystime > oldsystime && newsystime < oldsystime + 10000)
- WITH1->info = (na_long)((long)WITH1->info + oldsystime - newsystime);
- break;
-
- case 1:
- case 2:
- WITH1->info = (na_long)((long)WITH1->info - 1);
- break;
- }
- break;
-
- case act_16_draw:
- if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)) {
- log_16_led(act->lact, 5, -5,
- log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
- }
- if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 2)) != 0)) {
- log_16_led(act->lact, 5, 5,
- log_16_bv[((((unsigned long)WITH1->vars) & (1L << 2)) != 0) - false]);
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 3));
- }
- break;
-
- case act_16_erase:
- log_16_eraled(act->lact, 5, -5);
- log_16_eraled(act->lact, 5, 5);
- break;
-
- case act_16_configchgate:
- switch (WITH->actx) {
-
- case 2:
- case 3:
- case 4:
- if (WITH1->attr[WITH->actx - 1].UU.U73.i1 <= 0 ||
- WITH1->attr[WITH->actx - 1].UU.U73.i1 > 32767)
- WITH->actflag = false;
- break;
- }
- WITH1->info = (na_long)10;
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actflag = true;
- break;
-
- default:
- break;
- }
}
-static void makeconstpin(act, num, val)
-log_16_action *act;
-long num;
-int val;
+static void makeconstpin(log_16_action *act, long num, int val)
{
- na_strlist_t *l1;
- char STR1[256];
-
- if (act->lact->actgate->pin[num - 1]->ref <= 1)
- return;
- sprintf(STR1, "%ld", num);
- l1 = strlist_append(&act->lact->actstrlist, STR1);
- if (val)
- l1->value = (void *)vddsig->np;
- else
- l1->value = (void *)gndsig->np;
+ na_strlist_t *l1;
+ char STR1[256];
+
+ if (act->lact->actgate->pin[num - 1]->ref <= 1)
+ return;
+ sprintf(STR1, "%ld", num);
+ l1 = strlist_append(&act->lact->actstrlist, STR1);
+ if (val)
+ l1->value = (void *)vddsig->np;
+ else
+ l1->value = (void *)gndsig->np;
}
-void Log_16_switch(act)
-log_16_action *act;
+void Log_16_switch(log_16_action *act)
{
- short xx, yy;
- log_action_t *WITH;
- log_grec *WITH1;
- int TEMP;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_draw:
- if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)) {
- getpointmark(1, 0, 0, &xx, &yy);
- log_16_led(act->lact, xx, yy,
- log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
- }
- break;
-
- case act_16_erase:
- getpointmark(1, 0, 0, &xx, &yy);
- log_16_eraled(act->lact, xx, yy);
- break;
-
- case act_16_touch:
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
- WITH->actflag = true;
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT")) {
- WITH->actflag = true;
- strcpy(WITH->actstr, "P");
- } else if (!strcmp(WITH->genfunc, "PLOT")) {
- getpointmark(1, 0, 0, &xx, &yy);
- log_16_plotled(act->lact, xx, yy,
- log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
- } else if (!strcmp(WITH->genfunc, "CONSTPINS"))
- makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
- break;
-
- default:
- break;
- }
+ short xx, yy;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ int TEMP;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_draw:
+ if (WITH->refrflag || ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 0)) != 0))
+ {
+ getpointmark(1, 0, 0, &xx, &yy);
+ log_16_led(act->lact, xx, yy,
+ log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 1));
+ }
+ break;
+
+ case act_16_erase:
+ getpointmark(1, 0, 0, &xx, &yy);
+ log_16_eraled(act->lact, xx, yy);
+ break;
+
+ case act_16_touch:
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) == 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+ WITH->actflag = true;
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ {
+ WITH->actflag = true;
+ strcpy(WITH->actstr, "P");
+ }
+ else if (!strcmp(WITH->genfunc, "PLOT"))
+ {
+ getpointmark(1, 0, 0, &xx, &yy);
+ log_16_plotled(act->lact, xx, yy,
+ log_16_bv[((((unsigned long)WITH1->vars) & (1L << 0)) != 0) - false]);
+ }
+ else if (!strcmp(WITH->genfunc, "CONSTPINS"))
+ {
+ makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+ }
+ break;
+
+ default:
+ break;
+ }
}
-void Log_16_pulse(act)
-log_16_action *act;
+void Log_16_pulse(log_16_action *act)
{
- log_action_t *WITH;
- log_grec *WITH1;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- if (act->action != act_16_sim)
- return;
- if ((long)WITH1->info <= 0) {
- if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
- WITH1->info = (na_long)6;
- return;
- }
- WITH1->info = (na_long)((long)WITH1->info - 1);
- if ((long)WITH1->info <= 0)
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ log_action_t *WITH;
+ log_grec *WITH1;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ if (act->action != act_16_sim)
+ return;
+
+ if ((long)WITH1->info <= 0)
+ {
+ if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+ WITH1->info = (na_long)6;
+ return;
+ }
+ WITH1->info = (na_long)((long)WITH1->info - 1);
+
+ if ((long)WITH1->info <= 0)
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
}
-void Log_16_break(act)
-log_16_action *act;
+void Log_16_break(log_16_action *act)
{
- log_action_t *WITH;
- log_grec *WITH1;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_sim:
- if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0) {
- WITH->pwrflag = false;
- (*WITH->hook.vmessage)("Simulation is OFF (triggered BREAK gate)");
- }
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actflag = true;
- break;
-
- default:
- break;
- }
+ log_action_t *WITH;
+ log_grec *WITH1;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_sim:
+ if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+ {
+ WITH->pwrflag = false;
+ (*WITH->hook.vmessage)("Simulation is OFF (triggered BREAK gate)");
+ }
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ WITH->actflag = true;
+ break;
+
+ default:
+ break;
+ }
}
-void Log_16_scope(act)
-log_16_action *act;
+void Log_16_scope(log_16_action *act)
{
- int flag;
- nodeinfo *pin1, *pin2;
- short tx, ty;
- log_action_t *WITH;
- log_grec *WITH1;
- int TEMP;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_draw:
- if (WITH->pwrflag && diggattr[digonoff - 1].UU.nv != 0) {
- pin1 = (nodeinfo *)WITH1->pin[0]->info;
- pin2 = (nodeinfo *)WITH1->pin[1]->info;
- flag = (pin1->v == log_one);
- if ((((unsigned long)WITH1->vars) & (1L << 14)) == 0 || isstable) {
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 8)) == 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
- /*need to look at gate attributes*/
- if ((((unsigned long)WITH1->vars) & (1L << 8)) == 0) {
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 9)) == 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
- WITH1->vars = (na_long)
- (((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
- if ((((unsigned long)WITH1->vars) & (1L << 9)) == 0) {
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 10)) == 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
- WITH1->vars =
- (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 10));
- }
+ int flag;
+ nodeinfo *pin1, *pin2;
+ short tx, ty;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ int TEMP;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_draw:
+ if (WITH->pwrflag && diggattr[digonoff - 1].UU.nv != 0)
+ {
+ pin1 = (nodeinfo *)WITH1->pin[0]->info;
+ pin2 = (nodeinfo *)WITH1->pin[1]->info;
+ flag = (pin1->v == log_one);
+ if ((((unsigned long)WITH1->vars) & (1L << 14)) == 0 || isstable)
+ {
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 8)) == 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
+ /*need to look at gate attributes*/
+ if ((((unsigned long)WITH1->vars) & (1L << 8)) == 0)
+ {
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 9)) == 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
+ WITH1->vars = (na_long)
+ (((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
+ if ((((unsigned long)WITH1->vars) & (1L << 9)) == 0)
+ {
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 10)) == 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
+ WITH1->vars =
+ (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 10));
+ }
+ }
+
+ if (pin2->v == log_one && (((unsigned long)WITH1->vars) & (1L << 2)) == 0)
+ {
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
+ }
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 ||
+ ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) != flag);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
+ if (((((unsigned long)WITH1->vars) & (1L << 11)) == 0 ||
+ (((unsigned long)WITH1->vars) & (1L << 8)) == 0) &&
+ ((((unsigned long)WITH1->vars) & (1L << 12)) == 0 ||
+ (((unsigned long)WITH1->vars) & (1L << 9)) == 0) &&
+ ((((unsigned long)WITH1->vars) & (1L << 13)) == 0 ||
+ (((unsigned long)WITH1->vars) & (1L << 10)) == 0) &&
+ ((long)WITH1->info > 0 ||
+ (pin2->v != log_zero &&
+ (((unsigned long)WITH1->vars) & (1L << 2)) == 0)))
+ {
+ tx = 0;
+ ty = 0;
+ (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+ tx += (long)WITH1->info * 2 - 7;
+ (*WITH->hook.hidecursor)();
+ m_color((long)WITH->color.backgr);
+ m_drawline((long)tx, ty - 7L, (long)tx, ty + 6L);
+ m_drawline(tx + 1L, ty - 7L, tx + 1L, ty + 4L);
+ if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+ m_color((long)scopecolor);
+ else
+ m_color((long)WITH->color.backgr);
+ m_drawline((long)tx, ty - 6L, (long)tx, ty + 3L);
+ if (flag)
+ m_color((long)scopecolor);
+ else
+ m_color((long)WITH->color.backgr);
+ m_drawline((long)tx, ty - 7L, tx + 2L, ty - 7L);
+ if (flag)
+ m_color((long)WITH->color.backgr);
+ else
+ m_color((long)scopecolor);
+ m_drawline((long)tx, ty + 4L, tx + 2L, ty + 4L);
+ WITH1->info = (na_long)(((long)WITH1->info + 1) % 13);
+ tx = 0;
+ ty = 0;
+ (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+ tx += (long)WITH1->info * 2 - 7;
+ m_color((long)scopescancolor);
+ m_drawline((long)tx, ty + 5L, (long)tx, ty + 6L);
+ (*WITH->hook.unhidecursor)();
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ }
+ }
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
+ (((long)(pin1->v == log_one)) << 1));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
+ (((long)(pin2->v == log_one)) << 2));
+ }
+ break;
+
+ case act_16_erase:
+ m_color((long)WITH->color.backgr);
+ tx = 0;
+ ty = 0;
+ (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+ m_fillrect(tx - 7L, ty - 7L, tx + 19L, ty + 6L);
+ break;
+
+ case act_16_reset:
+ WITH1->info = (na_long)0;
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ WITH->actflag = true;
+ break;
+
+ default:
+ break;
}
- if (pin2->v == log_one && (((unsigned long)WITH1->vars) & (1L << 2)) == 0) {
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 10)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
- }
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 0)) != 0 ||
- ((((unsigned long)WITH1->vars) & (1L << 1)) != 0) != flag);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 0));
- if (((((unsigned long)WITH1->vars) & (1L << 11)) == 0 ||
- (((unsigned long)WITH1->vars) & (1L << 8)) == 0) &&
- ((((unsigned long)WITH1->vars) & (1L << 12)) == 0 ||
- (((unsigned long)WITH1->vars) & (1L << 9)) == 0) &&
- ((((unsigned long)WITH1->vars) & (1L << 13)) == 0 ||
- (((unsigned long)WITH1->vars) & (1L << 10)) == 0) &&
- ((long)WITH1->info > 0 ||
- (pin2->v != log_zero &&
- (((unsigned long)WITH1->vars) & (1L << 2)) == 0))) {
-/* p2c: logsim.text, line 599:
- * Note: Line breaker spent 2.0 seconds, 5000 tries on line 650 [251] */
- tx = 0;
- ty = 0;
- (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
- tx += (long)WITH1->info * 2 - 7;
- (*WITH->hook.hidecursor)();
- m_color((long)WITH->color.backgr);
- m_drawline((long)tx, ty - 7L, (long)tx, ty + 6L);
- m_drawline(tx + 1L, ty - 7L, tx + 1L, ty + 4L);
- if ((((unsigned long)WITH1->vars) & (1L << 0)) != 0)
- m_color((long)scopecolor);
- else
- m_color((long)WITH->color.backgr);
- m_drawline((long)tx, ty - 6L, (long)tx, ty + 3L);
- if (flag)
- m_color((long)scopecolor);
- else
- m_color((long)WITH->color.backgr);
- m_drawline((long)tx, ty - 7L, tx + 2L, ty - 7L);
- if (flag)
- m_color((long)WITH->color.backgr);
- else
- m_color((long)scopecolor);
- m_drawline((long)tx, ty + 4L, tx + 2L, ty + 4L);
- WITH1->info = (na_long)(((long)WITH1->info + 1) % 13);
-/* p2c: logsim.text, line 566:
- * Note: Using % for possibly-negative arguments [317] */
- tx = 0;
- ty = 0;
- (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
- tx += (long)WITH1->info * 2 - 7;
- m_color((long)scopescancolor);
- m_drawline((long)tx, ty + 5L, (long)tx, ty + 6L);
- (*WITH->hook.unhidecursor)();
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- }
- }
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 1)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
- (((long)(pin1->v == log_one)) << 1));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) |
- (((long)(pin2->v == log_one)) << 2));
- }
- break;
-
- case act_16_erase:
- m_color((long)WITH->color.backgr);
- tx = 0;
- ty = 0;
- (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
- m_fillrect(tx - 7L, ty - 7L, tx + 19L, ty + 6L);
- break;
-
- case act_16_reset:
- WITH1->info = (na_long)0;
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actflag = true;
- break;
-
- default:
- break;
- }
}
/* Local variables for Log_16_7seg: */
-struct LOC_Log_16_7seg {
- log_16_action *act;
- na_strlist_t *l1;
+struct LOC_Log_16_7seg
+{
+ log_16_action *act;
+ na_strlist_t *l1;
} ;
-static void plotline(x1, y1, x2, y2, LINK)
-short x1, y1, x2, y2;
-struct LOC_Log_16_7seg *LINK;
+static void plotline(short x1, short y1, short x2, short y2, struct LOC_Log_16_7seg *LINK)
{
- char STR2[256];
+ char STR2[256];
- sprintf(STR2, "line %d %d %d %d", x1, y1, x2, y2);
- LINK->l1 = strlist_append(&LINK->act->lact->actstrlist, STR2);
+ sprintf(STR2, "line %d %d %d %d", x1, y1, x2, y2);
+ LINK->l1 = strlist_append(&LINK->act->lact->actstrlist, STR2);
}
-void Log_16_7seg(act_)
-log_16_action *act_;
+void Log_16_7seg(log_16_action *act_)
{
- struct LOC_Log_16_7seg V;
- short t1, tx, ty;
- log_action_t *WITH;
- log_grec *WITH1;
- int TEMP;
-
- V.act = act_;
- WITH = V.act->lact;
- WITH1 = WITH->actgate;
- switch (V.act->action) {
-
- case act_16_sim:
- if (((((unsigned long)WITH1->vars) & (1L << 2)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) ||
- ((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) ||
- ((((unsigned long)WITH1->vars) & (1L << 4)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) ||
- ((((unsigned long)WITH1->vars) & (1L << 5)) != 0) !=
- ((((unsigned long)WITH1->vars) & (1L << 9)) != 0)) {
-/* p2c: logsim.text, line 694:
- * Note: Line breaker spent 3.0 seconds, 5000 tries on line 758 [251] */
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 6)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 6));
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 3)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 7)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 7));
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
- TEMP = ((((unsigned long)WITH1->vars) & (1L << 5)) != 0);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
- }
- break;
-
- case act_16_draw:
- if (WITH->refrflag || (((unsigned long)WITH1->vars) & (1L << 0)) != 0) {
- (*WITH->hook.hidecursor)();
- tx = 0;
- ty = 0;
- (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
- m_color((long)WITH->color.backgr);
- m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
- m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
- m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
- m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
- m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
- m_color((long)ledoncolor);
- t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
- ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
- ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
- ((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
- m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
- m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
- m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
- m_drawline(tx - 5L, ty - 10L, tx - 5L, (long)ty);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
- m_drawline(tx - 5L, (long)ty, tx - 5L, ty + 10L);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
- m_drawline(tx + 5L, ty - 10L, tx + 5L, (long)ty);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
- m_drawline(tx + 5L, (long)ty, tx + 5L, ty + 10L);
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- (*WITH->hook.unhidecursor)();
- }
- break;
-
- case act_16_erase:
- tx = 0;
- ty = 0;
- (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
- m_color((long)WITH->color.backgr);
- m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
- m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
- m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
- m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
- m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actflag = true;
- else if (!strcmp(WITH->genfunc, "PLOT")) {
- V.l1 = strlist_append(&WITH->actstrlist, "color onled");
- tx = 0;
- ty = 0;
- (*WITH->hook2->plainxform)(WITH->actgate, &tx, &ty);
- t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
- ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
- ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
- ((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
- plotline(tx - 5, ty - 10, tx + 5, ty - 10, &V);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
- plotline(tx - 5, ty, tx + 5, ty, &V);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
- plotline(tx - 5, ty + 10, tx + 5, ty + 10, &V);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
- plotline(tx - 5, ty - 10, tx - 5, ty, &V);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
- plotline(tx - 5, ty, tx - 5, ty + 10, &V);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
- plotline(tx + 5, ty - 10, tx + 5, ty, &V);
- if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
- plotline(tx + 5, ty, tx + 5, ty + 10, &V);
- }
- break;
-
- default:
- break;
- }
+ struct LOC_Log_16_7seg V;
+ short t1, tx, ty;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ int TEMP;
+
+ V.act = act_;
+ WITH = V.act->lact;
+ WITH1 = WITH->actgate;
+ switch (V.act->action)
+ {
+ case act_16_sim:
+ if (((((unsigned long)WITH1->vars) & (1L << 2)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) ||
+ ((((unsigned long)WITH1->vars) & (1L << 3)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) ||
+ ((((unsigned long)WITH1->vars) & (1L << 4)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) ||
+ ((((unsigned long)WITH1->vars) & (1L << 5)) != 0) !=
+ ((((unsigned long)WITH1->vars) & (1L << 9)) != 0))
+ {
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 2)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 6)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 6));
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 3)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 7)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 7));
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 4)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 8)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 8));
+ TEMP = ((((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 9)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((long)TEMP) << 9));
+ }
+ break;
+
+ case act_16_draw:
+ if (WITH->refrflag || (((unsigned long)WITH1->vars) & (1L << 0)) != 0)
+ {
+ (*WITH->hook.hidecursor)();
+ tx = 0;
+ ty = 0;
+ (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+ m_color((long)WITH->color.backgr);
+ m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
+ m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
+ m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
+ m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
+ m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
+ m_color((long)ledoncolor);
+ t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
+ ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
+ ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
+ ((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
+ m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
+ m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
+ m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
+ m_drawline(tx - 5L, ty - 10L, tx - 5L, (long)ty);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
+ m_drawline(tx - 5L, (long)ty, tx - 5L, ty + 10L);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
+ m_drawline(tx + 5L, ty - 10L, tx + 5L, (long)ty);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
+ m_drawline(tx + 5L, (long)ty, tx + 5L, ty + 10L);
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ (*WITH->hook.unhidecursor)();
+ }
+ break;
+
+ case act_16_erase:
+ tx = 0;
+ ty = 0;
+ (*WITH->hook.xform)(WITH->actgate, &tx, &ty);
+ m_color((long)WITH->color.backgr);
+ m_drawline(tx - 5L, ty - 10L, tx + 5L, ty - 10L);
+ m_drawline(tx - 5L, (long)ty, tx + 5L, (long)ty);
+ m_drawline(tx - 5L, ty + 10L, tx + 5L, ty + 10L);
+ m_drawline(tx - 5L, ty - 10L, tx - 5L, ty + 10L);
+ m_drawline(tx + 5L, ty - 10L, tx + 5L, ty + 10L);
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ {
+ WITH->actflag = true;
+ }
+ else if (!strcmp(WITH->genfunc, "PLOT"))
+ {
+ V.l1 = strlist_append(&WITH->actstrlist, "color onled");
+ tx = 0;
+ ty = 0;
+ (*WITH->hook2->plainxform)(WITH->actgate, &tx, &ty);
+ t1 = ((((unsigned long)WITH1->vars) & (1L << 6)) != 0) * 8 +
+ ((((unsigned long)WITH1->vars) & (1L << 7)) != 0) * 4 +
+ ((((unsigned long)WITH1->vars) & (1L << 8)) != 0) * 2 +
+ ((((unsigned long)WITH1->vars) & (1L << 9)) != 0);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2812) == 0)
+ plotline(tx - 5, ty - 10, tx + 5, ty - 10, &V);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x1083) == 0)
+ plotline(tx - 5, ty, tx + 5, ty, &V);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x8492L) == 0)
+ plotline(tx - 5, ty + 10, tx + 5, ty + 10, &V);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x208e) == 0)
+ plotline(tx - 5, ty - 10, tx - 5, ty, &V);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0x2ba) == 0)
+ plotline(tx - 5, ty, tx - 5, ty + 10, &V);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd860L) == 0)
+ plotline(tx + 5, ty - 10, tx + 5, ty, &V);
+ if ((unsigned)t1 >= 32 || ((1L << t1) & 0xd004L) == 0)
+ plotline(tx + 5, ty, tx + 5, ty + 10, &V);
+ }
+ break;
+
+ default:
+ break;
+ }
}
-void Log_16_keypad(act)
-log_16_action *act;
+void Log_16_keypad(log_16_action *act)
{
- short x1, y1, n;
- log_action_t *WITH;
- log_grec *WITH1;
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_touch:
- x1 = (WITH->actx + 4) / 2;
- y1 = (WITH->acty + 4) / 2;
- switch (y1 * 10 + x1) {
-
- case 0:
- n = 7;
- break;
-
- case 1:
- n = 8;
- break;
-
- case 2:
- n = 9;
- break;
-
- case 3:
- n = 15;
- break;
-
- case 10:
- n = 4;
- break;
-
- case 11:
- n = 5;
- break;
-
- case 12:
- n = 6;
- break;
-
- case 13:
- n = 14;
- break;
-
- case 20:
- n = 1;
- break;
-
- case 21:
- n = 2;
- break;
-
- case 22:
- n = 3;
- break;
-
- case 23:
- n = 13;
- break;
-
- case 30:
- n = 0;
- break;
-
- case 31:
- n = 10;
- break;
-
- case 32:
- n = 11;
- break;
-
- case 33:
- n = 12;
- break;
-
- default:
- n = 0;
- break;
- }
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 8L) & 1) << 2));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 4L) & 1) << 3));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 4)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 2L) & 1) << 4));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 5)));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | ((n & 1L) << 5));
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
- WITH->actflag = true;
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT")) {
- WITH->actflag = true;
- strcpy(WITH->actstr, "KLMNP");
- } else if (!strcmp(WITH->genfunc, "CONSTPINS")) {
- makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
- makeconstpin(act, 2L, (((unsigned long)WITH1->vars) & (1L << 4)) != 0);
- makeconstpin(act, 3L, (((unsigned long)WITH1->vars) & (1L << 3)) != 0);
- makeconstpin(act, 4L, (((unsigned long)WITH1->vars) & (1L << 2)) != 0);
- makeconstpin(act, 5L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
- }
- break;
-
- default:
- break;
- }
+ short x1, y1, n;
+ log_action_t *WITH;
+ log_grec *WITH1;
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_touch:
+ x1 = (WITH->actx + 4) / 2;
+ y1 = (WITH->acty + 4) / 2;
+ switch (y1 * 10 + x1)
+ {
+ case 0:
+ n = 7;
+ break;
+
+ case 1:
+ n = 8;
+ break;
+
+ case 2:
+ n = 9;
+ break;
+
+ case 3:
+ n = 15;
+ break;
+
+ case 10:
+ n = 4;
+ break;
+
+ case 11:
+ n = 5;
+ break;
+
+ case 12:
+ n = 6;
+ break;
+
+ case 13:
+ n = 14;
+ break;
+
+ case 20:
+ n = 1;
+ break;
+
+ case 21:
+ n = 2;
+ break;
+
+ case 22:
+ n = 3;
+ break;
+
+ case 23:
+ n = 13;
+ break;
+
+ case 30:
+ n = 0;
+ break;
+
+ case 31:
+ n = 10;
+ break;
+
+ case 32:
+ n = 11;
+ break;
+
+ case 33:
+ n = 12;
+ break;
+
+ default:
+ n = 0;
+ break;
+ }
+
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 2)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 8L) & 1) << 2));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 3)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 4L) & 1) << 3));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 4)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (((n / 2L) & 1) << 4));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 5)));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | ((n & 1L) << 5));
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+ WITH->actflag = true;
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ {
+ WITH->actflag = true;
+ strcpy(WITH->actstr, "KLMNP");
+ }
+ else if (!strcmp(WITH->genfunc, "CONSTPINS"))
+ {
+ makeconstpin(act, 1L, (((unsigned long)WITH1->vars) & (1L << 5)) != 0);
+ makeconstpin(act, 2L, (((unsigned long)WITH1->vars) & (1L << 4)) != 0);
+ makeconstpin(act, 3L, (((unsigned long)WITH1->vars) & (1L << 3)) != 0);
+ makeconstpin(act, 4L, (((unsigned long)WITH1->vars) & (1L << 2)) != 0);
+ makeconstpin(act, 5L, (((unsigned long)WITH1->vars) & (1L << 0)) != 0);
+ }
+ break;
+
+ default:
+ break;
+ }
}
-
-
-
-
-
-
/* The following routines run the digital simulation. */
-static short digglowcol(n, nonecolor)
-log_nrec *n;
-short nonecolor;
+static short digglowcol(log_nrec *n, short nonecolor)
{
- short Result;
- nodeinfo *ni;
-
- ni = (nodeinfo *)n->info;
- switch (ni->v) {
+ short Result;
+ nodeinfo *ni;
- case log_none:
- Result = nonecolor;
- break;
-
- case log_zero:
- Result = ledoffcolor;
- break;
-
- case log_one:
- Result = ledoncolor;
- break;
- }
- return Result;
+ ni = (nodeinfo *)n->info;
+ switch (ni->v)
+ {
+ case log_none:
+ Result = nonecolor;
+ break;
+
+ case log_zero:
+ Result = ledoffcolor;
+ break;
+
+ case log_one:
+ Result = ledoncolor;
+ break;
+ }
+ return Result;
}
-static int digtrigger(n)
-log_nrec *n;
+static int digtrigger(log_nrec *n)
{
- int Result;
- nodeinfo *ni;
-
- ni = (nodeinfo *)n->info;
- Result = false;
- if ((ni->v00 == log_zero) && (ni->v == log_one))
- Result = true;
- return Result;
+ int Result;
+ nodeinfo *ni;
+
+ ni = (nodeinfo *)n->info;
+ Result = false;
+ if ((ni->v00 == log_zero) && (ni->v == log_one))
+ Result = true;
+ return Result;
}
-static void callallgates(kind)
-log_16_actionkinds kind;
+static void callallgates(log_16_actionkinds kind)
{
- short pg;
- log_grec *g, *saveactgate;
- log_action_t *WITH;
- short FORLIM;
- log_krec *WITH1;
-
- WITH = logsima_action.lact;
- saveactgate = WITH->actgate;
- FORLIM = WITH->numpages;
- for (pg = 0; pg < FORLIM; pg++) {
- g = WITH->gbase[pg];
- while (g != NULL) {
- WITH1 = g->kind;
- if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc) {
- WITH->actgate = g;
- callgate(kind);
- }
- g = g->next;
- }
- }
- WITH->actgate = saveactgate;
+ short pg;
+ log_grec *g, *saveactgate;
+ log_action_t *WITH;
+ short FORLIM;
+ log_krec *WITH1;
+
+ WITH = logsima_action.lact;
+ saveactgate = WITH->actgate;
+ FORLIM = WITH->numpages;
+ for (pg = 0; pg < FORLIM; pg++)
+ {
+ g = WITH->gbase[pg];
+ while (g != NULL)
+ {
+ WITH1 = g->kind;
+ if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc) {
+ WITH->actgate = g;
+ callgate(kind);
+ }
+ g = g->next;
+ }
+ }
+ WITH->actgate = saveactgate;
}
-static void callkind(kind)
-log_16_actionkinds kind;
+static void callkind(log_16_actionkinds kind)
{
- kindinfo *ki;
- log_grec *saveactgate;
- log_action_t *WITH;
- log_krec *WITH1;
-
- WITH = logsima_action.lact;
- WITH1 = WITH->actkind;
- saveactgate = WITH->actgate;
- WITH->actgate = (log_grec *)WITH->actkind;
- /*just to satisfy "with actgate^" statements*/
- logsima_action.action = kind;
- ki = (kindinfo *)WITH1->info;
- (*ki->kindproc)(&logsima_action);
- WITH->actgate = saveactgate;
+ kindinfo *ki;
+ log_grec *saveactgate;
+ log_action_t *WITH;
+ log_krec *WITH1;
+
+ WITH = logsima_action.lact;
+ WITH1 = WITH->actkind;
+ saveactgate = WITH->actgate;
+ WITH->actgate = (log_grec *)WITH->actkind;
+ /*just to satisfy "with actgate^" statements*/
+ logsima_action.action = kind;
+ ki = (kindinfo *)WITH1->info;
+ (*ki->kindproc)(&logsima_action);
+ WITH->actgate = saveactgate;
}
-static void callallkinds(kind)
-log_16_actionkinds kind;
+static void callallkinds(log_16_actionkinds kind)
{
- kindinfo *ki;
- log_krec *k;
- log_action_t *WITH;
-
- WITH = logsima_action.lact;
- k = kbase_16;
- while (k != NULL) {
- ki = (kindinfo *)k->info;
- if (ki->hasproc) {
- WITH->actkind = k;
- callkind(kind);
- }
- k = ki->knext;
- }
+ kindinfo *ki;
+ log_krec *k;
+ log_action_t *WITH;
+
+ WITH = logsima_action.lact;
+ k = kbase_16;
+ while (k != NULL)
+ {
+ ki = (kindinfo *)k->info;
+ if (ki->hasproc)
+ {
+ WITH->actkind = k;
+ callkind(kind);
+ }
+ k = ki->knext;
+ }
}
-static void pass_16(act)
-log_16_action *act;
+static void pass_16(log_16_action *act)
{
- short pg;
- log_grec *g;
- log_action_t *WITH;
- short FORLIM;
- log_krec *WITH1;
-
- WITH = act->lact;
- oldsystime = newsystime;
- newsystime = timers_sysclock();
- if (!passready || WITH->resetflag) {
- if (vddsig == NULL)
- (*WITH->hook.getsig)("Vdd", &vddsig);
- if (gndsig == NULL)
- (*WITH->hook.getsig)("Gnd", &gndsig);
- if (resetsig == NULL)
- (*WITH->hook.getsig)("Reset", &resetsig);
- if (WITH->resetflag) {
- callallgates(act_16_reset);
- resetcounter = 10;
- }
- if (WITH->pwrflag) {
- maketimebid = false;
- if (diggattr[digonoff - 1].UU.nv != 0) {
- (*WITH->hook.clearconflicts)(logsima_tool_16);
- clearnodes(WITH->nbase);
- if (vddsig->np->simtype == logsima_tool_16)
- log_16_output(act->lact, vddsig->np, log_one);
- if (gndsig->np->simtype == logsima_tool_16)
- log_16_output(act->lact, gndsig->np, log_zero);
- if (resetsig->np->simtype == logsima_tool_16)
- log_16_output(act->lact, resetsig->np,
- log_16_bv[(resetcounter > 0) - false]);
- FORLIM = WITH->numpages;
- for (pg = 0; pg < FORLIM; pg++)
- executegates(&maketimebid, WITH->gbase[pg]);
- nexttimebid = diggattr[digtimestep - 1].UU.r;
- }
- passready = maketimebid;
- }
- }
- if ( WITH->pwrflag && maketimebid )
- WITH->busyflag = true;
- if (maketimebid)
- logsima_tool_16->nexttstep = nexttimebid;
- if (stabilizing && (isstable || timers_sysclock() > stabtime))
- stabilizing = false;
- if (WITH->showpage > 0) {
- g = WITH->gbase[WITH->showpage - 1];
- while (g != NULL) {
- WITH1 = g->kind;
- if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc) {
- WITH->actgate = g;
- callgate(act_16_draw);
- }
- g = g->next;
- }
- }
- if (WITH->probenode != NULL && WITH->probenode->simtype == logsima_tool_16)
- WITH->baselinecolor = digglowcol(WITH->probenode, WITH->color.wire[0]);
+ short pg;
+ log_grec *g;
+ log_action_t *WITH;
+ short FORLIM;
+ log_krec *WITH1;
+
+ WITH = act->lact;
+ oldsystime = newsystime;
+ newsystime = timers_sysclock();
+ if (!passready || WITH->resetflag)
+ {
+ if (vddsig == NULL)
+ (*WITH->hook.getsig)("Vdd", &vddsig);
+ if (gndsig == NULL)
+ (*WITH->hook.getsig)("Gnd", &gndsig);
+ if (resetsig == NULL)
+ (*WITH->hook.getsig)("Reset", &resetsig);
+ if (WITH->resetflag)
+ {
+ callallgates(act_16_reset);
+ resetcounter = 10;
+ }
+ if (WITH->pwrflag)
+ {
+ maketimebid = false;
+ if (diggattr[digonoff - 1].UU.nv != 0)
+ {
+ (*WITH->hook.clearconflicts)(logsima_tool_16);
+ clearnodes(WITH->nbase);
+ if (vddsig->np->simtype == logsima_tool_16)
+ log_16_output(act->lact, vddsig->np, log_one);
+ if (gndsig->np->simtype == logsima_tool_16)
+ log_16_output(act->lact, gndsig->np, log_zero);
+ if (resetsig->np->simtype == logsima_tool_16)
+ log_16_output(act->lact, resetsig->np,
+ log_16_bv[(resetcounter > 0) - false]);
+ FORLIM = WITH->numpages;
+ for (pg = 0; pg < FORLIM; pg++)
+ executegates(&maketimebid, WITH->gbase[pg]);
+ nexttimebid = diggattr[digtimestep - 1].UU.r;
+ }
+ passready = maketimebid;
+ }
+ }
+ if ( WITH->pwrflag && maketimebid )
+ WITH->busyflag = true;
+ if (maketimebid)
+ logsima_tool_16->nexttstep = nexttimebid;
+ if (stabilizing && (isstable || timers_sysclock() > stabtime))
+ stabilizing = false;
+ if (WITH->showpage > 0)
+ {
+ g = WITH->gbase[WITH->showpage - 1];
+ while (g != NULL)
+ {
+ WITH1 = g->kind;
+ if (WITH1->simtype == logsima_tool_16 && ((kindinfo *)WITH1->info)->hasproc)
+ {
+ WITH->actgate = g;
+ callgate(act_16_draw);
+ }
+ g = g->next;
+ }
+ }
+ if (WITH->probenode != NULL && WITH->probenode->simtype == logsima_tool_16)
+ WITH->baselinecolor = digglowcol(WITH->probenode, WITH->color.wire[0]);
}
-
-static void tstep_16(act)
-log_16_action *act;
+static void tstep_16(log_16_action *act)
{
- log_nrec *n;
- nodeinfo *ni;
- int stable;
- log_action_t *WITH;
-
- WITH = act->lact;
- if (!WITH->actflag)
- return;
- stable = true;
- copynodes(WITH->nbase, &stable);
- if (stabilizing) {
- n = WITH->nbase;
- while (n != NULL) {
- if (n->simtype == logsima_tool_16 && P_rand(&WITH->rndseed, 5L) == 0) {
- ni = (nodeinfo *)n->info;
- ni->v = ni->v00;
- }
- n = n->next;
- }
- }
- isstable = stable;
- passready = false;
- if (resetcounter > 0)
- resetcounter--;
+ log_nrec *n;
+ nodeinfo *ni;
+ int stable;
+ log_action_t *WITH;
+
+ WITH = act->lact;
+ if (!WITH->actflag)
+ return;
+ stable = true;
+ copynodes(WITH->nbase, &stable);
+ if (stabilizing)
+ {
+ n = WITH->nbase;
+ while (n != NULL)
+ {
+ if (n->simtype == logsima_tool_16 && P_rand(&WITH->rndseed, 5L) == 0)
+ {
+ ni = (nodeinfo *)n->info;
+ ni->v = ni->v00;
+ }
+ n = n->next;
+ }
+ }
+ isstable = stable;
+ passready = false;
+ if (resetcounter > 0)
+ resetcounter--;
}
-
-
-
/* The following procedures are exported for the LOGSIMA module to use. */
-void log_16_conf(act, n)
-log_16_action *act;
-log_nrec *n;
+void log_16_conf(log_16_action *act, log_nrec *n)
{
- (*act->lact->hook.nodeconflict)(n);
+ (*act->lact->hook.nodeconflict)(n);
}
-void log_16_noprog(act)
-log_16_action *act;
+void log_16_noprog(log_16_action *act)
{
- char STR1[44];
-
- if (!noprogloaded) {
- sprintf(STR1, "No program loaded for digital gate %s",
- act->lact->actkind->name);
- (*act->lact->hook.message)(STR1);
- noprogloaded = true;
- }
+ char STR1[44];
+
+ if (!noprogloaded) {
+ sprintf(STR1, "No program loaded for digital gate %s",
+ act->lact->actkind->name);
+ (*act->lact->hook.message)(STR1);
+ noprogloaded = true;
+ }
}
-static void nullkindproc(act)
-log_16_action *act;
+static void nullkindproc(log_16_action *act)
{
- /* ignore all calls */
+ /* ignore all calls */
}
-
-
-
/* This procedure runs the "status" screen. */
-static void status_16(flag)
-int *flag;
+static void status_16(int *flag)
{
- char s[256];
- log_action_t *WITH;
-
- WITH = logsima_action.lact;
- nk_gotoxy(0, 4);
- (*WITH->hook.realunit)(nexttimebid, 4, "s", s);
- printf("Next time bid: %s\t\n", s);
- printf("Pass ready: %5s\n", passready ? "TRUE" : "FALSE");
- printf("Stabilizing: %5s\n", stabilizing ? "TRUE" : "FALSE");
- WITH->actflag = false;
+ char s[256];
+ log_action_t *WITH;
+
+ WITH = logsima_action.lact;
+ nk_gotoxy(0, 4);
+ (*WITH->hook.realunit)(nexttimebid, 4, "s", s);
+ printf("Next time bid: %s\t\n", s);
+ printf("Pass ready: %5s\n", passready ? "TRUE" : "FALSE");
+ printf("Stabilizing: %5s\n", stabilizing ? "TRUE" : "FALSE");
+ WITH->actflag = false;
}
-
-
/* These routines handle the simtype 16 interface to LOG. */
-static void parseicommand(lact)
-log_action_t *lact;
+static void parseicommand(log_action_t *lact)
{
- int flag;
- log_action_t *WITH;
-
- WITH = lact;
- if (!strcmp(WITH->func, "DIGON")) {
- (*WITH->hook.clearfunc)();
- diggattr[digonoff - 1].UU.nv = 1;
- (*WITH->hook.vmessage)("Digital simulation is ON");
- return;
- }
- if (!strcmp(WITH->func, "DIGOFF")) {
- (*WITH->hook.clearfunc)();
- diggattr[digonoff - 1].UU.nv = 0;
- (*WITH->hook.vmessage)("Digital simulation is OFF");
- return;
- }
- if (!strcmp(WITH->func, "DIGONOFF")) {
- flag = (diggattr[digonoff - 1].UU.nv != 0);
- (*WITH->hook.getbool)(WITH->funcarg, &flag);
- diggattr[digonoff - 1].UU.nv = flag;
- (*WITH->hook.clearfunc)();
- (*WITH->hook.vmessageflag)("Digital simulation is ",
- diggattr[digonoff - 1].UU.nv != 0);
- return;
- }
- if (!strcmp(WITH->func, "STABILIZE")) {
- (*WITH->hook.clearfunc)();
- stabtime = timers_sysclock() +
- (long)floor(diggattr[stabdelay - 1].UU.r * 100 + 0.5);
- stabilizing = true;
- return;
- }
- if (!strcmp(WITH->func, "DIGSTEP")) {
- (*WITH->hook.getreal)(WITH->funcarg, &diggattr[digtimestep - 1].UU.r,
- 1e-8);
- (*WITH->hook.clearfunc)();
- }
+ int flag;
+ log_action_t *WITH;
+
+ WITH = lact;
+ if (!strcmp(WITH->func, "DIGON"))
+ {
+ (*WITH->hook.clearfunc)();
+ diggattr[digonoff - 1].UU.nv = 1;
+ (*WITH->hook.vmessage)("Digital simulation is ON");
+ return;
+ }
+ if (!strcmp(WITH->func, "DIGOFF"))
+ {
+ (*WITH->hook.clearfunc)();
+ diggattr[digonoff - 1].UU.nv = 0;
+ (*WITH->hook.vmessage)("Digital simulation is OFF");
+ return;
+ }
+ if (!strcmp(WITH->func, "DIGONOFF"))
+ {
+ flag = (diggattr[digonoff - 1].UU.nv != 0);
+ (*WITH->hook.getbool)(WITH->funcarg, &flag);
+ diggattr[digonoff - 1].UU.nv = flag;
+ (*WITH->hook.clearfunc)();
+ (*WITH->hook.vmessageflag)("Digital simulation is ",
+ diggattr[digonoff - 1].UU.nv != 0);
+ return;
+ }
+ if (!strcmp(WITH->func, "STABILIZE"))
+ {
+ (*WITH->hook.clearfunc)();
+ stabtime = timers_sysclock() +
+ (long)floor(diggattr[stabdelay - 1].UU.r * 100 + 0.5);
+ stabilizing = true;
+ return;
+ }
+ if (!strcmp(WITH->func, "DIGSTEP"))
+ {
+ (*WITH->hook.getreal)(WITH->funcarg, &diggattr[digtimestep - 1].UU.r,
+ 1e-8);
+ (*WITH->hook.clearfunc)();
+ }
}
-static void parsecommand(lact)
-log_action_t *lact;
+static void parsecommand(log_action_t *lact)
{
- log_action_t *WITH;
+ log_action_t *WITH;
- WITH = lact;
- if (!strcmp(WITH->func, "STABDELAY")) {
- (*WITH->hook.getreal)(WITH->funcarg, &diggattr[stabdelay - 1].UU.r, 5.0);
- (*WITH->hook.clearfunc)();
- }
+ WITH = lact;
+ if (!strcmp(WITH->func, "STABDELAY"))
+ {
+ (*WITH->hook.getreal)(WITH->funcarg, &diggattr[stabdelay - 1].UU.r, 5.0);
+ (*WITH->hook.clearfunc)();
+ }
}
-static char *log_action_tkinds_NAMES[] = {
- "ACT_INIT", "ACT_ENDINIT", "ACT_EXIT", "ACT_CLEARMSG", "ACT_STATUS",
- "ACT_CNF", "ACT_IMMED", "ACT_FUNC", "ACT_COLOR", "ACT_SELECT", "ACT_CLEAR",
- "ACT_EDIT", "ACT_PASS", "ACT_TSTEP", "ACT_ERASEGATE", "ACT_TOUCHGATE",
- "ACT_HISTORY", "ACT_HISTVAL", "ACT_HISTSTR", "ACT_TRIGGER", "ACT_GLOWCOL",
- "ACT_NEWGATE", "ACT_DISPOSEGATE", "ACT_COPYGATE", "ACT_WRITEGATE",
- "ACT_READGATE", "ACT_CONNECTGATE", "ACT_DISCONNECTGATE", "ACT_CONFIGGATE",
- "ACT_CONFIGCHGATE", "ACT_CONFIGRELGATE", "ACT_CONFIGNODE",
- "ACT_CONFIGCHNODE", "ACT_CONFIGRELNODE", "ACT_CONFIGHIST",
- "ACT_CONFIGCHHIST", "ACT_CONFIGRELHIST", "ACT_NEWKIND", "ACT_DISPOSEKIND",
- "ACT_NEWNODE", "ACT_DISPOSENODE", "ACT_COPYNODE", "ACT_COMBINENODES",
- "ACT_COMBINEINTONODE", "ACT_WRITENODE", "ACT_READNODE", "ACT_REFNODES",
- "ACT_NODEVAL", "ACT_GENERAL", "ACT_GENNODE", "ACT_GENKIND", "ACT_GENGATE"
+static char *log_action_tkinds_NAMES[] =
+{
+ "ACT_INIT", "ACT_ENDINIT", "ACT_EXIT", "ACT_CLEARMSG", "ACT_STATUS",
+ "ACT_CNF", "ACT_IMMED", "ACT_FUNC", "ACT_COLOR", "ACT_SELECT", "ACT_CLEAR",
+ "ACT_EDIT", "ACT_PASS", "ACT_TSTEP", "ACT_ERASEGATE", "ACT_TOUCHGATE",
+ "ACT_HISTORY", "ACT_HISTVAL", "ACT_HISTSTR", "ACT_TRIGGER", "ACT_GLOWCOL",
+ "ACT_NEWGATE", "ACT_DISPOSEGATE", "ACT_COPYGATE", "ACT_WRITEGATE",
+ "ACT_READGATE", "ACT_CONNECTGATE", "ACT_DISCONNECTGATE", "ACT_CONFIGGATE",
+ "ACT_CONFIGCHGATE", "ACT_CONFIGRELGATE", "ACT_CONFIGNODE",
+ "ACT_CONFIGCHNODE", "ACT_CONFIGRELNODE", "ACT_CONFIGHIST",
+ "ACT_CONFIGCHHIST", "ACT_CONFIGRELHIST", "ACT_NEWKIND", "ACT_DISPOSEKIND",
+ "ACT_NEWNODE", "ACT_DISPOSENODE", "ACT_COPYNODE", "ACT_COMBINENODES",
+ "ACT_COMBINEINTONODE", "ACT_WRITENODE", "ACT_READNODE", "ACT_REFNODES",
+ "ACT_NODEVAL", "ACT_GENERAL", "ACT_GENNODE", "ACT_GENKIND", "ACT_GENGATE"
} ;
-static char *actionname(Result, action)
-char *Result;
-log_actionkinds action;
+static char *actionname(char *Result, log_actionkinds action)
{
- long i;
- char s[33];
-
-/* p2c: logsim.text, line 1069: Note:
- * Line breaker spent 0.0+2.00 seconds, 5000 tries on line 1304 [251] */
- strcpy(s, log_action_tkinds_NAMES[(long)action]);
- i = strlen(s) + 1;
- s[i - 1] = '\0';
-/* p2c: logsim.text, line 1070:
- * Note: Modification of string length may translate incorrectly [146] */
- return strcpy(Result, s);
+ long i;
+ char s[33];
+
+ strcpy(s, log_action_tkinds_NAMES[(long)action]);
+ i = strlen(s) + 1;
+ s[i - 1] = '\0';
+ return strcpy(Result, s);
}
-static void showgatepins(g)
-log_grec *g;
+static void showgatepins(log_grec *g)
{
- short i, FORLIM;
- char STR1[256];
-
- FORLIM = g->kind->numpins;
- for (i = 1; i <= FORLIM; i++) {
- sprintf(STR1, "%d", i);
- (*logsima_action.lact->hook2->showpinname)(g, i,
- logsima_action.lact->color.backgr, STR1);
- }
- FORLIM = g->kind->numpins;
- for (i = 1; i <= FORLIM; i++) {
- sprintf(STR1, "%d", i);
- (*logsima_action.lact->hook2->showpinname)(g, i,
- logsima_action.lact->color.pinnum, STR1);
- }
+ short i, FORLIM;
+ char STR1[256];
+
+ FORLIM = g->kind->numpins;
+ for (i = 1; i <= FORLIM; i++)
+ {
+ sprintf(STR1, "%d", i);
+ (*logsima_action.lact->hook2->showpinname)(g, i,
+ logsima_action.lact->color.backgr, STR1);
+ }
+ FORLIM = g->kind->numpins;
+ for (i = 1; i <= FORLIM; i++)
+ {
+ sprintf(STR1, "%d", i);
+ (*logsima_action.lact->hook2->showpinname)(g, i,
+ logsima_action.lact->color.pinnum, STR1);
+ }
}
-static void newnode_16(lact, n)
-log_action_t *lact;
-log_nrec **n;
+static void newnode_16(log_action_t *lact,log_nrec ** n)
{
- log_action_t *WITH;
+ log_action_t *WITH;
- WITH = lact;
- (*WITH->hook.newnode)(n, log_16_simtype);
- (*n)->keep = true;
- (*n)->ref = 1;
+ WITH = lact;
+ (*WITH->hook.newnode)(n, log_16_simtype);
+ (*n)->keep = true;
+ (*n)->ref = 1;
}
-static void disposenode_16(lact, n)
-log_action_t *lact;
-log_nrec **n;
+static void disposenode_16(log_action_t *lact, log_nrec **n)
{
- log_action_t *WITH;
+ log_action_t *WITH;
- WITH = lact;
- (*n)->keep = false;
- (*WITH->hook.switchnode)(n, NULL);
+ WITH = lact;
+ (*n)->keep = false;
+ (*WITH->hook.switchnode)(n, NULL);
}
@@ -1445,17 +1427,18 @@ static void digproc1()
static void digproc2()
{
- log_gattrrec *WITH;
+ log_gattrrec *WITH;
- WITH = &diggattr[logsima_action.lact->actx - 1];
- switch (logsima_action.lact->actx) {
+ WITH = &diggattr[logsima_action.lact->actx - 1];
+ switch (logsima_action.lact->actx)
+ {
- case 1:
- case 2:
- if (WITH->UU.r <= 0)
- logsima_action.lact->actflag = false;
- break;
- }
+ case 1:
+ case 2:
+ if (WITH->UU.r <= 0)
+ logsima_action.lact->actflag = false;
+ break;
+ }
}
@@ -1466,502 +1449,523 @@ static void digproc3()
/* Local variables for Log_16_proc: */
struct LOC_Log_16_proc {
- kindinfo *ki;
+ kindinfo *ki;
} ;
-static void setupkindproc(LINK)
-struct LOC_Log_16_proc *LINK;
+static void setupkindproc(struct LOC_Log_16_proc *LINK)
{
- short pc, i, len;
- char procname[256];
- log_krec *WITH;
-
- WITH = logsima_action.lact->actkind;
- pc = 1;
- while (WITH->proc[pc - 1] != '\0' && WITH->proc[pc - 1] != '\022')
- pc++;
- if (WITH->proc[pc - 1] != '\022') {
- LINK->ki->hasproc = false;
- LINK->ki->kindproc = nullkindproc;
- return;
- }
- pc += 2;
- len = WITH->proc[pc - 1] - 128;
- procname[len] = '\0';
-/* p2c: logsim.text, line 1155:
- * Note: Modification of string length may translate incorrectly [146] */
- for (i = 0; i < len; i++)
- procname[i] = WITH->proc[pc + i];
- LINK->ki->hasproc = newci_findprocedure(procname,
- (void(**) ())(&LINK->ki->kindproc));
- if (!LINK->ki->hasproc)
- LINK->ki->kindproc = log_16_noprog;
+ short pc, i, len;
+ char procname[256];
+ log_krec *WITH;
+
+ WITH = logsima_action.lact->actkind;
+ pc = 1;
+ while (WITH->proc[pc - 1] != '\0' && WITH->proc[pc - 1] != '\022')
+ pc++;
+ if (WITH->proc[pc - 1] != '\022')
+ {
+ LINK->ki->hasproc = false;
+ LINK->ki->kindproc = nullkindproc;
+ return;
+ }
+ pc += 2;
+ len = WITH->proc[pc - 1] - 128;
+ procname[len] = '\0';
+ for (i = 0; i < len; i++)
+ procname[i] = WITH->proc[pc + i];
+ LINK->ki->hasproc = newci_findprocedure(procname,
+ (void(**) ())(&LINK->ki->kindproc));
+ if (!LINK->ki->hasproc)
+ LINK->ki->kindproc = log_16_noprog;
}
-void Log_16_proc(lact)
-log_action_t *lact;
+void Log_16_proc(log_action_t *lact)
{
- struct LOC_Log_16_proc V;
- nodeinfo *ni, *ni2;
- log_krec *k2;
- gateinfo *gi, *gi2;
- na_strlist_t *l1;
- short i;
- double val1, val2;
- char STR1[33];
- char STR2[46];
- char STR3[40];
- log_action_t *WITH;
- void (*TEMP) ();
- void (*TEMP1) ();
- void (*TEMP2) ();
- short FORLIM;
-
- logsima_action.lact = lact;
- if (lact->traceflag && traceactions && ((unsigned long)lact->action >= 32 ||
- ((1L << ((long)lact->action)) &
- ((1L << ((long)act_pass)) | (1L << ((long)act_tstep)))) == 0)) {
- sprintf(STR2, "log_16 gets %s", actionname(STR1, lact->action));
- (*lact->hook.trace)(STR2);
- }
- WITH = lact;
- switch (WITH->action) {
-
- case act_init:
- logsima_tool_16 = WITH->acttool;
- WITH->acttool->ready = true;
- WITH->acttool->simulator = true;
- strcpy(WITH->acttool->shortname, "Digital");
- if (*WITH->acttool->comment == '\0')
- strcpy(WITH->acttool->comment, "Digital simulator");
- logsima_init();
- WITH->rndseed = timers_sysclock();
- newsystime = 0;
- vddsig = NULL;
- gndsig = NULL;
- resetsig = NULL;
- resetcounter = 0;
- isstable = false;
- stabilizing = false;
- passready = false;
- maketimebid = false;
- noprogloaded = false;
- kbase_16 = NULL;
- logsima_action.hook_input = log_16_input;
- logsima_action.hook_output = log_16_output;
- logsima_action.hook_ocoutput = log_16_ocoutput;
- logsima_action.hook_led = log_16_led;
- logsima_action.hook_eraled = log_16_eraled;
- logsima_action.hook_plotled = log_16_plotled;
- l1 = strlist_append(&WITH->acttool->hlbl, "Digital signal trace");
- l1 = strlist_append(&WITH->acttool->hlbl, "");
- l1 = strlist_append(&WITH->acttool->hlbl,
- "2VCyan,Orange,Yellow,Pink,Green,Red,White,Medium Red,Light Gray,Dark Cyan,Dark Yellow,Dark Red:Color:");
- l1 = strlist_append(&WITH->acttool->hlbl, "BY:Phosphor visible:");
- l1 = strlist_append(&WITH->acttool->hlbl, "");
- l1 = strlist_append(&WITH->acttool->hlbl, "R.8:Signal height:");
- strlist_init(&diglbl);
- l1 = strlist_append(&diglbl, "Digital simulator");
- l1 = strlist_append(&diglbl, "");
- l1 = strlist_append(&diglbl, "Us,10ns:Timestep:");
- l1 = strlist_append(&diglbl, "");
- l1 = strlist_append(&diglbl, "2R5:Stabilize time:");
- l1 = strlist_append(&diglbl, "");
- l1 = strlist_append(&diglbl, "1VOff,On:Digital simulation:");
- (*WITH->hook.parselabel)(&diglbl, &dignumattrs, &digkattr);
- (*WITH->hook.newattrs)(&diggattr, dignumattrs, digkattr);
- break;
-
- case act_clearmsg:
- noprogloaded = false;
- break;
-
- case act_immed:
- parseicommand(lact);
- if (*lact->func != '\0')
- callallkinds(act_16_immed);
- break;
-
- case act_func:
- parsecommand(lact);
- if (*lact->func != '\0')
- callallkinds(act_16_func);
- break;
-
- case act_cnf:
- parsecommand(lact);
- if (*lact->func != '\0')
- callallkinds(act_16_cnf);
- break;
-
- case act_select:
- TEMP = digproc1;
- TEMP1 = digproc2;
- TEMP2 = digproc3;
- (*WITH->hook.editattrs)(diggattr, dignumattrs, digkattr, diglbl,
- "Digital", TEMP, TEMP1, TEMP2);
- break;
-
- case act_status:
- status_16(&WITH->actflag);
- break;
-
- case act_color:
- backgrcolor = WITH->color.backgr;
- (*WITH->hook.getcolor)("ONLED", &ledoncolor, log_red);
- (*WITH->hook.getcolor)("OFFLED", &ledoffcolor, log_black);
- (*WITH->hook.getcolor)("SCOPE", &scopecolor, log_yellow);
- (*WITH->hook.getcolor)("SCOPESCAN", &scopescancolor, log_white);
- break;
-
- case act_newkind:
- V.ki = (kindinfo *)Malloc(sizeof(kindinfo));
- V.ki->info = NULL;
- V.ki->numppins = 0;
- V.ki->numpvars = 0;
- if (WITH->actkind->proc[0] == '\027') {
- V.ki->instance = true;
- if (WITH->actkind->proc[1] > '"')
- V.ki->numppins = (WITH->actkind->proc[3] - 32) * 128 +
- WITH->actkind->proc[2] - 64;
- if (WITH->actkind->proc[1] > '$')
- V.ki->numpvars = (WITH->actkind->proc[5] - 32) * 128 +
- WITH->actkind->proc[4] - 64;
- } else
- V.ki->instance = false;
- setupkindproc(&V);
- V.ki->knext = kbase_16;
- kbase_16 = WITH->actkind;
- WITH->actkind->info = (void *)V.ki;
- callkind(act_16_newkind);
- break;
-
- case act_disposekind:
- V.ki = (kindinfo *)WITH->actkind->info;
- if (WITH->actkind == kbase_16)
- kbase_16 = ((kindinfo *)kbase_16->info)->knext;
- else {
- k2 = kbase_16;
- while (k2 != NULL && ((kindinfo *)k2->info)->knext != WITH->actkind)
- k2 = ((kindinfo *)k2->info)->knext;
- if (k2 != NULL)
- ((kindinfo *)k2->info)->knext = V.ki->knext;
- }
- callkind(act_16_disposekind);
- Free(V.ki);
- break;
-
- case act_edit:
- switch (WITH->acty) {
-
- case 0:
- edit_16(&WITH->actproc, &WITH->actx, WITH->actstr);
- break;
-
- case 1:
- case 2:
- dump_16(&WITH->actproc, &WITH->actstrlist, WITH->acty == 1);
- break;
-
- case 3:
- read_16(&WITH->actproc, &WITH->actx, WITH->actstrlist);
- break;
- }
- break;
-
- case act_pass:
- pass_16(&logsima_action);
- break;
-
- case act_tstep:
- tstep_16(&logsima_action);
- break;
-
- case act_erasegate:
- callgate(act_16_erase);
- break;
-
- case act_glowcol:
- WITH->actx = digglowcol(WITH->actnode, (int)WITH->actx);
- break;
-
- case act_trigger:
- WITH->actflag = digtrigger(WITH->actnode);
- break;
-
- case act_history:
- case act_nodeval:
- ni = (nodeinfo *)WITH->actnode->info;
- if (ni->v == ni->v00 || logsima_tool_16->deltatime == 0.0 || !WITH->pwrflag) {
- switch (ni->v00) {
-
- case log_none:
- WITH->actval = 0.0;
- break;
-
- case log_zero:
- WITH->actval = -0.5;
- break;
-
- case log_one:
- WITH->actval = 0.5;
- break;
- }
- } else {
- switch (ni->v) {
-
- case log_none:
- val1 = 0.0;
- break;
-
- case log_zero:
- val1 = -0.5;
- break;
-
- case log_one:
- val1 = 0.5;
- break;
- }
- switch (ni->v00) {
-
- case log_none:
- val2 = 0.0;
- break;
-
- case log_zero:
- val2 = -0.5;
- break;
-
- case log_one:
- val2 = 0.5;
- break;
- }
- WITH->actval = val2 +
- (val1 - val2) * logsima_tool_16->deltatime / nexttimebid;
- }
- if (WITH->action == act_nodeval)
- WITH->actval += 0.5;
- break;
-
- case act_histval:
- WITH->actval *= WITH->actgattr[histsize - 1].UU.r;
- if (!WITH->actgattr[histvis - 1].UU.b)
- WITH->acty = -1;
- else
- WITH->acty = histcolortable[WITH->actgattr[histcolor - 1].UU.nv];
- break;
-
- case act_histstr:
- if ((unsigned long)WITH->acty < 32 && ((1L << WITH->acty) & 0x6) != 0 &&
- WITH->actval > -1 && WITH->actval < 1) {
- if (WITH->actval > 0.2)
- strcpy(WITH->actstr, "One");
- else if (WITH->actval < -0.2)
- strcpy(WITH->actstr, "Zero");
- else
- strcpy(WITH->actstr, "Not driven");
- }
- break;
-
- case act_touchgate:
- callgate(act_16_touch);
- break;
-
- case act_newgate:
- V.ki = (kindinfo *)WITH->actgate->kind->info;
- if (V.ki->instance) {
- gi = (gateinfo *)Malloc(sizeof(gateinfo));
- gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
-
- /* code initializing ppins should go here */
-
- gi->pvars = (char *)Malloc((long)V.ki->numpvars);
- if (V.ki->numpvars != 0)
- memset((void *)gi->pvars, 0, (long)V.ki->numpvars);
- WITH->actgate->info = (void *)gi;
-
- }
- callgate(act_16_new);
- break;
-
- case act_disposegate:
- V.ki = (kindinfo *)WITH->actgate->kind->info;
- if (V.ki->instance) {
- gi = (gateinfo *)WITH->actgate->info;
-
- /* code disposing ppins should go here */
-
- Free(gi->ppins);
- Free(gi->pvars);
- Free(gi);
- }
- callgate(act_16_dispose);
- break;
-
- case act_copygate:
- V.ki = (kindinfo *)WITH->actgate->kind->info;
- if (V.ki->instance) {
- gi = (gateinfo *)Malloc(sizeof(gateinfo));
- gi2 = (gateinfo *)WITH->actgate2->info;
- gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
-
- /* code initializing ppins should go here */
-
- gi->pvars = (char *)Malloc((long)V.ki->numpvars);
- if (V.ki->numpvars != 0)
- memmove((void *)gi2->pvars, (void *)gi->pvars, (long)V.ki->numpvars);
- WITH->actgate->info = (void *)gi;
- }
- callgate(act_16_copy);
- break;
-
- case act_writegate:
- callgate(act_16_write);
- break;
-
- case act_readgate:
- callgate(act_16_read);
- break;
-
- case act_connectgate:
- callgate(act_16_connect);
- V.ki = (kindinfo *)WITH->actgate->kind->info;
- if (V.ki->instance) {
- gi = (gateinfo *)WITH->actgate->info;
- FORLIM = V.ki->numppins;
- for (i = 0; i < FORLIM; i++) /*this calls Log_16_proc recursively*/
- newnode_16(lact, &gi->ppins[i]);
- }
- break;
-
- case act_disconnectgate:
- callgate(act_16_disconnect);
- V.ki = (kindinfo *)WITH->actgate->kind->info;
- if (V.ki->instance) {
- gi = (gateinfo *)WITH->actgate->info;
- FORLIM = V.ki->numppins;
- for (i = 0; i < FORLIM; i++) /*this calls Log_16_proc recursively*/
- disposenode_16(lact, &gi->ppins[i]);
- }
- break;
-
- case act_configgate:
- callgate(act_16_configgate);
- break;
-
- case act_configchgate:
- callgate(act_16_configchgate);
- break;
-
- case act_configrelgate:
- callgate(act_16_configrelgate);
- break;
-
- case act_configchhist:
- /* blank case */
- break;
-
- case act_newnode:
- ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
- WITH->actnode->info = (void *)ni;
- ni->v = log_none;
- ni->v0 = log_none;
- ni->v00 = log_none;
- ni->defv = log_none;
- ni->truev = log_none;
- break;
-
- case act_disposenode:
- ni = (nodeinfo *)WITH->actnode->info;
- Free(ni);
- break;
-
- case act_copynode:
- ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
- ni2 = (nodeinfo *)WITH->actnode2->info;
- *ni = *ni2;
- WITH->actnode->info = (void *)ni;
- break;
-
- case act_combineintonode:
- /* blank case */
- break;
-
- case act_combinenodes:
- ni = (nodeinfo *)WITH->actnode->info;
- ni2 = (nodeinfo *)WITH->actnode2->info;
- ni->v = bcomb[(long)ni->v - (long)log_none][(long)ni2->v - (long)log_none];
- ni->v00 = ni->v;
- break;
-
- case act_writenode:
- ni = (nodeinfo *)WITH->actnode->info;
- fprintf(*WITH->actfile, "%d\n", (int)ni->v);
- break;
-
- case act_readnode:
- ni = (nodeinfo *)WITH->actnode->info;
- fscanf(*WITH->actfile, "%hd%*[^\n]", &i);
- getc(*WITH->actfile);
- ni->v = log_16_iv[i];
- ni->v00 = ni->v;
- break;
-
- case act_refnodes:
- callallgates(act_16_refnodes);
- break;
-
- case act_general:
- /* blank case */
- break;
-
- /* nothing to do */
- case act_gennode:
- break;
-
- /* nothing to do */
- case act_genkind:
- if (WITH->actkind == NULL)
- callallkinds(act_16_genkind);
- else if (!strcmp(WITH->genfunc, "DUMPKIND")) {
- callkind(act_16_genkind);
- if (WITH->actstrlist == NULL) {
- sprintf(STR3, "Definition for digital gate %s:", WITH->actkind->name);
- l1 = strlist_insert(&WITH->actstrlist, STR3);
- dump_16(&WITH->actkind->proc, &l1->next, true);
- }
- } else
- callkind(act_16_genkind);
- break;
-
- case act_gengate: /*ignore*/
- if (WITH->actgate == NULL)
- callallgates(act_16_gengate);
- else if (!strcmp(WITH->genfunc, "SHOWPINS")) {
- callgate(act_16_gengate);
- if (!WITH->actflag) {
- showgatepins(WITH->actgate);
- WITH->actflag = true;
- }
- } else
- callgate(act_16_gengate);
- break;
-
- default:
- break;
- }
+ struct LOC_Log_16_proc V;
+ nodeinfo *ni, *ni2;
+ log_krec *k2;
+ gateinfo *gi, *gi2;
+ na_strlist_t *l1;
+ short i;
+ double val1, val2;
+ char STR1[33];
+ char STR2[46];
+ char STR3[40];
+ log_action_t *WITH;
+ void (*TEMP) ();
+ void (*TEMP1) ();
+ void (*TEMP2) ();
+ short FORLIM;
+
+ logsima_action.lact = lact;
+ if (lact->traceflag && traceactions && ((unsigned long)lact->action >= 32 ||
+ ((1L << ((long)lact->action)) &
+ ((1L << ((long)act_pass)) | (1L << ((long)act_tstep)))) == 0))
+ {
+ sprintf(STR2, "log_16 gets %s", actionname(STR1, lact->action));
+ (*lact->hook.trace)(STR2);
+ }
+ WITH = lact;
+ switch (WITH->action)
+ {
+
+ case act_init:
+ logsima_tool_16 = WITH->acttool;
+ WITH->acttool->ready = true;
+ WITH->acttool->simulator = true;
+ strcpy(WITH->acttool->shortname, "Digital");
+ if (*WITH->acttool->comment == '\0')
+ strcpy(WITH->acttool->comment, "Digital simulator");
+ logsima_init();
+ WITH->rndseed = timers_sysclock();
+ newsystime = 0;
+ vddsig = NULL;
+ gndsig = NULL;
+ resetsig = NULL;
+ resetcounter = 0;
+ isstable = false;
+ stabilizing = false;
+ passready = false;
+ maketimebid = false;
+ noprogloaded = false;
+ kbase_16 = NULL;
+ logsima_action.hook_input = log_16_input;
+ logsima_action.hook_output = log_16_output;
+ logsima_action.hook_ocoutput = log_16_ocoutput;
+ logsima_action.hook_led = log_16_led;
+ logsima_action.hook_eraled = log_16_eraled;
+ logsima_action.hook_plotled = log_16_plotled;
+ l1 = strlist_append(&WITH->acttool->hlbl, "Digital signal trace");
+ l1 = strlist_append(&WITH->acttool->hlbl, "");
+ l1 = strlist_append(&WITH->acttool->hlbl,
+ "2VCyan,Orange,Yellow,Pink,Green,Red,White,Medium Red,Light Gray,Dark Cyan,Dark Yellow,Dark Red:Color:");
+ l1 = strlist_append(&WITH->acttool->hlbl, "BY:Phosphor visible:");
+ l1 = strlist_append(&WITH->acttool->hlbl, "");
+ l1 = strlist_append(&WITH->acttool->hlbl, "R.8:Signal height:");
+ strlist_init(&diglbl);
+ l1 = strlist_append(&diglbl, "Digital simulator");
+ l1 = strlist_append(&diglbl, "");
+ l1 = strlist_append(&diglbl, "Us,10ns:Timestep:");
+ l1 = strlist_append(&diglbl, "");
+ l1 = strlist_append(&diglbl, "2R5:Stabilize time:");
+ l1 = strlist_append(&diglbl, "");
+ l1 = strlist_append(&diglbl, "1VOff,On:Digital simulation:");
+ (*WITH->hook.parselabel)(&diglbl, &dignumattrs, &digkattr);
+ (*WITH->hook.newattrs)(&diggattr, dignumattrs, digkattr);
+ break;
+
+ case act_clearmsg:
+ noprogloaded = false;
+ break;
+
+ case act_immed:
+ parseicommand(lact);
+ if (*lact->func != '\0')
+ callallkinds(act_16_immed);
+ break;
+
+ case act_func:
+ parsecommand(lact);
+ if (*lact->func != '\0')
+ callallkinds(act_16_func);
+ break;
+
+ case act_cnf:
+ parsecommand(lact);
+ if (*lact->func != '\0')
+ callallkinds(act_16_cnf);
+ break;
+
+ case act_select:
+ TEMP = digproc1;
+ TEMP1 = digproc2;
+ TEMP2 = digproc3;
+ (*WITH->hook.editattrs)(diggattr, dignumattrs, digkattr, diglbl,
+ "Digital", TEMP, TEMP1, TEMP2);
+ break;
+
+ case act_status:
+ status_16(&WITH->actflag);
+ break;
+
+ case act_color:
+ backgrcolor = WITH->color.backgr;
+ (*WITH->hook.getcolor)("ONLED", &ledoncolor, log_red);
+ (*WITH->hook.getcolor)("OFFLED", &ledoffcolor, log_black);
+ (*WITH->hook.getcolor)("SCOPE", &scopecolor, log_yellow);
+ (*WITH->hook.getcolor)("SCOPESCAN", &scopescancolor, log_white);
+ break;
+
+ case act_newkind:
+ V.ki = (kindinfo *)Malloc(sizeof(kindinfo));
+ V.ki->info = NULL;
+ V.ki->numppins = 0;
+ V.ki->numpvars = 0;
+ if (WITH->actkind->proc[0] == '\027')
+ {
+ V.ki->instance = true;
+ if (WITH->actkind->proc[1] > '"')
+ V.ki->numppins = (WITH->actkind->proc[3] - 32) * 128 +
+ WITH->actkind->proc[2] - 64;
+ if (WITH->actkind->proc[1] > '$')
+ V.ki->numpvars = (WITH->actkind->proc[5] - 32) * 128 +
+ WITH->actkind->proc[4] - 64;
+ }
+ else
+ {
+ V.ki->instance = false;
+ }
+ setupkindproc(&V);
+ V.ki->knext = kbase_16;
+ kbase_16 = WITH->actkind;
+ WITH->actkind->info = (void *)V.ki;
+ callkind(act_16_newkind);
+ break;
+
+ case act_disposekind:
+ V.ki = (kindinfo *)WITH->actkind->info;
+ if (WITH->actkind == kbase_16)
+ {
+ kbase_16 = ((kindinfo *)kbase_16->info)->knext;
+ }
+ else
+ {
+ k2 = kbase_16;
+ while (k2 != NULL && ((kindinfo *)k2->info)->knext != WITH->actkind)
+ k2 = ((kindinfo *)k2->info)->knext;
+ if (k2 != NULL)
+ ((kindinfo *)k2->info)->knext = V.ki->knext;
+ }
+ callkind(act_16_disposekind);
+ Free(V.ki);
+ break;
+
+ case act_edit:
+ switch (WITH->acty)
+ {
+ case 0:
+ edit_16(&WITH->actproc, &WITH->actx, WITH->actstr);
+ break;
+
+ case 1:
+ case 2:
+ dump_16(&WITH->actproc, &WITH->actstrlist, WITH->acty == 1);
+ break;
+
+ case 3:
+ read_16(&WITH->actproc, &WITH->actx, WITH->actstrlist);
+ break;
+ }
+ break;
+
+ case act_pass:
+ pass_16(&logsima_action);
+ break;
+
+ case act_tstep:
+ tstep_16(&logsima_action);
+ break;
+
+ case act_erasegate:
+ callgate(act_16_erase);
+ break;
+
+ case act_glowcol:
+ WITH->actx = digglowcol(WITH->actnode, (int)WITH->actx);
+ break;
+
+ case act_trigger:
+ WITH->actflag = digtrigger(WITH->actnode);
+ break;
+
+ case act_history:
+ case act_nodeval:
+ ni = (nodeinfo *)WITH->actnode->info;
+ if (ni->v == ni->v00 || logsima_tool_16->deltatime == 0.0 || !WITH->pwrflag)
+ {
+ switch (ni->v00)
+ {
+ case log_none:
+ WITH->actval = 0.0;
+ break;
+
+ case log_zero:
+ WITH->actval = -0.5;
+ break;
+
+ case log_one:
+ WITH->actval = 0.5;
+ break;
+ }
+ }
+ else
+ {
+ switch (ni->v)
+ {
+ case log_none:
+ val1 = 0.0;
+ break;
+
+ case log_zero:
+ val1 = -0.5;
+ break;
+
+ case log_one:
+ val1 = 0.5;
+ break;
+ }
+ switch (ni->v00)
+ {
+
+ case log_none:
+ val2 = 0.0;
+ break;
+
+ case log_zero:
+ val2 = -0.5;
+ break;
+
+ case log_one:
+ val2 = 0.5;
+ break;
+ }
+ WITH->actval = val2 +
+ (val1 - val2) * logsima_tool_16->deltatime / nexttimebid;
+ }
+ if (WITH->action == act_nodeval)
+ WITH->actval += 0.5;
+ break;
+
+ case act_histval:
+ WITH->actval *= WITH->actgattr[histsize - 1].UU.r;
+ if (!WITH->actgattr[histvis - 1].UU.b)
+ WITH->acty = -1;
+ else
+ WITH->acty = histcolortable[WITH->actgattr[histcolor - 1].UU.nv];
+ break;
+
+ case act_histstr:
+ if ((unsigned long)WITH->acty < 32 && ((1L << WITH->acty) & 0x6) != 0 &&
+ WITH->actval > -1 && WITH->actval < 1)
+ {
+ if (WITH->actval > 0.2)
+ strcpy(WITH->actstr, "One");
+ else if (WITH->actval < -0.2)
+ strcpy(WITH->actstr, "Zero");
+ else
+ strcpy(WITH->actstr, "Not driven");
+ }
+ break;
+
+ case act_touchgate:
+ callgate(act_16_touch);
+ break;
+
+ case act_newgate:
+ V.ki = (kindinfo *)WITH->actgate->kind->info;
+ if (V.ki->instance)
+ {
+ gi = (gateinfo *)Malloc(sizeof(gateinfo));
+ gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
+
+ /* code initializing ppins should go here */
+
+ gi->pvars = (char *)Malloc((long)V.ki->numpvars);
+ if (V.ki->numpvars != 0)
+ memset((void *)gi->pvars, 0, (long)V.ki->numpvars);
+ WITH->actgate->info = (void *)gi;
+
+ }
+ callgate(act_16_new);
+ break;
+
+ case act_disposegate:
+ V.ki = (kindinfo *)WITH->actgate->kind->info;
+ if (V.ki->instance)
+ {
+ gi = (gateinfo *)WITH->actgate->info;
+
+ /* code disposing ppins should go here */
+
+ Free(gi->ppins);
+ Free(gi->pvars);
+ Free(gi);
+ }
+ callgate(act_16_dispose);
+ break;
+
+ case act_copygate:
+ V.ki = (kindinfo *)WITH->actgate->kind->info;
+ if (V.ki->instance)
+ {
+ gi = (gateinfo *)Malloc(sizeof(gateinfo));
+ gi2 = (gateinfo *)WITH->actgate2->info;
+ gi->ppins = (log_nrec **)Malloc(V.ki->numppins * sizeof(log_nrec *));
+
+ /* code initializing ppins should go here */
+
+ gi->pvars = (char *)Malloc((long)V.ki->numpvars);
+ if (V.ki->numpvars != 0)
+ memmove((void *)gi2->pvars, (void *)gi->pvars, (long)V.ki->numpvars);
+ WITH->actgate->info = (void *)gi;
+ }
+ callgate(act_16_copy);
+ break;
+
+ case act_writegate:
+ callgate(act_16_write);
+ break;
+
+ case act_readgate:
+ callgate(act_16_read);
+ break;
+
+ case act_connectgate:
+ callgate(act_16_connect);
+ V.ki = (kindinfo *)WITH->actgate->kind->info;
+ if (V.ki->instance)
+ {
+ gi = (gateinfo *)WITH->actgate->info;
+ FORLIM = V.ki->numppins;
+ for (i = 0; i < FORLIM; i++) /*this calls Log_16_proc recursively*/
+ newnode_16(lact, &gi->ppins[i]);
+ }
+ break;
+
+ case act_disconnectgate:
+ callgate(act_16_disconnect);
+ V.ki = (kindinfo *)WITH->actgate->kind->info;
+ if (V.ki->instance)
+ {
+ gi = (gateinfo *)WITH->actgate->info;
+ FORLIM = V.ki->numppins;
+ for (i = 0; i < FORLIM; i++) /*this calls Log_16_proc recursively*/
+ disposenode_16(lact, &gi->ppins[i]);
+ }
+ break;
+
+ case act_configgate:
+ callgate(act_16_configgate);
+ break;
+
+ case act_configchgate:
+ callgate(act_16_configchgate);
+ break;
+
+ case act_configrelgate:
+ callgate(act_16_configrelgate);
+ break;
+
+ case act_configchhist:
+ /* blank case */
+ break;
+
+ case act_newnode:
+ ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
+ WITH->actnode->info = (void *)ni;
+ ni->v = log_none;
+ ni->v0 = log_none;
+ ni->v00 = log_none;
+ ni->defv = log_none;
+ ni->truev = log_none;
+ break;
+
+ case act_disposenode:
+ ni = (nodeinfo *)WITH->actnode->info;
+ Free(ni);
+ break;
+
+ case act_copynode:
+ ni = (nodeinfo *)Malloc(sizeof(nodeinfo));
+ ni2 = (nodeinfo *)WITH->actnode2->info;
+ *ni = *ni2;
+ WITH->actnode->info = (void *)ni;
+ break;
+
+ case act_combineintonode:
+ /* blank case */
+ break;
+
+ case act_combinenodes:
+ ni = (nodeinfo *)WITH->actnode->info;
+ ni2 = (nodeinfo *)WITH->actnode2->info;
+ ni->v = bcomb[(long)ni->v - (long)log_none][(long)ni2->v - (long)log_none];
+ ni->v00 = ni->v;
+ break;
+
+ case act_writenode:
+ ni = (nodeinfo *)WITH->actnode->info;
+ fprintf(*WITH->actfile, "%d\n", (int)ni->v);
+ break;
+
+ case act_readnode:
+ ni = (nodeinfo *)WITH->actnode->info;
+ fscanf(*WITH->actfile, "%hd%*[^\n]", &i);
+ getc(*WITH->actfile);
+ ni->v = log_16_iv[i];
+ ni->v00 = ni->v;
+ break;
+
+ case act_refnodes:
+ callallgates(act_16_refnodes);
+ break;
+
+ case act_general:
+ /* blank case */
+ break;
+
+ /* nothing to do */
+ case act_gennode:
+ break;
+
+ /* nothing to do */
+ case act_genkind:
+ if (WITH->actkind == NULL)
+ {
+ callallkinds(act_16_genkind);
+ }
+ else if (!strcmp(WITH->genfunc, "DUMPKIND"))
+ {
+ callkind(act_16_genkind);
+ if (WITH->actstrlist == NULL)
+ {
+ sprintf(STR3, "Definition for digital gate %s:", WITH->actkind->name);
+ l1 = strlist_insert(&WITH->actstrlist, STR3);
+ dump_16(&WITH->actkind->proc, &l1->next, true);
+ }
+ }
+ else
+ {
+ callkind(act_16_genkind);
+ }
+ break;
+
+ case act_gengate: /*ignore*/
+ if (WITH->actgate == NULL)
+ {
+ callallgates(act_16_gengate);
+ }
+ else if (!strcmp(WITH->genfunc, "SHOWPINS"))
+ {
+ callgate(act_16_gengate);
+ if (!WITH->actflag)
+ {
+ showgatepins(WITH->actgate);
+ WITH->actflag = true;
+ }
+ }
+ else
+ {
+ callgate(act_16_gengate);
+ }
+ break;
+
+ default:
+ break;
+ }
}
-
-
-
-
-
-
-
-
-
/* End. */
diff --git a/log/src/logsimasm.c b/log/src/logsimasm.c
index 754a8043bef1611b343575beb946dde8c46f0653..eea138a42db8eb21028617bb52326f4f89cb9a38 100644
--- a/log/src/logsimasm.c
+++ b/log/src/logsimasm.c
@@ -7,18 +7,18 @@
Copyright (C) 1985, 1990 John Lazzaro.
Author's address: lazzaro@csvax.caltech.edu; 256-80 Caltech.
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation (any version).
+ This program is free software; you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation (any version).
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
-GNU General Public License for more details.
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
-You should have received a copy of the GNU General Public License
-along with this program; see the file COPYING. If not, write to
-the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+ You should have received a copy of the GNU General Public License
+ along with this program; see the file COPYING. If not, write to
+ the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
/* C equivalent code for the assembly-language portions of logsim.
@@ -50,61 +50,63 @@ static void (*callcache[255-32])(log_16_action *); /* first 32 are unused */
-static void nullproc_16(act)
-log_16_action *act;
+static void nullproc_16(log_16_action *act)
{
- /* do nothing */
+ /* do nothing */
}
void logsima_init()
{
- callcache[0] = nullproc_16;
- callcache_next = 33;
+ callcache[0] = nullproc_16;
+ callcache_next = 33;
}
-void clearnodes(n)
-register log_nrec *n;
+void clearnodes(log_nrec *n)
{
- register log_tool *tool16 = logsima_action.lact->acttool;
- register nodeinfo *nip;
-
- while (n) {
- if (n->simtype == tool16) {
- nip = (nodeinfo *)n->info;
- nip->v0 = nip->defv = log_none;
- }
- n = n->next;
- }
+ register log_tool *tool16 = logsima_action.lact->acttool;
+ register nodeinfo *nip;
+
+ while (n)
+ {
+ if (n->simtype == tool16)
+ {
+ nip = (nodeinfo *)n->info;
+ nip->v0 = nip->defv = log_none;
+ }
+ n = n->next;
+ }
}
-void copynodes(n, stable)
-register log_nrec *n;
-int *stable;
+void copynodes(log_nrec *n, int *stable)
{
- register log_tool *tool16 = logsima_action.lact->acttool;
- register nodeinfo *nip;
- register int st = *stable;
- register log_16_value newv;
-
- while (n) {
- if (n->simtype == tool16) {
- nip = (nodeinfo *)n->info;
- if ((nip->truev = newv = nip->v0) == log_none)
- newv = nip->defv;
- if (TRACE_COPY) printf("Setting node %x to %d\n", (unsigned int)nip, newv);
- if (newv != (nip->v00 = nip->v)) {
- nip->v = newv;
- st = false;
- n->changed = true;
- }
- }
- n = n->next;
- }
- *stable = st;
+ register log_tool *tool16 = logsima_action.lact->acttool;
+ register nodeinfo *nip;
+ register int st = *stable;
+ register log_16_value newv;
+
+ while (n)
+ {
+ if (n->simtype == tool16)
+ {
+ nip = (nodeinfo *)n->info;
+ if ((nip->truev = newv = nip->v0) == log_none)
+ newv = nip->defv;
+ if (TRACE_COPY)
+ printf("Setting node %x to %d\n", (unsigned int)nip, newv);
+ if (newv != (nip->v00 = nip->v))
+ {
+ nip->v = newv;
+ st = false;
+ n->changed = true;
+ }
+ }
+ n = n->next;
+ }
+ *stable = st;
}
@@ -116,96 +118,101 @@ static log_nrec **g_pins;
static gateinfo *g_info;
-static void processcall(action)
-log_16_actionkinds action;
+static void processcall(log_16_actionkinds action)
{
- uchar num;
- int len;
- char namebuf[256];
- void (*myproc)(log_16_action *);
-
- logsima_action.action = action;
- logsima_action.lact->actkind = logsima_action.lact->actgate->kind;
- num = *g_proc++;
- len = (*g_proc++) - 128;
- if (num < 255) {
- (*callcache[num - 32])(&logsima_action);
- } else {
- namebuf[len] = 0;
- strncpy(namebuf, (char *)g_proc, len);
- if (findprocedure(namebuf, (void(**)())(&myproc))) {
- if (callcache_next < 254) {
- num = g_proc[-2] = callcache_next++;
- callcache[num - 32] = myproc;
- }
- (*myproc)(&logsima_action);
- } else {
- printf("Could not resolve %s\n", namebuf);
- g_proc[-2] = 32;
- log_16_noprog(&logsima_action);
- }
- }
-
-
- g_proc += len;
+ uchar num;
+ int len;
+ char namebuf[256];
+ void (*myproc)(log_16_action *);
+
+ logsima_action.action = action;
+ logsima_action.lact->actkind = logsima_action.lact->actgate->kind;
+ num = *g_proc++;
+ len = (*g_proc++) - 128;
+ if (num < 255)
+ {
+ (*callcache[num - 32])(&logsima_action);
+ }
+ else
+ {
+ namebuf[len] = 0;
+ strncpy(namebuf, (char *)g_proc, len);
+ if (findprocedure(namebuf, (void(**)())(&myproc)))
+ {
+ if (callcache_next < 254)
+ {
+ num = g_proc[-2] = callcache_next++;
+ callcache[num - 32] = myproc;
+ }
+ (*myproc)(&logsima_action);
+ }
+ else
+ {
+ printf("Could not resolve %s\n", namebuf);
+ g_proc[-2] = 32;
+ log_16_noprog(&logsima_action);
+ }
+ }
+
+ g_proc += len;
}
-void callgate(action)
-log_16_actionkinds action;
+void callgate(log_16_actionkinds action)
{
- uchar *save_proc = g_proc;
- log_krec *kind;
- kindinfo *kip;
-
- kind = logsima_action.lact->actgate->kind;
- g_proc = kind->proc;
- kip = kind->info;
- if (kip->hasproc) {
- while (*g_proc) {
- if (*g_proc++ == 0x12)
- processcall(action);
- }
- }
- g_proc = save_proc;
+ uchar *save_proc = g_proc;
+ log_krec *kind;
+ kindinfo *kip;
+
+ kind = logsima_action.lact->actgate->kind;
+ g_proc = kind->proc;
+ kip = kind->info;
+ if (kip->hasproc)
+ {
+ while (*g_proc)
+ {
+ if (*g_proc++ == 0x12)
+ processcall(action);
+ }
+ }
+ g_proc = save_proc;
}
-static void record_conflict(np)
-log_nrec *np;
+static void record_conflict(log_nrec *np)
{
- (*logsima_action.lact->hook.nodeconflict)(np);
+ (*logsima_action.lact->hook.nodeconflict)(np);
}
#define REGMASK(n) (0x8000 >> (n))
#define case16(n) case n+0: case n+1: case n+2: case n+3: \
- case n+4: case n+5: case n+6: case n+7: \
- case n+8: case n+9: case n+10: case n+11: \
- case n+12: case n+13: case n+14: case n+15
+ case n+4: case n+5: case n+6: case n+7: \
+ case n+8: case n+9: case n+10: case n+11: \
+ case n+12: case n+13: case n+14: case n+15
static int and_table[3][3] = { { log_none, log_zero, log_one },
- { log_zero, log_zero, log_zero },
- { log_one, log_zero, log_one } };
+ { log_zero, log_zero, log_zero },
+ { log_one, log_zero, log_one } };
static int nand_table[3][3] = { { log_none, log_one, log_zero },
- { log_one, log_one, log_one },
- { log_zero, log_one, log_zero } };
+ { log_one, log_one, log_one },
+ { log_zero, log_one, log_zero } };
static int or_table[3][3] = { { log_none, log_zero, log_one },
- { log_zero, log_zero, log_one },
- { log_one, log_one, log_one } };
+ { log_zero, log_zero, log_one },
+ { log_one, log_one, log_one } };
static int nor_table[3][3] = { { log_none, log_one, log_zero },
- { log_one, log_one, log_zero },
- { log_zero, log_zero, log_zero } };
+ { log_one, log_one, log_zero },
+ { log_zero, log_zero, log_zero } };
static int xor_table[3][3] = { { log_none, log_zero, log_one },
- { log_zero, log_zero, log_one },
- { log_one, log_one, log_zero } };
+ { log_zero, log_zero, log_one },
+ { log_one, log_one, log_zero } };
static int not_table[3] = { log_none, log_one, log_zero };
static int fix_table[3] = { log_zero, log_zero, log_one };
@@ -214,468 +221,477 @@ static int fix_table[3] = { log_zero, log_zero, log_one };
static char *debug_dasm()
{
#define SAFETY_MARGIN 256
- long pc = 1;
- static char *buf;
- char *tmp = NULL;
- int pc2 = 0;
-
- if (buf) {
- Free(buf);
- buf = NULL;
- }
- if (*g_proc) {
- tmp = (char*)dasm_16(g_proc, &pc);
- buf = (char*)Malloc(strlen(tmp) + SAFETY_MARGIN);
- strcpy(buf, "\"");
- strcat(buf, tmp);
- strcat(buf, "\" <");
- Free(tmp);
- pc--;
- } else {
- buf = (char*)Malloc(SAFETY_MARGIN);
- strcpy(buf, "\"<");
- }
-
- while (pc2 < pc && pc2 < 8) {
- sprintf(buf + strlen(buf), "%s%.2x", (pc2 > 0) ? " " : "", g_proc[pc2]);
- pc2++;
- }
- if (pc2 < pc)
- strcat(buf, "...");
- strcat(buf, ">");
- return buf;
+ long pc = 1;
+ static char *buf;
+ char *tmp = NULL;
+ int pc2 = 0;
+
+ if (buf)
+ {
+ Free(buf);
+ buf = NULL;
+ }
+ if (*g_proc)
+ {
+ tmp = (char*)dasm_16(g_proc, &pc);
+ buf = (char*)Malloc(strlen(tmp) + SAFETY_MARGIN);
+ strcpy(buf, "\"");
+ strcat(buf, tmp);
+ strcat(buf, "\" <");
+ Free(tmp);
+ pc--;
+ }
+ else
+ {
+ buf = (char*)Malloc(SAFETY_MARGIN);
+ strcpy(buf, "\"<");
+ }
+
+ while (pc2 < pc && pc2 < 8)
+ {
+ sprintf(buf + strlen(buf), "%s%.2x", (pc2 > 0) ? " " : "", g_proc[pc2]);
+ pc2++;
+ }
+ if (pc2 < pc)
+ strcat(buf, "...");
+ strcat(buf, ">");
+ return buf;
}
static log_nrec *g_pinnum()
{
- register uchar ch;
-
- if (TRACE_OPS) printf("g_pinnum: %s\n", debug_dasm());
- switch ((ch = *g_proc++)) {
+ register uchar ch;
- case 0xab: /* internal node */
- ch = *g_proc++;
- if (ch < 128)
- return g_info->ppins[ch - 64];
- else
- return g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
+ if (TRACE_OPS) printf("g_pinnum: %s\n", debug_dasm());
+ switch ((ch = *g_proc++))
+ {
+ case 0xab: /* internal node */
+ ch = *g_proc++;
+ if (ch < 128)
+ return g_info->ppins[ch - 64];
+ else
+ return g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
- case 0xb0: /* high pin */
- return g_pins[*g_proc++];
+ case 0xb0: /* high pin */
+ return g_pins[*g_proc++];
- case16(0xc0): /* pin */
- case16(0xd0):
- return g_pins[ch & 0x1f];
+ case16(0xc0): /* pin */
+ case16(0xd0):
+ return g_pins[ch & 0x1f];
- default: /* Undefined op codes */
- return NULL;
+ default: /* Undefined op codes */
+ return NULL;
- }
+ }
}
static log_16_value g_expr()
{
- register uchar ch;
- register nodeinfo *nip;
-
- if (TRACE_OPS) printf("g_expr: %s\n", debug_dasm());
- switch ((ch = *g_proc++)) {
-
- case 0xa0: /* AND */
- ch = (int)g_expr();
- return and_table[ch][(int)g_expr()];
-
- case 0xa1: /* NAND */
- ch = (int)g_expr();
- return nand_table[ch][(int)g_expr()];
-
- case 0xa2: /* OR */
- ch = (int)g_expr();
- return or_table[ch][(int)g_expr()];
-
- case 0xa3: /* NOR */
- ch = (int)g_expr();
- return nor_table[ch][(int)g_expr()];
-
- case 0xa4: /* XOR */
- ch = (int)g_expr();
- return xor_table[ch][(int)g_expr()];
-
- case 0xa5: /* NOT */
- return not_table[(int)g_expr()];
-
- case 0xa6: /* RISE */
- nip = g_pinnum()->info;
- return (nip->v == log_one && nip->v00 == log_zero) ? log_one : log_zero;
-
- case 0xa7: /* FALL */
- nip = g_pinnum()->info;
- return (nip->v == log_zero && nip->v00 == log_one) ? log_one : log_zero;
-
- case 0xa8: /* ZERO */
- return log_zero;
-
- case 0xa9: /* ONE */
- return log_one;
-
- case 0xaa: /* SAME */
- nip = g_pinnum()->info;
- return (g_pinnum()->info == nip) ? log_one : log_zero;
-
- case 0xab: /* internal node */
- ch = *g_proc++;
- if (ch < 128)
- nip = g_info->ppins[ch - 64]->info;
- else
- nip = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)]->info;
- return nip->v;
-
- case 0xac: /* pvar */
- ch = *g_proc++;
- if (ch < 128)
- return g_info->pvars[ch - 64] ? log_one : log_zero;
- else
- return g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)]
- ? log_one : log_zero;
-
- case 0xad: /* FIX */
- return fix_table[(int)g_expr()];
-
- case 0xb0: /* high pin */
- nip = g_pins[*g_proc++]->info;
- if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
- return nip->v;
-
- case 0xb1: /* STRONG */
- nip = g_pinnum()->info;
- return nip->truev;
-
- case16(0xc0): /* pin */
- case16(0xd0):
- nip = g_pins[ch & 0x1f]->info;
- if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
- return nip->v;
-
- case16(0xe0): /* var */
- if (TRACE_VAL) printf(" Value of %c is %d\n",
- 'A' + (ch % 0x0f),
- (g_vars & REGMASK(ch & 0x0f)) != 0);
- return (g_vars & REGMASK(ch & 0x0f)) ? log_one : log_zero;
-
- case16(0xf0): /* NOT var */
- if (TRACE_VAL) printf(" Value of %c is %d\n",
- 'A' + (ch % 0x0f),
- (g_vars & REGMASK(ch & 0x0f)) != 0);
- return (g_vars & REGMASK(ch & 0x0f)) ? log_zero : log_one;
-
- default: /* Undefined op codes */
- return log_none;
-
- }
+ register uchar ch;
+ register nodeinfo *nip;
+
+ if (TRACE_OPS) printf("g_expr: %s\n", debug_dasm());
+ switch ((ch = *g_proc++))
+ {
+ case 0xa0: /* AND */
+ ch = (int)g_expr();
+ return and_table[ch][(int)g_expr()];
+
+ case 0xa1: /* NAND */
+ ch = (int)g_expr();
+ return nand_table[ch][(int)g_expr()];
+
+ case 0xa2: /* OR */
+ ch = (int)g_expr();
+ return or_table[ch][(int)g_expr()];
+
+ case 0xa3: /* NOR */
+ ch = (int)g_expr();
+ return nor_table[ch][(int)g_expr()];
+
+ case 0xa4: /* XOR */
+ ch = (int)g_expr();
+ return xor_table[ch][(int)g_expr()];
+
+ case 0xa5: /* NOT */
+ return not_table[(int)g_expr()];
+
+ case 0xa6: /* RISE */
+ nip = g_pinnum()->info;
+ return (nip->v == log_one && nip->v00 == log_zero) ? log_one : log_zero;
+
+ case 0xa7: /* FALL */
+ nip = g_pinnum()->info;
+ return (nip->v == log_zero && nip->v00 == log_one) ? log_one : log_zero;
+
+ case 0xa8: /* ZERO */
+ return log_zero;
+
+ case 0xa9: /* ONE */
+ return log_one;
+
+ case 0xaa: /* SAME */
+ nip = g_pinnum()->info;
+ return (g_pinnum()->info == nip) ? log_one : log_zero;
+
+ case 0xab: /* internal node */
+ ch = *g_proc++;
+ if (ch < 128)
+ nip = g_info->ppins[ch - 64]->info;
+ else
+ nip = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)]->info;
+ return nip->v;
+
+ case 0xac: /* pvar */
+ ch = *g_proc++;
+ if (ch < 128)
+ return g_info->pvars[ch - 64] ? log_one : log_zero;
+ else
+ return g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)]
+ ? log_one : log_zero;
+
+ case 0xad: /* FIX */
+ return fix_table[(int)g_expr()];
+
+ case 0xb0: /* high pin */
+ nip = g_pins[*g_proc++]->info;
+ if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
+ return nip->v;
+
+ case 0xb1: /* STRONG */
+ nip = g_pinnum()->info;
+ return nip->truev;
+
+ case16(0xc0): /* pin */
+ case16(0xd0):
+ nip = g_pins[ch & 0x1f]->info;
+ if (TRACE_VAL) printf(" Value of %x is %d\n", (unsigned int)nip, (int)nip->v - 1);
+ return nip->v;
+
+ case16(0xe0): /* var */
+ if (TRACE_VAL) printf(" Value of %c is %d\n",
+ 'A' + (ch % 0x0f),
+ (g_vars & REGMASK(ch & 0x0f)) != 0);
+ return (g_vars & REGMASK(ch & 0x0f)) ? log_one : log_zero;
+
+ case16(0xf0): /* NOT var */
+ if (TRACE_VAL) printf(" Value of %c is %d\n",
+ 'A' + (ch % 0x0f),
+ (g_vars & REGMASK(ch & 0x0f)) != 0);
+ return (g_vars & REGMASK(ch & 0x0f)) ? log_zero : log_one;
+
+ default: /* Undefined op codes */
+ return log_none;
+
+ }
}
static void g_stmts()
{
- register uchar ch, ch2;
- register int temp;
- register log_nrec *np;
- register nodeinfo *nip;
-
- for (;;) {
- if (TRACE_OPS) printf("g_stmts: %s\n", debug_dasm());
- switch ((ch = *g_proc++)) {
-
- case 0x00: /* end-of-procedure */
- return;
-
- case 0x01: /* NOP */
- break;
-
- case 0x02: /* END (of IF statement) */
- break;
-
- case 0x03: /* IF */
- if (g_expr() != log_zero)
- break;
-
- /* fall through */
- case 0x09: case 0x0a: case 0x0b:
- case 0x0c: case 0x0d: case 0x0e:
- case 0x0f: /* ELSE */
- if_skip:
- if (TRACE_OPS) printf("Skipping...\n");
- temp = 0;
- for (;;) {
- while (*g_proc++ > 0x0f) ;
- ch = g_proc[-1];
- if (ch == 0x02) { /* END */
- if (--temp < 0)
- break;
- } else if (ch == 0x0f) { /* ELSE */
- if (!temp)
- break;
- } else if (ch > 0x02) { /* nested IF */
- temp++;
- } else if (ch == 0) {
- return; /* mismatched IF/END's */
+ register uchar ch, ch2;
+ register int temp;
+ register log_nrec *np;
+ register nodeinfo *nip;
+
+ for (;;)
+ {
+ if (TRACE_OPS) printf("g_stmts: %s\n", debug_dasm());
+ switch ((ch = *g_proc++))
+ {
+ case 0x00: /* end-of-procedure */
+ return;
+
+ case 0x01: /* NOP */
+ break;
+
+ case 0x02: /* END (of IF statement) */
+ break;
+
+ case 0x03: /* IF */
+ if (g_expr() != log_zero)
+ break;
+
+ /* fall through */
+ case 0x09: case 0x0a: case 0x0b:
+ case 0x0c: case 0x0d: case 0x0e:
+ case 0x0f: /* ELSE */
+if_skip:
+ if (TRACE_OPS) printf("Skipping...\n");
+ temp = 0;
+ for (;;)
+ {
+ while (*g_proc++ > 0x0f) ;
+ ch = g_proc[-1];
+ if (ch == 0x02) { /* END */
+ if (--temp < 0)
+ break;
+ }
+ else if (ch == 0x0f) { /* ELSE */
+ if (!temp)
+ break;
+ }
+ else if (ch > 0x02) { /* nested IF */
+ temp++;
+ }
+ else if (ch == 0)
+ {
+ return; /* mismatched IF/END's */
+ }
+ }
+ break;
+
+ case 0x04: /* IFNONE */
+ if (g_expr() == log_none)
+ break;
+ goto if_skip;
+
+ case 0x05: /* IFZERO */
+ if (g_expr() == log_zero)
+ break;
+ goto if_skip;
+
+ case 0x06: /* IFONE */
+ if (g_expr() == log_one)
+ break;
+ goto if_skip;
+
+ case 0x07: /* IFCONN */
+ if (g_expr() != log_none)
+ break;
+ goto if_skip;
+
+ case 0x08: /* IFZN */
+ if (g_expr() != log_one)
+ break;
+ goto if_skip;
+
+ case 0x10: /* Output to internal node */
+ ch = *g_proc++;
+ if (ch < 128)
+ np = g_info->ppins[ch - 64];
+ else
+ np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
+ goto out_node;
+
+ case 0x11: /* O.C. output to internal node */
+ ch = *g_proc++;
+ if (ch < 128)
+ np = g_info->ppins[ch - 64];
+ else
+ np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
+ goto oc_out_node;
+
+ case 0x12: /* CALL */
+ g_gate->vars = (na_long)g_vars;
+ logsima_action.lact->actgate = g_gate;
+ processcall(act_16_sim);
+ g_vars = (long)g_gate->vars;
+ break;
+
+ case 0x16: /* Comment */
+ g_proc += *g_proc - 31;
+ break;
+
+ case 0x17: /* INST */
+ g_proc += *g_proc - 33;
+ break;
+
+ case 0x18: /* pvar = x */
+ ch = *g_proc++;
+ if (ch < 128)
+ g_info->pvars[ch - 64] = (g_expr() != log_zero);
+ else {
+ ch2 = *g_proc++;
+ g_info->pvars[ch + (ch2 << 7) - (32*128+64)] =
+ (g_expr() != log_zero);
+ }
+ break;
+
+ case 0x19: /* pvar = NOT pvar */
+ ch = *g_proc++;
+ if (ch < 128)
+ g_info->pvars[ch - 64] ^= 1;
+ else
+ g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] ^= 1;
+ break;
+
+ case 0x1a: /* pvar = ZERO */
+ ch = *g_proc++;
+ if (ch < 128)
+ g_info->pvars[ch - 64] = 0;
+ else
+ g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 0;
+ break;
+
+ case 0x1b: /* pvar = ONE */
+ ch = *g_proc++;
+ if (ch < 128)
+ g_info->pvars[ch - 64] = 1;
+ else
+ g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 1;
+ break;
+
+ case 0x1c: /* PULLDN */
+ np = g_pinnum();
+ nip = np->info;
+ if (nip->defv == log_one)
+ record_conflict(np);
+ else
+ nip->defv = log_zero;
+ break;
+
+ case 0x1d: /* PULLUP */
+ np = g_pinnum();
+ nip = np->info;
+ if (nip->defv == log_zero)
+ record_conflict(np);
+ else
+ nip->defv = log_one;
+ break;
+
+ case 0x1e: /* Output to high pin */
+ np = g_pins[*g_proc++];
+ goto out_node;
+
+ case 0x1f: /* O.C. output to high pin */
+ np = g_pins[*g_proc++];
+ goto oc_out_node;
+
+ case16(0x20): /* Output to pin */
+ case16(0x30):
+ np = g_pins[ch & 0x1f];
+
+out_node:
+ switch (g_expr())
+ {
+ case log_zero:
+ nip = np->info;
+ if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
+ if (nip->v0 == log_one)
+ record_conflict(np);
+ else
+ nip->v0 = log_zero;
+ break;
+
+ case log_one:
+ nip = np->info;
+ if (TRACE_VAL) printf(" Output 1 to %x (was %d)\n", (unsigned int)nip, nip->v0);
+ if (nip->v0 == log_zero)
+ record_conflict(np);
+ else
+ nip->v0 = log_one;
+ break;
+
+ default:
+ break;
+ }
+ break;
+
+ case16(0x40): /* O.C. output to pin */
+ case16(0x50):
+ np = g_pins[ch & 0x1f];
+
+oc_out_node:
+ if (g_expr() == log_zero)
+ {
+ nip = np->info;
+ if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
+ if (nip->v0 == log_one)
+ record_conflict(np);
+ else
+ nip->v0 = log_zero;
+ break;
+ }
+ break;
+
+ case16(0x60): /* var = x */
+ if (g_expr() != log_zero)
+ {
+ if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
+ g_vars |= REGMASK(ch & 0x0f);
+ }
+ else
+ {
+ if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
+ g_vars &= ~REGMASK(ch & 0x0f);
+ }
+ break;
+
+ case16(0x70): /* var = NOT var */
+ g_vars ^= REGMASK(ch & 0x0f);
+ if (TRACE_VAL) printf(" Store %d in %c\n",
+ ((g_vars & REGMASK(ch & 0x0f)) != 0),
+ 'A' + (ch % 0x0f));
+ break;
+
+ case16(0x80): /* var = ZERO */
+ if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
+ g_vars &= ~REGMASK(ch & 0x0f);
+ break;
+
+ case16(0x90): /* var = ONE */
+ if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
+ g_vars |= REGMASK(ch & 0x0f);
+ break;
+
+ default: /* Undefined op codes: ignore */
+ break;
+
+ }
}
- }
- break;
-
- case 0x04: /* IFNONE */
- if (g_expr() == log_none)
- break;
- goto if_skip;
-
- case 0x05: /* IFZERO */
- if (g_expr() == log_zero)
- break;
- goto if_skip;
-
- case 0x06: /* IFONE */
- if (g_expr() == log_one)
- break;
- goto if_skip;
-
- case 0x07: /* IFCONN */
- if (g_expr() != log_none)
- break;
- goto if_skip;
-
- case 0x08: /* IFZN */
- if (g_expr() != log_one)
- break;
- goto if_skip;
-
- case 0x10: /* Output to internal node */
- ch = *g_proc++;
- if (ch < 128)
- np = g_info->ppins[ch - 64];
- else
- np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
- goto out_node;
-
- case 0x11: /* O.C. output to internal node */
- ch = *g_proc++;
- if (ch < 128)
- np = g_info->ppins[ch - 64];
- else
- np = g_info->ppins[ch + ((*g_proc++) << 7) - (32*128+64)];
- goto oc_out_node;
-
- case 0x12: /* CALL */
- g_gate->vars = (na_long)g_vars;
- logsima_action.lact->actgate = g_gate;
- processcall(act_16_sim);
- g_vars = (long)g_gate->vars;
- break;
-
- case 0x16: /* Comment */
- g_proc += *g_proc - 31;
- break;
-
- case 0x17: /* INST */
- g_proc += *g_proc - 33;
- break;
-
- case 0x18: /* pvar = x */
- ch = *g_proc++;
- if (ch < 128)
- g_info->pvars[ch - 64] = (g_expr() != log_zero);
- else {
- ch2 = *g_proc++;
- g_info->pvars[ch + (ch2 << 7) - (32*128+64)] =
- (g_expr() != log_zero);
- }
- break;
-
- case 0x19: /* pvar = NOT pvar */
- ch = *g_proc++;
- if (ch < 128)
- g_info->pvars[ch - 64] ^= 1;
- else
- g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] ^= 1;
- break;
-
- case 0x1a: /* pvar = ZERO */
- ch = *g_proc++;
- if (ch < 128)
- g_info->pvars[ch - 64] = 0;
- else
- g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 0;
- break;
-
- case 0x1b: /* pvar = ONE */
- ch = *g_proc++;
- if (ch < 128)
- g_info->pvars[ch - 64] = 1;
- else
- g_info->pvars[ch + ((*g_proc++) << 7) - (32*128+64)] = 1;
- break;
-
- case 0x1c: /* PULLDN */
- np = g_pinnum();
- nip = np->info;
- if (nip->defv == log_one)
- record_conflict(np);
- else
- nip->defv = log_zero;
- break;
-
- case 0x1d: /* PULLUP */
- np = g_pinnum();
- nip = np->info;
- if (nip->defv == log_zero)
- record_conflict(np);
- else
- nip->defv = log_one;
- break;
-
- case 0x1e: /* Output to high pin */
- np = g_pins[*g_proc++];
- goto out_node;
-
- case 0x1f: /* O.C. output to high pin */
- np = g_pins[*g_proc++];
- goto oc_out_node;
-
- case16(0x20): /* Output to pin */
- case16(0x30):
- np = g_pins[ch & 0x1f];
-
- out_node:
- switch (g_expr()) {
-
- case log_zero:
- nip = np->info;
- if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
- if (nip->v0 == log_one)
- record_conflict(np);
- else
- nip->v0 = log_zero;
- break;
-
- case log_one:
- nip = np->info;
- if (TRACE_VAL) printf(" Output 1 to %x (was %d)\n", (unsigned int)nip, nip->v0);
- if (nip->v0 == log_zero)
- record_conflict(np);
- else
- nip->v0 = log_one;
- break;
-
- default:
- break;
- }
- break;
-
- case16(0x40): /* O.C. output to pin */
- case16(0x50):
- np = g_pins[ch & 0x1f];
-
- oc_out_node:
- if (g_expr() == log_zero) {
- nip = np->info;
- if (TRACE_VAL) printf(" Output 0 to %x (was %d)\n", (unsigned int)nip, nip->v0);
- if (nip->v0 == log_one)
- record_conflict(np);
- else
- nip->v0 = log_zero;
- break;
- }
- break;
-
- case16(0x60): /* var = x */
- if (g_expr() != log_zero) {
- if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
- g_vars |= REGMASK(ch & 0x0f);
- } else {
- if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
- g_vars &= ~REGMASK(ch & 0x0f);
- }
- break;
-
- case16(0x70): /* var = NOT var */
- g_vars ^= REGMASK(ch & 0x0f);
- if (TRACE_VAL) printf(" Store %d in %c\n",
- ((g_vars & REGMASK(ch & 0x0f)) != 0),
- 'A' + (ch % 0x0f));
- break;
-
- case16(0x80): /* var = ZERO */
- if (TRACE_VAL) printf(" Store 0 in %c\n", 'A' + (ch % 0x0f));
- g_vars &= ~REGMASK(ch & 0x0f);
- break;
-
- case16(0x90): /* var = ONE */
- if (TRACE_VAL) printf(" Store 1 in %c\n", 'A' + (ch % 0x0f));
- g_vars |= REGMASK(ch & 0x0f);
- break;
-
- default: /* Undefined op codes: ignore */
- break;
-
- }
- }
}
-void executeprog(pr, pins, ginfo, vars)
-uchar *pr;
-log_nrec **pins;
-gateinfo *ginfo;
-na_long *vars;
+void executeprog(uchar *pr, log_nrec **pins, gateinfo *ginfo, na_long *vars)
{
-
- uchar *s_proc = g_proc;
- long s_vars = g_vars;
- log_nrec **s_pins = g_pins;
- gateinfo *s_info = g_info;
-
- g_proc = pr;
- g_pins = pins;
- g_info = ginfo;
- g_vars = (long)(*vars);
- g_stmts();
- *vars = (na_long)g_vars;
-
- g_proc = s_proc;
- g_pins = s_pins;
- g_info = s_info;
- g_vars = s_vars;
-
-
+ uchar *s_proc = g_proc;
+ long s_vars = g_vars;
+ log_nrec **s_pins = g_pins;
+ gateinfo *s_info = g_info;
+
+ g_proc = pr;
+ g_pins = pins;
+ g_info = ginfo;
+ g_vars = (long)(*vars);
+ g_stmts();
+ *vars = (na_long)g_vars;
+
+ g_proc = s_proc;
+ g_pins = s_pins;
+ g_info = s_info;
+ g_vars = s_vars;
}
-void executegates(active, g)
-int *active;
-register log_grec *g;
+void executegates(int *active, log_grec *g)
{
- register log_tool *tool16 = logsima_action.lact->acttool;
-
- while (g && g->kind->simtype != tool16)
- g = g->next;
- if (!g)
- return;
- if (TRACE_COPY) printf("\n");
- *active = true;
-
- while (g) {
- if (g->kind->simtype == tool16) {
- if (TRACE_GATES) printf("\nexecutegates: %s\n", g->kind->name);
- g_proc = g->kind->proc;
- g_pins = g->pin;
- g_gate = g;
- g_info = g->info;
- g_vars = (long)g->vars;
- g_stmts();
- g->vars = (na_long)g_vars;
- }
- g = g->next;
- }
+ register log_tool *tool16 = logsima_action.lact->acttool;
+
+ while (g && g->kind->simtype != tool16)
+ g = g->next;
+ if (!g)
+ return;
+ if (TRACE_COPY) printf("\n");
+ *active = true;
+
+ while (g)
+ {
+ if (g->kind->simtype == tool16)
+ {
+ if (TRACE_GATES) printf("\nexecutegates: %s\n", g->kind->name);
+ g_proc = g->kind->proc;
+ g_pins = g->pin;
+ g_gate = g;
+ g_info = g->info;
+ g_vars = (long)g->vars;
+ g_stmts();
+ g->vars = (na_long)g_vars;
+ }
+ g = g->next;
+ }
}
+
diff --git a/log/src/logsimh.c b/log/src/logsimh.c
index dc9c28272e4fcddaa6b391028541ec683e36cc22..2054386b02daca87cd291fc0a5afc91088196957 100644
--- a/log/src/logsimh.c
+++ b/log/src/logsimh.c
@@ -11,28 +11,28 @@
Copyright (C) 1985, 1990 John Lazzaro.
Author's address: lazzaro@csvax.caltech.edu; 256-80 Caltech.
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation (any version).
+ This program is free software; you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation (any version).
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
-GNU General Public License for more details.
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
-You should have received a copy of the GNU General Public License
-along with this program; see the file COPYING. If not, write to
-the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+ You should have received a copy of the GNU General Public License
+ along with this program; see the file COPYING. If not, write to
+ the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
/* caged_process='newcom -g $B$M'
- LOG 4.1 Hierarchical digital logic simulation routines
+ LOG 4.1 Hierarchical digital logic simulation routines
- David Gillespie 7/18/88
+ David Gillespie 7/18/88
- The following module is subject to change at any time.
-*/
+ The following module is subject to change at any time.
+ */
#include <string.h>
#include <p2c/p2c.h>
@@ -48,67 +48,68 @@ the Free Software Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
typedef enum {
- dump_none, dump_dump, dump_big, dump_write
+ dump_none, dump_dump, dump_big, dump_write
} dumpmodes;
+
typedef enum {
- opt_always, opt_dump, opt_request
+ opt_always, opt_dump, opt_request
} optmodes;
typedef struct instinfo {
- int attrchg, okay, wasokay;
- struct hdefrec *hdef;
- long hdefstamp, clearstamp, oldnetstamp, numpins, numppins, numpvars;
- log_nrec **pins;
- gateinfo ginfo;
- long recstamp, oldattrstamp;
- short instattr, nameattr, dispattr;
- char *wasdrawn;
+ int attrchg, okay, wasokay;
+ struct hdefrec *hdef;
+ long hdefstamp, clearstamp, oldnetstamp, numpins, numppins, numpvars;
+ log_nrec **pins;
+ gateinfo ginfo;
+ long recstamp, oldattrstamp;
+ short instattr, nameattr, dispattr;
+ char *wasdrawn;
} instinfo;
typedef struct controlinfo {
- struct hdefrec *hdef;
- short pgnum;
- char message[81], oldmessage[81], message2[81], oldmessage2[81];
- int welcomeflag;
- short oldoptcolor, olddumpcolor;
- dumpmodes olddumpmode;
+ struct hdefrec *hdef;
+ short pgnum;
+ char message[81], oldmessage[81], message2[81], oldmessage2[81];
+ int welcomeflag;
+ short oldoptcolor, olddumpcolor;
+ dumpmodes olddumpmode;
} controlinfo;
typedef struct pdrec {
- int isinput, isoutput;
+ int isinput, isoutput;
} pdrec;
typedef pdrec pdarray[log_million];
typedef struct hdefrec {
- char *name;
- struct hdefrec *next;
- short pgnum;
- long oldlabelstamp, oldboxstamp, oldpagestamp, curstamp, clearstamp,
- oldshowstamp;
- int defined_;
- log_brec *defbox;
- log_regrec *defreg;
- log_grec *gtempl, *gcontrol;
- struct dependrec *depends;
- uchar *proc;
- long proclen;
- pdrec *pindata;
- long lastnorth, lasteast, lastsouth, numports;
- /*north<=south<=west<=numports*/
- long numppins, numpvars;
- int wantnote, wantstats;
- short optlevel;
- int optflag, nextoptflag, dumphighlight, optdelay;
- dumpmodes dumpmode;
- optmodes optmode;
- char *writefile;
+ char *name;
+ struct hdefrec *next;
+ short pgnum;
+ long oldlabelstamp, oldboxstamp, oldpagestamp, curstamp, clearstamp,
+ oldshowstamp;
+ int defined_;
+ log_brec *defbox;
+ log_regrec *defreg;
+ log_grec *gtempl, *gcontrol;
+ struct dependrec *depends;
+ uchar *proc;
+ long proclen;
+ pdrec *pindata;
+ long lastnorth, lasteast, lastsouth, numports;
+ /*north<=south<=west<=numports*/
+ long numppins, numpvars;
+ int wantnote, wantstats;
+ short optlevel;
+ int optflag, nextoptflag, dumphighlight, optdelay;
+ dumpmodes dumpmode;
+ optmodes optmode;
+ char *writefile;
} hdefrec;
typedef struct dependrec {
- hdefrec *hdef;
- long hdefstamp;
- struct dependrec *next;
+ hdefrec *hdef;
+ long hdefstamp;
+ struct dependrec *next;
} dependrec;
/*if(cond,then,else)*/
@@ -119,29 +120,29 @@ typedef struct dependrec {
/*rise(val)*/
/*zero()*/
typedef enum {
- op_if, op_ifnone, op_ifzero, op_ifone, op_ifconn, op_ifzn, op_pineq,
- op_pinoc, op_vareq, op_pullup, op_pulldn, op_iftrue, op_iffalse, op_and,
- op_nand, op_or, op_nor, op_xor, op_same, op_rise, op_fall, op_not, op_fix0,
- op_strong, op_zero, op_one, op_pin, op_pinref, op_var, op_none, op_fix1,
- op_alwaysconn
+ op_if, op_ifnone, op_ifzero, op_ifone, op_ifconn, op_ifzn, op_pineq,
+ op_pinoc, op_vareq, op_pullup, op_pulldn, op_iftrue, op_iffalse, op_and,
+ op_nand, op_or, op_nor, op_xor, op_same, op_rise, op_fall, op_not, op_fix0,
+ op_strong, op_zero, op_one, op_pin, op_pinref, op_var, op_none, op_fix1,
+ op_alwaysconn
} instrops; /*for internal use*/
typedef struct instrrec {
- instrops opcode;
- short ival;
- union {
- struct {
- struct instrrec *arg1, *arg2, *arg3, *next;
- } U1;
- struct instrrec *args[4];
- } UU;
+ instrops opcode;
+ short ival;
+ union {
+ struct {
+ struct instrrec *arg1, *arg2, *arg3, *next;
+ } U1;
+ struct instrrec *args[4];
+ } UU;
} instrrec;
typedef log_16_value unarytype[3];
static const unarytype unarynot = {
- log_none, log_one, log_zero
+ log_none, log_one, log_zero
};
@@ -159,52 +160,46 @@ static hdefrec *hdefbase;
+static short findgattr(log_grec *g, char *name, char *kinds, short def)
+{
+ na_strlist_t *l1;
+ l1 = g->kind->lbl;
+ while (l1 != NULL && l1->kind != '\001')
+ l1 = l1->next;
+ if (l1 != NULL)
+ l1 = strlist_find((na_strlist_t *)l1->value, name);
-static short findgattr(g, name, kinds, def)
-log_grec *g;
-char *name, *kinds;
-short def;
-{
- na_strlist_t *l1;
-
- l1 = g->kind->lbl;
- while (l1 != NULL && l1->kind != '\001')
- l1 = l1->next;
- if (l1 != NULL)
- l1 = strlist_find((na_strlist_t *)l1->value, name);
- if (l1 != NULL &&
- strposc(kinds, g->kind->attr[(long)l1->value - 1].dtype, 1L) != 0)
- return ((long)l1->value);
- else if (def >= 1 && def <= g->kind->numattrs &&
- strposc(kinds, g->kind->attr[def - 1].dtype, 1L) != 0)
- return def;
- else
- return 0;
+ if (l1 != NULL &&
+ strposc(kinds, g->kind->attr[(long)l1->value - 1].dtype, 1L) != 0)
+ return ((long)l1->value);
+ else if (def >= 1 && def <= g->kind->numattrs &&
+ strposc(kinds, g->kind->attr[def - 1].dtype, 1L) != 0)
+ return def;
+ else
+ return 0;
}
-static char *namegattr(Result, g, i)
-char *Result;
-log_grec *g;
-short i;
+static char *namegattr(char *Result, log_grec *g, short i)
{
- na_strlist_t *l1;
-
- l1 = g->kind->lbl;
- while (l1 != NULL && l1->kind != '\001')
- l1 = l1->next;
- if (l1 != NULL) {
- l1 = (na_strlist_t *)l1->value;
- while (l1 != NULL && (long)l1->value != i)
- l1 = l1->next;
- }
- if (l1 != NULL)
- return strcpy(Result, l1->s);
- else
- return strcpy(Result, "");
+ na_strlist_t *l1;
+
+ l1 = g->kind->lbl;
+ while (l1 != NULL && l1->kind != '\001')
+ l1 = l1->next;
+ if (l1 != NULL)
+ {
+ l1 = (na_strlist_t *)l1->value;
+ while (l1 != NULL && (long)l1->value != i)
+ l1 = l1->next;
+ }
+ if (l1 != NULL)
+ return strcpy(Result, l1->s);
+ else
+ return strcpy(Result, "");
}
@@ -217,106 +212,122 @@ short i;
-static void refrcontrol(g, force)
-log_grec *g;
-short force;
+static void refrcontrol(log_grec *g, short force)
{
- hdefrec *hdef;
- short showx, showy;
- controlinfo *cip;
- dumpmodes newdumpmode;
- short newoptcolor, newdumpcolor;
- log_action_t *WITH;
- controlinfo *WITH1;
-
- WITH = logsima_action.lact;
- if (g == NULL)
- return;
- cip = (controlinfo *)g->info;
- hdef = cip->hdef;
- WITH1 = cip;
- if (WITH1->pgnum != WITH->showpage)
- return;
- if (WITH1->hdef == NULL || !WITH1->hdef->defined_) {
- newoptcolor = darkwordcolor;
- newdumpcolor = darkwordcolor;
- newdumpmode = dump_none;
- } else {
- if (WITH1->hdef->optflag)
- newoptcolor = WITH->color.selword;
- else
- newoptcolor = WITH->color.menuword;
- if (WITH1->hdef->dumphighlight)
- newdumpcolor = WITH->color.selword;
- else if ((long)WITH1->hdef->dumpmode >= (long)dump_dump &&
- (WITH1->hdef->dumpmode != dump_write ||
- *WITH1->hdef->writefile != '\0'))
- newdumpcolor = WITH->color.menuword;
- else
- newdumpcolor = darkwordcolor;
- newdumpmode = WITH1->hdef->dumpmode;
- }
- if (WITH1->hdef == NULL) {
- if (WITH1->welcomeflag)
- strcpy(WITH1->message, "Welcome to Digital LOG");
- else
- strcpy(WITH1->message, "Not in a definition");
- *WITH1->message2 = '\0';
- } else
- WITH1->welcomeflag = false;
- if (newoptcolor != WITH1->oldoptcolor || force != 0) {
- showx = 0;
- showy = optlevely;
- (*WITH->hook.xform)(g, &showx, &showy);
- (*WITH->hook.hidecursor)();
- if (force < 0)
- m_color((long)WITH->color.backgr);
- else
- m_color((long)newoptcolor);
- m_centerstr((long)showx, showy - 4L, NULL, "Optimize");
- (*WITH->hook.unhidecursor)();
- WITH1->oldoptcolor = newoptcolor;
- }
- if (newdumpmode != WITH1->olddumpmode ||
- newdumpcolor != WITH1->olddumpcolor || force != 0) {
- showx = 0;
- showy = dumpmodey;
- (*WITH->hook.xform)(g, &showx, &showy);
- (*WITH->hook.hidecursor)();
- m_color((long)WITH->color.backgr);
- if (WITH1->olddumpmode == dump_write)
- m_centerstr((long)showx, showy - 4L, NULL, "Write");
- else
- m_centerstr((long)showx, showy - 4L, NULL, "Dump");
- if (force >= 0) {
- m_color((long)newdumpcolor);
- if (newdumpmode == dump_write)
- m_centerstr((long)showx, showy - 4L, NULL, "Write");
- else
- m_centerstr((long)showx, showy - 4L, NULL, "Dump");
- }
- (*WITH->hook.unhidecursor)();
- WITH1->olddumpmode = newdumpmode;
- WITH1->olddumpcolor = newdumpcolor;
- }
- if (!strcmp(WITH1->message, WITH1->oldmessage) &&
- !strcmp(WITH1->message2, WITH1->oldmessage2) && force == 0)
- return;
- showx = 0;
- showy = messagey;
- (*WITH->hook.xform)(g, &showx, &showy);
- (*WITH->hook.hidecursor)();
- m_color((long)WITH->color.backgr);
- m_centerstr((long)showx, showy - 4L, NULL, WITH1->oldmessage);
- m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->oldmessage2);
- if (force >= 0) {
- m_color((long)WITH->color.message);
- m_centerstr((long)showx, showy - 4L, NULL, WITH1->message);
- m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->message2);
- }
- (*WITH->hook.unhidecursor)();
- strcpy(WITH1->oldmessage, WITH1->message);
- strcpy(WITH1->oldmessage2, WITH1->message2);
+ hdefrec *hdef;
+ short showx, showy;
+ controlinfo *cip;
+ dumpmodes newdumpmode;
+ short newoptcolor, newdumpcolor;
+ log_action_t *WITH;
+ controlinfo *WITH1;
+
+ WITH = logsima_action.lact;
+ if (g == NULL)
+ return;
+ cip = (controlinfo *)g->info;
+ hdef = cip->hdef;
+ WITH1 = cip;
+ if (WITH1->pgnum != WITH->showpage)
+ return;
+ if (WITH1->hdef == NULL || !WITH1->hdef->defined_)
+ {
+ newoptcolor = darkwordcolor;
+ newdumpcolor = darkwordcolor;
+ newdumpmode = dump_none;
+ }
+ else
+ {
+ if (WITH1->hdef->optflag)
+ newoptcolor = WITH->color.selword;
+ else
+ newoptcolor = WITH->color.menuword;
+ if (WITH1->hdef->dumphighlight)
+ newdumpcolor = WITH->color.selword;
+ else if ((long)WITH1->hdef->dumpmode >= (long)dump_dump &&
+ (WITH1->hdef->dumpmode != dump_write ||
+ *WITH1->hdef->writefile != '\0'))
+ newdumpcolor = WITH->color.menuword;
+ else
+ newdumpcolor = darkwordcolor;
+ newdumpmode = WITH1->hdef->dumpmode;
+ }
+
+ if (WITH1->hdef == NULL)
+ {
+ if (WITH1->welcomeflag)
+ strcpy(WITH1->message, "Welcome to Digital LOG");
+ else
+ strcpy(WITH1->message, "Not in a definition");
+ *WITH1->message2 = '\0';
+ }
+ else
+ {
+ WITH1->welcomeflag = false;
+ }
+
+ if (newoptcolor != WITH1->oldoptcolor || force != 0)
+ {
+ showx = 0;
+ showy = optlevely;
+ (*WITH->hook.xform)(g, &showx, &showy);
+ (*WITH->hook.hidecursor)();
+ if (force < 0)
+ m_color((long)WITH->color.backgr);
+ else
+ m_color((long)newoptcolor);
+ m_centerstr((long)showx, showy - 4L, NULL, "Optimize");
+ (*WITH->hook.unhidecursor)();
+ WITH1->oldoptcolor = newoptcolor;
+ }
+
+ if (newdumpmode != WITH1->olddumpmode ||
+ newdumpcolor != WITH1->olddumpcolor || force != 0)
+ {
+ showx = 0;
+ showy = dumpmodey;
+ (*WITH->hook.xform)(g, &showx, &showy);
+ (*WITH->hook.hidecursor)();
+ m_color((long)WITH->color.backgr);
+ if (WITH1->olddumpmode == dump_write)
+ m_centerstr((long)showx, showy - 4L, NULL, "Write");
+ else
+ m_centerstr((long)showx, showy - 4L, NULL, "Dump");
+ if (force >= 0)
+ {
+ m_color((long)newdumpcolor);
+ if (newdumpmode == dump_write)
+ m_centerstr((long)showx, showy - 4L, NULL, "Write");
+ else
+ m_centerstr((long)showx, showy - 4L, NULL, "Dump");
+ }
+ (*WITH->hook.unhidecursor)();
+ WITH1->olddumpmode = newdumpmode;
+ WITH1->olddumpcolor = newdumpcolor;
+ }
+
+ if (!strcmp(WITH1->message, WITH1->oldmessage) &&
+ !strcmp(WITH1->message2, WITH1->oldmessage2) && force == 0)
+ return;
+
+ showx = 0;
+ showy = messagey;
+ (*WITH->hook.xform)(g, &showx, &showy);
+ (*WITH->hook.hidecursor)();
+ m_color((long)WITH->color.backgr);
+ m_centerstr((long)showx, showy - 4L, NULL, WITH1->oldmessage);
+ m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->oldmessage2);
+
+ if (force >= 0)
+ {
+ m_color((long)WITH->color.message);
+ m_centerstr((long)showx, showy - 4L, NULL, WITH1->message);
+ m_centerstr((long)showx, showy + messagespc - 4L, NULL, WITH1->message2);
+ }
+
+ (*WITH->hook.unhidecursor)();
+ strcpy(WITH1->oldmessage, WITH1->message);
+ strcpy(WITH1->oldmessage2, WITH1->message2);
}
#undef optlevely
@@ -325,375 +336,389 @@ short force;
#undef messagespc
-static void showcontrol(hdef, msg)
-hdefrec *hdef;
-char *msg;
+static void showcontrol(hdefrec *hdef, char *msg)
{
- controlinfo *cip;
- long i, j, limit;
- log_action_t *WITH;
-
- WITH = logsima_action.lact;
- if (hdef->gcontrol == NULL)
- return;
- cip = (controlinfo *)hdef->gcontrol->info;
- if (strlen(msg) > 30) {
- limit = strlen(msg) / 2;
- i = strposb(msg, " ", limit);
- j = strposc(msg, ' ', limit);
- if (i == 0)
- i = j;
- else if (i > 0 && limit - i > j - limit)
- i = j;
- if (i == 0 || i > 80) {
- sprintf(cip->message, "%.80s", msg);
- strsub(cip->message2, msg, 81, 80);
- } else {
- sprintf(cip->message, "%.*s", (int)(i - 1), msg);
- strsub(cip->message2, msg, (int)(i + 1), 80);
- }
- } else {
- strcpy(cip->message, msg);
- *cip->message2 = '\0';
- }
- /* call(hook.message, 'Showcontrol of "' + msg + '"'); {****/
- /* call(hook.message, 'Broken into "' + cip^.message + '" and "' + {****/
- /* cip^.message2 + '"'); {****/
- refrcontrol(hdef->gcontrol, 0);
+ controlinfo *cip;
+ long i, j, limit;
+ log_action_t *WITH;
+
+ WITH = logsima_action.lact;
+ if (hdef->gcontrol == NULL)
+ return;
+ cip = (controlinfo *)hdef->gcontrol->info;
+ if (strlen(msg) > 30)
+ {
+ limit = strlen(msg) / 2;
+ i = strposb(msg, " ", limit);
+ j = strposc(msg, ' ', limit);
+ if (i == 0)
+ i = j;
+ else if (i > 0 && limit - i > j - limit)
+ i = j;
+
+ if (i == 0 || i > 80)
+ {
+ sprintf(cip->message, "%.80s", msg);
+ strsub(cip->message2, msg, 81, 80);
+ }
+ else
+ {
+ sprintf(cip->message, "%.*s", (int)(i - 1), msg);
+ strsub(cip->message2, msg, (int)(i + 1), 80);
+ }
+ }
+ else
+ {
+ strcpy(cip->message, msg);
+ *cip->message2 = '\0';
+ }
+ /* call(hook.message, 'Showcontrol of "' + msg + '"'); {****/
+ /* call(hook.message, 'Broken into "' + cip^.message + '" and "' + {****/
+ /* cip^.message2 + '"'); {****/
+ refrcontrol(hdef->gcontrol, 0);
}
-static void showerrormsg(hdef, msg_)
-hdefrec *hdef;
-char *msg_;
+static void showerrormsg(hdefrec *hdef, char *msg_)
{
- char msg[256];
- na_strlist_t *l1;
-
- strcpy(msg, msg_);
- if (logsima_action.lact->msgstamp != viserrorstamp) {
- viserrorstamp = logsima_action.lact->msgstamp;
- strlist_empty(&viserrors);
- }
- if (strlist_find(viserrors, msg) == NULL) {
- l1 = strlist_append(&viserrors, msg);
- (*logsima_action.lact->hook.message)(msg);
- }
- /* and (act.lact^.showpage > 0) */
- if (hdef != NULL)
- showcontrol(hdef, msg);
-}
-
+ char msg[256];
+ na_strlist_t *l1;
+
+ strcpy(msg, msg_);
+ if (logsima_action.lact->msgstamp != viserrorstamp)
+ {
+ viserrorstamp = logsima_action.lact->msgstamp;
+ strlist_empty(&viserrors);
+ }
+ if (strlist_find(viserrors, msg) == NULL)
+ {
+ l1 = strlist_append(&viserrors, msg);
+ (*logsima_action.lact->hook.message)(msg);
+ }
+ /* and (act.lact^.showpage > 0) */
+ if (hdef != NULL)
+ showcontrol(hdef, msg);
+}
-static void dasmhdef(f, hdef, incldef)
-FILE *f;
-hdefrec *hdef;
-int incldef;
+static void dasmhdef(FILE *f, hdefrec *hdef, int incldef)
{
- char *buf;
- long pc, indent;
-
- pc = 1;
- indent = 0;
- while (pc < hdef->proclen) {
- if (incldef)
- fprintf(f, "DEF ");
- if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0x8004L) != 0)
- indent -= 3;
- if (indent > 0)
- fprintf(f, "%*s", (int)indent, "");
- if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0xfff8L) != 0)
- indent += 3;
- buf = dasm_16(hdef->proc, &pc);
- fprintf(f, "%s\n", buf);
- Free(buf);
- }
- if (hdef->proc[pc - 1] != '\0')
- fprintf(f, "# Warning: terminator is not #0\n");
- if (indent != 0)
- fprintf(f, "# Warning: final indentation level was %ld\n", indent / 3);
-}
-
+ char *buf;
+ long pc, indent;
+
+ pc = 1;
+ indent = 0;
+ while (pc < hdef->proclen)
+ {
+ if (incldef)
+ fprintf(f, "DEF ");
+ if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0x8004L) != 0)
+ indent -= 3;
+ if (indent > 0)
+ fprintf(f, "%*s", (int)indent, "");
+ if (hdef->proc[pc - 1] < 32 && ((1L << hdef->proc[pc - 1]) & 0xfff8L) != 0)
+ indent += 3;
+ buf = dasm_16(hdef->proc, &pc);
+ fprintf(f, "%s\n", buf);
+ Free(buf);
+ }
+ if (hdef->proc[pc - 1] != '\0')
+ fprintf(f, "# Warning: terminator is not #0\n");
+ if (indent != 0)
+ fprintf(f, "# Warning: final indentation level was %ld\n", indent / 3);
+}
-static hdefrec *findhdef(name, make)
-char *name;
-int make;
+static hdefrec *findhdef(char *name, int make)
{
- hdefrec *hdef;
-
- if (*name == '\0')
- return NULL;
- else {
- hdef = hdefbase;
- while (hdef != NULL && strcicmp(name, hdef->name) != 0)
- hdef = hdef->next;
- if (!(hdef == NULL && make))
- return hdef;
- hdef = (hdefrec *)Malloc(sizeof(hdefrec));
- hdef->name = strdup(name);
- hdef->pgnum = 0;
- hdef->oldlabelstamp = 0;
- hdef->oldboxstamp = 0;
- hdef->oldpagestamp = 0;
- hdef->curstamp = 0;
- hdef->clearstamp = 0;
- hdef->oldshowstamp = showstamp;
- hdef->defined_ = false;
- hdef->defreg = NULL;
- hdef->depends = NULL;
- hdef->proc = NULL;
- hdef->proclen = 0;
- hdef->pindata = NULL;
- hdef->gcontrol = NULL;
- hdef->optlevel = 1000;
- hdef->optflag = true;
- hdef->nextoptflag = false;
- hdef->dumphighlight = false;
- hdef->dumpmode = dump_none;
- hdef->optmode = opt_always;
- hdef->optdelay = true;
- hdef->writefile = strdup("");
- hdef->wantnote = 1;
- hdef->wantstats = false;
- hdef->next = hdefbase;
- hdefbase = hdef;
- return hdef;
- }
-}
+ hdefrec *hdef;
+ if (*name == '\0')
+ {
+ return NULL;
+ }
+ else
+ {
+ hdef = hdefbase;
+ while (hdef != NULL && strcicmp(name, hdef->name) != 0)
+ hdef = hdef->next;
+ if (!(hdef == NULL && make))
+ return hdef;
+ hdef = (hdefrec *)Malloc(sizeof(hdefrec));
+ hdef->name = strdup(name);
+ hdef->pgnum = 0;
+ hdef->oldlabelstamp = 0;
+ hdef->oldboxstamp = 0;
+ hdef->oldpagestamp = 0;
+ hdef->curstamp = 0;
+ hdef->clearstamp = 0;
+ hdef->oldshowstamp = showstamp;
+ hdef->defined_ = false;
+ hdef->defreg = NULL;
+ hdef->depends = NULL;
+ hdef->proc = NULL;
+ hdef->proclen = 0;
+ hdef->pindata = NULL;
+ hdef->gcontrol = NULL;
+ hdef->optlevel = 1000;
+ hdef->optflag = true;
+ hdef->nextoptflag = false;
+ hdef->dumphighlight = false;
+ hdef->dumpmode = dump_none;
+ hdef->optmode = opt_always;
+ hdef->optdelay = true;
+ hdef->writefile = strdup("");
+ hdef->wantnote = 1;
+ hdef->wantstats = false;
+ hdef->next = hdefbase;
+ hdefbase = hdef;
+ return hdef;
+ }
+}
-static void grabcontrolattrs(hdef, g)
-hdefrec *hdef;
-log_grec *g;
+static void grabcontrolattrs(hdefrec *hdef, log_grec *g)
{
- long num;
-
- num = findgattr(g, "opt", "I", 0);
- if (num != 0) {
- if (g->attr[num - 1].blnk)
- hdef->optlevel = 1000;
- else
- hdef->optlevel = g->attr[num - 1].UU.U73.i1;
- }
- num = findgattr(g, "opt-when", "V", 0);
- if (num != 0) {
- switch (g->attr[num - 1].UU.nv) {
-
- case 1:
- hdef->optmode = opt_dump;
- break;
-
- case 2:
- hdef->optmode = opt_request;
- break;
-
- default:
- hdef->optmode = opt_always;
- break;
- }
- }
- num = findgattr(g, "opt-delay", "B", 0);
- if (num != 0)
- hdef->optdelay = g->attr[num - 1].UU.b;
- num = findgattr(g, "disp", "B", 0);
- if (num != 0)
- hdef->wantnote = g->attr[num - 1].UU.b;
- num = findgattr(g, "stats", "B", 0);
- if (num != 0)
- hdef->wantstats = g->attr[num - 1].UU.b;
- num = findgattr(g, "dump", "V", 0);
- if (num != 0) {
- switch (g->attr[num - 1].UU.nv) {
-
- case 1:
- hdef->dumpmode = dump_dump;
- break;
-
- case 2:
- hdef->dumpmode = dump_big;
- break;
-
- case 3:
- hdef->dumpmode = dump_write;
- break;
-
- default:
- hdef->dumpmode = dump_none;
- break;
- }
- }
- num = findgattr(g, "write-file", "A", 0);
- if (num != 0 && g->attr[num - 1].UU.sp != NULL)
- strchange(&hdef->writefile, g->attr[num - 1].UU.sp);
+ long num;
+
+ num = findgattr(g, "opt", "I", 0);
+ if (num != 0)
+ {
+ if (g->attr[num - 1].blnk)
+ hdef->optlevel = 1000;
+ else
+ hdef->optlevel = g->attr[num - 1].UU.U73.i1;
+ }
+ num = findgattr(g, "opt-when", "V", 0);
+
+ if (num != 0)
+ {
+ switch (g->attr[num - 1].UU.nv)
+ {
+ case 1:
+ hdef->optmode = opt_dump;
+ break;
+
+ case 2:
+ hdef->optmode = opt_request;
+ break;
+
+ default:
+ hdef->optmode = opt_always;
+ break;
+ }
+ }
+ num = findgattr(g, "opt-delay", "B", 0);
+ if (num != 0)
+ hdef->optdelay = g->attr[num - 1].UU.b;
+ num = findgattr(g, "disp", "B", 0);
+ if (num != 0)
+ hdef->wantnote = g->attr[num - 1].UU.b;
+ num = findgattr(g, "stats", "B", 0);
+ if (num != 0)
+ hdef->wantstats = g->attr[num - 1].UU.b;
+ num = findgattr(g, "dump", "V", 0);
+ if (num != 0)
+ {
+ switch (g->attr[num - 1].UU.nv)
+ {
+ case 1:
+ hdef->dumpmode = dump_dump;
+ break;
+
+ case 2:
+ hdef->dumpmode = dump_big;
+ break;
+
+ case 3:
+ hdef->dumpmode = dump_write;
+ break;
+
+ default:
+ hdef->dumpmode = dump_none;
+ break;
+ }
+ }
+ num = findgattr(g, "write-file", "A", 0);
+ if (num != 0 && g->attr[num - 1].UU.sp != NULL)
+ strchange(&hdef->writefile, g->attr[num - 1].UU.sp);
}
-static void storecontrolattrs(hdef, g)
-hdefrec *hdef;
-log_grec *g;
+static void storecontrolattrs(hdefrec *hdef, log_grec *g)
{
- long num;
- log_gattrrec *WITH;
-
- num = findgattr(g, "opt", "I", 0);
- if (num != 0) {
- WITH = &g->attr[num - 1];
- if (hdef == NULL)
- WITH->UU.U73.i1 = 1000;
- else
- WITH->UU.U73.i1 = hdef->optlevel;
- WITH->blnk = (WITH->UU.U73.i1 == 1000);
- }
- num = findgattr(g, "opt-when", "V", 0);
- if (num != 0) {
- if (hdef == NULL)
- g->attr[num - 1].UU.nv = 0;
- else {
- switch (hdef->optmode) {
-
- case opt_dump:
- g->attr[num - 1].UU.nv = 1;
- break;
-
- case opt_request:
- g->attr[num - 1].UU.nv = 2;
- break;
-
- default:
- g->attr[num - 1].UU.nv = 0;
- break;
- }
- }
- }
- num = findgattr(g, "opt-delay", "B", 0);
- if (num != 0)
- g->attr[num - 1].UU.b = (hdef != NULL && hdef->optdelay);
- num = findgattr(g, "disp", "B", 0);
- if (num != 0)
- g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantnote);
- num = findgattr(g, "stats", "B", 0);
- if (num != 0)
- g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantstats);
- num = findgattr(g, "dump", "V", 0);
- if (num != 0) {
- if (hdef == NULL)
- g->attr[num - 1].UU.nv = 0;
- else {
- switch (hdef->dumpmode) {
-
- case dump_dump:
- g->attr[num - 1].UU.nv = 1;
- break;
-
- case dump_big:
- g->attr[num - 1].UU.nv = 2;
- break;
-
- case dump_write:
- g->attr[num - 1].UU.nv = 3;
- break;
-
- default:
- g->attr[num - 1].UU.nv = 0;
- break;
- }
- }
- }
- num = findgattr(g, "write-file", "A", 0);
- if (num != 0) {
- if (hdef != NULL)
- strchange(&g->attr[num - 1].UU.sp, hdef->writefile);
- }
+ long num;
+ log_gattrrec *WITH;
+
+ num = findgattr(g, "opt", "I", 0);
+ if (num != 0)
+ {
+ WITH = &g->attr[num - 1];
+ if (hdef == NULL)
+ WITH->UU.U73.i1 = 1000;
+ else
+ WITH->UU.U73.i1 = hdef->optlevel;
+ WITH->blnk = (WITH->UU.U73.i1 == 1000);
+ }
+ num = findgattr(g, "opt-when", "V", 0);
+ if (num != 0)
+ {
+ if (hdef == NULL)
+ {
+ g->attr[num - 1].UU.nv = 0;
+ }
+ else
+ {
+ switch (hdef->optmode)
+ {
+ case opt_dump:
+ g->attr[num - 1].UU.nv = 1;
+ break;
+
+ case opt_request:
+ g->attr[num - 1].UU.nv = 2;
+ break;
+
+ default:
+ g->attr[num - 1].UU.nv = 0;
+ break;
+ }
+ }
+ }
+ num = findgattr(g, "opt-delay", "B", 0);
+ if (num != 0)
+ g->attr[num - 1].UU.b = (hdef != NULL && hdef->optdelay);
+ num = findgattr(g, "disp", "B", 0);
+ if (num != 0)
+ g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantnote);
+ num = findgattr(g, "stats", "B", 0);
+ if (num != 0)
+ g->attr[num - 1].UU.b = (hdef != NULL && hdef->wantstats);
+ num = findgattr(g, "dump", "V", 0);
+ if (num != 0)
+ {
+ if (hdef == NULL)
+ {
+ g->attr[num - 1].UU.nv = 0;
+ }
+ else
+ {
+ switch (hdef->dumpmode)
+ {
+ case dump_dump:
+ g->attr[num - 1].UU.nv = 1;
+ break;
+
+ case dump_big:
+ g->attr[num - 1].UU.nv = 2;
+ break;
+
+ case dump_write:
+ g->attr[num - 1].UU.nv = 3;
+ break;
+
+ default:
+ g->attr[num - 1].UU.nv = 0;
+ break;
+ }
+ }
+ }
+ num = findgattr(g, "write-file", "A", 0);
+ if (num != 0)
+ {
+ if (hdef != NULL)
+ strchange(&g->attr[num - 1].UU.sp, hdef->writefile);
+ }
}
#define want "LOGSIMH_LOG_16_INST"
-
-
-static hdefrec *isinstance(g)
-log_grec *g;
+static hdefrec *isinstance(log_grec *g)
{
- long i;
- char STR2[12];
-
- if (g->kind->simtype != logsima_tool_16 || g->kind->proc[0] != '\022' ||
- g->kind->proc[2] != strlen(want) + 128)
- return NULL;
- else {
- i = 1;
- while (i <= strlen(want) && g->kind->proc[i + 2] == want[i - 1])
- i++;
- if (i <= strlen(want) || g->kind->proc[i + 2] != '\0')
- return NULL;
- else {
- i = findgattr(g, "inst-of", "CA", 0);
- if (i > 0)
- return (findhdef(g->attr[i - 1].UU.c, true));
- else {
- sprintf(STR2, "\"%s\"", g->kind->name);
- return (findhdef(STR2, true));
- }
- }
- }
+ long i;
+ char STR2[12];
+
+ if (g->kind->simtype != logsima_tool_16 || g->kind->proc[0] != '\022' ||
+ g->kind->proc[2] != strlen(want) + 128)
+ {
+ return NULL;
+ }
+ else
+ {
+ i = 1;
+ while (i <= strlen(want) && g->kind->proc[i + 2] == want[i - 1])
+ i++;
+ if (i <= strlen(want) || g->kind->proc[i + 2] != '\0')
+ {
+ return NULL;
+ }
+ else
+ {
+ i = findgattr(g, "inst-of", "CA", 0);
+ if (i > 0)
+ {
+ return (findhdef(g->attr[i - 1].UU.c, true));
+ }
+ else
+ {
+ sprintf(STR2, "\"%s\"", g->kind->name);
+ return (findhdef(STR2, true));
+ }
+ }
+ }
}
#undef want
-
-
static void updateinstance (log_grec *g);
#define setmax 200000L /*was 8000*/
-
typedef struct noderec {
- long poss, nextposs;
- short isused, wasused, isdef, wasdef;
- int alwaysconn, strong, wasstrong, loopflag;
- instrrec *defn;
- long level;
- short truenum;
+ long poss, nextposs;
+ short isused, wasused, isdef, wasdef;
+ int alwaysconn, strong, wasstrong, loopflag;
+ instrrec *defn;
+ long level;
+ short truenum;
} noderec;
typedef noderec nodearr[log_million + 1];
typedef struct trailrec {
- struct trailrec *next;
- long num;
- long oldposs;
- int oldstrong;
- long oldlevel;
+ struct trailrec *next;
+ long num;
+ long oldposs;
+ int oldstrong;
+ long oldlevel;
} trailrec;
static char *instrops_NAMES[] = {
- "OP_IF", "OP_IFNONE", "OP_IFZERO", "OP_IFONE", "OP_IFCONN", "OP_IFZN",
- "OP_PINEQ", "OP_PINOC", "OP_VAREQ", "OP_PULLUP", "OP_PULLDN", "OP_IFTRUE",
- "OP_IFFALSE", "OP_AND", "OP_NAND", "OP_OR", "OP_NOR", "OP_XOR", "OP_SAME",
- "OP_RISE", "OP_FALL", "OP_NOT", "OP_FIX0", "OP_STRONG", "OP_ZERO", "OP_ONE",
- "OP_PIN", "OP_PINREF", "OP_VAR", "OP_NONE", "OP_FIX1", "OP_ALWAYSCONN"
+ "OP_IF", "OP_IFNONE", "OP_IFZERO", "OP_IFONE", "OP_IFCONN", "OP_IFZN",
+ "OP_PINEQ", "OP_PINOC", "OP_VAREQ", "OP_PULLUP", "OP_PULLDN", "OP_IFTRUE",
+ "OP_IFFALSE", "OP_AND", "OP_NAND", "OP_OR", "OP_NOR", "OP_XOR", "OP_SAME",
+ "OP_RISE", "OP_FALL", "OP_NOT", "OP_FIX0", "OP_STRONG", "OP_ZERO", "OP_ONE",
+ "OP_PIN", "OP_PINREF", "OP_VAR", "OP_NONE", "OP_FIX1", "OP_ALWAYSCONN"
} ;
typedef struct gaterec {
- log_grec *gp;
- pdrec *pd;
- log_nrec **pins;
- uchar *pproc;
- short numpins;
- long *ins, *outs;
+ log_grec *gp;
+ pdrec *pd;
+ log_nrec **pins;
+ uchar *pproc;
+ short numpins;
+ long *ins, *outs;
} gaterec;
typedef gaterec gatearray[log_million];
@@ -701,3385 +726,3489 @@ typedef gaterec gatearray[log_million];
/* Local variables for compilepage: */
struct LOC_compilepage {
- hdefrec *hdef;
- long starttime;
- instrrec *ip1, *ipbase;
- log_grec *g, *gtempl, *gcontrol;
- log_nrec *n;
- int okay, truevars, hasstats, isverbose, bigdump;
- long optlevel;
- int optdelay;
- long pc, simppasscount, gatecount, subcount, inertcount, forcecount,
- instrcount, oldinstrcount, curppin, curpvar, savecurpvar, baseppin,
- basepvar, numvar, numports, numthings, thingnodes, thingvars;
- noderec *things;
- na_strlist_t *inertlist;
- log_brec *mybox;
- uchar *proc;
- log_nrec **gpins;
- int changed;
+ hdefrec *hdef;
+ long starttime;
+ instrrec *ip1, *ipbase;
+ log_grec *g, *gtempl, *gcontrol;
+ log_nrec *n;
+ int okay, truevars, hasstats, isverbose, bigdump;
+ long optlevel;
+ int optdelay;
+ long pc, simppasscount, gatecount, subcount, inertcount, forcecount,
+ instrcount, oldinstrcount, curppin, curpvar, savecurpvar, baseppin,
+ basepvar, numvar, numports, numthings, thingnodes, thingvars;
+ noderec *things;
+ na_strlist_t *inertlist;
+ log_brec *mybox;
+ uchar *proc;
+ log_nrec **gpins;
+ int changed;
} ;
static instrrec *parseterm (struct LOC_compilepage *LINK);
-static void error(msg, LINK)
-char *msg;
-struct LOC_compilepage *LINK;
+static void error(char *msg, struct LOC_compilepage *LINK)
{
- /* if act.lact^.curpage = act.lact^.showpage then */
- showerrormsg(LINK->hdef, msg);
- LINK->okay = false;
+ /* if act.lact^.curpage = act.lact^.showpage then */
+ showerrormsg(LINK->hdef, msg);
+ LINK->okay = false;
}
-static void newinstr(ip, LINK)
-instrrec **ip;
-struct LOC_compilepage *LINK;
+static void newinstr(instrrec **ip, struct LOC_compilepage *LINK)
{
- *ip = (instrrec *)Malloc(sizeof(instrrec));
- (*ip)->opcode = op_zero;
- (*ip)->UU.U1.arg1 = NULL;
- (*ip)->UU.U1.arg2 = NULL;
- (*ip)->UU.U1.arg3 = NULL;
- (*ip)->UU.U1.next = NULL;
+ *ip = (instrrec *)Malloc(sizeof(instrrec));
+ (*ip)->opcode = op_zero;
+ (*ip)->UU.U1.arg1 = NULL;
+ (*ip)->UU.U1.arg2 = NULL;
+ (*ip)->UU.U1.arg3 = NULL;
+ (*ip)->UU.U1.next = NULL;
}
-static void disposetree(ip, LINK)
-instrrec **ip;
-struct LOC_compilepage *LINK;
+static void disposetree(instrrec **ip, struct LOC_compilepage *LINK)
{
- if (*ip == NULL)
- return;
- disposetree(&(*ip)->UU.U1.arg1, LINK);
- disposetree(&(*ip)->UU.U1.arg2, LINK);
- disposetree(&(*ip)->UU.U1.arg3, LINK);
- disposetree(&(*ip)->UU.U1.next, LINK);
- Free(*ip);
+ if (*ip == NULL)
+ return;
+ disposetree(&(*ip)->UU.U1.arg1, LINK);
+ disposetree(&(*ip)->UU.U1.arg2, LINK);
+ disposetree(&(*ip)->UU.U1.arg3, LINK);
+ disposetree(&(*ip)->UU.U1.next, LINK);
+ Free(*ip);
}
/* Local variables for dumptree: */
struct LOC_dumptree {
- struct LOC_compilepage *LINK;
- FILE *f;
- instrrec *iphigh;
- char buf[256];
- long i;
+ struct LOC_compilepage *LINK;
+ FILE *f;
+ instrrec *iphigh;
+ char buf[256];
+ long i;
} ;
-static void dump(ip, indent, LINK)
-instrrec *ip;
-long indent;
-struct LOC_dumptree *LINK;
+static void dump(instrrec *ip, long indent, struct LOC_dumptree *LINK)
{
- long ind2;
-
- while (ip != NULL) {
- if (ip == LINK->iphigh) {
- putc(140, LINK->f);
-/* p2c: logsimh.text, line 707: Note: character >= 128 encountered [281] */
- }
- strcpy(LINK->buf, instrops_NAMES[(long)ip->opcode]);
- LINK->i = strlen(LINK->buf) + 1;
- fputs(LINK->buf + 3, LINK->f);
- ind2 = indent + strlen(LINK->buf) - 3;
- if (((1L << ((long)ip->opcode)) & ((1L << ((long)op_pineq)) |
- (1L << ((long)op_pinoc)) | (1L << ((long)op_vareq)) |
- (1L << ((long)op_pin)) | (1L << ((long)op_pinref)) |
- (1L << ((long)op_var)) | (1L << ((long)op_alwaysconn)))) != 0) {
- sprintf(LINK->buf, "%d", ip->ival);
- fprintf(LINK->f, "[%s]", LINK->buf);
- ind2 += strlen(LINK->buf) + 2;
- }
- if (ip->UU.U1.arg1 != NULL || ip->UU.U1.arg2 != NULL ||
- ip->UU.U1.arg3 != NULL) {
- putc('(', LINK->f);
- ind2++;
- if (ip->UU.U1.arg1 != NULL)
- dump(ip->UU.U1.arg1, ind2, LINK);
- if (ip->UU.U1.arg2 != NULL || ip->UU.U1.arg3 != NULL) {
- fprintf(LINK->f, ",\n");
- fprintf(LINK->f, "%*s", (int)ind2, "");
- if (ip->UU.U1.arg2 != NULL)
- dump(ip->UU.U1.arg2, ind2, LINK);
- if (ip->UU.U1.arg3 != NULL) {
- fprintf(LINK->f, ",\n");
- fprintf(LINK->f, "%*s", (int)ind2, "");
- dump(ip->UU.U1.arg3, ind2, LINK);
+ long ind2;
+
+ while (ip != NULL)
+ {
+ if (ip == LINK->iphigh)
+
+ {
+ putc(140, LINK->f);
+ }
+ strcpy(LINK->buf, instrops_NAMES[(long)ip->opcode]);
+ LINK->i = strlen(LINK->buf) + 1;
+ fputs(LINK->buf + 3, LINK->f);
+ ind2 = indent + strlen(LINK->buf) - 3;
+ if (((1L << ((long)ip->opcode)) & ((1L << ((long)op_pineq)) |
+ (1L << ((long)op_pinoc)) | (1L << ((long)op_vareq)) |
+ (1L << ((long)op_pin)) | (1L << ((long)op_pinref)) |
+ (1L << ((long)op_var)) | (1L << ((long)op_alwaysconn)))) != 0)
+ {
+ sprintf(LINK->buf, "%d", ip->ival);
+ fprintf(LINK->f, "[%s]", LINK->buf);
+ ind2 += strlen(LINK->buf) + 2;
+ }
+
+ if (ip->UU.U1.arg1 != NULL || ip->UU.U1.arg2 != NULL ||
+ ip->UU.U1.arg3 != NULL)
+ {
+ putc('(', LINK->f);
+ ind2++;
+ if (ip->UU.U1.arg1 != NULL)
+ dump(ip->UU.U1.arg1, ind2, LINK);
+ if (ip->UU.U1.arg2 != NULL || ip->UU.U1.arg3 != NULL)
+ {
+ fprintf(LINK->f, ",\n");
+ fprintf(LINK->f, "%*s", (int)ind2, "");
+ if (ip->UU.U1.arg2 != NULL)
+ dump(ip->UU.U1.arg2, ind2, LINK);
+ if (ip->UU.U1.arg3 != NULL) {
+ fprintf(LINK->f, ",\n");
+ fprintf(LINK->f, "%*s", (int)ind2, "");
+ dump(ip->UU.U1.arg3, ind2, LINK);
+ }
+ }
+ putc(')', LINK->f);
+ }
+ if (ip->UU.U1.next != NULL)
+ {
+ fprintf(LINK->f, ";\n");
+ fprintf(LINK->f, "%*s", (int)indent, "");
+ }
+
+ if (ip == LINK->iphigh)
+ putc(136, LINK->f);
+ ip = ip->UU.U1.next;
}
- }
- putc(')', LINK->f);
- }
- if (ip->UU.U1.next != NULL) {
- fprintf(LINK->f, ";\n");
- fprintf(LINK->f, "%*s", (int)indent, "");
- }
- if (ip == LINK->iphigh)
- putc(136, LINK->f);
-/* p2c: logsimh.text, line 746: Note: character >= 128 encountered [281] */
- ip = ip->UU.U1.next;
- }
}
-static void dumptree(f_, ip, iphigh_, LINK)
-FILE *f_;
-instrrec *ip, *iphigh_;
-struct LOC_compilepage *LINK;
+static void dumptree(FILE *f_, instrrec *ip, instrrec *iphigh_, struct LOC_compilepage *LINK)
{
- struct LOC_dumptree V;
+ struct LOC_dumptree V;
- V.LINK = LINK;
- V.f = f_;
- V.iphigh = iphigh_;
- dump(ip, 0L, &V);
- putc('\n', V.f);
+ V.LINK = LINK;
+ V.f = f_;
+ V.iphigh = iphigh_;
+ dump(ip, 0L, &V);
+ putc('\n', V.f);
}
-static void debugtree(ip, iphigh, LINK)
-instrrec *ip, *iphigh;
-struct LOC_compilepage *LINK;
+static void debugtree(instrrec *ip, instrrec *iphigh, struct LOC_compilepage *LINK)
{
- if (ip == NULL)
- ip = LINK->ipbase;
- dumptree(stdout, ip, iphigh, LINK);
+ if (ip == NULL)
+ ip = LINK->ipbase;
+ dumptree(stdout, ip, iphigh, LINK);
}
-static int isinert(g, LINK)
-log_grec *g;
-struct LOC_compilepage *LINK;
+static int isinert(log_grec *g, struct LOC_compilepage *LINK)
{
- return (!strcmp(g->kind->name, "LED") || !strcmp(g->kind->name, "7SEG") ||
- strlist_find(LINK->inertlist, g->kind->name) != NULL);
+ return (!strcmp(g->kind->name, "LED") || !strcmp(g->kind->name, "7SEG") ||
+ strlist_find(LINK->inertlist, g->kind->name) != NULL);
}
/* Local variables for parseterm: */
struct LOC_parseterm {
- struct LOC_compilepage *LINK;
- instrrec *ip;
- long ins;
- int done;
+ struct LOC_compilepage *LINK;
+ instrrec *ip;
+ long ins;
+ int done;
} ;
-static void badop(LINK)
-struct LOC_parseterm *LINK;
+static void badop(struct LOC_parseterm *LINK)
{
- char STR2[256];
+ char STR2[256];
- sprintf(STR2, "%s: bad opcode (%.2lX)",
- LINK->LINK->g->kind->name, LINK->ins & 0xff);
- error(STR2, LINK->LINK);
+ sprintf(STR2, "%s: bad opcode (%.2lX)",
+ LINK->LINK->g->kind->name, LINK->ins & 0xff);
+ error(STR2, LINK->LINK);
}
-static instrrec *parsepin(LINK)
-struct LOC_parseterm *LINK;
+static instrrec *parsepin(struct LOC_parseterm *LINK)
{
- instrrec *ip;
-
- ip = parseterm(LINK->LINK);
- if (ip->opcode == op_pin)
- ip->opcode = op_pinref;
- else
- badop(LINK);
- return ip;
+ instrrec *ip;
+
+ ip = parseterm(LINK->LINK);
+ if (ip->opcode == op_pin)
+ ip->opcode = op_pinref;
+ else
+ badop(LINK);
+ return ip;
}
-static long getpnum(LINK)
-struct LOC_parseterm *LINK;
+static long getpnum(struct LOC_parseterm *LINK)
{
- long Result;
-
- if (LINK->LINK->proc[LINK->LINK->pc - 1] < 128) {
-/* p2c: logsimh.text, line 802: Note: character >= 128 encountered [281] */
- Result = LINK->LINK->proc[LINK->LINK->pc - 1] - 64;
- LINK->LINK->pc++;
- } else {
- Result = LINK->LINK->proc[LINK->LINK->pc - 1] +
- (LINK->LINK->proc[LINK->LINK->pc] - 32) * 128 - 64;
- LINK->LINK->pc += 2;
- }
- return Result;
+ long Result;
+
+ if (LINK->LINK->proc[LINK->LINK->pc - 1] < 128)
+ {
+ Result = LINK->LINK->proc[LINK->LINK->pc - 1] - 64;
+ LINK->LINK->pc++;
+ }
+ else
+ {
+ Result = LINK->LINK->proc[LINK->LINK->pc - 1] +
+ (LINK->LINK->proc[LINK->LINK->pc] - 32) * 128 - 64;
+ LINK->LINK->pc += 2;
+ }
+ return Result;
}
-static long findpin(i, LINK)
-long i;
-struct LOC_parseterm *LINK;
+static long findpin(long i, struct LOC_parseterm *LINK)
{
- return ((long)LINK->LINK->gpins[i - 1]->temp);
+ return ((long)LINK->LINK->gpins[i - 1]->temp);
}
-static long findvar(i, LINK)
-long i;
-struct LOC_parseterm *LINK;
+static long findvar(long i, struct LOC_parseterm *LINK)
{
- long Result;
+ long Result;
- Result = LINK->LINK->curpvar + i;
- if (i >= LINK->LINK->numvar)
- LINK->LINK->numvar = i + 1;
- return Result;
+ Result = LINK->LINK->curpvar + i;
+ if (i >= LINK->LINK->numvar)
+ LINK->LINK->numvar = i + 1;
+ return Result;
}
-static void checkcomment(LINK)
-struct LOC_parseterm *LINK;
+static void checkcomment(struct LOC_parseterm *LINK)
{
- char s[256];
- long i, FORLIM;
- char STR1[256], STR2[256];
-
- s[LINK->LINK->proc[LINK->LINK->pc - 1] - 32] = '\0';
- FORLIM = strlen(s);
-/* p2c: logsimh.text, line 832:
- * Note: Modification of string length may translate incorrectly [146] */
- for (i = 0; i < FORLIM; i++)
- s[i] = LINK->LINK->proc[LINK->LINK->pc + i];
- LINK->done = false;
- if (strncmp(s, "FORCE_DRIVEN ", 13L) || strlen(s) <= 13 ||
- !strsubset(strcpy(STR1, s + 13), "0123456789"))
- return;
- LINK->ip->opcode = op_alwaysconn;
- LINK->ip->ival = findpin(strtol(strcpy(STR2, s + 13), NULL, 0), LINK);
- LINK->LINK->forcecount++;
- LINK->done = true;
+ char s[256];
+ long i, FORLIM;
+ char STR1[256], STR2[256];
+
+ s[LINK->LINK->proc[LINK->LINK->pc - 1] - 32] = '\0';
+ FORLIM = strlen(s);
+ for (i = 0; i < FORLIM; i++)
+ s[i] = LINK->LINK->proc[LINK->LINK->pc + i];
+ LINK->done = false;
+ if (strncmp(s, "FORCE_DRIVEN ", 13L) || strlen(s) <= 13 ||
+ !strsubset(strcpy(STR1, s + 13), "0123456789"))
+ return;
+ LINK->ip->opcode = op_alwaysconn;
+ LINK->ip->ival = findpin(strtol(strcpy(STR2, s + 13), NULL, 0), LINK);
+ LINK->LINK->forcecount++;
+ LINK->done = true;
}
/* Parse a GDL definition into a tree */
-static instrrec *parseterm(LINK)
-struct LOC_compilepage *LINK;
+static instrrec *parseterm(struct LOC_compilepage *LINK)
{
- struct LOC_parseterm V;
- instrrec *ip1, **ipp;
- long i;
- na_long tempvars;
- char STR1[54];
-
- V.LINK = LINK;
- newinstr(&V.ip, LINK);
- do {
- V.done = true;
- V.ins = LINK->proc[LINK->pc - 1];
- LINK->pc++;
- switch (V.ins / 16) {
-
- case 0:
- switch (V.ins) {
-
- case 0: /*stray end-of-program*/
- V.ip->opcode = op_iffalse; /*closest thing to a real "nop"*/
- break;
-
- case 1:
- case 2:
- case 15: /*NOP, stray END and ELSE*/
- V.done = false;
- break;
-
- case 3:
- case 4:
- case 5:
- case 6:
- case 7:
- case 8: /*IF's*/
- LINK->oldinstrcount++;
- switch (V.ins) {
-
- case 3:
- V.ip->opcode = op_if;
- break;
-
- case 4:
- V.ip->opcode = op_ifnone;
- break;
-
- case 5:
- V.ip->opcode = op_ifzero;
- break;
-
- case 6:
- V.ip->opcode = op_ifone;
- break;
-
- case 7:
- V.ip->opcode = op_ifconn;
- break;
-
- case 8:
- V.ip->opcode = op_ifzn;
- break;
- }
- V.ip->UU.U1.arg1 = parseterm(LINK);
- V.ip->UU.U1.arg2 = NULL;
- V.ip->UU.U1.arg3 = NULL;
- ipp = &V.ip->UU.U1.arg2;
- while (LINK->proc[LINK->pc - 1] >= 32 ||
- ((1L << LINK->proc[LINK->pc - 1]) & 0x8005L) == 0) {
- ip1 = parseterm(LINK);
- *ipp = ip1;
- ipp = &ip1->UU.U1.next;
- }
- if (LINK->proc[LINK->pc - 1] == '\017') {
- LINK->pc++;
- ipp = &V.ip->UU.U1.arg3;
- while (LINK->proc[LINK->pc - 1] >= 32 ||
- ((1L << LINK->proc[LINK->pc - 1]) & 0x5) == 0) {
- ip1 = parseterm(LINK);
- *ipp = ip1;
- ipp = &ip1->UU.U1.next;
- }
- }
- if (LINK->proc[LINK->pc - 1] == '\002')
- LINK->pc++;
- break;
-
- default:
- badop(&V);
- break;
- }
- break;
-
- case 1:
- switch (V.ins & 15) {
-
- case 0: /*ppin=x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pineq;
- V.ip->ival = LINK->baseppin + getpnum(&V);
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 1: /*ppin<x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pinoc;
- V.ip->ival = LINK->baseppin + getpnum(&V);
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 2: /*CALL*/
- logsima_action.lact->actflag = false;
- *logsima_action.lact->actstr = '\0';
- logsima_action.lact->actx = 0;
- (*logsima_action.lact->hook2->send_gengate)(LINK->g, "INERT");
- if (logsima_action.lact->actflag) {
- if (*logsima_action.lact->actstr != '\0') {
- tempvars = LINK->g->vars;
- V.ip->opcode = op_iftrue;
- ipp = &V.ip->UU.U1.arg2;
- for (i = 0; i <= 15; i++) { /*ord('P') - i*/
- if (strposc(logsima_action.lact->actstr, (char)(i + 'A'), 1L) !=
- 0) {
- LINK->oldinstrcount++;
- newinstr(ipp, LINK);
- (*ipp)->opcode = op_vareq;
- (*ipp)->ival = LINK->basepvar + i;
- newinstr(&(*ipp)->UU.U1.arg1, LINK);
- if ((((unsigned long)tempvars) & (1L << (15 - i))) != 0)
- (*ipp)->UU.U1.arg1->opcode = op_one;
- else
- (*ipp)->UU.U1.arg1->opcode = op_zero;
- ipp = &(*ipp)->UU.U1.next;
- }
- }
- } else
- V.done = false;
- } else if (logsima_action.lact->actx == -42) {
- LINK->gcontrol = LINK->g;
- LINK->inertcount--;
- V.done = false;
- } else {
- sprintf(STR1, "Instance cannot contain Pascal-defined gate %s",
- LINK->g->kind->name);
- error(STR1, LINK);
- }
- LINK->pc += LINK->proc[LINK->pc] - 126;
- break;
-
- case 6: /*comment*/
- checkcomment(&V);
- LINK->pc += LINK->proc[LINK->pc - 1] - 31;
- break;
-
- case 7: /*INST*/
- if (LINK->proc[LINK->pc - 1] > '"')
- LINK->curppin += (LINK->proc[LINK->pc + 1] - 32) * 128 +
- LINK->proc[LINK->pc] - 64;
- if (LINK->proc[LINK->pc - 1] > '$')
- LINK->curpvar += (LINK->proc[LINK->pc + 3] - 32) * 128 +
- LINK->proc[LINK->pc + 2] - 64;
- LINK->pc += LINK->proc[LINK->pc - 1] - 33;
- V.done = false;
- break;
-
- case 8: /*pvar=x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = LINK->basepvar + getpnum(&V);
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 9: /*pvar=not pvar*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = LINK->basepvar + getpnum(&V);
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_not;
- newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
- V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
- break;
-
- case 10: /*pvar=zero*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = LINK->basepvar + getpnum(&V);
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_zero;
- break;
-
- case 11: /*pvar=one*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = LINK->basepvar + getpnum(&V);
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_one;
- break;
-
- case 12: /*pin=PULLDN*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pulldn;
- V.ip->UU.U1.arg1 = parsepin(&V);
- break;
-
- case 13: /*pin=PULLUP*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pullup;
- V.ip->UU.U1.arg1 = parsepin(&V);
- break;
-
- case 14: /*high pin=x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pineq;
- V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
- LINK->pc++;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 15: /*high pin<x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pinoc;
- V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
- LINK->pc++;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- default:
- badop(&V);
- break;
- }
- break;
-
- case 2:
- case 3: /*pin=x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pineq;
- V.ip->ival = findpin(V.ins - 31, &V);
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 4:
- case 5: /*pin<x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_pinoc;
- V.ip->ival = findpin(V.ins - 63, &V);
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 6: /*var=x*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = findvar(V.ins & 15, &V);
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 7: /*var=not var*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = findvar(V.ins & 15, &V);
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_not;
- newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
- V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
- break;
-
- case 8: /*var=zero*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = findvar(V.ins & 15, &V);
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_zero;
- break;
-
- case 9: /*var=one*/
- LINK->oldinstrcount++;
- V.ip->opcode = op_vareq;
- V.ip->ival = findvar(V.ins & 15, &V);
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_one;
- break;
-
- case 10:
- case 11:
- switch (V.ins & 31) {
-
- case 0: /*AND*/
- V.ip->opcode = op_and;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- V.ip->UU.U1.arg2 = parseterm(LINK);
- break;
-
- case 1: /*NAND*/
- V.ip->opcode = op_nand;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- V.ip->UU.U1.arg2 = parseterm(LINK);
- break;
-
- case 2: /*OR*/
- V.ip->opcode = op_or;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- V.ip->UU.U1.arg2 = parseterm(LINK);
- break;
-
- case 3: /*NOR*/
- V.ip->opcode = op_nor;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- V.ip->UU.U1.arg2 = parseterm(LINK);
- break;
-
- case 4: /*XOR*/
- V.ip->opcode = op_xor;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- V.ip->UU.U1.arg2 = parseterm(LINK);
- break;
-
- case 5: /*NOT*/
- V.ip->opcode = op_not;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 6: /*RISE*/
- V.ip->opcode = op_rise;
- V.ip->UU.U1.arg1 = parsepin(&V);
- break;
-
- case 7: /*FALL*/
- V.ip->opcode = op_fall;
- V.ip->UU.U1.arg1 = parsepin(&V);
- break;
-
- case 8: /*ZERO*/
- V.ip->opcode = op_zero;
- break;
-
- case 9:
- case 15: /*ONE*/
- V.ip->opcode = op_one;
- break;
-
- case 10: /*SAME*/
- V.ip->opcode = op_same;
- V.ip->UU.U1.arg1 = parsepin(&V);
- V.ip->UU.U1.arg2 = parsepin(&V);
- break;
-
- case 11: /*ppin*/
- V.ip->opcode = op_pin;
- V.ip->ival = LINK->baseppin + getpnum(&V);
- break;
-
- case 12: /*pvar*/
- V.ip->opcode = op_var;
- V.ip->ival = LINK->basepvar + getpnum(&V);
- break;
-
- case 13: /*FIX*/
- V.ip->opcode = op_fix0;
- V.ip->UU.U1.arg1 = parseterm(LINK);
- break;
-
- case 14: /*AMP*/
- V.done = false;
- break;
-
- case 16: /*high pin*/
- V.ip->opcode = op_pin;
- V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
- LINK->pc++;
- break;
-
- case 17: /*STRONG*/
- V.ip->opcode = op_strong;
- V.ip->UU.U1.arg1 = parsepin(&V);
- break;
-
- default:
- badop(&V);
- break;
- }
- break;
-
- case 12:
- case 13: /*pin*/
- V.ip->opcode = op_pin;
- V.ip->ival = findpin(V.ins - 191, &V);
- break;
-
- case 14: /*var*/
- V.ip->opcode = op_var;
- V.ip->ival = findvar(V.ins & 15, &V);
- break;
-
- case 15: /*NOT var*/
- V.ip->opcode = op_not;
- newinstr(&V.ip->UU.U1.arg1, LINK);
- V.ip->UU.U1.arg1->opcode = op_var;
- V.ip->UU.U1.arg1->ival = findvar(V.ins & 15, &V);
- break;
-
- default:
- badop(&V);
- break;
- }
- } while (!V.done);
- return V.ip;
+ struct LOC_parseterm V;
+ instrrec *ip1, **ipp;
+ long i;
+ na_long tempvars;
+ char STR1[54];
+
+ V.LINK = LINK;
+ newinstr(&V.ip, LINK);
+ do
+ {
+ V.done = true;
+ V.ins = LINK->proc[LINK->pc - 1];
+ LINK->pc++;
+ switch (V.ins / 16)
+ {
+ case 0:
+ switch (V.ins)
+ {
+ case 0: /*stray end-of-program*/
+ V.ip->opcode = op_iffalse; /*closest thing to a real "nop"*/
+ break;
+
+ case 1:
+ case 2:
+ case 15: /*NOP, stray END and ELSE*/
+ V.done = false;
+ break;
+
+ case 3:
+ case 4:
+ case 5:
+ case 6:
+ case 7:
+ case 8: /*IF's*/
+ LINK->oldinstrcount++;
+ switch (V.ins)
+ {
+ case 3:
+ V.ip->opcode = op_if;
+ break;
+
+ case 4:
+ V.ip->opcode = op_ifnone;
+ break;
+
+ case 5:
+ V.ip->opcode = op_ifzero;
+ break;
+
+ case 6:
+ V.ip->opcode = op_ifone;
+ break;
+
+ case 7:
+ V.ip->opcode = op_ifconn;
+ break;
+
+ case 8:
+ V.ip->opcode = op_ifzn;
+ break;
+ }
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ V.ip->UU.U1.arg2 = NULL;
+ V.ip->UU.U1.arg3 = NULL;
+ ipp = &V.ip->UU.U1.arg2;
+ while (LINK->proc[LINK->pc - 1] >= 32 ||
+ ((1L << LINK->proc[LINK->pc - 1]) & 0x8005L) == 0)
+ {
+ ip1 = parseterm(LINK);
+ *ipp = ip1;
+ ipp = &ip1->UU.U1.next;
+ }
+
+ if (LINK->proc[LINK->pc - 1] == '\017')
+ {
+ LINK->pc++;
+ ipp = &V.ip->UU.U1.arg3;
+ while (LINK->proc[LINK->pc - 1] >= 32 ||
+ ((1L << LINK->proc[LINK->pc - 1]) & 0x5) == 0)
+ {
+ ip1 = parseterm(LINK);
+ *ipp = ip1;
+ ipp = &ip1->UU.U1.next;
+ }
+ }
+
+ if (LINK->proc[LINK->pc - 1] == '\002')
+ LINK->pc++;
+ break;
+
+ default:
+ badop(&V);
+ break;
+ }
+ break;
+
+ case 1:
+ switch (V.ins & 15)
+ {
+
+ case 0: /*ppin=x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pineq;
+ V.ip->ival = LINK->baseppin + getpnum(&V);
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 1: /*ppin<x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pinoc;
+ V.ip->ival = LINK->baseppin + getpnum(&V);
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 2: /*CALL*/
+ logsima_action.lact->actflag = false;
+ *logsima_action.lact->actstr = '\0';
+ logsima_action.lact->actx = 0;
+ (*logsima_action.lact->hook2->send_gengate)(LINK->g, "INERT");
+ if (logsima_action.lact->actflag)
+ {
+ if (*logsima_action.lact->actstr != '\0')
+ {
+ tempvars = LINK->g->vars;
+ V.ip->opcode = op_iftrue;
+ ipp = &V.ip->UU.U1.arg2;
+ for (i = 0; i <= 15; i++)
+ { /*ord('P') - i*/
+ if (strposc(logsima_action.lact->actstr, (char)(i + 'A'), 1L) != 0)
+ {
+ LINK->oldinstrcount++;
+ newinstr(ipp, LINK);
+ (*ipp)->opcode = op_vareq;
+ (*ipp)->ival = LINK->basepvar + i;
+ newinstr(&(*ipp)->UU.U1.arg1, LINK);
+
+ if ((((unsigned long)tempvars) & (1L << (15 - i))) != 0)
+ (*ipp)->UU.U1.arg1->opcode = op_one;
+ else
+ (*ipp)->UU.U1.arg1->opcode = op_zero;
+ ipp = &(*ipp)->UU.U1.next;
+ }
+ }
+ }
+ else
+ {
+ V.done = false;
+ }
+ }
+ else if (logsima_action.lact->actx == -42)
+ {
+ LINK->gcontrol = LINK->g;
+ LINK->inertcount--;
+ V.done = false;
+ }
+ else
+ {
+ sprintf(STR1, "Instance cannot contain Pascal-defined gate %s",
+ LINK->g->kind->name);
+ error(STR1, LINK);
+ }
+ LINK->pc += LINK->proc[LINK->pc] - 126;
+ break;
+
+ case 6: /*comment*/
+ checkcomment(&V);
+ LINK->pc += LINK->proc[LINK->pc - 1] - 31;
+ break;
+
+ case 7: /*INST*/
+ if (LINK->proc[LINK->pc - 1] > '"')
+ LINK->curppin += (LINK->proc[LINK->pc + 1] - 32) * 128 +
+ LINK->proc[LINK->pc] - 64;
+ if (LINK->proc[LINK->pc - 1] > '$')
+ LINK->curpvar += (LINK->proc[LINK->pc + 3] - 32) * 128 +
+ LINK->proc[LINK->pc + 2] - 64;
+ LINK->pc += LINK->proc[LINK->pc - 1] - 33;
+ V.done = false;
+ break;
+
+ case 8: /*pvar=x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = LINK->basepvar + getpnum(&V);
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 9: /*pvar=not pvar*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = LINK->basepvar + getpnum(&V);
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_not;
+ newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
+ V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
+ break;
+
+ case 10: /*pvar=zero*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = LINK->basepvar + getpnum(&V);
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_zero;
+ break;
+
+ case 11: /*pvar=one*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = LINK->basepvar + getpnum(&V);
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_one;
+ break;
+
+ case 12: /*pin=PULLDN*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pulldn;
+ V.ip->UU.U1.arg1 = parsepin(&V);
+ break;
+
+ case 13: /*pin=PULLUP*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pullup;
+ V.ip->UU.U1.arg1 = parsepin(&V);
+ break;
+
+ case 14: /*high pin=x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pineq;
+ V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
+ LINK->pc++;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 15: /*high pin<x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pinoc;
+ V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
+ LINK->pc++;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ default:
+ badop(&V);
+ break;
+ }
+ break;
+
+ case 2:
+ case 3: /*pin=x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pineq;
+ V.ip->ival = findpin(V.ins - 31, &V);
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 4:
+ case 5: /*pin<x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_pinoc;
+ V.ip->ival = findpin(V.ins - 63, &V);
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 6: /*var=x*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = findvar(V.ins & 15, &V);
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 7: /*var=not var*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = findvar(V.ins & 15, &V);
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_not;
+ newinstr(&V.ip->UU.U1.arg1->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->UU.U1.arg1->opcode = op_var;
+ V.ip->UU.U1.arg1->UU.U1.arg1->ival = V.ip->ival;
+ break;
+
+ case 8: /*var=zero*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = findvar(V.ins & 15, &V);
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_zero;
+ break;
+
+ case 9: /*var=one*/
+ LINK->oldinstrcount++;
+ V.ip->opcode = op_vareq;
+ V.ip->ival = findvar(V.ins & 15, &V);
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_one;
+ break;
+
+ case 10:
+ case 11:
+ switch (V.ins & 31)
+ {
+ case 0: /*AND*/
+ V.ip->opcode = op_and;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ V.ip->UU.U1.arg2 = parseterm(LINK);
+ break;
+
+ case 1: /*NAND*/
+ V.ip->opcode = op_nand;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ V.ip->UU.U1.arg2 = parseterm(LINK);
+ break;
+
+ case 2: /*OR*/
+ V.ip->opcode = op_or;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ V.ip->UU.U1.arg2 = parseterm(LINK);
+ break;
+
+ case 3: /*NOR*/
+ V.ip->opcode = op_nor;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ V.ip->UU.U1.arg2 = parseterm(LINK);
+ break;
+
+ case 4: /*XOR*/
+ V.ip->opcode = op_xor;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ V.ip->UU.U1.arg2 = parseterm(LINK);
+ break;
+
+ case 5: /*NOT*/
+ V.ip->opcode = op_not;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 6: /*RISE*/
+ V.ip->opcode = op_rise;
+ V.ip->UU.U1.arg1 = parsepin(&V);
+ break;
+
+ case 7: /*FALL*/
+ V.ip->opcode = op_fall;
+ V.ip->UU.U1.arg1 = parsepin(&V);
+ break;
+
+ case 8: /*ZERO*/
+ V.ip->opcode = op_zero;
+ break;
+
+ case 9:
+ case 15: /*ONE*/
+ V.ip->opcode = op_one;
+ break;
+
+ case 10: /*SAME*/
+ V.ip->opcode = op_same;
+ V.ip->UU.U1.arg1 = parsepin(&V);
+ V.ip->UU.U1.arg2 = parsepin(&V);
+ break;
+
+ case 11: /*ppin*/
+ V.ip->opcode = op_pin;
+ V.ip->ival = LINK->baseppin + getpnum(&V);
+ break;
+
+ case 12: /*pvar*/
+ V.ip->opcode = op_var;
+ V.ip->ival = LINK->basepvar + getpnum(&V);
+ break;
+
+ case 13: /*FIX*/
+ V.ip->opcode = op_fix0;
+ V.ip->UU.U1.arg1 = parseterm(LINK);
+ break;
+
+ case 14: /*AMP*/
+ V.done = false;
+ break;
+
+ case 16: /*high pin*/
+ V.ip->opcode = op_pin;
+ V.ip->ival = findpin(LINK->proc[LINK->pc - 1] + 1L, &V);
+ LINK->pc++;
+ break;
+
+ case 17: /*STRONG*/
+ V.ip->opcode = op_strong;
+ V.ip->UU.U1.arg1 = parsepin(&V);
+ break;
+
+ default:
+ badop(&V);
+ break;
+ }
+ break;
+
+ case 12:
+ case 13: /*pin*/
+ V.ip->opcode = op_pin;
+ V.ip->ival = findpin(V.ins - 191, &V);
+ break;
+
+ case 14: /*var*/
+ V.ip->opcode = op_var;
+ V.ip->ival = findvar(V.ins & 15, &V);
+ break;
+
+ case 15: /*NOT var*/
+ V.ip->opcode = op_not;
+ newinstr(&V.ip->UU.U1.arg1, LINK);
+ V.ip->UU.U1.arg1->opcode = op_var;
+ V.ip->UU.U1.arg1->ival = findvar(V.ins & 15, &V);
+ break;
+
+ default:
+ badop(&V);
+ break;
+ }
+ } while (!V.done);
+ return V.ip;
}
/* Find out which pins are inputs and which are outputs */
-static void getpindata(pindata, numpins, proc, LINK)
-pdrec **pindata;
-long numpins;
-uchar *proc;
-struct LOC_compilepage *LINK;
+static void getpindata(pdrec **pindata, long numpins, uchar *proc, struct LOC_compilepage *LINK)
{
- long i, pc;
- pdrec *WITH;
-
- if (*pindata != NULL)
- return;
- *pindata = (pdrec *)Malloc(numpins * sizeof(pdrec));
- for (i = 0; i < numpins; i++) {
- WITH = &(*pindata)[i];
- WITH->isinput = false;
- WITH->isoutput = false;
- }
- pc = 1;
- while (proc[pc - 1] != '\0') {
- switch (proc[pc - 1]) {
-
- case 30:
- case 31: /*output to high-numbered pin*/
- (*pindata)[proc[pc]].isoutput = true;
- pc += 2;
- break;
-
- case 176: /*input from high-numbered pin*/
- (*pindata)[proc[pc]].isinput = true;
- pc += 2;
- break;
-
- case 28:
- case 29: /*pull-up or pull-down*/
- pc++;
- if (proc[pc - 1] == 176) {
-/* p2c: logsimh.text, line 1244: Note: character >= 128 encountered [281] */
- (*pindata)[proc[pc]].isoutput = true;
- pc += 2;
- } else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223) {
-/* p2c: logsimh.text, line 1249: Note: character >= 128 encountered [281] */
-/* p2c: logsimh.text, line 1249: Note: character >= 128 encountered [281] */
- (*pindata)[proc[pc - 1] & 31].isoutput = true;
- pc++;
- }
- break;
-
- case 16:
- case 17:
- case 24:
- case 25:
- case 26:
- case 27:
- case 171:
- case 172:
- pc += (proc[pc] >= 128) + 2;
-/* p2c: logsimh.text, line 1256: Note: character >= 128 encountered [281] */
- break;
-
- case 18:
- case 22:
- case 23:
- case 170:
- pc += length_16(proc, pc);
- break;
-
- default:
- if (proc[pc - 1] >= 32 && proc[pc - 1] <= 95) {
- /*output to low-numbered pin*/
- (*pindata)[proc[pc - 1] & 31].isoutput = true;
- pc++;
- } else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223) {
- /*input from low-numbered pin*/
- (*pindata)[proc[pc - 1] & 31].isinput = true;
- pc++;
- } else
- pc++;
- break;
- }
- }
+ long i, pc;
+ pdrec *WITH;
+
+ if (*pindata != NULL)
+ return;
+
+ *pindata = (pdrec *)Malloc(numpins * sizeof(pdrec));
+ for (i = 0; i < numpins; i++)
+ {
+ WITH = &(*pindata)[i];
+ WITH->isinput = false;
+ WITH->isoutput = false;
+ }
+ pc = 1;
+ while (proc[pc - 1] != '\0')
+ {
+ switch (proc[pc - 1])
+ {
+ case 30:
+ case 31: /*output to high-numbered pin*/
+ (*pindata)[proc[pc]].isoutput = true;
+ pc += 2;
+ break;
+
+ case 176: /*input from high-numbered pin*/
+ (*pindata)[proc[pc]].isinput = true;
+ pc += 2;
+ break;
+
+ case 28:
+ case 29: /*pull-up or pull-down*/
+ pc++;
+ if (proc[pc - 1] == 176)
+ {
+ (*pindata)[proc[pc]].isoutput = true;
+ pc += 2;
+ }
+ else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223)
+ {
+ (*pindata)[proc[pc - 1] & 31].isoutput = true;
+ pc++;
+ }
+ break;
+
+ case 16:
+ case 17:
+ case 24:
+ case 25:
+ case 26:
+ case 27:
+ case 171:
+ case 172:
+ pc += (proc[pc] >= 128) + 2;
+ break;
+
+ case 18:
+ case 22:
+ case 23:
+ case 170:
+ pc += length_16(proc, pc);
+ break;
+
+ default:
+ if (proc[pc - 1] >= 32 && proc[pc - 1] <= 95)
+ {
+ /*output to low-numbered pin*/
+ (*pindata)[proc[pc - 1] & 31].isoutput = true;
+ pc++;
+ }
+ else if (proc[pc - 1] >= 192 && proc[pc - 1] <= 223)
+ {
+ /*input from low-numbered pin*/
+ (*pindata)[proc[pc - 1] & 31].isinput = true;
+ pc++;
+ }
+ else
+ {
+ pc++;
+ }
+ break;
+ }
+ }
}
-static long setbytes(bits, LINK)
-long bits;
-struct LOC_compilepage *LINK;
+static long setbytes(long bits, struct LOC_compilepage *LINK)
{
- return ((bits + 63) / 32 * 4);
+ return ((bits + 63) / 32 * 4);
}
/* Local variables for parsegates: */
struct LOC_parsegates {
- struct LOC_compilepage *LINK;
+ struct LOC_compilepage *LINK;
} ;
-static void subupdate(g1, LINK)
-log_grec *g1;
-struct LOC_parsegates *LINK;
+static void subupdate(log_grec *g1, struct LOC_parsegates *LINK)
{
- log_nrec **ports;
- long i;
- log_action_t *WITH;
- long FORLIM;
-
- WITH = logsima_action.lact;
- ports = (log_nrec **)Malloc(LINK->LINK->numports * sizeof(log_nrec *));
- LINK->LINK->n = WITH->nbase;
- while (LINK->LINK->n != NULL)
- { /*save global "node^.temp.i" for reentrant code*/
- if ((long)LINK->LINK->n->temp != LONG_MIN)
- ports[-(long)LINK->LINK->n->temp - 1] = LINK->LINK->n;
- LINK->LINK->n = LINK->LINK->n->next;
- }
- updateinstance(g1);
- LINK->LINK->n = WITH->nbase;
- while (LINK->LINK->n != NULL) { /*restore "node^.temp.i" information*/
- LINK->LINK->n->temp = (na_long)LONG_MIN;
- LINK->LINK->n = LINK->LINK->n->next;
- }
- FORLIM = LINK->LINK->numports;
- for (i = 1; i <= FORLIM; i++)
- ports[i - 1]->temp = (na_long)(-i);
+ log_nrec **ports;
+ long i;
+ log_action_t *WITH;
+ long FORLIM;
+
+ WITH = logsima_action.lact;
+ ports = (log_nrec **)Malloc(LINK->LINK->numports * sizeof(log_nrec *));
+ LINK->LINK->n = WITH->nbase;
+ while (LINK->LINK->n != NULL)
+ { /*save global "node^.temp.i" for reentrant code*/
+ if ((long)LINK->LINK->n->temp != LONG_MIN)
+ ports[-(long)LINK->LINK->n->temp - 1] = LINK->LINK->n;
+ LINK->LINK->n = LINK->LINK->n->next;
+ }
+ updateinstance(g1);
+ LINK->LINK->n = WITH->nbase;
+ while (LINK->LINK->n != NULL)
+ { /*restore "node^.temp.i" information*/
+ LINK->LINK->n->temp = (na_long)LONG_MIN;
+ LINK->LINK->n = LINK->LINK->n->next;
+ }
+ FORLIM = LINK->LINK->numports;
+ for (i = 1; i <= FORLIM; i++)
+ ports[i - 1]->temp = (na_long)(-i);
}
-static void parsegates(LINK)
-struct LOC_compilepage *LINK;
+static void parsegates(struct LOC_compilepage *LINK)
{
- struct LOC_parsegates V;
- long i, j, num, best, setsize, first, numg, previnstrcount;
- long *defs, *tdefs;
- log_grec *g1;
- gaterec *glist;
- instinfo *instii;
- dependrec *dep;
- instrrec *ip, **ipp;
- log_16_kindinfo *ki;
- int any;
- gaterec *WITH;
- char STR2[256];
- long FORLIM, FORLIM1;
- long SET[257];
- long SET1[257];
- long SET2[257];
- pdrec *WITH1;
- long SET3[257];
- long SET4[257];
-
-
- V.LINK = LINK;
- /* Collect a list of all gates in the definition */
- g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
- i = 0;
- while (g1 != NULL) {
- if (gateinbox(LINK->mybox, g1) && g1 != LINK->gtempl) {
- if (g1->kind->simtype == logsima_tool_16)
- i++;
- LINK->inertcount++;
- }
- g1 = g1->next;
- }
- glist = (gaterec *)Malloc(i * sizeof(gaterec));
- numg = 0;
- g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
- while (g1 != NULL && LINK->okay) {
- if (g1 != LINK->gtempl && g1->kind->simtype == logsima_tool_16 &&
- gateinbox(LINK->mybox, g1) && !isinert(g1, LINK)) {
- if (isinstance(g1) != NULL) { /* a sub-instance gate */
- subupdate(g1, &V);
- instii = (instinfo *)g1->info;
- if (instii->hdef->gtempl != g1) { /* not a template gate */
- dep = LINK->hdef->depends;
- while (dep != NULL && dep->hdef != instii->hdef)
- dep = dep->next;
- if (dep == NULL) {
- dep = (dependrec *)Malloc(sizeof(dependrec));
- dep->hdef = instii->hdef;
- dep->hdefstamp = instii->hdef->curstamp;
- dep->next = LINK->hdef->depends;
- LINK->hdef->depends = dep;
- }
- if (instii->okay) {
- numg++;
- WITH = &glist[numg - 1];
- WITH->gp = g1;
- WITH->numpins = instii->hdef->numports;
- WITH->pins = instii->pins;
- WITH->pproc = instii->hdef->proc;
- if (LINK->optlevel >= 2)
- getpindata(&instii->hdef->pindata, (long)WITH->numpins,
- WITH->pproc, LINK);
- WITH->pd = instii->hdef->pindata;
- LINK->subcount++;
- } else {
- if (instii->hdef != LINK->hdef) {
- sprintf(STR2, "Sub-instance %s is not complete",
- instii->hdef->name);
- showcontrol(LINK->hdef, STR2);
- }
- LINK->okay = false;
- }
+ struct LOC_parsegates V;
+ long i, j, num, best, setsize, first, numg, previnstrcount;
+ long *defs, *tdefs;
+ log_grec *g1;
+ gaterec *glist;
+ instinfo *instii;
+ dependrec *dep;
+ instrrec *ip, **ipp;
+ log_16_kindinfo *ki;
+ int any;
+ gaterec *WITH;
+ char STR2[256];
+ long FORLIM, FORLIM1;
+ long SET[257];
+ long SET1[257];
+ long SET2[257];
+ pdrec *WITH1;
+ long SET3[257];
+ long SET4[257];
+
+
+ V.LINK = LINK;
+ /* Collect a list of all gates in the definition */
+ g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
+ i = 0;
+ while (g1 != NULL)
+ {
+ if (gateinbox(LINK->mybox, g1) && g1 != LINK->gtempl)
+ {
+ if (g1->kind->simtype == logsima_tool_16)
+ i++;
+ LINK->inertcount++;
+ }
+ g1 = g1->next;
}
- } else {
- numg++;
- WITH = &glist[numg - 1];
- WITH->gp = g1;
- WITH->numpins = g1->kind->numpins;
- WITH->pins = g1->pin;
- WITH->pproc = g1->kind->proc;
- ki = (log_16_kindinfo *)g1->kind->info;
- if (LINK->optlevel >= 2)
- getpindata((pdrec **)(&ki->info), (long)WITH->numpins, WITH->pproc,
- LINK);
- WITH->pd = (pdrec *)ki->info;
- }
- }
- g1 = g1->next;
- }
-
- /* Assign numbers for internal nodes */
- if (LINK->okay) {
- for (i = 0; i < numg; i++) {
- WITH = &glist[i];
- FORLIM1 = WITH->numpins;
- for (j = 0; j < FORLIM1; j++) {
- if ((long)WITH->pins[j]->temp == LONG_MIN) {
- WITH->pins[j]->temp = (na_long)LINK->curppin;
- LINK->curppin++;
+ glist = (gaterec *)Malloc(i * sizeof(gaterec));
+ numg = 0;
+ g1 = logsima_action.lact->gbase[LINK->hdef->pgnum - 1];
+ while (g1 != NULL && LINK->okay)
+ {
+ if (g1 != LINK->gtempl && g1->kind->simtype == logsima_tool_16 &&
+ gateinbox(LINK->mybox, g1) && !isinert(g1, LINK))
+ {
+ if (isinstance(g1) != NULL)
+ { /* a sub-instance gate */
+ subupdate(g1, &V);
+ instii = (instinfo *)g1->info;
+ if (instii->hdef->gtempl != g1)
+ { /* not a template gate */
+ dep = LINK->hdef->depends;
+ while (dep != NULL && dep->hdef != instii->hdef)
+ dep = dep->next;
+
+ if (dep == NULL)
+ {
+ dep = (dependrec *)Malloc(sizeof(dependrec));
+ dep->hdef = instii->hdef;
+ dep->hdefstamp = instii->hdef->curstamp;
+ dep->next = LINK->hdef->depends;
+ LINK->hdef->depends = dep;
+ }
+
+ if (instii->okay)
+ {
+ numg++;
+ WITH = &glist[numg - 1];
+ WITH->gp = g1;
+ WITH->numpins = instii->hdef->numports;
+ WITH->pins = instii->pins;
+ WITH->pproc = instii->hdef->proc;
+ if (LINK->optlevel >= 2)
+ getpindata(&instii->hdef->pindata, (long)WITH->numpins,
+ WITH->pproc, LINK);
+ WITH->pd = instii->hdef->pindata;
+ LINK->subcount++;
+ }
+ else
+ {
+ if (instii->hdef != LINK->hdef)
+ {
+ sprintf(STR2, "Sub-instance %s is not complete",
+ instii->hdef->name);
+ showcontrol(LINK->hdef, STR2);
+ }
+ LINK->okay = false;
+ }
+ }
+ }
+ else
+ {
+ numg++;
+ WITH = &glist[numg - 1];
+ WITH->gp = g1;
+ WITH->numpins = g1->kind->numpins;
+ WITH->pins = g1->pin;
+ WITH->pproc = g1->kind->proc;
+ ki = (log_16_kindinfo *)g1->kind->info;
+ if (LINK->optlevel >= 2)
+ getpindata((pdrec **)(&ki->info), (long)WITH->numpins, WITH->pproc,
+ LINK);
+ WITH->pd = (pdrec *)ki->info;
+ }
+ }
+ g1 = g1->next;
}
- }
- }
- }
-
- /* Sort gates into mostly "causal" order */
- if (LINK->optlevel >= 2 && LINK->okay) {
- setsize = setbytes(LINK->curppin + LINK->numports, LINK);
- defs = (long *)Malloc(setsize);
- P_addsetr(P_expset(defs, 0L), 0, (int)(LINK->numports - 1));
- if (vddsig->np->simtype == logsima_tool_16 &&
- (long)vddsig->np->temp != LONG_MIN)
- P_addset(defs, (int)((long)vddsig->np->temp + LINK->numports));
- if (gndsig->np->simtype == logsima_tool_16 &&
- (long)gndsig->np->temp != LONG_MIN)
- P_addset(defs, (int)((long)gndsig->np->temp + LINK->numports));
- tdefs = (long *)Malloc(setsize);
- for (i = 0; i < numg; i++) {
- WITH = &glist[i];
- WITH->ins = (long *)Malloc(setsize);
- P_expset(WITH->ins, 0L);
- WITH->outs = (long *)Malloc(setsize);
- P_expset(WITH->outs, 0L);
- FORLIM = WITH->numpins;
- for (j = 0; j < FORLIM; j++) {
- WITH1 = &WITH->pd[j];
- num = (long)WITH->pins[j]->temp + LINK->numports;
- if (num <= setmax) {
- if (WITH1->isinput)
- P_addset(WITH->ins, (int)num);
- if (WITH1->isoutput) {
- P_addset(WITH->outs, (int)num);
- if (num < LINK->numports)
- P_remset(defs, (int)num);
- }
+
+ /* Assign numbers for internal nodes */
+ if (LINK->okay)
+ {
+ for (i = 0; i < numg; i++)
+ {
+ WITH = &glist[i];
+ FORLIM1 = WITH->numpins;
+ for (j = 0; j < FORLIM1; j++)
+ {
+ if ((long)WITH->pins[j]->temp == LONG_MIN)
+ {
+ WITH->pins[j]->temp = (na_long)LINK->curppin;
+ LINK->curppin++;
+ }
+ }
+ }
}
- }
- }
- first = 1;
- while (first < numg) {
- any = false;
- i = first;
- while (i <= numg) {
- if (!P_subset(glist[i - 1].ins, defs)) {
- i++;
- continue;
+
+ /* Sort gates into mostly "causal" order */
+ if (LINK->optlevel >= 2 && LINK->okay)
+ {
+ setsize = setbytes(LINK->curppin + LINK->numports, LINK);
+ defs = (long *)Malloc(setsize);
+ P_addsetr(P_expset(defs, 0L), 0, (int)(LINK->numports - 1));
+ if (vddsig->np->simtype == logsima_tool_16 &&
+ (long)vddsig->np->temp != LONG_MIN)
+ P_addset(defs, (int)((long)vddsig->np->temp + LINK->numports));
+ if (gndsig->np->simtype == logsima_tool_16 &&
+ (long)gndsig->np->temp != LONG_MIN)
+ P_addset(defs, (int)((long)gndsig->np->temp + LINK->numports));
+ tdefs = (long *)Malloc(setsize);
+ for (i = 0; i < numg; i++)
+ {
+ WITH = &glist[i];
+ WITH->ins = (long *)Malloc(setsize);
+ P_expset(WITH->ins, 0L);
+ WITH->outs = (long *)Malloc(setsize);
+ P_expset(WITH->outs, 0L);
+ FORLIM = WITH->numpins;
+ for (j = 0; j < FORLIM; j++)
+ {
+ WITH1 = &WITH->pd[j];
+ num = (long)WITH->pins[j]->temp + LINK->numports;
+ if (num <= setmax) {
+ if (WITH1->isinput)
+ P_addset(WITH->ins, (int)num);
+ if (WITH1->isoutput) {
+ P_addset(WITH->outs, (int)num);
+ if (num < LINK->numports)
+ P_remset(defs, (int)num);
+ }
+ }
+ }
+ }
+ first = 1;
+ while (first < numg)
+ {
+ any = false;
+ i = first;
+ while (i <= numg)
+ {
+ if (!P_subset(glist[i - 1].ins, defs))
+ {
+ i++;
+ continue;
+ }
+
+ if (i == first)
+ i++;
+ else
+ na_exch((void *)(&glist[i - 1]), (void *)(&glist[first - 1]),
+ sizeof(gaterec));
+ P_setunion(defs, defs, glist[first - 1].outs);
+ first++;
+ any = true;
+ }
+
+ if (any)
+ continue;
+
+ best = LONG_MAX;
+ for (i = first; i <= numg; i++)
+ {
+ P_setdiff(tdefs, glist[i - 1].ins, defs);
+ num = na_setcard(tdefs);
+ if (num < best)
+ {
+ best = num;
+ j = i;
+ }
+ }
+ na_exch((void *)(&glist[j - 1]), (void *)(&glist[first - 1]),
+ sizeof(gaterec));
+ P_setunion(defs, defs, glist[first - 1].outs);
+ first++;
+ }
}
- if (i == first)
- i++;
- else
- na_exch((void *)(&glist[i - 1]), (void *)(&glist[first - 1]),
- sizeof(gaterec));
- P_setunion(defs, defs, glist[first - 1].outs);
- first++;
- any = true;
- }
- if (any)
- continue;
- best = LONG_MAX;
- for (i = first; i <= numg; i++) {
- P_setdiff(tdefs, glist[i - 1].ins, defs);
- num = na_setcard(tdefs);
- if (num < best) {
- best = num;
- j = i;
+
+ /* Parse the GDL definitions of the gates */
+ ipp = &LINK->ipbase;
+ if (LINK->okay)
+ {
+ for (i = 0; i < numg; i++)
+ {
+ WITH = &glist[i];
+ LINK->g = WITH->gp;
+ LINK->proc = WITH->pproc;
+ LINK->gpins = WITH->pins;
+ LINK->baseppin = LINK->curppin;
+ LINK->basepvar = LINK->curpvar;
+ LINK->numvar = 0;
+ LINK->pc = 1;
+ while (LINK->okay && LINK->proc[LINK->pc - 1] != '\0')
+ {
+ previnstrcount = LINK->oldinstrcount;
+ LINK->ip1 = parseterm(LINK);
+ if (LINK->oldinstrcount > previnstrcount)
+ LINK->gatecount++;
+ if (LINK->ip1->opcode == op_zero) /*more suitable "null" stmt*/
+ LINK->ip1->opcode = op_iffalse;
+ if (LINK->isverbose)
+ {
+ printf("parsed: ");
+ dumptree(stdout, LINK->ip1, NULL, LINK);
+ }
+ *ipp = LINK->ip1;
+ ipp = &LINK->ip1->UU.U1.next;
+ }
+ LINK->curpvar += LINK->numvar;
+ }
}
- }
- na_exch((void *)(&glist[j - 1]), (void *)(&glist[first - 1]),
- sizeof(gaterec));
- P_setunion(defs, defs, glist[first - 1].outs);
- first++;
- }
- }
-
- /* Parse the GDL definitions of the gates */
- ipp = &LINK->ipbase;
- if (LINK->okay) {
- for (i = 0; i < numg; i++) {
- WITH = &glist[i];
- LINK->g = WITH->gp;
- LINK->proc = WITH->pproc;
- LINK->gpins = WITH->pins;
- LINK->baseppin = LINK->curppin;
- LINK->basepvar = LINK->curpvar;
- LINK->numvar = 0;
- LINK->pc = 1;
- while (LINK->okay && LINK->proc[LINK->pc - 1] != '\0') {
- previnstrcount = LINK->oldinstrcount;
- LINK->ip1 = parseterm(LINK);
- if (LINK->oldinstrcount > previnstrcount)
- LINK->gatecount++;
- if (LINK->ip1->opcode == op_zero) /*more suitable "null" stmt*/
- LINK->ip1->opcode = op_iffalse;
- if (LINK->isverbose) {
- printf("parsed: ");
- dumptree(stdout, LINK->ip1, NULL, LINK);
+ LINK->inertcount -= LINK->gatecount;
+ LINK->gatecount -= LINK->subcount;
+
+ /* Create bogus instrs to handle Vdd and Gnd */
+ if (!LINK->okay)
+ return;
+
+ if (vddsig->np->simtype == logsima_tool_16 &&
+ (long)vddsig->np->temp != LONG_MIN)
+ {
+ newinstr(&ip, LINK);
+ ip->UU.U1.next = LINK->ipbase;
+ ip->opcode = op_pineq;
+ ip->ival = (long)vddsig->np->temp;
+ newinstr(&ip->UU.U1.arg1, LINK);
+ ip->UU.U1.arg1->opcode = op_one;
+ LINK->ipbase = ip;
+ LINK->oldinstrcount++;
}
- *ipp = LINK->ip1;
- ipp = &LINK->ip1->UU.U1.next;
- }
- LINK->curpvar += LINK->numvar;
- }
- }
- LINK->inertcount -= LINK->gatecount;
- LINK->gatecount -= LINK->subcount;
-
- /* Create bogus instrs to handle Vdd and Gnd */
- if (!LINK->okay)
- return;
- if (vddsig->np->simtype == logsima_tool_16 &&
- (long)vddsig->np->temp != LONG_MIN) {
- newinstr(&ip, LINK);
- ip->UU.U1.next = LINK->ipbase;
- ip->opcode = op_pineq;
- ip->ival = (long)vddsig->np->temp;
- newinstr(&ip->UU.U1.arg1, LINK);
- ip->UU.U1.arg1->opcode = op_one;
- LINK->ipbase = ip;
- LINK->oldinstrcount++;
- }
- if (gndsig->np->simtype != logsima_tool_16 ||
- (long)gndsig->np->temp == LONG_MIN)
- return;
- newinstr(&ip, LINK);
- ip->UU.U1.next = LINK->ipbase;
- ip->opcode = op_pineq;
- ip->ival = (long)gndsig->np->temp;
- newinstr(&ip->UU.U1.arg1, LINK);
- ip->UU.U1.arg1->opcode = op_zero;
- LINK->ipbase = ip;
- LINK->oldinstrcount++;
+
+ if (gndsig->np->simtype != logsima_tool_16 ||
+ (long)gndsig->np->temp == LONG_MIN)
+ return;
+
+ newinstr(&ip, LINK);
+ ip->UU.U1.next = LINK->ipbase;
+ ip->opcode = op_pineq;
+ ip->ival = (long)gndsig->np->temp;
+ newinstr(&ip->UU.U1.arg1, LINK);
+ ip->UU.U1.arg1->opcode = op_zero;
+ LINK->ipbase = ip;
+ LINK->oldinstrcount++;
} /*parsegates*/
/* Simplify a procedure tree */
-static int checkconn(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static int checkconn(instrrec *ip, struct LOC_compilepage *LINK)
{
- int Result;
-
- switch (ip->opcode) {
-
- case op_and:
- case op_nand:
- case op_or:
- case op_nor:
- case op_xor:
- Result = (checkconn(ip->UU.U1.arg1, LINK) ||
- checkconn(ip->UU.U1.arg2, LINK));
- break;
-
- case op_not:
- Result = checkconn(ip->UU.U1.arg1, LINK);
- break;
-
- case op_same:
- case op_var:
- case op_fix0:
- case op_fix1:
- case op_rise:
- case op_fall:
- Result = true;
- break;
-
- case op_pin:
- case op_pinref:
- Result = (((1L << ((long)log_none)) &
- LINK->things[ip->ival + LINK->thingnodes].poss) == 0);
- break;
-
- default:
- Result = false;
- break;
- }
- return Result;
+ int Result;
+
+ switch (ip->opcode)
+ {
+ case op_and:
+ case op_nand:
+ case op_or:
+ case op_nor:
+ case op_xor:
+ Result = (checkconn(ip->UU.U1.arg1, LINK) ||
+ checkconn(ip->UU.U1.arg2, LINK));
+ break;
+
+ case op_not:
+ Result = checkconn(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_same:
+ case op_var:
+ case op_fix0:
+ case op_fix1:
+ case op_rise:
+ case op_fall:
+ Result = true;
+ break;
+
+ case op_pin:
+ case op_pinref:
+ Result = (((1L << ((long)log_none)) &
+ LINK->things[ip->ival + LINK->thingnodes].poss) == 0);
+ break;
+
+ default:
+ Result = false;
+ break;
+ }
+ return Result;
}
-static int cmptrees(ip1, ip2, LINK)
-instrrec *ip1, *ip2;
-struct LOC_compilepage *LINK;
+static int cmptrees(instrrec *ip1, instrrec *ip2, struct LOC_compilepage *LINK)
{
- if (ip1 == NULL)
- return (ip2 == NULL);
- else if (ip2 == NULL)
- return false;
- else if (ip1->opcode != ip2->opcode)
- return false;
- else if (ip1->ival != ip2->ival &&
- ((1L << ((long)ip1->opcode)) &
- ((1L << ((long)op_pineq)) | (1L << ((long)op_pinoc)) |
- (1L << ((long)op_vareq)) | (1L << ((long)op_pin)) |
- (1L << ((long)op_pinref)) | (1L << ((long)op_var)))) != 0)
-/* p2c: logsimh.text, line 3879: Note:
- * Line breaker spent 4.0+1.00 seconds, 5000 tries on line 1761 [251] */
- return false;
- else if (!cmptrees(ip1->UU.U1.arg1, ip2->UU.U1.arg1, LINK))
- return false;
- else if (!cmptrees(ip1->UU.U1.arg2, ip2->UU.U1.arg2, LINK))
- return false;
- else if (!cmptrees(ip1->UU.U1.arg3, ip2->UU.U1.arg3, LINK))
- return false;
- else
- return true;
+ if (ip1 == NULL)
+ return (ip2 == NULL);
+ else if (ip2 == NULL)
+ return false;
+ else if (ip1->opcode != ip2->opcode)
+ return false;
+ else if (ip1->ival != ip2->ival &&
+ ((1L << ((long)ip1->opcode)) &
+ ((1L << ((long)op_pineq)) | (1L << ((long)op_pinoc)) |
+ (1L << ((long)op_vareq)) | (1L << ((long)op_pin)) |
+ (1L << ((long)op_pinref)) | (1L << ((long)op_var)))) != 0)
+ return false;
+ else if (!cmptrees(ip1->UU.U1.arg1, ip2->UU.U1.arg1, LINK))
+ return false;
+ else if (!cmptrees(ip1->UU.U1.arg2, ip2->UU.U1.arg2, LINK))
+ return false;
+ else if (!cmptrees(ip1->UU.U1.arg3, ip2->UU.U1.arg3, LINK))
+ return false;
+ else
+ return true;
}
-static int treecontains(ip1, ip2, LINK)
-instrrec *ip1, *ip2;
-struct LOC_compilepage *LINK;
+static int treecontains(instrrec *ip1, instrrec *ip2, struct LOC_compilepage *LINK)
{
- if (ip1 == NULL)
- return false;
- else
- return (cmptrees(ip1, ip2, LINK) ||
- treecontains(ip1->UU.U1.arg1, ip2, LINK) ||
- treecontains(ip1->UU.U1.arg2, ip2, LINK) ||
- treecontains(ip1->UU.U1.arg3, ip2, LINK));
+ if (ip1 == NULL)
+ return false;
+ else
+ return (cmptrees(ip1, ip2, LINK) ||
+ treecontains(ip1->UU.U1.arg1, ip2, LINK) ||
+ treecontains(ip1->UU.U1.arg2, ip2, LINK) ||
+ treecontains(ip1->UU.U1.arg3, ip2, LINK));
}
-static int treerefers(ip, num, LINK)
-instrrec *ip;
-long num;
-struct LOC_compilepage *LINK;
+static int treerefers(instrrec *ip, long num, struct LOC_compilepage *LINK)
{
- int Result;
-
- if (ip == NULL)
- return false;
- if (treerefers(ip->UU.U1.arg1, num, LINK) ||
- treerefers(ip->UU.U1.arg2, num, LINK) ||
- treerefers(ip->UU.U1.arg3, num, LINK))
- return true;
- switch (ip->opcode) {
-
- case op_pin:
- case op_pinref:
- case op_pineq:
- case op_pinoc:
- Result = (num == ip->ival + LINK->thingnodes);
- break;
-
- /*$if false$
- op_pin:
- if (num = ip^.ival + thingnodes) then
- treerefers := true
- else
- begin
- treerefers := false;
- with things^[ip^.ival + thingnodes] do
- if hasstats and (defn <> nil) and
- optdelay and (wasdef = 1) and
- (defn^.opcode = op_pineq) then
- begin
- wasdef := 2; {avoid recursion}
- if treerefers(defn^.arg1, num) then
- treerefers := true;
- wasdef := 1;
- end;
- end;
+ int Result;
+
+ if (ip == NULL)
+ return false;
+ if (treerefers(ip->UU.U1.arg1, num, LINK) ||
+ treerefers(ip->UU.U1.arg2, num, LINK) ||
+ treerefers(ip->UU.U1.arg3, num, LINK))
+ return true;
+ switch (ip->opcode)
+ {
+ case op_pin:
+ case op_pinref:
+ case op_pineq:
+ case op_pinoc:
+ Result = (num == ip->ival + LINK->thingnodes);
+ break;
+
+ /*$if false$
+op_pin:
+if (num = ip^.ival + thingnodes) then
+treerefers := true
+else
+begin
+treerefers := false;
+with things^[ip^.ival + thingnodes] do
+if hasstats and (defn <> nil) and
+optdelay and (wasdef = 1) and
+(defn^.opcode = op_pineq) then
+begin
+wasdef := 2; {avoid recursion}
+if treerefers(defn^.arg1, num) then
+treerefers := true;
+wasdef := 1;
+end;
+end;
$end$*/
- case op_var:
- case op_vareq:
- Result = (num == ip->ival + LINK->thingvars);
- break;
-
- default:
- Result = false;
- break;
- }
- return Result;
+ case op_var:
+ case op_vareq:
+ Result = (num == ip->ival + LINK->thingvars);
+ break;
+
+ default:
+ Result = false;
+ break;
+ }
+ return Result;
}
-int cyclicdefn(ip, num, inside, LINK)
-instrrec *ip;
-long num;
-int inside;
-struct LOC_compilepage *LINK;
+int cyclicdefn(instrrec *ip, long num, int inside, struct LOC_compilepage *LINK)
{
- int Result;
- noderec *WITH;
-
- if (ip == NULL)
- return false;
- if (cyclicdefn(ip->UU.U1.arg1, num, inside, LINK) ||
- cyclicdefn(ip->UU.U1.arg2, num, inside, LINK) ||
- cyclicdefn(ip->UU.U1.arg3, num, inside, LINK))
- return true;
- switch (ip->opcode) {
-
- case op_pin:
- if (ip->ival + LINK->thingnodes == num && inside)
- Result = true;
- else {
- WITH = &LINK->things[ip->ival + LINK->thingnodes];
- if (LINK->hasstats && WITH->defn != NULL && LINK->optdelay &&
- WITH->wasdef == 1 && WITH->defn->opcode == op_pineq) {
- WITH->wasdef = 2; /*avoid recursion*/
- Result = cyclicdefn(WITH->defn->UU.U1.arg1, num, true, LINK);
- WITH->wasdef = 1;
- } else
- Result = false;
- }
- break;
-
- default:
- Result = false;
- break;
- }
- return Result;
+ int Result;
+ noderec *WITH;
+
+ if (ip == NULL)
+ return false;
+ if (cyclicdefn(ip->UU.U1.arg1, num, inside, LINK) ||
+ cyclicdefn(ip->UU.U1.arg2, num, inside, LINK) ||
+ cyclicdefn(ip->UU.U1.arg3, num, inside, LINK))
+ return true;
+ switch (ip->opcode)
+ {
+ case op_pin:
+ if (ip->ival + LINK->thingnodes == num && inside)
+ {
+ Result = true;
+ }
+ else
+ {
+ WITH = &LINK->things[ip->ival + LINK->thingnodes];
+ if (LINK->hasstats && WITH->defn != NULL && LINK->optdelay &&
+ WITH->wasdef == 1 && WITH->defn->opcode == op_pineq)
+ {
+ WITH->wasdef = 2; /*avoid recursion*/
+ Result = cyclicdefn(WITH->defn->UU.U1.arg1, num, true, LINK);
+ WITH->wasdef = 1;
+ }
+ else
+ {
+ Result = false;
+ }
+ }
+ break;
+
+ default:
+ Result = false;
+ break;
+ }
+ return Result;
}
-static void swapinstrs(ip1, ip2, LINK)
-instrrec **ip1, **ip2;
-struct LOC_compilepage *LINK;
+static void swapinstrs(instrrec **ip1, instrrec **ip2, struct LOC_compilepage *LINK)
{
- instrrec *iptemp;
+ instrrec *iptemp;
- iptemp = *ip1;
- *ip1 = *ip2;
- *ip2 = iptemp;
- LINK->changed = true;
+ iptemp = *ip1;
+ *ip1 = *ip2;
+ *ip2 = iptemp;
+ LINK->changed = true;
}
-static instrrec *makeinstr0(code, LINK)
-instrops code;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr0(instrops code, struct LOC_compilepage *LINK)
{
- instrrec *ip;
-
- ip = (instrrec *)Malloc(sizeof(instrrec));
- ip->opcode = code;
- ip->UU.U1.arg1 = NULL;
- ip->UU.U1.arg2 = NULL;
- ip->UU.U1.arg3 = NULL;
- ip->UU.U1.next = NULL;
- LINK->changed = true;
- return ip;
+ instrrec *ip;
+
+ ip = (instrrec *)Malloc(sizeof(instrrec));
+ ip->opcode = code;
+ ip->UU.U1.arg1 = NULL;
+ ip->UU.U1.arg2 = NULL;
+ ip->UU.U1.arg3 = NULL;
+ ip->UU.U1.next = NULL;
+ LINK->changed = true;
+ return ip;
}
-static instrrec *makeinstr1(code, a1, LINK)
-instrops code;
-instrrec *a1;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr1(instrops code, instrrec *a1, struct LOC_compilepage *LINK)
{
- instrrec *ip;
-
- ip = (instrrec *)Malloc(sizeof(instrrec));
- ip->opcode = code;
- ip->UU.U1.arg1 = a1;
- ip->UU.U1.arg2 = NULL;
- ip->UU.U1.arg3 = NULL;
- ip->UU.U1.next = NULL;
- LINK->changed = true;
- return ip;
+ instrrec *ip;
+
+ ip = (instrrec *)Malloc(sizeof(instrrec));
+ ip->opcode = code;
+ ip->UU.U1.arg1 = a1;
+ ip->UU.U1.arg2 = NULL;
+ ip->UU.U1.arg3 = NULL;
+ ip->UU.U1.next = NULL;
+ LINK->changed = true;
+ return ip;
}
-static instrrec *makeinstr2(code, a1, a2, LINK)
-instrops code;
-instrrec *a1, *a2;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr2(instrops code, instrrec *a1, instrrec *a2, struct LOC_compilepage *LINK)
{
- instrrec *ip;
-
- ip = (instrrec *)Malloc(sizeof(instrrec));
- ip->opcode = code;
- ip->UU.U1.arg1 = a1;
- ip->UU.U1.arg2 = a2;
- ip->UU.U1.arg3 = NULL;
- ip->UU.U1.next = NULL;
- LINK->changed = true;
- return ip;
+ instrrec *ip;
+
+ ip = (instrrec *)Malloc(sizeof(instrrec));
+ ip->opcode = code;
+ ip->UU.U1.arg1 = a1;
+ ip->UU.U1.arg2 = a2;
+ ip->UU.U1.arg3 = NULL;
+ ip->UU.U1.next = NULL;
+ LINK->changed = true;
+ return ip;
}
-static instrrec *makeinstr3(code, a1, a2, a3, LINK)
-instrops code;
-instrrec *a1, *a2, *a3;
-struct LOC_compilepage *LINK;
+static instrrec *makeinstr3(instrops code, instrrec *a1, instrrec *a2, instrrec *a3, struct LOC_compilepage *LINK)
{
- instrrec *ip;
-
- ip = (instrrec *)Malloc(sizeof(instrrec));
- ip->opcode = code;
- ip->UU.U1.arg1 = a1;
- ip->UU.U1.arg2 = a2;
- ip->UU.U1.arg3 = a3;
- ip->UU.U1.next = NULL;
- LINK->changed = true;
- return ip;
+ instrrec *ip;
+
+ ip = (instrrec *)Malloc(sizeof(instrrec));
+ ip->opcode = code;
+ ip->UU.U1.arg1 = a1;
+ ip->UU.U1.arg2 = a2;
+ ip->UU.U1.arg3 = a3;
+ ip->UU.U1.next = NULL;
+ LINK->changed = true;
+ return ip;
}
static instrrec *makefix0(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+ instrrec *arg;
+ struct LOC_compilepage *LINK;
{
- return (makeinstr1(op_fix0, arg, LINK));
+ return (makeinstr1(op_fix0, arg, LINK));
}
static instrrec *makefix1(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+ instrrec *arg;
+ struct LOC_compilepage *LINK;
{
- return (makeinstr1(op_fix1, arg, LINK));
+ return (makeinstr1(op_fix1, arg, LINK));
}
static instrrec *copytree(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+ instrrec *ip;
+ struct LOC_compilepage *LINK;
{
- instrrec *Result, *ip2;
- noderec *WITH;
-
- if (ip == NULL)
- return NULL;
- ip2 = (instrrec *)Malloc(sizeof(instrrec));
- ip2->opcode = ip->opcode;
- ip2->ival = ip->ival;
- ip2->UU.U1.arg1 = copytree(ip->UU.U1.arg1, LINK);
- ip2->UU.U1.arg2 = copytree(ip->UU.U1.arg2, LINK);
- ip2->UU.U1.arg3 = copytree(ip->UU.U1.arg3, LINK);
- ip2->UU.U1.next = copytree(ip->UU.U1.next, LINK);
- Result = ip2;
- switch (ip2->opcode) {
-
- case op_pin:
- case op_pinref:
- WITH = &LINK->things[ip->ival + LINK->thingnodes];
- WITH->wasused++;
- break;
-
- case op_var:
- WITH = &LINK->things[ip->ival + LINK->thingvars];
- WITH->wasused++;
- break;
-
- default:
- break;
- }
- return Result;
+ instrrec *Result, *ip2;
+ noderec *WITH;
+
+ if (ip == NULL)
+ return NULL;
+ ip2 = (instrrec *)Malloc(sizeof(instrrec));
+ ip2->opcode = ip->opcode;
+ ip2->ival = ip->ival;
+ ip2->UU.U1.arg1 = copytree(ip->UU.U1.arg1, LINK);
+ ip2->UU.U1.arg2 = copytree(ip->UU.U1.arg2, LINK);
+ ip2->UU.U1.arg3 = copytree(ip->UU.U1.arg3, LINK);
+ ip2->UU.U1.next = copytree(ip->UU.U1.next, LINK);
+ Result = ip2;
+ switch (ip2->opcode)
+ {
+ case op_pin:
+ case op_pinref:
+ WITH = &LINK->things[ip->ival + LINK->thingnodes];
+ WITH->wasused++;
+ break;
+
+ case op_var:
+ WITH = &LINK->things[ip->ival + LINK->thingvars];
+ WITH->wasused++;
+ break;
+
+ default:
+ break;
+ }
+ return Result;
}
-static void replacetree(ip, ip2, LINK)
-instrrec **ip, *ip2;
-struct LOC_compilepage *LINK;
+static void replacetree(instrrec **ip, instrrec **ip2, struct LOC_compilepage *LINK)
{
- disposetree(ip, LINK);
- *ip = ip2;
- LINK->changed = true;
+ disposetree(ip, LINK);
+ *ip = ip2;
+ LINK->changed = true;
}
-static void chgop(ip, opc, LINK)
-instrrec *ip;
-instrops opc;
-struct LOC_compilepage *LINK;
+static void chgop(instrrec *ip, instrops opc, struct LOC_compilepage *LINK)
{
- if (ip->opcode != opc) {
- ip->opcode = opc;
- LINK->changed = true;
- }
+ if (ip->opcode != opc)
+ {
+ ip->opcode = opc;
+ LINK->changed = true;
+ }
}
-static void killstmt(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static void killstmt(instrrec *ip, struct LOC_compilepage *LINK)
{
- ip->opcode = op_iffalse;
- LINK->changed = true;
- disposetree(&ip->UU.U1.arg1, LINK);
- disposetree(&ip->UU.U1.arg2, LINK);
- disposetree(&ip->UU.U1.arg3, LINK);
+ ip->opcode = op_iffalse;
+ LINK->changed = true;
+ disposetree(&ip->UU.U1.arg1, LINK);
+ disposetree(&ip->UU.U1.arg2, LINK);
+ disposetree(&ip->UU.U1.arg3, LINK);
}
/* Change in "goodness" if we did makenot(arg) */
-static long invertable(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+static long invertable(instrrec *arg, struct LOC_compilepage *LINK)
{
- long Result;
-
- switch (arg->opcode) {
-
- case op_and:
- case op_nand:
- case op_or:
- case op_nor:
- case op_one:
- case op_zero:
- case op_none:
- Result = 0;
- break;
-
- case op_xor:
- Result = invertable(arg->UU.U1.arg1, LINK) + invertable(arg->UU.U1.arg2, LINK);
- break;
-
- case op_not:
- if (LINK->truevars && arg->UU.U1.arg1->opcode == op_var &&
- arg->UU.U1.arg1->ival < 16)
- Result = 0; /*doesn't help since NOT V is primitive*/
- else
- Result = 1;
- break;
-
- case op_var:
- if (LINK->truevars && arg->ival < 16)
- Result = 0;
- else
- Result = -1;
- break;
-
- default:
- Result = -1;
- break;
- }
- return Result;
+ long Result;
+
+ switch (arg->opcode)
+ {
+ case op_and:
+ case op_nand:
+ case op_or:
+ case op_nor:
+ case op_one:
+ case op_zero:
+ case op_none:
+ Result = 0;
+ break;
+
+ case op_xor:
+ Result = invertable(arg->UU.U1.arg1, LINK) + invertable(arg->UU.U1.arg2, LINK);
+ break;
+
+ case op_not:
+ if (LINK->truevars && arg->UU.U1.arg1->opcode == op_var &&
+ arg->UU.U1.arg1->ival < 16)
+ Result = 0; /*doesn't help since NOT V is primitive*/
+ else
+ Result = 1;
+ break;
+
+ case op_var:
+ if (LINK->truevars && arg->ival < 16)
+ Result = 0;
+ else
+ Result = -1;
+ break;
+
+ default:
+ Result = -1;
+ break;
+ }
+ return Result;
}
-static instrrec *makenot(arg, LINK)
-instrrec *arg;
-struct LOC_compilepage *LINK;
+static instrrec *makenot(instrrec *arg, struct LOC_compilepage *LINK)
{
- instrrec *Result;
-
- switch (arg->opcode) {
-
- case op_not:
- Result = arg->UU.U1.arg1;
- Free(arg);
- break;
-
- case op_xor:
- if (invertable(arg->UU.U1.arg1, LINK) >= 0) {
- arg->UU.U1.arg1 = makenot(arg->UU.U1.arg1, LINK);
- Result = arg;
- } else if (invertable(arg->UU.U1.arg2, LINK) >= 0) {
- arg->UU.U1.arg2 = makenot(arg->UU.U1.arg2, LINK);
- Result = arg;
- } else
- Result = makeinstr1(op_not, arg, LINK);
- break;
-
- default:
- Result = makeinstr1(op_not, arg, LINK);
- break;
- }
- LINK->changed = true;
- return Result;
+ instrrec *Result;
+
+ switch (arg->opcode)
+ {
+ case op_not:
+ Result = arg->UU.U1.arg1;
+ Free(arg);
+ break;
+
+ case op_xor:
+ if (invertable(arg->UU.U1.arg1, LINK) >= 0)
+ {
+ arg->UU.U1.arg1 = makenot(arg->UU.U1.arg1, LINK);
+ Result = arg;
+ }
+ else if (invertable(arg->UU.U1.arg2, LINK) >= 0)
+ {
+ arg->UU.U1.arg2 = makenot(arg->UU.U1.arg2, LINK);
+ Result = arg;
+ }
+ else
+ {
+ Result = makeinstr1(op_not, arg, LINK);
+ }
+ break;
+
+ default:
+ Result = makeinstr1(op_not, arg, LINK);
+ break;
+ }
+ LINK->changed = true;
+ return Result;
}
-static long exprcost(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static long exprcost(instrrec *ip, struct LOC_compilepage *LINK)
{
- long Result;
+ long Result;
- if (ip == NULL)
- return 0;
- switch (ip->opcode) {
+ if (ip == NULL)
+ return 0;
- case op_var:
- Result = 20000;
- break;
+ switch (ip->opcode)
+ {
+ case op_var:
+ Result = 20000;
+ break;
- default:
- Result = exprcost(ip->UU.U1.arg1, LINK) + exprcost(ip->UU.U1.arg2, LINK) + 1;
- break;
- }
- return Result;
+ default:
+ Result = exprcost(ip->UU.U1.arg1, LINK) + exprcost(ip->UU.U1.arg2, LINK) + 1;
+ break;
+ }
+ return Result;
}
-static long expansioncost(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static long expansioncost(instrrec *ip, struct LOC_compilepage *LINK)
{
- long Result, c;
-
- c = exprcost(ip, LINK);
- switch (c) {
-
- case 0:
- case 1:
- Result = 10000;
- break;
-
- case 2:
- case 3:
- Result = 20;
- break;
-
- case 4:
- case 5:
- Result = 2;
- break;
-
- default:
- Result = (c < 10000);
- break;
- }
- return Result;
+ long Result, c;
+
+ c = exprcost(ip, LINK);
+ switch (c)
+ {
+ case 0:
+ case 1:
+ Result = 10000;
+ break;
+
+ case 2:
+ case 3:
+ Result = 20;
+ break;
+
+ case 4:
+ case 5:
+ Result = 2;
+ break;
+
+ default:
+ Result = (c < 10000);
+ break;
+ }
+ return Result;
}
/* Local variables for simplify: */
struct LOC_simplify {
- struct LOC_compilepage *LINK;
- long simplevel;
- trailrec *tbase;
+ struct LOC_compilepage *LINK;
+ long simplevel;
+ trailrec *tbase;
} ;
-static void chgposs2(i, newposs, newstrong, LINK)
-long i;
-long newposs;
-int newstrong;
-struct LOC_simplify *LINK;
+static void chgposs2(long i, long newposs, int newstrong, struct LOC_simplify *LINK)
{
- trailrec *t, **tp;
- noderec *WITH;
-
- WITH = &LINK->LINK->things[i];
- if (WITH->poss == newposs && WITH->strong == newstrong)
- return;
- if (WITH->level != LINK->simplevel) {
- tp = &LINK->tbase;
- while (*tp != NULL && (*tp)->num < i)
- tp = &(*tp)->next;
- t = (trailrec *)Malloc(sizeof(trailrec));
- t->num = i;
- t->oldposs = WITH->poss;
- t->oldstrong = WITH->strong;
- t->oldlevel = WITH->level;
- t->next = *tp;
- *tp = t;
- WITH->level = LINK->simplevel;
- }
- WITH->poss = newposs;
- WITH->strong = newstrong;
+ trailrec *t, **tp;
+ noderec *WITH;
+
+ WITH = &LINK->LINK->things[i];
+ if (WITH->poss == newposs && WITH->strong == newstrong)
+ return;
+
+ if (WITH->level != LINK->simplevel)
+ {
+ tp = &LINK->tbase;
+ while (*tp != NULL && (*tp)->num < i)
+ tp = &(*tp)->next;
+
+ t = (trailrec *)Malloc(sizeof(trailrec));
+ t->num = i;
+ t->oldposs = WITH->poss;
+ t->oldstrong = WITH->strong;
+ t->oldlevel = WITH->level;
+ t->next = *tp;
+ *tp = t;
+ WITH->level = LINK->simplevel;
+ }
+
+ WITH->poss = newposs;
+ WITH->strong = newstrong;
}
-static void chgposs(i, newposs, LINK)
-long i;
-long newposs;
-struct LOC_simplify *LINK;
+static void chgposs(long i, long newposs, struct LOC_simplify *LINK)
{
- chgposs2(i, newposs, LINK->LINK->things[i].strong, LINK);
+ chgposs2(i, newposs, LINK->LINK->things[i].strong, LINK);
}
-static void arith(ip, ident, LINK)
-instrrec **ip;
-instrops ident;
-struct LOC_simplify *LINK;
+static void arith(instrrec **ip, instrops ident, struct LOC_simplify *LINK)
{
- /* Move more complicated argument to arg2 */
- if ((*ip)->UU.U1.arg1->UU.U1.arg1 != NULL &&
- (*ip)->UU.U1.arg2->UU.U1.arg1 == NULL)
- swapinstrs(&(*ip)->UU.U1.arg1, &(*ip)->UU.U1.arg2, LINK->LINK);
-
+ /* Move more complicated argument to arg2 */
+ if ((*ip)->UU.U1.arg1->UU.U1.arg1 != NULL &&
+ (*ip)->UU.U1.arg2->UU.U1.arg1 == NULL)
+ swapinstrs(&(*ip)->UU.U1.arg1, &(*ip)->UU.U1.arg2, LINK->LINK);
}
-static void simplexpr(ip, nonelike, LINK)
-instrrec **ip;
-log_16_value nonelike;
-struct LOC_simplify *LINK;
+static void simplexpr(instrrec **ip, log_16_value nonelike, struct LOC_simplify *LINK)
{
- int oldch;
- long i;
- noderec *WITH;
-
- oldch = LINK->LINK->changed;
- if (*ip != NULL) {
- do {
- LINK->LINK->changed = false;
- switch ((*ip)->opcode) {
-
- case op_and:
- simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
- simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_one)
- replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_none)
- replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_one)
- replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_none)
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
- (*ip)->UU.U1.arg2->opcode == op_zero)
- chgop(*ip, op_zero, LINK->LINK);
- else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
- invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
- replacetree(ip, makeinstr2(op_nor,
- makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
- makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
- replacetree(ip, makefix1(makeinstr2(op_and,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
- replacetree(ip, makefix1(makeinstr2(op_and,
- copytree((*ip)->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- else
- arith(ip, op_one, LINK);
- break;
-
- case op_nand:
- simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
- simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_one)
- replacetree(ip,
- makenot(makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_none)
- replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_one)
- replacetree(ip,
- makenot(makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_none)
- replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
- (*ip)->UU.U1.arg2->opcode == op_zero)
- chgop(*ip, op_one, LINK->LINK);
- else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
- invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
- replacetree(ip, makeinstr2(op_or,
- makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
- makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
- replacetree(ip, makefix0(makeinstr2(op_nand,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
- replacetree(ip, makefix0(makeinstr2(op_nand,
- copytree((*ip)->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
- replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else
- arith(ip, op_one, LINK);
- break;
-
- case op_or:
- simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
- simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_zero)
- replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_none)
- replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_zero)
- replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_none)
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_one ||
- (*ip)->UU.U1.arg2->opcode == op_one)
- chgop(*ip, op_one, LINK->LINK);
- else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
- invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
- replacetree(ip, makeinstr2(op_nand,
- makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
- makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
- replacetree(ip, makefix0(makeinstr2(op_or,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
- replacetree(ip, makefix0(makeinstr2(op_or,
- copytree((*ip)->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- else
- arith(ip, op_zero, LINK);
- break;
-
- case op_nor:
- simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
- simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_zero)
- replacetree(ip,
- makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_none)
- replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_zero)
- replacetree(ip,
- makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_none)
- replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_one ||
- (*ip)->UU.U1.arg2->opcode == op_one)
- chgop(*ip, op_zero, LINK->LINK);
- else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
- invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
- replacetree(ip, makeinstr2(op_and,
- makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
- makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
- replacetree(ip, makefix1(makeinstr2(op_nor,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
- replacetree(ip, makefix1(makeinstr2(op_nor,
- copytree((*ip)->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
- replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else
- arith(ip, op_zero, LINK);
- break;
-
- case op_xor:
- simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
- simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_zero)
- replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_one)
- replacetree(ip,
- makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_none)
- replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_zero)
- replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_one)
- replacetree(ip,
- makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_none)
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
- invertable((*ip)->UU.U1.arg2, LINK->LINK) > 1)
- replacetree(ip, makenot(makeinstr2(op_xor,
- makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
- makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
- replacetree(ip, makefix0(makeinstr2(op_xor,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
- replacetree(ip, makefix0(makeinstr2(op_xor,
- copytree((*ip)->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK), LINK->LINK);
- else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
- chgop(*ip, op_zero, LINK->LINK);
- else
- arith(ip, op_zero, LINK);
- break;
-
- case op_same:
- if ((*ip)->UU.U1.arg1->ival == (*ip)->UU.U1.arg2->ival)
- chgop(*ip, op_one, LINK->LINK);
- else if ((*ip)->UU.U1.arg1->ival >= 0 || (*ip)->UU.U1.arg2->ival >= 0)
- chgop(*ip, op_zero, LINK->LINK);
- break;
-
- case op_rise:
- case op_fall:
- WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
- if ((((1L << ((long)log_zero)) | (1L << ((long)log_one))) &
- (~WITH->poss)) != 0)
- chgop(*ip, op_zero, LINK->LINK);
- break;
-
- case op_not:
- simplexpr(&(*ip)->UU.U1.arg1, unarynot[(long)nonelike], LINK);
- switch ((*ip)->UU.U1.arg1->opcode) {
-
- case op_and:
- replacetree(ip, makeinstr2(op_nand,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- break;
-
- case op_nand:
- replacetree(ip, makeinstr2(op_and,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- break;
-
- case op_or:
- replacetree(ip, makeinstr2(op_nor,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- break;
-
- case op_nor:
- replacetree(ip, makeinstr2(op_or,
- copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
- LINK->LINK), LINK->LINK);
- break;
-
- case op_not:
- replacetree(ip, copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
- LINK->LINK);
- break;
-
- case op_fix0:
- replacetree(ip,
- makefix1(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
- LINK->LINK), LINK->LINK), LINK->LINK),
- LINK->LINK);
- break;
-
- case op_fix1:
- replacetree(ip,
- makefix0(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
- LINK->LINK), LINK->LINK), LINK->LINK),
- LINK->LINK);
- break;
-
- case op_one:
- chgop(*ip, op_zero, LINK->LINK);
- break;
-
- case op_zero:
- chgop(*ip, op_one, LINK->LINK);
- break;
-
- case op_none:
- chgop(*ip, op_none, LINK->LINK);
- break;
-
- default:
- break;
- }
- break;
-
- case op_fix0:
- simplexpr(&(*ip)->UU.U1.arg1, log_zero, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_none)
- chgop(*ip, op_zero, LINK->LINK);
- else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
- ((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
- chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
- else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
- nonelike == log_zero)
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- break;
-
- case op_fix1:
- simplexpr(&(*ip)->UU.U1.arg1, log_one, LINK);
- if ((*ip)->UU.U1.arg1->opcode == op_none)
- chgop(*ip, op_one, LINK->LINK);
- else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
- ((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
- chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
- else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
- nonelike == log_one)
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- break;
-
- case op_strong:
- WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
- if (WITH->wasstrong) {
- replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
- chgop(*ip, op_pin, LINK->LINK); /*from op_pinref*/
+ int oldch;
+ long i;
+ noderec *WITH;
+
+ oldch = LINK->LINK->changed;
+ if (*ip != NULL)
+ {
+ do
+ {
+ LINK->LINK->changed = false;
+ switch ((*ip)->opcode)
+ {
+ case op_and:
+ simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+ simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_one)
+ replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_none)
+ replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_one)
+ replacetree(ip, makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_none)
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
+ (*ip)->UU.U1.arg2->opcode == op_zero)
+ chgop(*ip, op_zero, LINK->LINK);
+ else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+ invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+ replacetree(ip, makeinstr2(op_nor,
+ makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+ makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
+ replacetree(ip, makefix1(makeinstr2(op_and,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
+ replacetree(ip, makefix1(makeinstr2(op_and,
+ copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ else
+ arith(ip, op_one, LINK);
+ break;
+
+ case op_nand:
+ simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+ simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_one)
+ replacetree(ip,
+ makenot(makefix1(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_none)
+ replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_one)
+ replacetree(ip,
+ makenot(makefix1(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_none)
+ replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_zero ||
+ (*ip)->UU.U1.arg2->opcode == op_zero)
+ chgop(*ip, op_one, LINK->LINK);
+ else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+ invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+ replacetree(ip, makeinstr2(op_or,
+ makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+ makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_fix1)
+ replacetree(ip, makefix0(makeinstr2(op_nand,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_fix1)
+ replacetree(ip, makefix0(makeinstr2(op_nand,
+ copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+ replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else
+ arith(ip, op_one, LINK);
+ break;
+
+ case op_or:
+ simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+ simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_zero)
+ replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_none)
+ replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_zero)
+ replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_none)
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_one ||
+ (*ip)->UU.U1.arg2->opcode == op_one)
+ chgop(*ip, op_one, LINK->LINK);
+ else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+ invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+ replacetree(ip, makeinstr2(op_nand,
+ makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+ makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
+ replacetree(ip, makefix0(makeinstr2(op_or,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
+ replacetree(ip, makefix0(makeinstr2(op_or,
+ copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ else
+ arith(ip, op_zero, LINK);
+ break;
+
+ case op_nor:
+ simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+ simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_zero)
+ replacetree(ip,
+ makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_none)
+ replacetree(ip, makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_zero)
+ replacetree(ip,
+ makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_none)
+ replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_one ||
+ (*ip)->UU.U1.arg2->opcode == op_one)
+ chgop(*ip, op_zero, LINK->LINK);
+ else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+ invertable((*ip)->UU.U1.arg2, LINK->LINK) > 0)
+ replacetree(ip, makeinstr2(op_and,
+ makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+ makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
+ replacetree(ip, makefix1(makeinstr2(op_nor,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
+ replacetree(ip, makefix1(makeinstr2(op_nor,
+ copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+ replacetree(ip, makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else
+ arith(ip, op_zero, LINK);
+ break;
+
+ case op_xor:
+ simplexpr(&(*ip)->UU.U1.arg1, log_none, LINK);
+ simplexpr(&(*ip)->UU.U1.arg2, log_none, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_zero)
+ replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_one)
+ replacetree(ip,
+ makenot(makefix0(copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_none)
+ replacetree(ip, copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_zero)
+ replacetree(ip, makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_one)
+ replacetree(ip,
+ makenot(makefix0(copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_none)
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ else if (invertable((*ip)->UU.U1.arg1, LINK->LINK) +
+ invertable((*ip)->UU.U1.arg2, LINK->LINK) > 1)
+ replacetree(ip, makenot(makeinstr2(op_xor,
+ makenot(copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK),
+ makenot(copytree((*ip)->UU.U1.arg2, LINK->LINK), LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->opcode == op_fix0)
+ replacetree(ip, makefix0(makeinstr2(op_xor,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if ((*ip)->UU.U1.arg2->opcode == op_fix0)
+ replacetree(ip, makefix0(makeinstr2(op_xor,
+ copytree((*ip)->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg2->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK), LINK->LINK);
+ else if (cmptrees((*ip)->UU.U1.arg1, (*ip)->UU.U1.arg2, LINK->LINK))
+ chgop(*ip, op_zero, LINK->LINK);
+ else
+ arith(ip, op_zero, LINK);
+ break;
+
+ case op_same:
+ if ((*ip)->UU.U1.arg1->ival == (*ip)->UU.U1.arg2->ival)
+ chgop(*ip, op_one, LINK->LINK);
+ else if ((*ip)->UU.U1.arg1->ival >= 0 || (*ip)->UU.U1.arg2->ival >= 0)
+ chgop(*ip, op_zero, LINK->LINK);
+ break;
+
+ case op_rise:
+ case op_fall:
+ WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
+ if ((((1L << ((long)log_zero)) | (1L << ((long)log_one))) &
+ (~WITH->poss)) != 0)
+ chgop(*ip, op_zero, LINK->LINK);
+ break;
+
+ case op_not:
+ simplexpr(&(*ip)->UU.U1.arg1, unarynot[(long)nonelike], LINK);
+ switch ((*ip)->UU.U1.arg1->opcode) {
+
+ case op_and:
+ replacetree(ip, makeinstr2(op_nand,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ break;
+
+ case op_nand:
+ replacetree(ip, makeinstr2(op_and,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ break;
+
+ case op_or:
+ replacetree(ip, makeinstr2(op_nor,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ break;
+
+ case op_nor:
+ replacetree(ip, makeinstr2(op_or,
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ copytree((*ip)->UU.U1.arg1->UU.U1.arg2, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ break;
+
+ case op_not:
+ replacetree(ip, copytree((*ip)->UU.U1.arg1->UU.U1.arg1, LINK->LINK),
+ LINK->LINK);
+ break;
+
+ case op_fix0:
+ replacetree(ip,
+ makefix1(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
+ LINK->LINK), LINK->LINK), LINK->LINK),
+ LINK->LINK);
+ break;
+
+ case op_fix1:
+ replacetree(ip,
+ makefix0(makenot(copytree((*ip)->UU.U1.arg1->UU.U1.arg1,
+ LINK->LINK), LINK->LINK), LINK->LINK),
+ LINK->LINK);
+ break;
+
+ case op_one:
+ chgop(*ip, op_zero, LINK->LINK);
+ break;
+
+ case op_zero:
+ chgop(*ip, op_one, LINK->LINK);
+ break;
+
+ case op_none:
+ chgop(*ip, op_none, LINK->LINK);
+ break;
+
+ default:
+ break;
+ }
+ break;
+
+ case op_fix0:
+ simplexpr(&(*ip)->UU.U1.arg1, log_zero, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_none)
+ chgop(*ip, op_zero, LINK->LINK);
+ else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
+ ((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
+ chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
+ else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
+ nonelike == log_zero)
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ break;
+
+ case op_fix1:
+ simplexpr(&(*ip)->UU.U1.arg1, log_one, LINK);
+ if ((*ip)->UU.U1.arg1->opcode == op_none)
+ chgop(*ip, op_one, LINK->LINK);
+ else if (((1L << ((long)(*ip)->UU.U1.arg1->opcode)) &
+ ((1L << ((long)op_zero)) | (1L << ((long)op_one)))) != 0)
+ chgop(*ip, (*ip)->UU.U1.arg1->opcode, LINK->LINK);
+ else if (checkconn((*ip)->UU.U1.arg1, LINK->LINK) ||
+ nonelike == log_one)
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ break;
+
+ case op_strong:
+ WITH = &LINK->LINK->things[(*ip)->UU.U1.arg1->ival + LINK->LINK->thingnodes];
+ if (WITH->wasstrong)
+ {
+ replacetree(ip, copytree((*ip)->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ chgop(*ip, op_pin, LINK->LINK); /*from op_pinref*/
+ }
+ break;
+
+ case op_zero:
+ case op_one:
+ case op_none:
+ if ((*ip)->opcode == op_none)
+ {
+ switch (nonelike)
+ {
+ case log_none:
+ /* blank case */
+ break;
+
+ case log_one:
+ chgop(*ip, op_one, LINK->LINK);
+ break;
+
+ case log_zero:
+ chgop(*ip, op_zero, LINK->LINK);
+ break;
+ }
+ }
+ disposetree(&(*ip)->UU.U1.arg1, LINK->LINK);
+ disposetree(&(*ip)->UU.U1.arg2, LINK->LINK);
+ disposetree(&(*ip)->UU.U1.arg3, LINK->LINK);
+ break;
+
+ case op_pin:
+ i = (*ip)->ival + LINK->LINK->thingnodes;
+ WITH = &LINK->LINK->things[i];
+ if (WITH->poss == 1L << ((long)log_zero))
+ chgop(*ip, op_zero, LINK->LINK);
+ else if (WITH->poss == 1L << ((long)log_one))
+ chgop(*ip, op_one, LINK->LINK);
+ else if (WITH->poss == 1L << ((long)log_none))
+ chgop(*ip, op_none, LINK->LINK);
+ else if (LINK->LINK->hasstats && WITH->defn != NULL &&
+ LINK->LINK->optdelay && WITH->wasdef == 1 &&
+ WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
+ LINK->LINK) &&
+ WITH->defn->opcode == op_pineq &&
+ ((WITH->wasused == 1 && i >= LINK->LINK->numports) ||
+ !cyclicdefn(WITH->defn->UU.U1.arg1, i, true, LINK->LINK)))
+ replacetree(ip, copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
+ LINK->LINK);
+ break;
+
+ case op_var:
+ WITH = &LINK->LINK->things[(*ip)->ival + LINK->LINK->thingvars];
+ if (WITH->poss == 1L << ((long)log_zero))
+ chgop(*ip, op_zero, LINK->LINK);
+ else if (WITH->poss == 1L << ((long)log_one))
+ chgop(*ip, op_one, LINK->LINK);
+ else if (LINK->LINK->hasstats && WITH->defn != NULL &&
+ LINK->LINK->optlevel >= 3 && WITH->wasdef == 1 &&
+ WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
+ LINK->LINK) &&
+ WITH->defn->opcode == op_vareq)
+ replacetree(ip,
+ makefix1(copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ break;
+
+ default:
+ break;
+ }
+ if (LINK->LINK->changed)
+ oldch = true;
+ } while (LINK->LINK->changed);
}
- break;
-
- case op_zero:
- case op_one:
- case op_none:
- if ((*ip)->opcode == op_none) {
- switch (nonelike) {
-
- case log_none:
- /* blank case */
- break;
-
- case log_one:
- chgop(*ip, op_one, LINK->LINK);
- break;
-
- case log_zero:
- chgop(*ip, op_zero, LINK->LINK);
- break;
- }
- }
- disposetree(&(*ip)->UU.U1.arg1, LINK->LINK);
- disposetree(&(*ip)->UU.U1.arg2, LINK->LINK);
- disposetree(&(*ip)->UU.U1.arg3, LINK->LINK);
- break;
-
- case op_pin:
- i = (*ip)->ival + LINK->LINK->thingnodes;
- WITH = &LINK->LINK->things[i];
- if (WITH->poss == 1L << ((long)log_zero))
- chgop(*ip, op_zero, LINK->LINK);
- else if (WITH->poss == 1L << ((long)log_one))
- chgop(*ip, op_one, LINK->LINK);
- else if (WITH->poss == 1L << ((long)log_none))
- chgop(*ip, op_none, LINK->LINK);
- else if (LINK->LINK->hasstats && WITH->defn != NULL &&
- LINK->LINK->optdelay && WITH->wasdef == 1 &&
- WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
- LINK->LINK) &&
- WITH->defn->opcode == op_pineq &&
- ((WITH->wasused == 1 && i >= LINK->LINK->numports) ||
- !cyclicdefn(WITH->defn->UU.U1.arg1, i, true, LINK->LINK)))
- replacetree(ip, copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
- LINK->LINK);
- break;
-
- case op_var:
- WITH = &LINK->LINK->things[(*ip)->ival + LINK->LINK->thingvars];
- if (WITH->poss == 1L << ((long)log_zero))
- chgop(*ip, op_zero, LINK->LINK);
- else if (WITH->poss == 1L << ((long)log_one))
- chgop(*ip, op_one, LINK->LINK);
- else if (LINK->LINK->hasstats && WITH->defn != NULL &&
- LINK->LINK->optlevel >= 3 && WITH->wasdef == 1 &&
- WITH->wasused <= expansioncost(WITH->defn->UU.U1.arg1,
- LINK->LINK) &&
- WITH->defn->opcode == op_vareq)
- replacetree(ip,
- makefix1(copytree(WITH->defn->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- break;
-
- default:
- break;
- }
- if (LINK->LINK->changed)
- oldch = true;
- } while (LINK->LINK->changed);
- }
- LINK->LINK->changed = oldch;
+ LINK->LINK->changed = oldch;
}
/* Local variables for simplstmt: */
struct LOC_simplstmt {
- struct LOC_simplify *LINK;
- instrrec **ipbase, *ip, **ipp;
-} ;
+ struct LOC_simplify *LINK;
+ instrrec **ipbase, *ip, **ipp;
+};
-static long iftonumber(ip, LINK)
-instrrec *ip;
-struct LOC_simplstmt *LINK;
+static long iftonumber(instrrec *ip, struct LOC_simplstmt *LINK)
{
- long Result;
+ long Result;
- switch (ip->opcode) {
+ switch (ip->opcode)
+ {
+ case op_iffalse:
+ Result = 0;
+ break;
- case op_iffalse:
- Result = 0;
- break;
+ case op_ifnone:
+ Result = 1;
+ break;
- case op_ifnone:
- Result = 1;
- break;
+ case op_ifzero:
+ Result = 2;
+ break;
- case op_ifzero:
- Result = 2;
- break;
+ case op_ifzn:
+ Result = 3;
+ break;
- case op_ifzn:
- Result = 3;
- break;
+ case op_ifone:
+ Result = 4;
+ break;
- case op_ifone:
- Result = 4;
- break;
+ case op_if:
+ Result = 5;
+ break;
- case op_if:
- Result = 5;
- break;
+ case op_ifconn:
+ Result = 6;
+ break;
- case op_ifconn:
- Result = 6;
- break;
+ case op_iftrue:
+ Result = 7;
+ break;
- case op_iftrue:
- Result = 7;
- break;
-
- default:
- break;
- }
- return Result;
+ default:
+ break;
+ }
+ return Result;
}
-static instrops numbertoif(i, LINK)
-long i;
-struct LOC_simplstmt *LINK;
+static instrops numbertoif(long i, struct LOC_simplstmt *LINK)
{
- instrops Result;
+ instrops Result;
- switch (i & 7) {
+ switch (i & 7)
+ {
+ case 0:
+ Result = op_iffalse;
+ break;
- case 0:
- Result = op_iffalse;
- break;
+ case 1:
+ Result = op_ifnone;
+ break;
- case 1:
- Result = op_ifnone;
- break;
+ case 2:
+ Result = op_ifzero;
+ break;
- case 2:
- Result = op_ifzero;
- break;
+ case 3:
+ Result = op_ifzn;
+ break;
- case 3:
- Result = op_ifzn;
- break;
+ case 4:
+ Result = op_ifone;
+ break;
- case 4:
- Result = op_ifone;
- break;
+ case 5:
+ Result = op_if;
+ break;
- case 5:
- Result = op_if;
- break;
+ case 6:
+ Result = op_ifconn;
+ break;
- case 6:
- Result = op_ifconn;
- break;
-
- case 7:
- Result = op_iftrue;
- break;
- }
- return Result;
+ case 7:
+ Result = op_iftrue;
+ break;
+ }
+ return Result;
}
-static void untrail(tp, LINK)
-trailrec *tp;
-struct LOC_simplstmt *LINK;
+static void untrail(trailrec *tp, struct LOC_simplstmt *LINK)
{
- int tflag;
- noderec *WITH;
-
- while (tp != NULL) {
- WITH = &LINK->LINK->LINK->things[tp->num];
- na_exch((void *)(&WITH->poss), (void *)(&tp->oldposs), sizeof(long));
- tflag = WITH->strong;
- WITH->strong = tp->oldstrong;
- tp->oldstrong = tflag;
- P_iswap2(&WITH->level, &tp->oldlevel);
- WITH->defn = NULL;
- tp = tp->next;
- }
+ int tflag;
+ noderec *WITH;
+
+ while (tp != NULL)
+ {
+ WITH = &LINK->LINK->LINK->things[tp->num];
+ na_exch((void *)(&WITH->poss), (void *)(&tp->oldposs), sizeof(long));
+ tflag = WITH->strong;
+ WITH->strong = tp->oldstrong;
+ tp->oldstrong = tflag;
+ P_iswap2(&WITH->level, &tp->oldlevel);
+ WITH->defn = NULL;
+ tp = tp->next;
+ }
}
-static void eattrail(tb, LINK)
-trailrec **tb;
-struct LOC_simplstmt *LINK;
+static void eattrail(trailrec **tb, struct LOC_simplstmt *LINK)
{
- trailrec *tp;
+ trailrec *tp;
- tp = (*tb)->next;
- Free(*tb);
- *tb = tp;
+ tp = (*tb)->next;
+ Free(*tb);
+ *tb = tp;
}
/* Append list ip2 to end of list ip */
-static void appendlist(ip, ip2, LINK)
-instrrec **ip, *ip2;
-struct LOC_simplstmt *LINK;
+static void appendlist(instrrec **ip, instrrec *ip2, struct LOC_simplstmt *LINK)
{
- instrrec *ip3;
-
- if (ip2 == NULL)
- return;
- if (*ip == NULL) {
- *ip = ip2;
- return;
- }
- ip3 = *ip;
- while (ip3->UU.U1.next != NULL)
- ip3 = ip3->UU.U1.next;
- ip3->UU.U1.next = ip2;
+ instrrec *ip3;
+
+ if (ip2 == NULL)
+ return;
+
+ if (*ip == NULL)
+ {
+ *ip = ip2;
+ return;
+ }
+
+ ip3 = *ip;
+ while (ip3->UU.U1.next != NULL)
+ ip3 = ip3->UU.U1.next;
+ ip3->UU.U1.next = ip2;
}
/* Insert list ip2 at front of list ip */
-static void insertlist(ip, ip2, LINK)
-instrrec **ip, *ip2;
-struct LOC_simplstmt *LINK;
+static void insertlist(instrrec **ip, instrrec *ip2, struct LOC_simplstmt *LINK)
{
- instrrec *ip3;
-
- if (ip2 == NULL)
- return;
- ip3 = ip2;
- while (ip3->UU.U1.next != NULL)
- ip3 = ip3->UU.U1.next;
- ip3->UU.U1.next = *ip;
- *ip = ip2;
+ instrrec *ip3;
+
+ if (ip2 == NULL)
+ return;
+
+ ip3 = ip2;
+ while (ip3->UU.U1.next != NULL)
+ ip3 = ip3->UU.U1.next;
+ ip3->UU.U1.next = *ip;
+ *ip = ip2;
}
-static void cleanpineq(ip, ival, LINK)
-instrrec *ip;
-long ival;
-struct LOC_simplstmt *LINK;
+static void cleanpineq(instrrec *ip, long ival, struct LOC_simplstmt *LINK)
{
- while (ip != NULL) {
- if (ip->opcode == op_pineq && ip->ival == ival)
- killstmt(ip, LINK->LINK->LINK);
- ip = ip->UU.U1.next;
- }
+ while (ip != NULL)
+ {
+ if (ip->opcode == op_pineq && ip->ival == ival)
+ killstmt(ip, LINK->LINK->LINK);
+ ip = ip->UU.U1.next;
+ }
}
-static void builddefvusev(ip, defv, usev, LINK)
-instrrec *ip;
-long *defv, *usev;
-struct LOC_simplstmt *LINK;
+static void builddefvusev(instrrec *ip, long *defv, long *usev, struct LOC_simplstmt *LINK)
{
- instrrec *ip2;
- long i;
- long SET[257];
- long SET1[257];
-
- for (i = 0; i <= 2; i++) {
- ip2 = ip->UU.args[i];
- while (ip2 != NULL) {
- builddefvusev(ip2, defv, usev, LINK);
- ip2 = ip2->UU.U1.next;
- }
- }
- switch (ip->opcode) {
-
- case op_var:
- P_addset(usev, ip->ival);
- break;
-
- case op_vareq:
- P_addset(defv, ip->ival);
- break;
-
- default:
- break;
- }
+ instrrec *ip2;
+ long i;
+ long SET[257];
+ long SET1[257];
+
+ for (i = 0; i <= 2; i++)
+ {
+ ip2 = ip->UU.args[i];
+ while (ip2 != NULL)
+ {
+ builddefvusev(ip2, defv, usev, LINK);
+ ip2 = ip2->UU.U1.next;
+ }
+ }
+ switch (ip->opcode)
+ {
+ case op_var:
+ P_addset(usev, ip->ival);
+ break;
+
+ case op_vareq:
+ P_addset(defv, ip->ival);
+ break;
+
+ default:
+ break;
+ }
}
-static void checkdefvusev(ip, defv, usev, good, LINK)
-instrrec *ip;
-long *defv, *usev;
-int *good;
-struct LOC_simplstmt *LINK;
+static void checkdefvusev(instrrec *ip, long *defv, long *usev, uint *good, struct LOC_simplstmt *LINK)
{
- instrrec *ip2;
- long i;
-
- if (!*good)
- return;
- for (i = 0; i <= 2; i++) {
- ip2 = ip->UU.args[i];
- while (ip2 != NULL) {
- checkdefvusev(ip2, defv, usev, good, LINK);
- ip2 = ip2->UU.U1.next;
- }
- }
- switch (ip->opcode) {
-
- case op_var:
- if (P_inset(ip->ival, defv))
- *good = false;
- break;
-
- case op_vareq:
- if (P_inset(ip->ival, defv) || P_inset(ip->ival, usev))
- *good = false;
- break;
-
- default:
- break;
- }
+ instrrec *ip2;
+ long i;
+
+ if (!*good)
+ return;
+
+ for (i = 0; i <= 2; i++)
+ {
+ ip2 = ip->UU.args[i];
+ while (ip2 != NULL)
+ {
+ checkdefvusev(ip2, defv, usev, good, LINK);
+ ip2 = ip2->UU.U1.next;
+ }
+ }
+
+ switch (ip->opcode)
+ {
+ case op_var:
+ if (P_inset(ip->ival, defv))
+ *good = false;
+ break;
+
+ case op_vareq:
+ if (P_inset(ip->ival, defv) || P_inset(ip->ival, usev))
+ *good = false;
+ break;
+
+ default:
+ break;
+ }
}
/*try to combine two "if x"'s into one*/
-static void trymoveif(LINK)
-struct LOC_simplstmt *LINK;
+static void trymoveif(struct LOC_simplstmt *LINK)
{
- instrrec *ip2, *ip3, **ipp2;
- long *defv1, *usev1, *defv2, *usev2;
- int good1, good2, localchg;
- instrops otherif;
- long i;
-
- otherif = numbertoif(~iftonumber(LINK->ip, LINK), LINK);
- defv1 = NULL;
- ipp2 = LINK->ipbase;
- while (*ipp2 != LINK->ip) {
- ip2 = *ipp2;
- localchg = false;
- if ((ip2->opcode == LINK->ip->opcode || ip2->opcode == otherif) &&
- cmptrees(ip2->UU.U1.arg1, LINK->ip->UU.U1.arg1, LINK->LINK->LINK))
- { /*possible candidate for combination*/
- if (defv1 == NULL) {
- i = setbytes(LINK->LINK->LINK->savecurpvar, LINK->LINK->LINK);
- defv1 = (long *)Malloc(i);
- usev1 = (long *)Malloc(i);
- defv2 = (long *)Malloc(i);
- usev2 = (long *)Malloc(i);
- P_expset(defv2, 0L);
- P_expset(usev2, 0L);
- builddefvusev(LINK->ip, defv2, usev2, LINK);
- }
- P_expset(defv1, 0L);
- P_expset(usev1, 0L);
- builddefvusev(ip2, defv1, usev1, LINK);
- ip3 = ip2->UU.U1.next;
- good1 = true;
- good2 = true;
- while (ip3 != LINK->ip && (good1 || good2)) {
- checkdefvusev(ip3, defv1, usev1, &good1, LINK);
- checkdefvusev(ip3, defv2, usev2, &good2, LINK);
- ip3 = ip3->UU.U1.next;
- }
- if (good1) { /*move earlier one later*/
- *ipp2 = ip2->UU.U1.next;
- if (ip2->opcode == otherif) {
- insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg3, LINK);
- insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg2, LINK);
- } else {
- insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg2, LINK);
- insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg3, LINK);
- }
- if (ip2->UU.U1.next == LINK->ip)
- LINK->ipp = ipp2;
- disposetree(&ip2->UU.U1.arg1, LINK->LINK->LINK);
- Free(ip2);
- LINK->LINK->LINK->changed = true;
- localchg = true;
- } else if (good2) {
- *LINK->ipp = LINK->ip->UU.U1.next;
- if (ip2->opcode == otherif) {
- appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg3, LINK);
- appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg2, LINK);
- } else {
- appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg2, LINK);
- appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg3, LINK);
+ instrrec *ip2, *ip3, **ipp2;
+ long *defv1, *usev1, *defv2, *usev2;
+ int good1, good2, localchg;
+ instrops otherif;
+ long i;
+
+ otherif = numbertoif(~iftonumber(LINK->ip, LINK), LINK);
+ defv1 = NULL;
+ ipp2 = LINK->ipbase;
+ while (*ipp2 != LINK->ip)
+ {
+ ip2 = *ipp2;
+ localchg = false;
+ if ((ip2->opcode == LINK->ip->opcode || ip2->opcode == otherif) &&
+ cmptrees(ip2->UU.U1.arg1, LINK->ip->UU.U1.arg1, LINK->LINK->LINK))
+ { /*possible candidate for combination*/
+ if (defv1 == NULL)
+ {
+ i = setbytes(LINK->LINK->LINK->savecurpvar, LINK->LINK->LINK);
+ defv1 = (long *)Malloc(i);
+ usev1 = (long *)Malloc(i);
+ defv2 = (long *)Malloc(i);
+ usev2 = (long *)Malloc(i);
+ P_expset(defv2, 0L);
+ P_expset(usev2, 0L);
+ builddefvusev(LINK->ip, defv2, usev2, LINK);
+ }
+
+ P_expset(defv1, 0L);
+ P_expset(usev1, 0L);
+ builddefvusev(ip2, defv1, usev1, LINK);
+ ip3 = ip2->UU.U1.next;
+ good1 = true;
+ good2 = true;
+
+ while (ip3 != LINK->ip && (good1 || good2))
+ {
+ checkdefvusev(ip3, defv1, usev1, &good1, LINK);
+ checkdefvusev(ip3, defv2, usev2, &good2, LINK);
+ ip3 = ip3->UU.U1.next;
+ }
+
+ if (good1)
+ { /*move earlier one later*/
+ *ipp2 = ip2->UU.U1.next;
+ if (ip2->opcode == otherif)
+ {
+ insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg3, LINK);
+ insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg2, LINK);
+ }
+ else
+ {
+ insertlist(&LINK->ip->UU.U1.arg2, ip2->UU.U1.arg2, LINK);
+ insertlist(&LINK->ip->UU.U1.arg3, ip2->UU.U1.arg3, LINK);
+ }
+
+ if (ip2->UU.U1.next == LINK->ip)
+ LINK->ipp = ipp2;
+ disposetree(&ip2->UU.U1.arg1, LINK->LINK->LINK);
+ Free(ip2);
+ LINK->LINK->LINK->changed = true;
+ localchg = true;
+ }
+ else if (good2)
+ {
+ *LINK->ipp = LINK->ip->UU.U1.next;
+ if (ip2->opcode == otherif)
+ {
+ appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg3, LINK);
+ appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg2, LINK);
+ }
+ else
+ {
+ appendlist(&ip2->UU.U1.arg2, LINK->ip->UU.U1.arg2, LINK);
+ appendlist(&ip2->UU.U1.arg3, LINK->ip->UU.U1.arg3, LINK);
+ }
+
+ disposetree(&LINK->ip->UU.U1.arg1, LINK->LINK->LINK);
+ Free(LINK->ip);
+ LINK->ipp = ipp2;
+ LINK->ip = ip2;
+ LINK->LINK->LINK->changed = true;
+ localchg = true;
+ }
+ }
+ if (!localchg)
+ ipp2 = &ip2->UU.U1.next;
}
- disposetree(&LINK->ip->UU.U1.arg1, LINK->LINK->LINK);
- Free(LINK->ip);
- LINK->ipp = ipp2;
- LINK->ip = ip2;
- LINK->LINK->LINK->changed = true;
- localchg = true;
- }
- }
- if (!localchg)
- ipp2 = &ip2->UU.U1.next;
- }
-
- /*move later one earlier*/
+ /*move later one earlier*/
}
/*try to factor common statements out of "if" and "else" branches*/
-static void tryfactorif(LINK)
-struct LOC_simplstmt *LINK;
+static void tryfactorif(struct LOC_simplstmt *LINK)
{
- instrrec *ip2, *ip3, *ip4;
-
- ip2 = LINK->ip->UU.U1.arg2;
- ip3 = LINK->ip->UU.U1.arg3;
- if (ip2 == NULL || ip3 == NULL)
- return;
- /*for now, we examine only the final stmts of the branches,*/
- /*thus avoiding all variable-side-effect problems*/
- while (ip2->UU.U1.next != NULL)
- ip2 = ip2->UU.U1.next;
- while (ip3->UU.U1.next != NULL)
- ip3 = ip3->UU.U1.next;
- if (!(cmptrees(ip2, ip3, LINK->LINK->LINK) && ip2->opcode != op_iffalse))
- return;
- ip4 = copytree(ip3, LINK->LINK->LINK);
- ip4->UU.U1.next = LINK->ip->UU.U1.next;
- LINK->ip->UU.U1.next = ip4;
- killstmt(ip2, LINK->LINK->LINK);
- killstmt(ip3, LINK->LINK->LINK);
+ instrrec *ip2, *ip3, *ip4;
+
+ ip2 = LINK->ip->UU.U1.arg2;
+ ip3 = LINK->ip->UU.U1.arg3;
+ if (ip2 == NULL || ip3 == NULL)
+ return;
+ /*for now, we examine only the final stmts of the branches,*/
+ /*thus avoiding all variable-side-effect problems*/
+ while (ip2->UU.U1.next != NULL)
+ ip2 = ip2->UU.U1.next;
+ while (ip3->UU.U1.next != NULL)
+ ip3 = ip3->UU.U1.next;
+
+ if (!(cmptrees(ip2, ip3, LINK->LINK->LINK) && ip2->opcode != op_iffalse))
+ return;
+
+ ip4 = copytree(ip3, LINK->LINK->LINK);
+ ip4->UU.U1.next = LINK->ip->UU.U1.next;
+ LINK->ip->UU.U1.next = ip4;
+ killstmt(ip2, LINK->LINK->LINK);
+ killstmt(ip3, LINK->LINK->LINK);
}
-static void simplstmt(ipbase_, LINK)
-instrrec **ipbase_;
-struct LOC_simplify *LINK;
+static void simplstmt(instrrec **ipbase_, struct LOC_simplify *LINK)
{
- struct LOC_simplstmt V;
- int oldch;
- instrrec *ip1;
- trailrec *oldtrail, *thentrail, *elsetrail;
- long num, ifnum;
- noderec *WITH;
-
- V.LINK = LINK;
- V.ipbase = ipbase_;
- oldch = LINK->LINK->changed;
- V.ipp = V.ipbase;
- while (*V.ipp != NULL) {
- LINK->LINK->changed = false;
- V.ip = *V.ipp;
- switch (V.ip->opcode) {
-
- case op_if:
- case op_ifnone:
- case op_ifzero:
- case op_ifone:
- case op_ifconn:
- case op_ifzn:
- ifnum = iftonumber(V.ip, &V);
- switch (V.ip->opcode) {
-
- case op_if:
- case op_ifzero:
- simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
- break;
-
- case op_ifzn:
- case op_ifone:
- simplexpr(&V.ip->UU.U1.arg1, log_zero, LINK);
- break;
-
- default:
- simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
- break;
- }
- oldtrail = LINK->tbase;
- LINK->simplevel++;
-
- LINK->tbase = NULL; /*simplify the "then" part*/
- simplstmt(&V.ip->UU.U1.arg2, LINK);
- thentrail = LINK->tbase;
- untrail(thentrail, &V);
-
- LINK->tbase = NULL; /*simplify the "else" part*/
- simplstmt(&V.ip->UU.U1.arg3, LINK);
- elsetrail = LINK->tbase;
- untrail(elsetrail, &V);
-
- LINK->simplevel--;
- LINK->tbase = oldtrail;
- while (thentrail != NULL || elsetrail != NULL) {
- if (thentrail != NULL &&
- (elsetrail == NULL || thentrail->num < elsetrail->num))
- { /*"then" part only*/
- num = thentrail->num;
- /* if num < thingvars then
- chgposs(num, things^[num].poss * thentrail^.oldposs)
- else */
- chgposs(num, LINK->LINK->things[num].poss | thentrail->oldposs,
- LINK);
- eattrail(&thentrail, &V);
- continue;
- }
- if (thentrail == NULL || thentrail->num > elsetrail->num)
- { /*"else" part only*/
- num = elsetrail->num;
- /* if num < thingvars then
- chgposs(num, things^[num].poss * elsetrail^.oldposs)
- else */
- chgposs(num, LINK->LINK->things[num].poss | elsetrail->oldposs,
- LINK);
- eattrail(&elsetrail, &V);
- continue;
- }
- num = thentrail->num;
- if (num < LINK->LINK->thingvars &&
- ((1L << ((long)V.ip->opcode)) &
- ((1L << ((long)op_if)) | (1L << ((long)op_ifone)) |
- (1L << ((long)op_ifzn)) | (1L << ((long)op_ifzero)))) != 0 &&
- ((thentrail->oldposs == 1L << ((long)log_zero) &&
- elsetrail->oldposs == 1L << ((long)log_one)) ||
- (thentrail->oldposs == 1L << ((long)log_one) &&
- elsetrail->oldposs == 1L << ((long)log_zero))))
- { /*found an inverter or buffer*/
- ip1 = copytree(V.ip->UU.U1.arg1, LINK->LINK);
- switch (V.ip->opcode) {
-
- case op_if:
- ip1 = makefix1(ip1, LINK->LINK);
- break;
-
- case op_ifone:
- ip1 = makefix0(ip1, LINK->LINK);
- break;
-
- case op_ifzn:
- ip1 = makenot(makefix0(ip1, LINK->LINK), LINK->LINK);
- break;
-
- case op_ifzero:
- ip1 = makenot(makefix1(ip1, LINK->LINK), LINK->LINK);
- break;
-
- default:
- break;
- }
- if (thentrail->oldposs == 1L << ((long)log_zero))
- ip1 = makenot(ip1, LINK->LINK);
- ip1 = makeinstr1(op_pineq, ip1, LINK->LINK);
- ip1->ival = num - LINK->LINK->thingnodes;
- cleanpineq(V.ip->UU.U1.arg2, (long)ip1->ival, &V);
- cleanpineq(V.ip->UU.U1.arg3, (long)ip1->ival, &V);
- insertlist(V.ipp, ip1, &V);
- V.ipp = &ip1->UU.U1.next;
- }
- chgposs(num, thentrail->oldposs | elsetrail->oldposs, LINK);
- if (thentrail->oldstrong && elsetrail->oldstrong)
- LINK->LINK->things[num].strong = true;
- eattrail(&thentrail, &V);
- eattrail(&elsetrail, &V);
- }
- if (V.ip->UU.U1.arg2 == NULL) { /*THEN part is empty*/
- if (V.ip->UU.U1.arg3 == NULL) /*both parts are empty!*/
- killstmt(V.ip, LINK->LINK);
- else {
- chgop(V.ip, numbertoif(~ifnum, &V), LINK->LINK);
- swapinstrs(&V.ip->UU.U1.arg2, &V.ip->UU.U1.arg3, LINK->LINK);
- }
- } else {
- ip1 = V.ip->UU.U1.arg1;
- switch (ip1->opcode) {
-
- case op_not:
- case op_nand:
- case op_nor:
- replacetree(&V.ip->UU.U1.arg1,
- makenot(copytree(V.ip->UU.U1.arg1, LINK->LINK),
- LINK->LINK), LINK->LINK);
- switch (V.ip->opcode) {
-
- case op_if:
- chgop(V.ip, op_ifzn, LINK->LINK);
- break;
-
- case op_ifzero:
- chgop(V.ip, op_ifone, LINK->LINK);
- break;
-
- case op_ifone:
- chgop(V.ip, op_ifzero, LINK->LINK);
- break;
-
- case op_ifzn:
- chgop(V.ip, op_if, LINK->LINK);
- break;
-
- case op_ifnone:
- case op_ifconn:
- /* blank case */
- break;
-
- default:
- break;
- }
- break;
-
- case op_fix0:
- replacetree(&V.ip->UU.U1.arg1,
- copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
- switch (V.ip->opcode) {
-
- case op_if:
- chgop(V.ip, op_ifone, LINK->LINK);
- break;
-
- case op_ifzero:
- chgop(V.ip, op_ifzn, LINK->LINK);
- break;
-
- case op_ifnone:
- chgop(V.ip, op_iffalse, LINK->LINK);
- break;
-
- case op_ifconn:
- chgop(V.ip, op_iftrue, LINK->LINK);
- break;
-
- case op_ifone:
- case op_ifzn:
- /* blank case */
- break;
-
- default:
- break;
- }
- break;
-
- case op_fix1:
- replacetree(&V.ip->UU.U1.arg1,
- copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
- switch (V.ip->opcode) {
-
- case op_ifone:
- chgop(V.ip, op_if, LINK->LINK);
- break;
-
- case op_ifzn:
- chgop(V.ip, op_ifzero, LINK->LINK);
- break;
-
- case op_ifnone:
- chgop(V.ip, op_iffalse, LINK->LINK);
- break;
-
- case op_ifconn:
- chgop(V.ip, op_iftrue, LINK->LINK);
- break;
-
- case op_if:
- case op_ifzero:
- /* blank case */
- break;
-
- default:
- break;
- }
- break;
-
- case op_one:
- if ((ifnum & (1L << 2)) != 0)
- chgop(V.ip, op_iftrue, LINK->LINK);
- else
- chgop(V.ip, op_iffalse, LINK->LINK);
- break;
-
- case op_zero:
- if ((ifnum & (1L << 1)) != 0)
- chgop(V.ip, op_iftrue, LINK->LINK);
- else
- chgop(V.ip, op_iffalse, LINK->LINK);
- break;
-
- case op_none:
- if ((ifnum & (1L << 0)) != 0)
- chgop(V.ip, op_iftrue, LINK->LINK);
- else
- chgop(V.ip, op_iffalse, LINK->LINK);
- break;
-
- default:
- break;
+ struct LOC_simplstmt V;
+ int oldch;
+ instrrec *ip1;
+ trailrec *oldtrail, *thentrail, *elsetrail;
+ long num, ifnum;
+ noderec *WITH;
+
+ V.LINK = LINK;
+ V.ipbase = ipbase_;
+ oldch = LINK->LINK->changed;
+ V.ipp = V.ipbase;
+ while (*V.ipp != NULL)
+ {
+ LINK->LINK->changed = false;
+ V.ip = *V.ipp;
+ switch (V.ip->opcode)
+ {
+ case op_if:
+ case op_ifnone:
+ case op_ifzero:
+ case op_ifone:
+ case op_ifconn:
+ case op_ifzn:
+ ifnum = iftonumber(V.ip, &V);
+ switch (V.ip->opcode)
+ {
+ case op_if:
+ case op_ifzero:
+ simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
+ break;
+
+ case op_ifzn:
+ case op_ifone:
+ simplexpr(&V.ip->UU.U1.arg1, log_zero, LINK);
+ break;
+
+ default:
+ simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
+ break;
+ }
+
+ oldtrail = LINK->tbase;
+ LINK->simplevel++;
+
+ LINK->tbase = NULL; /*simplify the "then" part*/
+ simplstmt(&V.ip->UU.U1.arg2, LINK);
+ thentrail = LINK->tbase;
+ untrail(thentrail, &V);
+
+ LINK->tbase = NULL; /*simplify the "else" part*/
+ simplstmt(&V.ip->UU.U1.arg3, LINK);
+ elsetrail = LINK->tbase;
+ untrail(elsetrail, &V);
+
+ LINK->simplevel--;
+ LINK->tbase = oldtrail;
+ while (thentrail != NULL || elsetrail != NULL)
+ {
+ if (thentrail != NULL &&
+ (elsetrail == NULL || thentrail->num < elsetrail->num))
+ { /*"then" part only*/
+ num = thentrail->num;
+ /* if num < thingvars then
+ chgposs(num, things^[num].poss * thentrail^.oldposs)
+ else */
+ chgposs(num, LINK->LINK->things[num].poss | thentrail->oldposs,
+ LINK);
+ eattrail(&thentrail, &V);
+ continue;
+ }
+
+ if (thentrail == NULL || thentrail->num > elsetrail->num)
+ { /*"else" part only*/
+ num = elsetrail->num;
+ /* if num < thingvars then
+ chgposs(num, things^[num].poss * elsetrail^.oldposs)
+ else */
+ chgposs(num, LINK->LINK->things[num].poss | elsetrail->oldposs,
+ LINK);
+ eattrail(&elsetrail, &V);
+ continue;
+ }
+
+ num = thentrail->num;
+ if (num < LINK->LINK->thingvars &&
+ ((1L << ((long)V.ip->opcode)) &
+ ((1L << ((long)op_if)) | (1L << ((long)op_ifone)) |
+ (1L << ((long)op_ifzn)) | (1L << ((long)op_ifzero)))) != 0 &&
+ ((thentrail->oldposs == 1L << ((long)log_zero) &&
+ elsetrail->oldposs == 1L << ((long)log_one)) ||
+ (thentrail->oldposs == 1L << ((long)log_one) &&
+ elsetrail->oldposs == 1L << ((long)log_zero))))
+ { /*found an inverter or buffer*/
+ ip1 = copytree(V.ip->UU.U1.arg1, LINK->LINK);
+ switch (V.ip->opcode)
+ {
+ case op_if:
+ ip1 = makefix1(ip1, LINK->LINK);
+ break;
+
+ case op_ifone:
+ ip1 = makefix0(ip1, LINK->LINK);
+ break;
+
+ case op_ifzn:
+ ip1 = makenot(makefix0(ip1, LINK->LINK), LINK->LINK);
+ break;
+
+ case op_ifzero:
+ ip1 = makenot(makefix1(ip1, LINK->LINK), LINK->LINK);
+ break;
+
+ default:
+ break;
+ }
+
+ if (thentrail->oldposs == 1L << ((long)log_zero))
+ ip1 = makenot(ip1, LINK->LINK);
+ ip1 = makeinstr1(op_pineq, ip1, LINK->LINK);
+ ip1->ival = num - LINK->LINK->thingnodes;
+ cleanpineq(V.ip->UU.U1.arg2, (long)ip1->ival, &V);
+ cleanpineq(V.ip->UU.U1.arg3, (long)ip1->ival, &V);
+ insertlist(V.ipp, ip1, &V);
+ V.ipp = &ip1->UU.U1.next;
+ }
+
+ chgposs(num, thentrail->oldposs | elsetrail->oldposs, LINK);
+
+ if (thentrail->oldstrong && elsetrail->oldstrong)
+ LINK->LINK->things[num].strong = true;
+
+ eattrail(&thentrail, &V);
+ eattrail(&elsetrail, &V);
+ }
+ if (V.ip->UU.U1.arg2 == NULL)
+ { /*THEN part is empty*/
+ if (V.ip->UU.U1.arg3 == NULL) /*both parts are empty!*/
+ {
+ killstmt(V.ip, LINK->LINK);
+ }
+ else
+ {
+ chgop(V.ip, numbertoif(~ifnum, &V), LINK->LINK);
+ swapinstrs(&V.ip->UU.U1.arg2, &V.ip->UU.U1.arg3, LINK->LINK);
+ }
+ }
+ else
+ {
+ ip1 = V.ip->UU.U1.arg1;
+ switch (ip1->opcode)
+ {
+ case op_not:
+ case op_nand:
+ case op_nor:
+ replacetree(&V.ip->UU.U1.arg1,
+ makenot(copytree(V.ip->UU.U1.arg1, LINK->LINK),
+ LINK->LINK), LINK->LINK);
+ switch (V.ip->opcode)
+ {
+ case op_if:
+ chgop(V.ip, op_ifzn, LINK->LINK);
+ break;
+
+ case op_ifzero:
+ chgop(V.ip, op_ifone, LINK->LINK);
+ break;
+
+ case op_ifone:
+ chgop(V.ip, op_ifzero, LINK->LINK);
+ break;
+
+ case op_ifzn:
+ chgop(V.ip, op_if, LINK->LINK);
+ break;
+
+ case op_ifnone:
+ case op_ifconn:
+ /* blank case */
+ break;
+
+ default:
+ break;
+ }
+ break;
+
+ case op_fix0:
+ replacetree(&V.ip->UU.U1.arg1,
+ copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ switch (V.ip->opcode)
+ {
+ case op_if:
+ chgop(V.ip, op_ifone, LINK->LINK);
+ break;
+
+ case op_ifzero:
+ chgop(V.ip, op_ifzn, LINK->LINK);
+ break;
+
+ case op_ifnone:
+ chgop(V.ip, op_iffalse, LINK->LINK);
+ break;
+
+ case op_ifconn:
+ chgop(V.ip, op_iftrue, LINK->LINK);
+ break;
+
+ case op_ifone:
+ case op_ifzn:
+ /* blank case */
+ break;
+
+ default:
+ break;
+ }
+ break;
+
+ case op_fix1:
+ replacetree(&V.ip->UU.U1.arg1,
+ copytree(ip1->UU.U1.arg1, LINK->LINK), LINK->LINK);
+ switch (V.ip->opcode)
+ {
+ case op_ifone:
+ chgop(V.ip, op_if, LINK->LINK);
+ break;
+
+ case op_ifzn:
+ chgop(V.ip, op_ifzero, LINK->LINK);
+ break;
+
+ case op_ifnone:
+ chgop(V.ip, op_iffalse, LINK->LINK);
+ break;
+
+ case op_ifconn:
+ chgop(V.ip, op_iftrue, LINK->LINK);
+ break;
+
+ case op_if:
+ case op_ifzero:
+ /* blank case */
+ break;
+
+ default:
+ break;
+ }
+ break;
+
+ case op_one:
+ if ((ifnum & (1L << 2)) != 0)
+ chgop(V.ip, op_iftrue, LINK->LINK);
+ else
+ chgop(V.ip, op_iffalse, LINK->LINK);
+ break;
+
+ case op_zero:
+ if ((ifnum & (1L << 1)) != 0)
+ chgop(V.ip, op_iftrue, LINK->LINK);
+ else
+ chgop(V.ip, op_iffalse, LINK->LINK);
+ break;
+
+ case op_none:
+ if ((ifnum & (1L << 0)) != 0)
+ chgop(V.ip, op_iftrue, LINK->LINK);
+ else
+ chgop(V.ip, op_iffalse, LINK->LINK);
+ break;
+
+ default:
+ break;
+ }
+
+ if (!LINK->LINK->changed && checkconn(V.ip->UU.U1.arg1, LINK->LINK))
+ {
+ switch (V.ip->opcode)
+ {
+
+ case op_ifone:
+ chgop(V.ip, op_if, LINK->LINK);
+ break;
+
+ case op_ifzn:
+ chgop(V.ip, op_ifzero, LINK->LINK);
+ break;
+
+ case op_ifconn:
+ chgop(V.ip, op_iftrue, LINK->LINK);
+ break;
+
+ case op_ifnone:
+ chgop(V.ip, op_iffalse, LINK->LINK);
+ break;
+
+ default:
+ break;
+ }
+ }
+
+ if (!LINK->LINK->changed && LINK->LINK->optlevel >= 3)
+ {
+ trymoveif(&V);
+ if (!LINK->LINK->changed)
+ tryfactorif(&V);
+ }
+ }
+ break;
+
+ case op_iftrue:
+ case op_iffalse:
+ disposetree(&V.ip->UU.U1.arg1, LINK->LINK);
+ if (V.ip->opcode == op_iftrue)
+ {
+ disposetree(&V.ip->UU.U1.arg3, LINK->LINK);
+ ip1 = V.ip->UU.U1.arg2;
+ }
+ else
+ {
+ disposetree(&V.ip->UU.U1.arg2, LINK->LINK);
+ ip1 = V.ip->UU.U1.arg3;
+ }
+
+ *V.ipp = V.ip->UU.U1.next;
+ insertlist(V.ipp, ip1, &V);
+ Free(V.ip);
+ LINK->LINK->changed = true;
+ break;
+
+ case op_pineq:
+ num = V.ip->ival + LINK->LINK->thingnodes;
+ WITH = &LINK->LINK->things[num];
+ if (!LINK->LINK->hasstats || num < LINK->LINK->numports ||
+ (WITH->wasused > 0 &&
+ !(WITH->wasused == 1 &&
+ treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))))
+ {
+ ip1 = WITH->defn;
+ WITH->defn = NULL; /*don't recursively expand!*/
+ simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
+ if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
+ WITH->defn = V.ip;
+ if (V.ip->UU.U1.arg1->opcode == op_one)
+ chgposs2(num, 1L << ((long)log_one), true, LINK);
+ else if (V.ip->UU.U1.arg1->opcode == op_zero)
+ chgposs2(num, 1L << ((long)log_zero), true, LINK);
+ else if (V.ip->UU.U1.arg1->opcode == op_none)
+ {
+ WITH->defn = NULL;
+ killstmt(V.ip, LINK->LINK);
+ }
+ else if (checkconn(V.ip->UU.U1.arg1, LINK->LINK))
+ {
+ chgposs2(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
+ true, LINK);
+ }
+ }
+ else
+ {
+ killstmt(V.ip, LINK->LINK);
+ }
+ break;
+
+ case op_pinoc:
+ num = V.ip->ival + LINK->LINK->thingnodes;
+ WITH = &LINK->LINK->things[num];
+ if (!LINK->LINK->hasstats || WITH->wasused > 0 ||
+ num < LINK->LINK->numports)
+ {
+ ip1 = WITH->defn;
+ WITH->defn = NULL; /*don't recursively expand!*/
+ simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
+ if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
+ WITH->defn = V.ip;
+ if (V.ip->UU.U1.arg1->opcode == op_one ||
+ V.ip->UU.U1.arg1->opcode == op_none)
+ {
+ WITH->defn = NULL;
+ killstmt(V.ip, LINK->LINK);
+ }
+ else if (V.ip->UU.U1.arg1->opcode == op_zero)
+ chgposs(num, 1L << ((long)log_zero), LINK);
+ }
+ else
+ {
+ killstmt(V.ip, LINK->LINK);
+ }
+ break;
+
+ case op_pullup:
+ num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
+ WITH = &LINK->LINK->things[num];
+ if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
+ num < LINK->LINK->numports) && !WITH->wasstrong)
+ {
+ /*true*/
+ /**/
+ if (LINK->LINK->hasstats && WITH->wasdef == 1)
+ {
+ chgop(V.ip, op_pineq, LINK->LINK);
+ V.ip->ival = V.ip->UU.U1.arg1->ival;
+ chgop(V.ip->UU.U1.arg1, op_one, LINK->LINK);
+ }
+ else
+ {
+ chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
+ ip1 = V.ip->UU.U1.next;
+ while (ip1 != NULL) /*eliminate redundant pullup's*/
+ { /* (useful for compiling transistors) */
+ if (ip1->opcode == op_pullup && cmptrees(V.ip, ip1, LINK->LINK))
+ /*optimized for speed*/
+ killstmt(ip1, LINK->LINK);
+ ip1 = ip1->UU.U1.next;
+ }
+ }
+ }
+ else
+ {
+ killstmt(V.ip, LINK->LINK);
+ }
+ break;
+
+ case op_pulldn:
+ num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
+ WITH = &LINK->LINK->things[num];
+ if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
+ num < LINK->LINK->numports) && !WITH->wasstrong)
+ {
+ /*true*/
+ /**/
+ if (LINK->LINK->hasstats && WITH->wasdef == 1)
+ {
+ chgop(V.ip, op_pineq, LINK->LINK);
+ V.ip->ival = V.ip->UU.U1.arg1->ival;
+ chgop(V.ip->UU.U1.arg1, op_zero, LINK->LINK);
+ }
+ else
+ {
+ chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
+ ip1 = V.ip->UU.U1.next;
+ while (ip1 != NULL) /*eliminate redundant pulldn's*/
+ { /* (useful for compiling transistors) */
+ if (ip1->opcode == op_pulldn && cmptrees(V.ip, ip1, LINK->LINK))
+ /*optimized for speed*/
+ killstmt(ip1, LINK->LINK);
+ ip1 = ip1->UU.U1.next;
+ }
+ }
+ }
+ else
+ {
+ killstmt(V.ip, LINK->LINK);
+ }
+ break;
+
+ case op_vareq:
+ num = V.ip->ival + LINK->LINK->thingvars;
+ WITH = &LINK->LINK->things[num];
+ if (!LINK->LINK->hasstats ||
+ (WITH->wasused > 0 &&
+ !(WITH->wasused == 1 &&
+ treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))))
+ {
+ simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
+ if (V.ip->UU.U1.arg1->opcode == op_one)
+ chgposs(num, 1L << ((long)log_one), LINK);
+ else if (V.ip->UU.U1.arg1->opcode == op_zero)
+ chgposs(num, 1L << ((long)log_zero), LINK);
+ else
+ chgposs(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
+ LINK);
+ }
+ else
+ {
+ killstmt(V.ip, LINK->LINK);
+ }
+ break;
+
+ case op_alwaysconn:
+ num = V.ip->ival + LINK->LINK->thingnodes;
+ LINK->LINK->things[num].alwaysconn = true;
+ *V.ipp = V.ip->UU.U1.next;
+ Free(V.ip);
+ LINK->LINK->changed = true;
+ break;
+
+ default:
+ break;
+ }
+ if (LINK->LINK->changed)
+ oldch = true;
+ else
+ V.ipp = &V.ip->UU.U1.next;
}
- if (!LINK->LINK->changed && checkconn(V.ip->UU.U1.arg1, LINK->LINK)) {
- switch (V.ip->opcode) {
-
- case op_ifone:
- chgop(V.ip, op_if, LINK->LINK);
- break;
+ LINK->LINK->changed = oldch;
- case op_ifzn:
- chgop(V.ip, op_ifzero, LINK->LINK);
- break;
-
- case op_ifconn:
- chgop(V.ip, op_iftrue, LINK->LINK);
- break;
-
- case op_ifnone:
- chgop(V.ip, op_iffalse, LINK->LINK);
- break;
-
- default:
- break;
- }
- }
- if (!LINK->LINK->changed && LINK->LINK->optlevel >= 3) {
- trymoveif(&V);
- if (!LINK->LINK->changed)
- tryfactorif(&V);
- }
- }
- break;
-
- case op_iftrue:
- case op_iffalse:
- disposetree(&V.ip->UU.U1.arg1, LINK->LINK);
- if (V.ip->opcode == op_iftrue) {
- disposetree(&V.ip->UU.U1.arg3, LINK->LINK);
- ip1 = V.ip->UU.U1.arg2;
- } else {
- disposetree(&V.ip->UU.U1.arg2, LINK->LINK);
- ip1 = V.ip->UU.U1.arg3;
- }
- *V.ipp = V.ip->UU.U1.next;
- insertlist(V.ipp, ip1, &V);
- Free(V.ip);
- LINK->LINK->changed = true;
- break;
-
- case op_pineq:
- num = V.ip->ival + LINK->LINK->thingnodes;
- WITH = &LINK->LINK->things[num];
- if (!LINK->LINK->hasstats || num < LINK->LINK->numports ||
- (WITH->wasused > 0 &&
- !(WITH->wasused == 1 &&
- treerefers(V.ip->UU.U1.arg1, num, LINK->LINK)))) {
- ip1 = WITH->defn;
- WITH->defn = NULL; /*don't recursively expand!*/
- simplexpr(&V.ip->UU.U1.arg1, log_none, LINK);
- if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
- WITH->defn = V.ip;
- if (V.ip->UU.U1.arg1->opcode == op_one)
- chgposs2(num, 1L << ((long)log_one), true, LINK);
- else if (V.ip->UU.U1.arg1->opcode == op_zero)
- chgposs2(num, 1L << ((long)log_zero), true, LINK);
- else if (V.ip->UU.U1.arg1->opcode == op_none) {
- WITH->defn = NULL;
- killstmt(V.ip, LINK->LINK);
- } else if (checkconn(V.ip->UU.U1.arg1, LINK->LINK))
- chgposs2(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
- true, LINK);
- } else
- killstmt(V.ip, LINK->LINK);
- break;
-
- case op_pinoc:
- num = V.ip->ival + LINK->LINK->thingnodes;
- WITH = &LINK->LINK->things[num];
- if (!LINK->LINK->hasstats || WITH->wasused > 0 ||
- num < LINK->LINK->numports) {
- ip1 = WITH->defn;
- WITH->defn = NULL; /*don't recursively expand!*/
- simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
- if (ip1 != NULL && !treerefers(V.ip->UU.U1.arg1, num, LINK->LINK))
- WITH->defn = V.ip;
- if (V.ip->UU.U1.arg1->opcode == op_one ||
- V.ip->UU.U1.arg1->opcode == op_none) {
- WITH->defn = NULL;
- killstmt(V.ip, LINK->LINK);
- } else if (V.ip->UU.U1.arg1->opcode == op_zero)
- chgposs(num, 1L << ((long)log_zero), LINK);
- } else
- killstmt(V.ip, LINK->LINK);
- break;
-
- case op_pullup:
- num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
- WITH = &LINK->LINK->things[num];
- if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
- num < LINK->LINK->numports) && !WITH->wasstrong) {
- /*true*/
- /**/
- if (LINK->LINK->hasstats && WITH->wasdef == 1) {
- chgop(V.ip, op_pineq, LINK->LINK);
- V.ip->ival = V.ip->UU.U1.arg1->ival;
- chgop(V.ip->UU.U1.arg1, op_one, LINK->LINK);
- } else {
- chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
- ip1 = V.ip->UU.U1.next;
- while (ip1 != NULL) /*eliminate redundant pullup's*/
- { /* (useful for compiling transistors) */
- if (ip1->opcode == op_pullup && cmptrees(V.ip, ip1, LINK->LINK))
- /*optimized for speed*/
- killstmt(ip1, LINK->LINK);
- ip1 = ip1->UU.U1.next;
- }
- }
- } else
- killstmt(V.ip, LINK->LINK);
- break;
-
- case op_pulldn:
- num = V.ip->UU.U1.arg1->ival + LINK->LINK->thingnodes;
- WITH = &LINK->LINK->things[num];
- if ((!LINK->LINK->hasstats || WITH->wasused > 0 ||
- num < LINK->LINK->numports) && !WITH->wasstrong) {
- /*true*/
- /**/
- if (LINK->LINK->hasstats && WITH->wasdef == 1) {
- chgop(V.ip, op_pineq, LINK->LINK);
- V.ip->ival = V.ip->UU.U1.arg1->ival;
- chgop(V.ip->UU.U1.arg1, op_zero, LINK->LINK);
- } else {
- chgposs(num, WITH->poss & (~(1L << ((long)log_none))), LINK);
- ip1 = V.ip->UU.U1.next;
- while (ip1 != NULL) /*eliminate redundant pulldn's*/
- { /* (useful for compiling transistors) */
- if (ip1->opcode == op_pulldn && cmptrees(V.ip, ip1, LINK->LINK))
- /*optimized for speed*/
- killstmt(ip1, LINK->LINK);
- ip1 = ip1->UU.U1.next;
- }
- }
- } else
- killstmt(V.ip, LINK->LINK);
- break;
-
- case op_vareq:
- num = V.ip->ival + LINK->LINK->thingvars;
- WITH = &LINK->LINK->things[num];
- if (!LINK->LINK->hasstats ||
- (WITH->wasused > 0 &&
- !(WITH->wasused == 1 &&
- treerefers(V.ip->UU.U1.arg1, num, LINK->LINK)))) {
- simplexpr(&V.ip->UU.U1.arg1, log_one, LINK);
- if (V.ip->UU.U1.arg1->opcode == op_one)
- chgposs(num, 1L << ((long)log_one), LINK);
- else if (V.ip->UU.U1.arg1->opcode == op_zero)
- chgposs(num, 1L << ((long)log_zero), LINK);
- else
- chgposs(num, (1L << ((long)log_zero)) | (1L << ((long)log_one)),
- LINK);
- } else
- killstmt(V.ip, LINK->LINK);
- break;
-
- case op_alwaysconn:
- num = V.ip->ival + LINK->LINK->thingnodes;
- LINK->LINK->things[num].alwaysconn = true;
- *V.ipp = V.ip->UU.U1.next;
- Free(V.ip);
- LINK->LINK->changed = true;
- break;
-
- default:
- break;
- }
- if (LINK->LINK->changed)
- oldch = true;
- else
- V.ipp = &V.ip->UU.U1.next;
- }
- LINK->LINK->changed = oldch;
-
- /*both parts*/
+ /*both parts*/
}
-static void simplify(ipbase, LINK)
-instrrec **ipbase;
-struct LOC_compilepage *LINK;
+static void simplify(instrrec **ipbase, struct LOC_compilepage *LINK)
{
- struct LOC_simplify V;
- char STR2[256];
-
- V.LINK = LINK;
- LINK->simppasscount++;
- sprintf(STR2, "Optimization pass #%ld", LINK->simppasscount);
- showcontrol(LINK->hdef, STR2);
- LINK->changed = false;
- V.tbase = NULL;
- V.simplevel = 1;
- simplstmt(ipbase, &V);
+ struct LOC_simplify V;
+ char STR2[256];
+
+ V.LINK = LINK;
+ LINK->simppasscount++;
+ sprintf(STR2, "Optimization pass #%ld", LINK->simppasscount);
+ showcontrol(LINK->hdef, STR2);
+ LINK->changed = false;
+ V.tbase = NULL;
+ V.simplevel = 1;
+ simplstmt(ipbase, &V);
}
/* Scan to find usage of variables and nodes */
-static void scan(ip, scanlevel, LINK)
-instrrec *ip;
-long scanlevel;
-struct LOC_compilepage *LINK;
+static void scan(instrrec *ip, long scanlevel, struct LOC_compilepage *LINK)
{
- noderec *WITH;
-
- while (ip != NULL) {
- if (ip->UU.U1.arg1 != NULL)
- scan(ip->UU.U1.arg1, scanlevel + 1, LINK);
- if (ip->UU.U1.arg2 != NULL)
- scan(ip->UU.U1.arg2, scanlevel + 1, LINK);
- if (ip->UU.U1.arg3 != NULL)
- scan(ip->UU.U1.arg3, scanlevel + 1, LINK);
- switch (ip->opcode) {
-
- case op_pin:
- case op_pinref:
- WITH = &LINK->things[ip->ival + LINK->thingnodes];
- WITH->isused++;
- break;
-
- case op_var:
- WITH = &LINK->things[ip->ival + LINK->thingvars];
- WITH->isused++;
- break;
-
- case op_pineq:
- case op_pinoc:
- WITH = &LINK->things[ip->ival + LINK->thingnodes];
- WITH->isdef++;
- if (ip->UU.U1.arg1->opcode == op_one)
- WITH->nextposs |= 1L << ((long)log_one);
- else if (ip->UU.U1.arg1->opcode == op_zero)
- WITH->nextposs |= 1L << ((long)log_zero);
- else
- WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
- if (scanlevel == 1 &&
- !treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingnodes, LINK))
- WITH->defn = ip;
- else
- WITH->defn = NULL;
- break;
-
- case op_pullup:
- case op_pulldn:
- WITH = &LINK->things[ip->UU.U1.arg1->ival + LINK->thingnodes];
- WITH->isused--; /*counteract recursive call*/
- WITH->isdef++;
- WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
- if (scanlevel == 1) {
- WITH->defn = ip;
- WITH->alwaysconn = true;
- } else
- WITH->defn = NULL;
- break;
-
- case op_vareq:
- WITH = &LINK->things[ip->ival + LINK->thingvars];
- WITH->isdef++;
- if (ip->UU.U1.arg1->opcode == op_one)
- WITH->nextposs |= 1L << ((long)log_one);
- else if (ip->UU.U1.arg1->opcode == op_zero)
- WITH->nextposs |= 1L << ((long)log_zero);
- else
- WITH->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
- if (scanlevel == 1 &&
- !treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingvars, LINK))
- WITH->defn = ip;
- else
- WITH->defn = NULL;
- break;
-
- default:
- break;
- }
- ip = ip->UU.U1.next;
- }
+ noderec *WITH;
+
+ while (ip != NULL)
+ {
+ if (ip->UU.U1.arg1 != NULL)
+ scan(ip->UU.U1.arg1, scanlevel + 1, LINK);
+ if (ip->UU.U1.arg2 != NULL)
+ scan(ip->UU.U1.arg2, scanlevel + 1, LINK);
+ if (ip->UU.U1.arg3 != NULL)
+ scan(ip->UU.U1.arg3, scanlevel + 1, LINK);
+ switch (ip->opcode)
+ {
+ case op_pin:
+ case op_pinref:
+ WITH = &LINK->things[ip->ival + LINK->thingnodes];
+ WITH->isused++;
+ break;
+
+ case op_var:
+ WITH = &LINK->things[ip->ival + LINK->thingvars];
+ WITH->isused++;
+ break;
+
+ case op_pineq:
+ case op_pinoc:
+ WITH = &LINK->things[ip->ival + LINK->thingnodes];
+ WITH->isdef++;
+ if (ip->UU.U1.arg1->opcode == op_one)
+ WITH->nextposs |= 1L << ((long)log_one);
+ else if (ip->UU.U1.arg1->opcode == op_zero)
+ WITH->nextposs |= 1L << ((long)log_zero);
+ else
+ WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
+ if (scanlevel == 1 &&
+ !treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingnodes, LINK))
+ WITH->defn = ip;
+ else
+ WITH->defn = NULL;
+ break;
+
+ case op_pullup:
+ case op_pulldn:
+ WITH = &LINK->things[ip->UU.U1.arg1->ival + LINK->thingnodes];
+ WITH->isused--; /*counteract recursive call*/
+ WITH->isdef++;
+ WITH->nextposs |= (1L << ((long)log_zero)) | (1L << ((long)log_one));
+ if (scanlevel == 1)
+ {
+ WITH->defn = ip;
+ WITH->alwaysconn = true;
+ }
+ else
+ {
+ WITH->defn = NULL;
+ }
+ break;
+
+ case op_vareq:
+ WITH = &LINK->things[ip->ival + LINK->thingvars];
+ WITH->isdef++;
+ if (ip->UU.U1.arg1->opcode == op_one)
+ WITH->nextposs |= 1L << ((long)log_one);
+ else if (ip->UU.U1.arg1->opcode == op_zero)
+ WITH->nextposs |= 1L << ((long)log_zero);
+ else
+ WITH->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
+ if (scanlevel == 1 &&
+ !treerefers(ip->UU.U1.arg1, ip->ival + LINK->thingvars, LINK))
+ WITH->defn = ip;
+ else
+ WITH->defn = NULL;
+ break;
+
+ default:
+ break;
+ }
+ ip = ip->UU.U1.next;
+ }
}
/* Assign optimal variable names; also assign internal node numbers */
/* Concentrates most often-used variables in the faster A through P */
-static void assignvars(LINK)
-struct LOC_compilepage *LINK;
+static void assignvars(struct LOC_compilepage *LINK)
{
- long i, max, done, FORLIM;
- noderec *WITH;
-
- LINK->curppin = 0;
- LINK->curpvar = 0;
- FORLIM = LINK->thingvars;
- for (i = LINK->thingnodes; i < FORLIM; i++) {
- WITH = &LINK->things[i];
- if (WITH->wasused > 0 || WITH->wasdef > 0) {
- WITH->truenum = LINK->curppin;
- LINK->curppin++;
- }
- }
- FORLIM = LINK->numthings;
- for (i = LINK->thingvars; i < FORLIM; i++) {
- WITH = &LINK->things[i];
- if (WITH->wasused > 0 || WITH->wasdef > 0) {
- WITH->truenum = -1;
- LINK->curpvar++;
- } else
- WITH->truenum = 0;
- }
- done = 0;
- while (done < LINK->curpvar) {
- max = 0;
- FORLIM = LINK->numthings;
- for (i = LINK->thingvars; i < FORLIM; i++) {
- WITH = &LINK->things[i];
- if (WITH->truenum < 0 && WITH->wasused > max)
- max = WITH->wasused;
- }
- FORLIM = LINK->numthings;
- for (i = LINK->thingvars; i < FORLIM; i++) {
- WITH = &LINK->things[i];
- if (WITH->truenum < 0 && WITH->wasused >= max) {
- WITH->truenum = done;
- done++;
- }
- }
- }
+ long i, max, done, FORLIM;
+ noderec *WITH;
+
+ LINK->curppin = 0;
+ LINK->curpvar = 0;
+ FORLIM = LINK->thingvars;
+ for (i = LINK->thingnodes; i < FORLIM; i++)
+ {
+ WITH = &LINK->things[i];
+ if (WITH->wasused > 0 || WITH->wasdef > 0)
+ {
+ WITH->truenum = LINK->curppin;
+ LINK->curppin++;
+ }
+ }
+ FORLIM = LINK->numthings;
+ for (i = LINK->thingvars; i < FORLIM; i++)
+ {
+ WITH = &LINK->things[i];
+ if (WITH->wasused > 0 || WITH->wasdef > 0)
+ {
+ WITH->truenum = -1;
+ LINK->curpvar++;
+ } else
+ WITH->truenum = 0;
+ }
+ done = 0;
+ while (done < LINK->curpvar)
+ {
+ max = 0;
+ FORLIM = LINK->numthings;
+ for (i = LINK->thingvars; i < FORLIM; i++)
+ {
+ WITH = &LINK->things[i];
+ if (WITH->truenum < 0 && WITH->wasused > max)
+ max = WITH->wasused;
+ }
+ FORLIM = LINK->numthings;
+ for (i = LINK->thingvars; i < FORLIM; i++)
+ {
+ WITH = &LINK->things[i];
+ if (WITH->truenum < 0 && WITH->wasused >= max)
+ {
+ WITH->truenum = done;
+ done++;
+ }
+ }
+ }
}
/* Clean up node and variable numbers */
-static void clean(ip, LINK)
-instrrec *ip;
-struct LOC_compilepage *LINK;
+static void clean(instrrec *ip, struct LOC_compilepage *LINK)
{
- while (ip != NULL) {
- if (ip->UU.U1.arg1 != NULL)
- clean(ip->UU.U1.arg1, LINK);
- if (ip->UU.U1.arg2 != NULL)
- clean(ip->UU.U1.arg2, LINK);
- if (ip->UU.U1.arg3 != NULL)
- clean(ip->UU.U1.arg3, LINK);
- switch (ip->opcode) {
-
- case op_pin:
- case op_pinref:
- case op_pineq:
- case op_pinoc:
- ip->ival = LINK->things[ip->ival + LINK->thingnodes].truenum;
- break;
-
- case op_var:
- case op_vareq:
- ip->ival = LINK->things[ip->ival + LINK->thingvars].truenum;
- break;
-
- case op_fix1:
- ip->opcode = op_not;
- ip->UU.U1.arg1 = makeinstr1(op_fix0, makenot(ip->UU.U1.arg1, LINK), LINK);
- break;
-
- case op_none: /*should never occur*/
- ip->opcode = op_one;
- break;
-
- default:
- break;
- }
- ip = ip->UU.U1.next;
- }
+ while (ip != NULL)
+ {
+ if (ip->UU.U1.arg1 != NULL)
+ clean(ip->UU.U1.arg1, LINK);
+ if (ip->UU.U1.arg2 != NULL)
+ clean(ip->UU.U1.arg2, LINK);
+ if (ip->UU.U1.arg3 != NULL)
+ clean(ip->UU.U1.arg3, LINK);
+ switch (ip->opcode)
+ {
+ case op_pin:
+ case op_pinref:
+ case op_pineq:
+ case op_pinoc:
+ ip->ival = LINK->things[ip->ival + LINK->thingnodes].truenum;
+ break;
+
+ case op_var:
+ case op_vareq:
+ ip->ival = LINK->things[ip->ival + LINK->thingvars].truenum;
+ break;
+
+ case op_fix1:
+ ip->opcode = op_not;
+ ip->UU.U1.arg1 = makeinstr1(op_fix0, makenot(ip->UU.U1.arg1, LINK), LINK);
+ break;
+
+ case op_none: /*should never occur*/
+ ip->opcode = op_one;
+ break;
+
+ default:
+ break;
+ }
+ ip = ip->UU.U1.next;
+ }
}
/* Local variables for codegen: */
struct LOC_codegen {
- struct LOC_compilepage *LINK;
- int genflag;
- uchar *proc;
+ struct LOC_compilepage *LINK;
+ int genflag;
+ uchar *proc;
} ;
-static void store(b, LINK)
-long b;
-struct LOC_codegen *LINK;
+static void store(long b, struct LOC_codegen *LINK)
{
- LINK->LINK->pc++;
- if (LINK->genflag)
- LINK->proc[LINK->LINK->pc - 1] = (char)b;
+ LINK->LINK->pc++;
+ if (LINK->genflag)
+ LINK->proc[LINK->LINK->pc - 1] = (char)b;
}
-static void storepnum(i, twobytes, LINK)
-long i;
-int twobytes;
-struct LOC_codegen *LINK;
+static void storepnum(long i, int twobytes, struct LOC_codegen *LINK)
{
- if (i >= 64) {
- store(((i - 64) & 127) + 128, LINK);
- store((i - 64) / 128 + 32, LINK);
- return;
- }
- store(i + 64, LINK);
- if (twobytes)
- store(32L, LINK);
+ if (i >= 64)
+ {
+ store(((i - 64) & 127) + 128, LINK);
+ store((i - 64) / 128 + 32, LINK);
+ return;
+ }
+ store(i + 64, LINK);
+ if (twobytes)
+ store(32L, LINK);
}
-static void genlist(ip, LINK)
-instrrec *ip;
-struct LOC_codegen *LINK;
+static void genlist(instrrec *ip, struct LOC_codegen *LINK)
{
- char STR2[256];
-
- while (ip != NULL) {
- switch (ip->opcode) {
-
- case op_if:
- case op_ifnone:
- case op_ifzero:
- case op_ifone:
- case op_ifconn:
- case op_ifzn:
- LINK->LINK->instrcount++;
- switch (ip->opcode) {
-
- case op_if:
- store(3L, LINK);
- break;
-
- case op_ifnone:
- store(4L, LINK);
- break;
-
- case op_ifzero:
- store(5L, LINK);
- break;
-
- case op_ifone:
- store(6L, LINK);
- break;
-
- case op_ifconn:
- store(7L, LINK);
- break;
-
- case op_ifzn:
- store(8L, LINK);
- break;
-
- default:
- break;
- }
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- if (ip->UU.U1.arg3 != NULL) {
- store(15L, LINK); /*ELSE*/
- genlist(ip->UU.U1.arg3, LINK);
- }
- store(2L, LINK); /*END*/
- break;
-
- case op_iftrue: /*if simplify was not called enough times*/
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_iffalse:
- genlist(ip->UU.U1.arg3, LINK);
- break;
-
- case op_pineq:
- LINK->LINK->instrcount++;
- if (ip->ival >= 0) {
- store(16L, LINK);
- storepnum((long)ip->ival, false, LINK);
- } else if (ip->ival < -32) {
- store(30L, LINK);
- store(-ip->ival - 1L, LINK);
- } else
- store(31L - ip->ival, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_pinoc:
- LINK->LINK->instrcount++;
- if (ip->ival >= 0) {
- store(17L, LINK);
- storepnum((long)ip->ival, false, LINK);
- } else if (ip->ival < -32) {
- store(31L, LINK);
- store(-ip->ival - 1L, LINK);
- } else
- store(63L - ip->ival, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_vareq:
- LINK->LINK->instrcount++;
- if (ip->ival < 16) {
- if (ip->UU.U1.arg1->opcode == op_not &&
- ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
- ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival)
- store(ip->ival + 112L, LINK);
- else if (ip->UU.U1.arg1->opcode == op_zero)
- store(ip->ival + 128L, LINK);
- else if (ip->UU.U1.arg1->opcode == op_one)
- store(ip->ival + 144L, LINK);
- else {
- store(ip->ival + 96L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- }
- } else {
- if (ip->UU.U1.arg1->opcode == op_not &&
- ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
- ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival) {
- store(25L, LINK);
- storepnum(ip->ival - 16L, false, LINK);
- } else if (ip->UU.U1.arg1->opcode == op_zero) {
- store(26L, LINK);
- storepnum(ip->ival - 16L, false, LINK);
- } else if (ip->UU.U1.arg1->opcode == op_one) {
- store(27L, LINK);
- storepnum(ip->ival - 16L, false, LINK);
- } else {
- store(24L, LINK);
- storepnum(ip->ival - 16L, false, LINK);
- genlist(ip->UU.U1.arg1, LINK);
+ char STR2[256];
+
+ while (ip != NULL)
+ {
+ switch (ip->opcode)
+ {
+ case op_if:
+ case op_ifnone:
+ case op_ifzero:
+ case op_ifone:
+ case op_ifconn:
+ case op_ifzn:
+ LINK->LINK->instrcount++;
+ switch (ip->opcode)
+ {
+ case op_if:
+ store(3L, LINK);
+ break;
+
+ case op_ifnone:
+ store(4L, LINK);
+ break;
+
+ case op_ifzero:
+ store(5L, LINK);
+ break;
+
+ case op_ifone:
+ store(6L, LINK);
+ break;
+
+ case op_ifconn:
+ store(7L, LINK);
+ break;
+
+ case op_ifzn:
+ store(8L, LINK);
+ break;
+
+ default:
+ break;
+ }
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ if (ip->UU.U1.arg3 != NULL)
+ {
+ store(15L, LINK); /*ELSE*/
+ genlist(ip->UU.U1.arg3, LINK);
+ }
+ store(2L, LINK); /*END*/
+ break;
+
+ case op_iftrue: /*if simplify was not called enough times*/
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_iffalse:
+ genlist(ip->UU.U1.arg3, LINK);
+ break;
+
+ case op_pineq:
+ LINK->LINK->instrcount++;
+ if (ip->ival >= 0)
+ {
+ store(16L, LINK);
+ storepnum((long)ip->ival, false, LINK);
+ }
+ else if (ip->ival < -32)
+ {
+ store(30L, LINK);
+ store(-ip->ival - 1L, LINK);
+ }
+ else
+ {
+ store(31L - ip->ival, LINK);
+ }
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_pinoc:
+ LINK->LINK->instrcount++;
+ if (ip->ival >= 0)
+ {
+ store(17L, LINK);
+ storepnum((long)ip->ival, false, LINK);
+ }
+ else if (ip->ival < -32)
+ {
+ store(31L, LINK);
+ store(-ip->ival - 1L, LINK);
+ }
+ else
+ {
+ store(63L - ip->ival, LINK);
+ }
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_vareq:
+ LINK->LINK->instrcount++;
+ if (ip->ival < 16)
+ {
+ if (ip->UU.U1.arg1->opcode == op_not &&
+ ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
+ ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival)
+ store(ip->ival + 112L, LINK);
+ else if (ip->UU.U1.arg1->opcode == op_zero)
+ store(ip->ival + 128L, LINK);
+ else if (ip->UU.U1.arg1->opcode == op_one)
+ store(ip->ival + 144L, LINK);
+ else
+ {
+ store(ip->ival + 96L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ }
+ }
+ else
+ {
+ if (ip->UU.U1.arg1->opcode == op_not &&
+ ip->UU.U1.arg1->UU.U1.arg1->opcode == op_var &&
+ ip->UU.U1.arg1->UU.U1.arg1->ival == ip->ival)
+ {
+ store(25L, LINK);
+ storepnum(ip->ival - 16L, false, LINK);
+ }
+ else if (ip->UU.U1.arg1->opcode == op_zero)
+ {
+ store(26L, LINK);
+ storepnum(ip->ival - 16L, false, LINK);
+ }
+ else if (ip->UU.U1.arg1->opcode == op_one)
+ {
+ store(27L, LINK);
+ storepnum(ip->ival - 16L, false, LINK);
+ }
+ else
+ {
+ store(24L, LINK);
+ storepnum(ip->ival - 16L, false, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ }
+ }
+ break;
+
+ case op_pulldn:
+ LINK->LINK->instrcount++;
+ store(28L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_pullup:
+ LINK->LINK->instrcount++;
+ store(29L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_and:
+ store(160L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_nand:
+ store(161L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_or:
+ store(162L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_nor:
+ store(163L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_xor:
+ store(164L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_not:
+ if (ip->UU.U1.arg1->opcode == op_var && ip->UU.U1.arg1->ival < 16)
+ store(ip->UU.U1.arg1->ival + 240L, LINK);
+ else
+ {
+ store(165L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ }
+ break;
+
+ case op_rise:
+ store(166L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_fall:
+ store(167L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_zero:
+ store(168L, LINK);
+ break;
+
+ case op_one:
+ store(169L, LINK);
+ break;
+
+ case op_same:
+ store(170L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ genlist(ip->UU.U1.arg2, LINK);
+ break;
+
+ case op_fix0:
+ store(173L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_strong:
+ store(177L, LINK);
+ genlist(ip->UU.U1.arg1, LINK);
+ break;
+
+ case op_pin:
+ case op_pinref:
+ if (ip->ival >= 0)
+ {
+ store(171L, LINK);
+ storepnum((long)ip->ival, false, LINK);
+ }
+ else if (ip->ival < -32)
+ {
+ store(176L, LINK);
+ store(-ip->ival - 1L, LINK);
+ }
+ else
+ store(191L - ip->ival, LINK);
+ break;
+
+ case op_var:
+ if (ip->ival < 16)
+ store(ip->ival + 224L, LINK);
+ else
+ {
+ store(172L, LINK);
+ storepnum(ip->ival - 16L, false, LINK);
+ }
+ break;
+
+ case op_alwaysconn:
+ /* blank case */
+ break;
+
+ default:
+ sprintf(STR2, "Internal error in code generator, opcode=%ld",
+ (long)ip->opcode);
+ /*nothing to store*/
+ error(STR2, LINK->LINK);
+ break;
+ }
+ ip = ip->UU.U1.next;
}
- }
- break;
-
- case op_pulldn:
- LINK->LINK->instrcount++;
- store(28L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_pullup:
- LINK->LINK->instrcount++;
- store(29L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_and:
- store(160L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_nand:
- store(161L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_or:
- store(162L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_nor:
- store(163L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_xor:
- store(164L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_not:
- if (ip->UU.U1.arg1->opcode == op_var && ip->UU.U1.arg1->ival < 16)
- store(ip->UU.U1.arg1->ival + 240L, LINK);
- else {
- store(165L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- }
- break;
-
- case op_rise:
- store(166L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_fall:
- store(167L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_zero:
- store(168L, LINK);
- break;
-
- case op_one:
- store(169L, LINK);
- break;
-
- case op_same:
- store(170L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- genlist(ip->UU.U1.arg2, LINK);
- break;
-
- case op_fix0:
- store(173L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_strong:
- store(177L, LINK);
- genlist(ip->UU.U1.arg1, LINK);
- break;
-
- case op_pin:
- case op_pinref:
- if (ip->ival >= 0) {
- store(171L, LINK);
- storepnum((long)ip->ival, false, LINK);
- } else if (ip->ival < -32) {
- store(176L, LINK);
- store(-ip->ival - 1L, LINK);
- } else
- store(191L - ip->ival, LINK);
- break;
-
- case op_var:
- if (ip->ival < 16)
- store(ip->ival + 224L, LINK);
- else {
- store(172L, LINK);
- storepnum(ip->ival - 16L, false, LINK);
- }
- break;
-
- case op_alwaysconn:
- /* blank case */
- break;
-
- default:
- sprintf(STR2, "Internal error in code generator, opcode=%ld",
- (long)ip->opcode);
- /*nothing to store*/
- error(STR2, LINK->LINK);
- break;
- }
- ip = ip->UU.U1.next;
- }
}
-
/* Generate a GDL definition from a tree */
-static void codegen(genflag_, LINK)
-int genflag_;
-struct LOC_compilepage *LINK;
+static void codegen(int genflag_, struct LOC_compilepage *LINK)
{
- struct LOC_codegen V;
-
- V.LINK = LINK;
- V.genflag = genflag_;
- V.proc = LINK->hdef->proc;
- if (LINK->hdef->numpvars > 0) {
- store(23L, &V); /*INST*/
- store(38L, &V);
- storepnum(LINK->hdef->numppins, true, &V);
- storepnum(LINK->hdef->numpvars, true, &V);
- } else if (LINK->hdef->numppins > 0) {
- store(23L, &V); /*INST*/
- store(36L, &V);
- storepnum(LINK->hdef->numppins, true, &V);
- }
- genlist(LINK->ipbase, &V);
- if (LINK->pc == 0) {
- store(23L, &V); /*INST*/
- store(34L, &V);
- }
- store(0L, &V);
-
- /* store(23); {INST*/
- /* store(34); {*/
+ struct LOC_codegen V;
+
+ V.LINK = LINK;
+ V.genflag = genflag_;
+ V.proc = LINK->hdef->proc;
+ if (LINK->hdef->numpvars > 0)
+ {
+ store(23L, &V); /*INST*/
+ store(38L, &V);
+ storepnum(LINK->hdef->numppins, true, &V);
+ storepnum(LINK->hdef->numpvars, true, &V);
+ }
+ else if (LINK->hdef->numppins > 0)
+ {
+ store(23L, &V); /*INST*/
+ store(36L, &V);
+ storepnum(LINK->hdef->numppins, true, &V);
+ }
+
+ genlist(LINK->ipbase, &V);
+ if (LINK->pc == 0)
+ {
+ store(23L, &V); /*INST*/
+ store(34L, &V);
+ }
+ store(0L, &V);
+
+ /* store(23); {INST*/
+ /* store(34); {*/
} /*codegen*/
-static void writestats(f, pref, LINK)
-FILE *f;
-char *pref;
-struct LOC_compilepage *LINK;
+static void writestats(FILE *f, char *pref, struct LOC_compilepage *LINK)
{
- char STR2[256];
-
- fprintf(f, "%sDump of %s on %s by %s\n",
- pref, LINK->hdef->name, strdate(STR2, "$X"), cuserid(NULL));
- fprintf(f, "%sLOG digital hierarchy compiler version of %s\n\n",
- pref, lastmoddate);
- fprintf(f, "%sCompilation time: %1.2f sec\n",
- pref, LINK->starttime / 100.0);
- fprintf(f, "%sOptimization steps: %ld\n", pref, LINK->simppasscount);
- fprintf(f, "%sOptimization limit: ", pref);
- if (LINK->optlevel < 1000)
- fprintf(f, "%ld\n", LINK->optlevel);
- else
- fprintf(f, "Infinite\n");
- fprintf(f,
- "\n%sDefinition gates: %ld active, %ld instance, %ld inert\n",
- pref, LINK->gatecount, LINK->subcount, LINK->inertcount);
- if (LINK->forcecount > 0)
- fprintf(f, "%sForce-driven nodes: %ld\n", pref, LINK->forcecount);
- fprintf(f, "%sTotal instructions: %ld", pref, LINK->instrcount);
- if (LINK->simppasscount > 0)
- fprintf(f, " (from %ld)", LINK->oldinstrcount);
- fprintf(f, "\n%sProgram bytes: %ld\n", pref, LINK->pc);
- fprintf(f, "%sState variables: ", pref);
- if (LINK->curpvar > 16) {
- fprintf(f, "A-P, V0");
- if (LINK->curpvar > 17)
- fprintf(f, "-V%ld", LINK->curpvar - 17);
- } else if (LINK->curpvar > 1)
- fprintf(f, "A-%c", (char)(LINK->curpvar + 64));
- else if (LINK->curpvar == 1)
- putc('A', f);
- else
- fprintf(f, "None");
- fprintf(f, "\n%sInternal nodes: ", pref);
- if (LINK->curppin > 1)
- fprintf(f, "##0-##%ld", LINK->curppin - 1);
- else if (LINK->curppin == 1)
- fprintf(f, "##0");
- else
- fprintf(f, "None");
- putc('\n', f);
- fprintf(f, "%sExternal pins: %d\n", pref, LINK->numports);
+ char STR2[256];
+
+ fprintf(f, "%sDump of %s on %s by %s\n",
+ pref, LINK->hdef->name, strdate(STR2, "$X"), cuserid(NULL));
+ fprintf(f, "%sLOG digital hierarchy compiler version of %s\n\n",
+ pref, lastmoddate);
+ fprintf(f, "%sCompilation time: %1.2f sec\n",
+ pref, LINK->starttime / 100.0);
+ fprintf(f, "%sOptimization steps: %ld\n", pref, LINK->simppasscount);
+ fprintf(f, "%sOptimization limit: ", pref);
+ if (LINK->optlevel < 1000)
+ fprintf(f, "%ld\n", LINK->optlevel);
+ else
+ fprintf(f, "Infinite\n");
+ fprintf(f,
+ "\n%sDefinition gates: %ld active, %ld instance, %ld inert\n",
+ pref, LINK->gatecount, LINK->subcount, LINK->inertcount);
+ if (LINK->forcecount > 0)
+ fprintf(f, "%sForce-driven nodes: %ld\n", pref, LINK->forcecount);
+ fprintf(f, "%sTotal instructions: %ld", pref, LINK->instrcount);
+ if (LINK->simppasscount > 0)
+ fprintf(f, " (from %ld)", LINK->oldinstrcount);
+ fprintf(f, "\n%sProgram bytes: %ld\n", pref, LINK->pc);
+ fprintf(f, "%sState variables: ", pref);
+ if (LINK->curpvar > 16)
+ {
+ fprintf(f, "A-P, V0");
+ if (LINK->curpvar > 17)
+ fprintf(f, "-V%ld", LINK->curpvar - 17);
+ }
+ else if (LINK->curpvar > 1)
+ fprintf(f, "A-%c", (char)(LINK->curpvar + 64));
+ else if (LINK->curpvar == 1)
+ putc('A', f);
+ else
+ fprintf(f, "None");
+ fprintf(f, "\n%sInternal nodes: ", pref);
+ if (LINK->curppin > 1)
+ fprintf(f, "##0-##%ld", LINK->curppin - 1);
+ else if (LINK->curppin == 1)
+ fprintf(f, "##0");
+ else
+ fprintf(f, "None");
+ putc('\n', f);
+ fprintf(f, "%sExternal pins: %d\n", pref, LINK->numports);
}
-static void dodump(LINK)
-struct LOC_compilepage *LINK;
+static void dodump(struct LOC_compilepage *LINK)
{
- FILE *f;
- char buf[256];
- char STR2[256];
-
- f = NULL;
- sprintf(buf, "/spool/apple.text/dig%ld", ma_rand2(1000L, 9999L));
- sprintf(STR2, "Writing to dump file %s", buf);
- (*logsima_action.lact->hook.vmessage)(STR2);
- if (f != NULL)
- f = freopen(buf, "w", f);
- else
- f = fopen(buf, "w");
- if (f == NULL)
- _EscIO(FileNotFound);
- writestats(f, "", LINK);
- fprintf(f, "\n\n");
- if (LINK->bigdump) {
- dumptree(f, LINK->ipbase, NULL, LINK);
- putc('\n', f);
- }
- dasmhdef(f, LINK->hdef, false);
- if (f != NULL)
- fclose(f);
- f = NULL;
- if (f != NULL)
- fclose(f);
+ FILE *f;
+ char buf[256];
+ char STR2[256];
+
+ f = NULL;
+ sprintf(buf, "/spool/apple.text/dig%ld", ma_rand2(1000L, 9999L));
+ sprintf(STR2, "Writing to dump file %s", buf);
+ (*logsima_action.lact->hook.vmessage)(STR2);
+ if (f != NULL)
+ f = freopen(buf, "w", f);
+ else
+ f = fopen(buf, "w");
+
+ if (f == NULL)
+ _EscIO(FileNotFound);
+ writestats(f, "", LINK);
+ fprintf(f, "\n\n");
+ if (LINK->bigdump)
+ {
+ dumptree(f, LINK->ipbase, NULL, LINK);
+ putc('\n', f);
+ }
+ dasmhdef(f, LINK->hdef, false);
+
+ if (f != NULL)
+ fclose(f);
+ f = NULL;
+
+ if (f != NULL)
+ fclose(f);
}
-static void dowritefile(fn_, LINK)
-char *fn_;
-struct LOC_compilepage *LINK;
+static void dowritefile(char *fn_, struct LOC_compilepage *LINK)
{
- char fn[256];
- FILE *f;
- char STR1[256];
-
- strcpy(fn, fn_);
- f = NULL;
- sprintf(STR1, "Writing definition to file %s", fn);
- (*logsima_action.lact->hook.vmessage)(STR1);
- if (f != NULL)
- f = freopen(fn, "w", f);
- else
- f = fopen(fn, "w");
- if (f == NULL)
- _EscIO(FileNotFound);
- writestats(f, "# ", LINK);
- fprintf(f, "\nUPDATEKIND\n");
- fprintf(f, "SIMTYPE 16\n\n");
- dasmhdef(f, LINK->hdef, true);
- putc('\n', f);
- if (f != NULL)
- fclose(f);
- f = NULL;
- if (f != NULL)
- fclose(f);
+ char fn[256];
+ FILE *f;
+ char STR1[256];
+
+ strcpy(fn, fn_);
+ f = NULL;
+ sprintf(STR1, "Writing definition to file %s", fn);
+ (*logsima_action.lact->hook.vmessage)(STR1);
+ if (f != NULL)
+ f = freopen(fn, "w", f);
+ else
+ f = fopen(fn, "w");
+
+ if (f == NULL)
+ _EscIO(FileNotFound);
+
+ writestats(f, "# ", LINK);
+ fprintf(f, "\nUPDATEKIND\n");
+ fprintf(f, "SIMTYPE 16\n\n");
+ dasmhdef(f, LINK->hdef, true);
+ putc('\n', f);
+
+ if (f != NULL)
+ fclose(f);
+ f = NULL;
+
+ if (f != NULL)
+ fclose(f);
}
-static void showstats(LINK)
-struct LOC_compilepage *LINK;
+static void showstats(struct LOC_compilepage *LINK)
{
- char buf[256];
- log_action_t *WITH;
- char STR1[256];
- char STR2[256];
-
- WITH = logsima_action.lact;
- sprintf(buf, "Compilation of %s took %s seconds",
- LINK->hdef->name,
- ma_strfmtreal(STR1, LINK->starttime / 100.0, -1L, 2L));
- if (LINK->simppasscount > 0)
- sprintf(buf + strlen(buf), " in %ld optimization steps",
- LINK->simppasscount);
- sprintf(STR2, "%s.", buf);
- (*WITH->hook.message)(STR2);
- sprintf(buf, "Gate program is %ld bytes = %ld instructions long",
- LINK->pc, LINK->instrcount);
- (*WITH->hook.message)(buf);
- sprintf(buf, "Program uses %ld state variable", LINK->curpvar);
- if (LINK->curpvar != 1)
- strcat(buf, "s");
- sprintf(buf + strlen(buf), " and %ld internal node", LINK->curppin);
- if (LINK->curppin != 1)
- strcat(buf, "s");
- sprintf(STR2, "%s.", buf);
- (*WITH->hook.message)(STR2);
+ char buf[256];
+ log_action_t *WITH;
+ char STR1[256];
+ char STR2[256];
+
+ WITH = logsima_action.lact;
+ sprintf(buf, "Compilation of %s took %s seconds",
+ LINK->hdef->name,
+ ma_strfmtreal(STR1, LINK->starttime / 100.0, -1L, 2L));
+
+ if (LINK->simppasscount > 0)
+ sprintf(buf + strlen(buf), " in %ld optimization steps",
+ LINK->simppasscount);
+
+ sprintf(STR2, "%s.", buf);
+ (*WITH->hook.message)(STR2);
+ sprintf(buf, "Gate program is %ld bytes = %ld instructions long",
+ LINK->pc, LINK->instrcount);
+ (*WITH->hook.message)(buf);
+ sprintf(buf, "Program uses %ld state variable", LINK->curpvar);
+
+ if (LINK->curpvar != 1)
+ strcat(buf, "s");
+ sprintf(buf + strlen(buf), " and %ld internal node", LINK->curppin);
+
+ if (LINK->curppin != 1)
+ strcat(buf, "s");
+ sprintf(STR2, "%s.", buf);
+ (*WITH->hook.message)(STR2);
}
@@ -4088,790 +4217,939 @@ struct LOC_compilepage *LINK;
It works by converting each GDL procedure into tree form, combining the
trees, simplifying, then converting the resulting tree back into GDL. */
-static void compilepage(hdef_)
-hdefrec *hdef_;
+static void compilepage(hdefrec *hdef_)
{
- struct LOC_compilepage V;
- controlinfo *cip;
- int wantstats, dumpflag;
- char writefile[256];
- long i, extrarpt;
- log_nrec **templs;
- short *pnumlist;
- na_strlist_t *l1;
- dependrec *dep;
- log_lrec *lp;
- char buf[256], wrd[256];
- log_sigrec *sig;
- log_action_t *WITH;
- char STR1[256];
- char STR2[256];
- char STR3[256];
- long FORLIM;
- noderec *WITH1;
-
-
- V.instrcount = 0;
- V.pc = 0;
- V.hdef = hdef_;
- WITH = logsima_action.lact;
- if (V.hdef->gcontrol != NULL)
- cip = (controlinfo *)V.hdef->gcontrol->info;
- else
- cip = NULL;
- V.starttime = timers_sysclock();
- if (V.hdef->wantnote) {
- if (V.hdef->proclen == 0) { /*****/
- sprintf(STR1, "Compiling %s", V.hdef->name);
- (*WITH->hook.vmessage)(STR1);
- } else { /*****/
- sprintf(STR1, "Recompiling %s", V.hdef->name);
- (*WITH->hook.vmessage)(STR1);
- }
- /*****/
- /*****/
- }
- if (V.hdef->pindata != NULL)
- Free(V.hdef->pindata);
- V.okay = true;
- V.numports = -1;
- if (vddsig == NULL)
- (*WITH->hook.getsig)("Vdd", &vddsig);
- if (gndsig == NULL)
- (*WITH->hook.getsig)("Gnd", &gndsig);
- V.n = WITH->nbase;
- while (V.n != NULL) {
- V.n->temp = (na_long)LONG_MIN;
- V.n = V.n->next;
- }
- while (V.hdef->depends != NULL) {
- dep = V.hdef->depends;
- V.hdef->depends = dep->next;
- Free(dep);
- }
- V.inertlist = NULL;
- V.isverbose = false;
- wantstats = V.hdef->wantstats;
- dumpflag = false;
- *writefile = '\0';
- V.bigdump = (V.hdef->dumpmode == dump_big);
- if (V.hdef->dumphighlight) {
- if (V.hdef->dumpmode == dump_write)
- strcpy(writefile, V.hdef->writefile);
- else
- dumpflag = true;
- }
- V.hdef->optflag = (V.hdef->nextoptflag || V.hdef->optmode == opt_always);
- if (V.hdef->optflag)
- V.optlevel = V.hdef->optlevel;
- else
- V.optlevel = 0;
- V.optdelay = (V.hdef->optdelay && V.optlevel >= 3);
- V.hdef->nextoptflag = false;
- V.mybox = V.hdef->defbox;
- lp = WITH->lbase[V.hdef->pgnum - 1];
- while (lp != NULL && V.okay) {
- if (labelinbox(V.mybox, lp) && commandlabel(lp, wrd, buf)) {
- if (!strcmp(wrd, "INERT")) {
- while (*buf != '\0') {
- strword(buf, wrd);
- l1 = strlist_add(&V.inertlist, strupper(STR2, wrd));
- }
- } else if (!strcmp(wrd, "VERBOSE"))
- V.isverbose = true;
- else if (!strcmp(wrd, "TIMING"))
- wantstats = true;
- else if (!strcmp(wrd, "DUMP")) {
- dumpflag = true;
- if (strcicmp(buf, "BIG") == 0)
- V.bigdump = true;
- } else if (!strcmp(wrd, "WRITEDEF")) {
- if (*buf == '\0')
- strpart(writefile, V.hdef->name, 2,
- (int)(strlen(V.hdef->name) - 1L));
+ struct LOC_compilepage V;
+ controlinfo *cip;
+ int wantstats, dumpflag;
+ char writefile[256];
+ long i, extrarpt;
+ log_nrec **templs;
+ short *pnumlist;
+ na_strlist_t *l1;
+ dependrec *dep;
+ log_lrec *lp;
+ char buf[256], wrd[256];
+ log_sigrec *sig;
+ log_action_t *WITH;
+ char STR1[256];
+ char STR2[256];
+ char STR3[256];
+ long FORLIM;
+ noderec *WITH1;
+
+
+ V.instrcount = 0;
+ V.pc = 0;
+ V.hdef = hdef_;
+ WITH = logsima_action.lact;
+
+ if (V.hdef->gcontrol != NULL)
+ cip = (controlinfo *)V.hdef->gcontrol->info;
else
- strcpy(writefile, buf);
- newci_fixfname(writefile, "def", "");
- } else if (!strcmp(wrd, "OPT") || !strcmp(wrd, "OPTIMIZE")) {
- if (*buf != '\0' && strsubset(buf, "0123456789"))
- V.optlevel = strtol(buf, NULL, 0);
+ cip = NULL;
+
+ V.starttime = timers_sysclock();
+
+ if (V.hdef->wantnote)
+ {
+ if (V.hdef->proclen == 0)
+ { /*****/
+ sprintf(STR1, "Compiling %s", V.hdef->name);
+ (*WITH->hook.vmessage)(STR1);
+ }
+ else
+ { /*****/
+ sprintf(STR1, "Recompiling %s", V.hdef->name);
+ (*WITH->hook.vmessage)(STR1);
+ }
+ /*****/
+ /*****/
+ }
+ if (V.hdef->pindata != NULL)
+ Free(V.hdef->pindata);
+
+ V.okay = true;
+ V.numports = -1;
+
+ if (vddsig == NULL)
+ (*WITH->hook.getsig)("Vdd", &vddsig);
+
+ if (gndsig == NULL)
+ (*WITH->hook.getsig)("Gnd", &gndsig);
+ V.n = WITH->nbase;
+
+ while (V.n != NULL)
+ {
+ V.n->temp = (na_long)LONG_MIN;
+ V.n = V.n->next;
+ }
+
+ while (V.hdef->depends != NULL)
+ {
+ dep = V.hdef->depends;
+ V.hdef->depends = dep->next;
+ Free(dep);
+ }
+
+ V.inertlist = NULL;
+ V.isverbose = false;
+ wantstats = V.hdef->wantstats;
+ dumpflag = false;
+ *writefile = '\0';
+ V.bigdump = (V.hdef->dumpmode == dump_big);
+
+ if (V.hdef->dumphighlight)
+ {
+ if (V.hdef->dumpmode == dump_write)
+ strcpy(writefile, V.hdef->writefile);
+ else
+ dumpflag = true;
+ }
+ V.hdef->optflag = (V.hdef->nextoptflag || V.hdef->optmode == opt_always);
+
+ if (V.hdef->optflag)
+ V.optlevel = V.hdef->optlevel;
else
- error("Syntax error in <OPTIMIZE>", &V);
- } else if (!strcmp(wrd, "PORT") || !strcmp(wrd, "PORTS")) {
- if (V.numports >= 0) {
- sprintf(STR1, "More than one <port> declaration exists for %s",
- V.hdef->name);
- error(STR1, &V);
- } else {
- i = 0;
- while (*buf != '\0') {
- strword(buf, wrd);
- if (strcicmp(wrd, "VDD") == 0 || strcicmp(wrd, "GND") == 0)
- continue;
- i++;
- (*WITH->hook.getsig)(wrd, &sig);
- if ((long)sig->np->temp == LONG_MIN || (long)sig->np->temp == 0)
- /*newly created*/
- sig->np->temp = (na_long)(-i);
- else {
- sprintf(STR3, "Node %s appears as more than one port", wrd);
- error(STR3, &V);
- }
- }
- V.numports = i;
+ V.optlevel = 0;
+
+ V.optdelay = (V.hdef->optdelay && V.optlevel >= 3);
+ V.hdef->nextoptflag = false;
+ V.mybox = V.hdef->defbox;
+ lp = WITH->lbase[V.hdef->pgnum - 1];
+ while (lp != NULL && V.okay)
+ {
+ if (labelinbox(V.mybox, lp) && commandlabel(lp, wrd, buf))
+ {
+ if (!strcmp(wrd, "INERT"))
+ {
+ while (*buf != '\0')
+ {
+ strword(buf, wrd);
+ l1 = strlist_add(&V.inertlist, strupper(STR2, wrd));
+ }
+ }
+ else if (!strcmp(wrd, "VERBOSE"))
+ V.isverbose = true;
+ else if (!strcmp(wrd, "TIMING"))
+ wantstats = true;
+ else if (!strcmp(wrd, "DUMP")) {
+ dumpflag = true;
+ if (strcicmp(buf, "BIG") == 0)
+ V.bigdump = true;
+ }
+ else if (!strcmp(wrd, "WRITEDEF"))
+ {
+ if (*buf == '\0')
+ strpart(writefile, V.hdef->name, 2,
+ (int)(strlen(V.hdef->name) - 1L));
+ else
+ strcpy(writefile, buf);
+ newci_fixfname(writefile, "def", "");
+ }
+ else if (!strcmp(wrd, "OPT") || !strcmp(wrd, "OPTIMIZE"))
+ {
+ if (*buf != '\0' && strsubset(buf, "0123456789"))
+ V.optlevel = strtol(buf, NULL, 0);
+ else
+ error("Syntax error in <OPTIMIZE>", &V);
+ }
+ else if (!strcmp(wrd, "PORT") || !strcmp(wrd, "PORTS"))
+ {
+ if (V.numports >= 0)
+ {
+ sprintf(STR1, "More than one <port> declaration exists for %s",
+ V.hdef->name);
+ error(STR1, &V);
+ }
+ else
+ {
+ i = 0;
+ while (*buf != '\0')
+ {
+ strword(buf, wrd);
+ if (strcicmp(wrd, "VDD") == 0 || strcicmp(wrd, "GND") == 0)
+ continue;
+ i++;
+ (*WITH->hook.getsig)(wrd, &sig);
+
+ if ((long)sig->np->temp == LONG_MIN || (long)sig->np->temp == 0)
+ /*newly created*/
+ sig->np->temp = (na_long)(-i);
+ else
+ {
+ sprintf(STR3, "Node %s appears as more than one port", wrd);
+ error(STR3, &V);
+ }
+ }
+ V.numports = i;
+ }
+ }
+ }
+ lp = lp->next;
}
- }
- }
- lp = lp->next;
- }
- if (V.okay) {
- if (V.numports >= 0) {
- V.hdef->lastnorth = -1;
- V.hdef->lasteast = -1;
- V.hdef->lastsouth = -1;
- V.hdef->gtempl = NULL;
- } else {
- V.gtempl = WITH->gbase[V.hdef->pgnum - 1];
- while (V.gtempl != NULL && (isinstance(V.gtempl) != V.hdef ||
- !gateinbox(V.mybox, V.gtempl)))
- V.gtempl = V.gtempl->next;
- V.hdef->gtempl = V.gtempl;
- if (V.gtempl != NULL) {
- templs = (log_nrec **)Malloc(V.gtempl->kind->numpins * sizeof(log_nrec *));
- pnumlist = NULL;
- examinetemplate(V.gtempl, templs, (long)V.gtempl->kind->numpins, isgenericinstgate(V.gtempl),
- &pnumlist, &V.hdef->lastnorth, &V.hdef->lasteast,
- &V.hdef->lastsouth, &V.numports);
- Free(pnumlist);
- FORLIM = V.numports;
- for (i = 1; i <= FORLIM; i++) {
- if ((long)templs[i - 1]->temp == LONG_MIN)
- templs[i - 1]->temp = (na_long)(-i);
- else {
- sprintf(STR3, "Template \"%s\" pin %ld is shorted",V.hdef->name,i);
- error(STR3, &V);
- }
+
+ if (V.okay)
+ {
+ if (V.numports >= 0)
+ {
+ V.hdef->lastnorth = -1;
+ V.hdef->lasteast = -1;
+ V.hdef->lastsouth = -1;
+ V.hdef->gtempl = NULL;
+ }
+ else
+ {
+ V.gtempl = WITH->gbase[V.hdef->pgnum - 1];
+
+ while (V.gtempl != NULL && (isinstance(V.gtempl) != V.hdef ||
+ !gateinbox(V.mybox, V.gtempl)))
+ V.gtempl = V.gtempl->next;
+ V.hdef->gtempl = V.gtempl;
+
+ if (V.gtempl != NULL)
+ {
+ templs = (log_nrec **)Malloc(V.gtempl->kind->numpins * sizeof(log_nrec *));
+ pnumlist = NULL;
+ examinetemplate(V.gtempl, templs, (long)V.gtempl->kind->numpins, isgenericinstgate(V.gtempl),
+ &pnumlist, &V.hdef->lastnorth, &V.hdef->lasteast,
+ &V.hdef->lastsouth, &V.numports);
+ Free(pnumlist);
+ FORLIM = V.numports;
+
+ for (i = 1; i <= FORLIM; i++)
+ {
+ if ((long)templs[i - 1]->temp == LONG_MIN)
+ templs[i - 1]->temp = (na_long)(-i);
+ else
+ {
+ sprintf(STR3, "Template \"%s\" pin %ld is shorted",V.hdef->name,i);
+ error(STR3, &V);
+ }
+ }
+ Free(templs);
+ }
+ else
+ {
+ sprintf(STR3, "No port list or template gate for %s", V.hdef->name);
+ error(STR3, &V);
+ }
+ }
+
+ V.hdef->numports = V.numports;
+ V.curppin = 0;
+ V.curpvar = 0;
+ V.oldinstrcount = 0;
+ V.gatecount = 0;
+ V.subcount = 0;
+ V.inertcount = 0;
+ V.forcecount = 0;
}
- Free(templs);
- } else {
- sprintf(STR3, "No port list or template gate for %s", V.hdef->name);
- error(STR3, &V);
- }
- }
- V.hdef->numports = V.numports;
- V.curppin = 0;
- V.curpvar = 0;
- V.oldinstrcount = 0;
- V.gatecount = 0;
- V.subcount = 0;
- V.inertcount = 0;
- V.forcecount = 0;
- }
- V.gcontrol = NULL;
- if (V.isverbose)
- printf("\f");
- V.ipbase = NULL;
- if (V.okay) {
- sprintf(STR3, "Compiling %s", V.hdef->name);
- showcontrol(V.hdef, STR3);
- parsegates(&V);
- }
- if (V.gcontrol != V.hdef->gcontrol && (V.okay || V.gcontrol != NULL)) {
- if (V.hdef->gcontrol != NULL) {
- cip->hdef = NULL; /*disconnect old gate*/
- refrcontrol(V.hdef->gcontrol, 0);
- }
- V.hdef->gcontrol = V.gcontrol;
- if (V.gcontrol != NULL) {
- cip = (controlinfo *)V.gcontrol->info;
- cip->hdef = V.hdef; /*connect new one*/
- if ((((unsigned long)V.gcontrol->vars) & (1L << 0)) != 0)
- grabcontrolattrs(V.hdef, V.gcontrol);
- else
- storecontrolattrs(V.hdef, V.gcontrol);
- V.gcontrol->vars = (na_long)
- (((unsigned long)V.gcontrol->vars) & (~(1L << 0)));
- refrcontrol(V.gcontrol, 0);
- } else
- cip = NULL;
- }
- if (V.okay) {
- /* "things" array consists of NUMPORTS external nodes, */
- /* followed by CURPPIN internal nodes, */
- /* followed by CURPVAR state variables */
- V.savecurpvar = V.curpvar;
- V.numthings = V.curppin + V.numports + V.curpvar;
- V.thingnodes = V.numports;
- V.thingvars = V.curppin + V.numports;
- V.things = (noderec *)Malloc(V.numthings * sizeof(noderec));
- FORLIM = V.thingnodes;
- for (i = 0; i < FORLIM; i++) { /*external nodes*/
- WITH1 = &V.things[i];
- WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
- (1L << ((long)log_one));
- WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
- (1L << ((long)log_one));
- WITH1->alwaysconn = false;
- WITH1->strong = false;
- WITH1->wasstrong = false;
- WITH1->isdef = 0;
- WITH1->isused = 0;
- WITH1->level = 1;
- WITH1->truenum = i - V.thingnodes;
- WITH1->defn = NULL;
- WITH1->loopflag = false;
- }
- FORLIM = V.thingvars;
- for (i = V.thingnodes; i < FORLIM; i++) { /*internal nodes*/
- WITH1 = &V.things[i];
- WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
- (1L << ((long)log_one));
- WITH1->nextposs = 1L << ((long)log_none);
- WITH1->alwaysconn = false;
- WITH1->strong = false;
- WITH1->wasstrong = false;
- WITH1->isdef = 0;
- WITH1->isused = 0;
- WITH1->level = 1;
- WITH1->truenum = i - V.thingnodes;
- WITH1->defn = NULL;
- WITH1->loopflag = false;
- }
- FORLIM = V.numthings;
- for (i = V.thingvars; i < FORLIM; i++) { /*state variables*/
- WITH1 = &V.things[i];
- WITH1->poss = (1L << ((long)log_zero)) | (1L << ((long)log_one));
- WITH1->nextposs = 0;
- WITH1->strong = true;
- WITH1->wasstrong = true;
- WITH1->isdef = 0;
- WITH1->isused = 0;
- WITH1->level = 1;
- WITH1->truenum = i - V.thingvars;
- WITH1->defn = NULL;
- WITH1->loopflag = false;
- }
- }
- V.simppasscount = 0;
- if (V.optlevel >= 1 && V.okay) {
- V.truevars = false;
- V.hasstats = false;
- simplify(&V.ipbase, &V);
- scan(V.ipbase, 1L, &V);
- if (V.isverbose) {
- printf("after simplify:\n");
- dumptree(stdout, V.ipbase, NULL, &V);
- putchar('\n');
- }
- }
- if (V.optlevel >= 2 && V.okay) {
- FORLIM = V.thingnodes;
- for (i = 0; i < FORLIM; i++) {
- WITH1 = &V.things[i];
- WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
- (1L << ((long)log_one));
- WITH1->wasdef = WITH1->isdef;
- WITH1->isdef = 0;
- WITH1->wasused = WITH1->isused;
- WITH1->isused = 0;
- WITH1->wasstrong = WITH1->strong;
- WITH1->strong = false;
- }
- FORLIM = V.thingvars;
- for (i = V.thingnodes; i < FORLIM; i++) {
- WITH1 = &V.things[i];
- WITH1->poss &= WITH1->nextposs;
- /* if (isdef = 0) then
- poss := [log_none]; */
- WITH1->nextposs = 1L << ((long)log_none);
- WITH1->wasdef = WITH1->isdef;
- WITH1->isdef = 0;
- WITH1->wasused = WITH1->isused;
- WITH1->isused = 0;
- WITH1->wasstrong = WITH1->strong;
- WITH1->strong = false;
- }
- FORLIM = V.numthings;
- for (i = V.thingvars; i < FORLIM; i++) {
- WITH1 = &V.things[i];
- if (WITH1->isdef == 0 ||
- ((1L << ((long)log_one)) & WITH1->nextposs) == 0)
- WITH1->poss = 1L << ((long)log_zero);
- else if (WITH1->nextposs == 1L << ((long)log_one))
- WITH1->poss = 1L << ((long)log_one);
- WITH1->nextposs = 0;
- WITH1->wasdef = WITH1->isdef;
- WITH1->isdef = 0;
- WITH1->wasused = WITH1->isused;
- WITH1->isused = 0;
- }
- V.hasstats = true;
- extrarpt = 2;
- do {
- simplify(&V.ipbase, &V);
- scan(V.ipbase, 1L, &V);
- FORLIM = V.thingnodes;
- for (i = 0; i < FORLIM; i++) {
- WITH1 = &V.things[i];
- if (WITH1->alwaysconn) {
- if (WITH1->poss != 1L << ((long)log_none))
- WITH1->poss &= ~(1L << ((long)log_none));
- WITH1->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
- } else
- WITH1->nextposs = (1L << ((long)log_none)) |
- (1L << ((long)log_zero)) | (1L << ((long)log_one));
- WITH1->wasdef = WITH1->isdef;
- WITH1->isdef = 0;
- WITH1->wasused = WITH1->isused;
- WITH1->isused = 0;
- WITH1->wasstrong = WITH1->strong;
- WITH1->strong = false;
- }
- FORLIM = V.thingvars;
- for (i = V.thingnodes; i < FORLIM; i++) {
- WITH1 = &V.things[i];
- WITH1->poss &= WITH1->nextposs;
- if (WITH1->alwaysconn && WITH1->poss != 1L << ((long)log_none))
- WITH1->poss &= ~(1L << ((long)log_none));
- WITH1->nextposs = 1L << ((long)log_none);
- WITH1->wasdef = WITH1->isdef;
- WITH1->isdef = 0;
- WITH1->wasused = WITH1->isused;
- WITH1->isused = 0;
- WITH1->wasstrong = WITH1->strong;
- WITH1->strong = false;
- }
- FORLIM = V.numthings;
- for (i = V.thingvars; i < FORLIM; i++) {
- WITH1 = &V.things[i];
- WITH1->poss &= WITH1->nextposs;
- if (WITH1->poss == 0)
- WITH1->poss = 1L << ((long)log_zero);
- WITH1->nextposs = 0;
- WITH1->wasdef = WITH1->isdef;
- WITH1->isdef = 0;
- WITH1->wasused = WITH1->isused;
- WITH1->isused = 0;
- }
- if (V.changed)
- extrarpt = 2;
- else if (extrarpt > 0)
- extrarpt--;
- } while (V.okay && extrarpt > 0 && V.simppasscount < V.optlevel);
- /* until not okay or ((curppin = oldcurppin) and
- (curpvar = oldcurpvar) and
- ((not changed and
- (rptcount >= optlevel div 2)) or
- (rptcount >= optlevel))); */
- if (V.okay)
- assignvars(&V);
- if (V.optlevel >= 3 && V.simppasscount < V.optlevel) {
- V.truevars = true;
- simplify(&V.ipbase, &V);
- }
- }
- if (V.okay) {
- clean(V.ipbase, &V);
- V.hdef->numppins = V.curppin;
- V.hdef->numpvars = P_imax2((long)(V.curpvar - 16), 0L);
- V.pc = 0;
- V.instrcount = 0;
- codegen(false, &V); /*find out how long it will be*/
- if (V.pc != V.hdef->proclen) {
- if (V.hdef->proc != NULL)
- Free(V.hdef->proc);
- V.hdef->proc = (uchar *)Malloc(V.pc);
- V.hdef->proclen = V.pc;
- }
- V.pc = 0;
- V.instrcount = 0;
- codegen(true, &V); /*actually generate the code*/
- }
- V.starttime = timers_sysclock() - V.starttime;
- if (wantstats)
- showstats(&V);
- if (V.okay) {
- if (dumpflag) {
- showcontrol(V.hdef, "Dumping...");
- if (V.hdef->oldshowstamp != showstamp) {
- V.hdef->oldshowstamp = showstamp;
- dodump(&V);
- }
- } else
- V.hdef->oldshowstamp = 0;
- if (V.isverbose)
- dasmhdef(stdout, V.hdef, false);
- if (*writefile != '\0') {
- sprintf(STR1, "Writing to \"%s\"", writefile);
- showcontrol(V.hdef, STR1);
- dowritefile(writefile, &V);
- }
- }
- disposetree(&V.ipbase, &V);
- strlist_empty(&V.inertlist);
- V.hdef->defined_ = V.okay;
- V.hdef->dumphighlight = false;
- if (V.optlevel > 0) {
- WITH->curstamp++;
- V.hdef->clearstamp = WITH->curstamp;
- }
- refrcontrol(V.hdef->gcontrol, 0);
-} /*compilepage*/
-#undef setmax
+ V.gcontrol = NULL;
+
+ if (V.isverbose)
+ printf("\f");
+ V.ipbase = NULL;
+
+ if (V.okay)
+ {
+ sprintf(STR3, "Compiling %s", V.hdef->name);
+ showcontrol(V.hdef, STR3);
+ parsegates(&V);
+ }
+
+ if (V.gcontrol != V.hdef->gcontrol && (V.okay || V.gcontrol != NULL))
+ {
+ if (V.hdef->gcontrol != NULL)
+ {
+ cip->hdef = NULL; /*disconnect old gate*/
+ refrcontrol(V.hdef->gcontrol, 0);
+ }
+
+ V.hdef->gcontrol = V.gcontrol;
+ if (V.gcontrol != NULL)
+ {
+ cip = (controlinfo *)V.gcontrol->info;
+ cip->hdef = V.hdef; /*connect new one*/
+ if ((((unsigned long)V.gcontrol->vars) & (1L << 0)) != 0)
+ grabcontrolattrs(V.hdef, V.gcontrol);
+ else
+ storecontrolattrs(V.hdef, V.gcontrol);
+ V.gcontrol->vars = (na_long)
+ (((unsigned long)V.gcontrol->vars) & (~(1L << 0)));
+ refrcontrol(V.gcontrol, 0);
+ }
+ else
+ cip = NULL;
+ }
+
+ if (V.okay)
+ {
+ /* "things" array consists of NUMPORTS external nodes, */
+ /* followed by CURPPIN internal nodes, */
+ /* followed by CURPVAR state variables */
+ V.savecurpvar = V.curpvar;
+ V.numthings = V.curppin + V.numports + V.curpvar;
+ V.thingnodes = V.numports;
+ V.thingvars = V.curppin + V.numports;
+ V.things = (noderec *)Malloc(V.numthings * sizeof(noderec));
+ FORLIM = V.thingnodes;
+
+ for (i = 0; i < FORLIM; i++)
+ { /*external nodes*/
+ WITH1 = &V.things[i];
+ WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+ (1L << ((long)log_one));
+ WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+ (1L << ((long)log_one));
+ WITH1->alwaysconn = false;
+ WITH1->strong = false;
+ WITH1->wasstrong = false;
+ WITH1->isdef = 0;
+ WITH1->isused = 0;
+ WITH1->level = 1;
+ WITH1->truenum = i - V.thingnodes;
+ WITH1->defn = NULL;
+ WITH1->loopflag = false;
+ }
+
+ FORLIM = V.thingvars;
+
+ for (i = V.thingnodes; i < FORLIM; i++)
+ { /*internal nodes*/
+ WITH1 = &V.things[i];
+ WITH1->poss = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+ (1L << ((long)log_one));
+ WITH1->nextposs = 1L << ((long)log_none);
+ WITH1->alwaysconn = false;
+ WITH1->strong = false;
+ WITH1->wasstrong = false;
+ WITH1->isdef = 0;
+ WITH1->isused = 0;
+ WITH1->level = 1;
+ WITH1->truenum = i - V.thingnodes;
+ WITH1->defn = NULL;
+ WITH1->loopflag = false;
+ }
+ FORLIM = V.numthings;
+
+ for (i = V.thingvars; i < FORLIM; i++)
+ { /*state variables*/
+ WITH1 = &V.things[i];
+ WITH1->poss = (1L << ((long)log_zero)) | (1L << ((long)log_one));
+ WITH1->nextposs = 0;
+ WITH1->strong = true;
+ WITH1->wasstrong = true;
+ WITH1->isdef = 0;
+ WITH1->isused = 0;
+ WITH1->level = 1;
+ WITH1->truenum = i - V.thingvars;
+ WITH1->defn = NULL;
+ WITH1->loopflag = false;
+ }
+ }
+
+ V.simppasscount = 0;
+ if (V.optlevel >= 1 && V.okay)
+ {
+ V.truevars = false;
+ V.hasstats = false;
+ simplify(&V.ipbase, &V);
+ scan(V.ipbase, 1L, &V);
+ if (V.isverbose)
+ {
+ printf("after simplify:\n");
+ dumptree(stdout, V.ipbase, NULL, &V);
+ putchar('\n');
+ }
+ }
+
+ if (V.optlevel >= 2 && V.okay)
+ {
+ FORLIM = V.thingnodes;
+ for (i = 0; i < FORLIM; i++)
+ {
+ WITH1 = &V.things[i];
+ WITH1->nextposs = (1L << ((long)log_none)) | (1L << ((long)log_zero)) |
+ (1L << ((long)log_one));
+ WITH1->wasdef = WITH1->isdef;
+ WITH1->isdef = 0;
+ WITH1->wasused = WITH1->isused;
+ WITH1->isused = 0;
+ WITH1->wasstrong = WITH1->strong;
+ WITH1->strong = false;
+ }
+ FORLIM = V.thingvars;
+ for (i = V.thingnodes; i < FORLIM; i++)
+ {
+ WITH1 = &V.things[i];
+ WITH1->poss &= WITH1->nextposs;
+ /* if (isdef = 0) then
+poss := [log_none]; */
+ WITH1->nextposs = 1L << ((long)log_none);
+ WITH1->wasdef = WITH1->isdef;
+ WITH1->isdef = 0;
+ WITH1->wasused = WITH1->isused;
+ WITH1->isused = 0;
+ WITH1->wasstrong = WITH1->strong;
+ WITH1->strong = false;
+ }
+ FORLIM = V.numthings;
+ for (i = V.thingvars; i < FORLIM; i++)
+ {
+ WITH1 = &V.things[i];
+ if (WITH1->isdef == 0 ||
+ ((1L << ((long)log_one)) & WITH1->nextposs) == 0)
+ WITH1->poss = 1L << ((long)log_zero);
+ else if (WITH1->nextposs == 1L << ((long)log_one))
+ WITH1->poss = 1L << ((long)log_one);
+ WITH1->nextposs = 0;
+ WITH1->wasdef = WITH1->isdef;
+ WITH1->isdef = 0;
+ WITH1->wasused = WITH1->isused;
+ WITH1->isused = 0;
+ }
+
+ V.hasstats = true;
+ extrarpt = 2;
+ do
+ {
+ simplify(&V.ipbase, &V);
+ scan(V.ipbase, 1L, &V);
+ FORLIM = V.thingnodes;
+ for (i = 0; i < FORLIM; i++)
+ {
+ WITH1 = &V.things[i];
+ if (WITH1->alwaysconn)
+ {
+ if (WITH1->poss != 1L << ((long)log_none))
+ WITH1->poss &= ~(1L << ((long)log_none));
+ WITH1->nextposs = (1L << ((long)log_zero)) | (1L << ((long)log_one));
+ }
+ else
+ WITH1->nextposs = (1L << ((long)log_none)) |
+ (1L << ((long)log_zero)) | (1L << ((long)log_one));
+
+ WITH1->wasdef = WITH1->isdef;
+ WITH1->isdef = 0;
+ WITH1->wasused = WITH1->isused;
+ WITH1->isused = 0;
+ WITH1->wasstrong = WITH1->strong;
+ WITH1->strong = false;
+ }
+
+ FORLIM = V.thingvars;
+ for (i = V.thingnodes; i < FORLIM; i++)
+ {
+ WITH1 = &V.things[i];
+ WITH1->poss &= WITH1->nextposs;
+ if (WITH1->alwaysconn && WITH1->poss != 1L << ((long)log_none))
+ WITH1->poss &= ~(1L << ((long)log_none));
+ WITH1->nextposs = 1L << ((long)log_none);
+ WITH1->wasdef = WITH1->isdef;
+ WITH1->isdef = 0;
+ WITH1->wasused = WITH1->isused;
+ WITH1->isused = 0;
+ WITH1->wasstrong = WITH1->strong;
+ WITH1->strong = false;
+ }
+
+ FORLIM = V.numthings;
+ for (i = V.thingvars; i < FORLIM; i++)
+ {
+ WITH1 = &V.things[i];
+ WITH1->poss &= WITH1->nextposs;
+ if (WITH1->poss == 0)
+ WITH1->poss = 1L << ((long)log_zero);
+ WITH1->nextposs = 0;
+ WITH1->wasdef = WITH1->isdef;
+ WITH1->isdef = 0;
+ WITH1->wasused = WITH1->isused;
+ WITH1->isused = 0;
+ }
+
+ if (V.changed)
+ extrarpt = 2;
+ else if (extrarpt > 0)
+ extrarpt--;
+ } while (V.okay && extrarpt > 0 && V.simppasscount < V.optlevel);
+ /* until not okay or ((curppin = oldcurppin) and
+ (curpvar = oldcurpvar) and
+ ((not changed and
+ (rptcount >= optlevel div 2)) or
+ (rptcount >= optlevel))); */
+ if (V.okay)
+ assignvars(&V);
+
+ if (V.optlevel >= 3 && V.simppasscount < V.optlevel)
+ {
+ V.truevars = true;
+ simplify(&V.ipbase, &V);
+ }
+ }
+ if (V.okay)
+ {
+ clean(V.ipbase, &V);
+ V.hdef->numppins = V.curppin;
+ V.hdef->numpvars = P_imax2((long)(V.curpvar - 16), 0L);
+ V.pc = 0;
+ V.instrcount = 0;
+ codegen(false, &V); /*find out how long it will be*/
+ if (V.pc != V.hdef->proclen)
+ {
+ if (V.hdef->proc != NULL)
+ Free(V.hdef->proc);
+ V.hdef->proc = (uchar *)Malloc(V.pc);
+ V.hdef->proclen = V.pc;
+ }
+ V.pc = 0;
+ V.instrcount = 0;
+ codegen(true, &V); /*actually generate the code*/
+ }
+ V.starttime = timers_sysclock() - V.starttime;
+
+ if (wantstats)
+ showstats(&V);
+
+ if (V.okay)
+ {
+ if (dumpflag)
+ {
+ showcontrol(V.hdef, "Dumping...");
+ if (V.hdef->oldshowstamp != showstamp) {
+ V.hdef->oldshowstamp = showstamp;
+ dodump(&V);
+ }
+ }
+ else
+ {
+ V.hdef->oldshowstamp = 0;
+ }
+
+ if (V.isverbose)
+ dasmhdef(stdout, V.hdef, false);
+
+ if (*writefile != '\0') {
+ sprintf(STR1, "Writing to \"%s\"", writefile);
+ showcontrol(V.hdef, STR1);
+ dowritefile(writefile, &V);
+ }
+ }
+ disposetree(&V.ipbase, &V);
+ strlist_empty(&V.inertlist);
+ V.hdef->defined_ = V.okay;
+ V.hdef->dumphighlight = false;
+
+ if (V.optlevel > 0)
+ {
+ WITH->curstamp++;
+ V.hdef->clearstamp = WITH->curstamp;
+ }
+ refrcontrol(V.hdef->gcontrol, 0);
+} /*compilepage*/
+#undef setmax
/* Make sure hdef's compiled information is up-to-date */
-static void updatehdef(hdef)
-hdefrec *hdef;
+static void updatehdef(hdefrec *hdef)
{
- char buf[256], wrd[256];
- long i, j, newstamp;
- dependrec *dep;
- log_lrec *lp, *mylabel;
- log_brec *mybox;
- int chglabels, wasdefined;
- log_grec *g1;
- instinfo *ii1;
- log_action_t *WITH;
- long FORLIM;
- char STR1[256], STR2[256];
-
- WITH = logsima_action.lact;
- chglabels = (WITH->labelstamp != hdef->oldlabelstamp ||
- WITH->boxstamp != hdef->oldboxstamp);
- if (chglabels) {
- hdef->oldlabelstamp = WITH->labelstamp;
- hdef->oldboxstamp = WITH->boxstamp;
- j = 0;
- FORLIM = WITH->numpages;
- for (i = 0; i < FORLIM; i++) {
- lp = WITH->lbase[i];
- while (lp != NULL) {
- if (commandlabel(lp, wrd, buf) && !strcmp(wrd, "NAME") &&
- strcicmp((sprintf(STR2, "\"%s\"", buf), STR2), hdef->name) == 0) {
- if (j != 0) {
- sprintf(STR1, "%s defined in more than one place", hdef->name);
- showerrormsg(hdef, STR1);
- } else {
- mylabel = lp;
- j = i + 1;
- }
- }
- lp = lp->next;
- }
- }
- if (j != 0) {
- if (commandlabel(mylabel, wrd, buf) &&
- strcmp((sprintf(STR1, "\"%s\"", buf), STR1), hdef->name)) {
- sprintf(hdef->name, "\"%s\"", buf); /*fix capitalization*/
- FORLIM = WITH->numpages;
- for (i = 0; i < FORLIM; i++) {
- g1 = WITH->gbase[i];
- while (g1 != NULL) {
- if (isinstance(g1) == hdef) {
- ii1 = (instinfo *)g1->info;
- ii1->attrchg = true;
- }
- g1 = g1->next;
- }
+ char buf[256], wrd[256];
+ long i, j, newstamp;
+ dependrec *dep;
+ log_lrec *lp, *mylabel;
+ log_brec *mybox;
+ int chglabels, wasdefined;
+ log_grec *g1;
+ instinfo *ii1;
+ log_action_t *WITH;
+ long FORLIM;
+ char STR1[256], STR2[256];
+
+ WITH = logsima_action.lact;
+ chglabels = (WITH->labelstamp != hdef->oldlabelstamp ||
+ WITH->boxstamp != hdef->oldboxstamp);
+ if (chglabels)
+ {
+ hdef->oldlabelstamp = WITH->labelstamp;
+ hdef->oldboxstamp = WITH->boxstamp;
+ j = 0;
+ FORLIM = WITH->numpages;
+ for (i = 0; i < FORLIM; i++)
+ {
+ lp = WITH->lbase[i];
+ while (lp != NULL)
+ {
+ if (commandlabel(lp, wrd, buf) && !strcmp(wrd, "NAME") &&
+ strcicmp((sprintf(STR2, "\"%s\"", buf), STR2), hdef->name) == 0) {
+ if (j != 0)
+ {
+ sprintf(STR1, "%s defined in more than one place", hdef->name);
+ showerrormsg(hdef, STR1);
+ }
+ else
+ {
+ mylabel = lp;
+ j = i + 1;
+ }
+ }
+ lp = lp->next;
+ }
+ }
+
+ if (j != 0)
+ {
+ if (commandlabel(mylabel, wrd, buf) &&
+ strcmp((sprintf(STR1, "\"%s\"", buf), STR1), hdef->name))
+ {
+ sprintf(hdef->name, "\"%s\"", buf); /*fix capitalization*/
+ FORLIM = WITH->numpages;
+ for (i = 0; i < FORLIM; i++)
+ {
+ g1 = WITH->gbase[i];
+ while (g1 != NULL)
+ {
+ if (isinstance(g1) == hdef)
+ {
+ ii1 = (instinfo *)g1->info;
+ ii1->attrchg = true;
+ }
+ g1 = g1->next;
+ }
+ }
+ }
+ mybox = labelbox(mylabel, (int)j);
+ hdef->defbox = mybox;
+
+ if (j != 0)
+ {
+ if (mybox == NULL)
+ {
+ if (hdef->defreg != NULL)
+ (*WITH->hook.setupregion)(&hdef->defreg, 0);
+ }
+ else
+ {
+ if (hdef->defreg == NULL)
+ (*WITH->hook.setupregion)(&hdef->defreg, (int)j);
+ hdef->defreg->x1 = mybox->x1;
+ hdef->defreg->y1 = mybox->y1;
+ hdef->defreg->x2 = mybox->x2;
+ hdef->defreg->y2 = mybox->y2;
+ }
+ }
+ }
+ } else
+ j = hdef->pgnum;
+
+ if (j == 0)
+ {
+ hdef->pgnum = 0;
+ hdef->defined_ = false;
+ if (hdef->defreg != NULL)
+ (*WITH->hook.setupregion)(&hdef->defreg, 0);
+ return;
}
- }
- mybox = labelbox(mylabel, (int)j);
- hdef->defbox = mybox;
- if (j != 0) {
- if (mybox == NULL) {
- if (hdef->defreg != NULL)
- (*WITH->hook.setupregion)(&hdef->defreg, 0);
- } else {
- if (hdef->defreg == NULL)
- (*WITH->hook.setupregion)(&hdef->defreg, (int)j);
- hdef->defreg->x1 = mybox->x1;
- hdef->defreg->y1 = mybox->y1;
- hdef->defreg->x2 = mybox->x2;
- hdef->defreg->y2 = mybox->y2;
+
+ if (hdef->defreg != NULL)
+ newstamp = hdef->defreg->regstamp;
+ else
+ newstamp = WITH->pagestamp[j - 1];
+
+ dep = hdef->depends;
+ while (dep != NULL && dep->hdefstamp == dep->hdef->curstamp)
+ dep = dep->next;
+
+ if (hdef->pgnum == j && newstamp == hdef->oldpagestamp && dep == NULL)
+ /*definition moved to a new page?*/
+ return;
+ /*has definition been edited?*/
+ /*depends on an hdef which has changed?*/
+ hdef->pgnum = j;
+ hdef->oldpagestamp = newstamp;
+ wasdefined = hdef->defined_;
+ compilepage(hdef);
+
+ if (hdef->defined_ || wasdefined)
+ {
+ WITH->curstamp++;
+ hdef->curstamp = WITH->curstamp;
}
- }
- }
- } else
- j = hdef->pgnum;
- if (j == 0) {
- hdef->pgnum = 0;
- hdef->defined_ = false;
- if (hdef->defreg != NULL)
- (*WITH->hook.setupregion)(&hdef->defreg, 0);
- return;
- }
- if (hdef->defreg != NULL)
- newstamp = hdef->defreg->regstamp;
- else
- newstamp = WITH->pagestamp[j - 1];
- dep = hdef->depends;
- while (dep != NULL && dep->hdefstamp == dep->hdef->curstamp)
- dep = dep->next;
- if (hdef->pgnum == j && newstamp == hdef->oldpagestamp && dep == NULL)
- /*definition moved to a new page?*/
- return;
- /*has definition been edited?*/
- /*depends on an hdef which has changed?*/
- hdef->pgnum = j;
- hdef->oldpagestamp = newstamp;
- wasdefined = hdef->defined_;
- compilepage(hdef);
- if (hdef->defined_ || wasdefined) {
- WITH->curstamp++;
- hdef->curstamp = WITH->curstamp;
- }
}
-
/* Reallocate if necessary a gate's ports, internal nodes, and internal variables */
-static char *instname(Result, g)
-char *Result;
-log_grec *g;
+static char *instname(char *Result, log_grec *g)
{
- short i;
-
- i = findgattr(g, "gate-name", "CA", 0);
- if (i == 0 || *g->attr[i - 1].UU.c == '\0')
- i = findgattr(g, "inst-of", "CA", 0);
- if (i == 0 || *g->attr[i - 1].UU.c == '\0')
- return strcpy(Result, g->kind->name);
- else
- return strcpy(Result, g->attr[i - 1].UU.c);
+ short i;
+
+ i = findgattr(g, "gate-name", "CA", 0);
+ if (i == 0 || *g->attr[i - 1].UU.c == '\0')
+ i = findgattr(g, "inst-of", "CA", 0);
+ if (i == 0 || *g->attr[i - 1].UU.c == '\0')
+ return strcpy(Result, g->kind->name);
+ else
+ return strcpy(Result, g->attr[i - 1].UU.c);
}
-static void reallocgate(g, clearit)
-log_grec *g;
-int clearit;
+static void reallocgate(log_grec *g, int clearit)
{
- instinfo *ii;
- hdefrec *hdef;
- long i;
- log_nrec **newpins;
- log_action_t *WITH;
- long FORLIM;
- char STR1[256];
- char STR4[256];
-
- WITH = logsima_action.lact;
- ii = (instinfo *)g->info;
- hdef = ii->hdef;
- if (clearit)
- g->vars = (na_long)0;
- if (hdef->numppins != ii->numppins) {
- if (hdef->numppins > 0) {
- newpins = (log_nrec **)Malloc(hdef->numppins * sizeof(log_nrec *));
- FORLIM = hdef->numppins;
- for (i = ii->numppins; i < FORLIM; i++) {
- (*WITH->hook.newnode)(&newpins[i], log_16_simtype);
- newpins[i]->ref = 1;
- }
- } else
- newpins = NULL;
- if (ii->numppins > 0) {
- FORLIM = P_imin2((long)hdef->numppins, (long)ii->numppins);
- for (i = 0; i < FORLIM; i++)
- newpins[i] = ii->ginfo.ppins[i];
- FORLIM = ii->numppins;
- for (i = hdef->numppins; i < FORLIM; i++)
- (*WITH->hook.switchnode)(&ii->ginfo.ppins[i], NULL);
- Free(ii->ginfo.ppins);
- }
- ii->ginfo.ppins = newpins;
- ii->numppins = hdef->numppins;
- }
- if (hdef->numpvars != ii->numpvars) {
- if (ii->numpvars > 0)
- Free(ii->ginfo.pvars);
- if (hdef->numpvars > 0) {
- ii->ginfo.pvars = (char *)Malloc(hdef->numpvars);
- clearit = true;
- }
- ii->numpvars = hdef->numpvars;
- g->vars = (na_long)0; /*just to be consistent*/
- }
- if (clearit && hdef->numpvars > 0)
- memset((void *)ii->ginfo.pvars, 0, hdef->numpvars);
- if (hdef->gtempl == NULL) { /*defined by port list*/
- if (ii->numpins > 0)
- Free(ii->pins);
- ii->numpins = 0;
- if (hdef->numports != g->kind->numpins) {
- sprintf(STR4, "Gate %s has %d pins but %ld ports",
- instname(STR1, g), g->kind->numpins, hdef->numports);
- /* if curpage = showpage then */
- showerrormsg(hdef, STR4);
- ii->okay = false;
- }
- return;
- }
- if (hdef->numports == ii->numpins)
- return;
- if (ii->numpins > 0)
- Free(ii->pins);
- if (hdef->numports > 0)
- ii->pins = (log_nrec **)Malloc(hdef->numports * sizeof(log_nrec *));
- ii->numpins = hdef->numports;
- ii->oldnetstamp = 0; /*force re-connection*/
-
- /*defined by template*/
+ instinfo *ii;
+ hdefrec *hdef;
+ long i;
+ log_nrec **newpins;
+ log_action_t *WITH;
+ long FORLIM;
+ char STR1[256];
+ char STR4[256];
+
+ WITH = logsima_action.lact;
+ ii = (instinfo *)g->info;
+ hdef = ii->hdef;
+
+ if (clearit)
+ g->vars = (na_long)0;
+
+ if (hdef->numppins != ii->numppins)
+ {
+ if (hdef->numppins > 0)
+ {
+ newpins = (log_nrec **)Malloc(hdef->numppins * sizeof(log_nrec *));
+ FORLIM = hdef->numppins;
+ for (i = ii->numppins; i < FORLIM; i++)
+ {
+ (*WITH->hook.newnode)(&newpins[i], log_16_simtype);
+ newpins[i]->ref = 1;
+ }
+ }
+ else
+ newpins = NULL;
+
+ if (ii->numppins > 0)
+ {
+ FORLIM = P_imin2((long)hdef->numppins, (long)ii->numppins);
+ for (i = 0; i < FORLIM; i++)
+ newpins[i] = ii->ginfo.ppins[i];
+ FORLIM = ii->numppins;
+
+ for (i = hdef->numppins; i < FORLIM; i++)
+ (*WITH->hook.switchnode)(&ii->ginfo.ppins[i], NULL);
+ Free(ii->ginfo.ppins);
+ }
+ ii->ginfo.ppins = newpins;
+ ii->numppins = hdef->numppins;
+ }
+
+ if (hdef->numpvars != ii->numpvars)
+ {
+ if (ii->numpvars > 0)
+ Free(ii->ginfo.pvars);
+ if (hdef->numpvars > 0)
+ {
+ ii->ginfo.pvars = (char *)Malloc(hdef->numpvars);
+ clearit = true;
+ }
+ ii->numpvars = hdef->numpvars;
+ g->vars = (na_long)0; /*just to be consistent*/
+ }
+
+ if (clearit && hdef->numpvars > 0)
+ memset((void *)ii->ginfo.pvars, 0, hdef->numpvars);
+ if (hdef->gtempl == NULL)
+ { /*defined by port list*/
+ if (ii->numpins > 0)
+ Free(ii->pins);
+ ii->numpins = 0;
+ if (hdef->numports != g->kind->numpins)
+ {
+ sprintf(STR4, "Gate %s has %d pins but %ld ports",
+ instname(STR1, g), g->kind->numpins, hdef->numports);
+ /* if curpage = showpage then */
+ showerrormsg(hdef, STR4);
+ ii->okay = false;
+ }
+ return;
+ }
+ if (hdef->numports == ii->numpins)
+ return;
+
+ if (ii->numpins > 0)
+ Free(ii->pins);
+
+ if (hdef->numports > 0)
+ ii->pins = (log_nrec **)Malloc(hdef->numports * sizeof(log_nrec *));
+
+ ii->numpins = hdef->numports;
+ ii->oldnetstamp = 0; /*force re-connection*/
+
+ /*defined by template*/
}
/* Local variables for reconnectgate: */
struct LOC_reconnectgate {
- log_grec *g;
- instinfo *ii;
- long lastwest;
-} ;
+ log_grec *g;
+ instinfo *ii;
+ long lastwest;
+};
-static void check(dir, conn, port, LINK)
-char *dir;
-long conn, port;
-struct LOC_reconnectgate *LINK;
+static void check(char *dir, long conn, long port, struct LOC_reconnectgate *LINK)
{
- char buf[256], STR1[256];
-
- if (conn == port)
- return;
- if (LINK->lastwest != 0) { /*and*/
- /* (act.lact^.curpage = act.lact^.showpage) */
- sprintf(buf, "Gate %s has %ld %s connection",
- instname(STR1, LINK->g), conn, dir);
- if (conn != 1)
- strcat(buf, "s");
- sprintf(buf + strlen(buf), " but %ld %s port", port, dir);
- if (port != 1)
- strcat(buf, "s");
- showerrormsg(NULL, buf); /*nil to prevent flashing message in hdef*/
- }
- /*no message if totally unconnected*/
- LINK->ii->okay = false;
+ char buf[256], STR1[256];
+
+ if (conn == port)
+ return;
+ if (LINK->lastwest != 0)
+ { /*and*/
+ /* (act.lact^.curpage = act.lact^.showpage) */
+ sprintf(buf, "Gate %s has %ld %s connection",
+ instname(STR1, LINK->g), conn, dir);
+ if (conn != 1)
+ strcat(buf, "s");
+ sprintf(buf + strlen(buf), " but %ld %s port", port, dir);
+ if (port != 1)
+ strcat(buf, "s");
+ showerrormsg(NULL, buf); /*nil to prevent flashing message in hdef*/
+ }
+ /*no message if totally unconnected*/
+ LINK->ii->okay = false;
}
-
-
/* Reconnect a gate's ports to its pins */
-static void reconnectgate(g_)
-log_grec *g_;
+static void reconnectgate(log_grec *g_)
{
- struct LOC_reconnectgate V;
- hdefrec *hdef;
- long lastnorth, lasteast, lastsouth;
- short *pnum;
- log_action_t *WITH;
-
- V.g = g_;
- WITH = logsima_action.lact;
- V.ii = (instinfo *)V.g->info;
- hdef = V.ii->hdef;
- if (hdef->gtempl == NULL) {
- V.ii->pins = V.g->pin; /*easy one-to-one mapping*/
- return;
- }
- pnum = NULL;
- examinetemplate(V.g, V.ii->pins, hdef->numports, isgenericinstgate(V.g), &pnum, &lastnorth,
- &lasteast, &lastsouth, &V.lastwest);
- check("north", lastnorth, hdef->lastnorth, &V);
- check("east", lasteast - lastnorth, hdef->lasteast - hdef->lastnorth, &V);
- check("south", lastsouth - lasteast, hdef->lastsouth - hdef->lasteast, &V);
- check("west", V.lastwest - lastsouth, hdef->numports - hdef->lastsouth, &V);
- Free(pnum);
+ struct LOC_reconnectgate V;
+ hdefrec *hdef;
+ long lastnorth, lasteast, lastsouth;
+ short *pnum;
+ log_action_t *WITH;
+
+ V.g = g_;
+ WITH = logsima_action.lact;
+ V.ii = (instinfo *)V.g->info;
+ hdef = V.ii->hdef;
+
+ if (hdef->gtempl == NULL)
+ {
+ V.ii->pins = V.g->pin; /*easy one-to-one mapping*/
+ return;
+ }
+
+ pnum = NULL;
+ examinetemplate(V.g, V.ii->pins, hdef->numports, isgenericinstgate(V.g), &pnum, &lastnorth,
+ &lasteast, &lastsouth, &V.lastwest);
+ check("north", lastnorth, hdef->lastnorth, &V);
+ check("east", lasteast - lastnorth, hdef->lasteast - hdef->lastnorth, &V);
+ check("south", lastsouth - lasteast, hdef->lastsouth - hdef->lasteast, &V);
+ check("west", V.lastwest - lastsouth, hdef->numports - hdef->lastsouth, &V);
+ Free(pnum);
}
-
-
/* Make sure an instance gate is up-to-date */
-static void updateinstance(g)
-log_grec *g;
+static void updateinstance(log_grec *g)
{
- instinfo *ii;
- hdefrec *hdef;
- long i;
- log_action_t *WITH;
- char STR2[12];
- char STR3[38];
-
- WITH = logsima_action.lact;
- ii = (instinfo *)g->info;
- if (ii->recstamp == currecstamp) {
- sprintf(STR3, "Gate %s is recursively defined", g->kind->name);
- /* if curpage = showpage then */
- showerrormsg(ii->hdef, STR3);
- ii->okay = false;
- return;
- }
- ii->recstamp = currecstamp;
- if (ii->attrchg) { /*circuit has changed*/
- i = findgattr(g, "inst-of", "CA", 0);
- if (i == 0) {
- sprintf(STR2, "\"%s\"", g->kind->name);
- ii->hdef = findhdef(STR2, true);
- } else {
- ii->hdef = findhdef(g->attr[i - 1].UU.c, true);
- if (ii->hdef != NULL && strcmp(ii->hdef->name, g->attr[i - 1].UU.c)) {
- strcpy(g->attr[i - 1].UU.c, ii->hdef->name);
- g->attr[i - 1].changed = true;
- ii->oldattrstamp = 0;
- }
- }
- ii->attrchg = false;
- }
- hdef = ii->hdef;
- if (hdef != NULL) {
- updatehdef(hdef);
- if (hdef->defined_) {
- ii->okay = true;
- if (hdef->gtempl != g) { /*not the template*/
- if (ii->hdefstamp != hdef->curstamp) { /*rewire the gate*/
- reallocgate(g, ii->clearstamp != hdef->clearstamp);
- if (ii->okay) {
- ii->hdefstamp = hdef->curstamp;
- ii->clearstamp = hdef->clearstamp;
- ii->oldnetstamp = 0;
- }
+ instinfo *ii;
+ hdefrec *hdef;
+ long i;
+ log_action_t *WITH;
+ char STR2[12];
+ char STR3[38];
+
+ WITH = logsima_action.lact;
+ ii = (instinfo *)g->info;
+ if (ii->recstamp == currecstamp)
+ {
+ sprintf(STR3, "Gate %s is recursively defined", g->kind->name);
+ /* if curpage = showpage then */
+ showerrormsg(ii->hdef, STR3);
+ ii->okay = false;
+ return;
}
- if (ii->oldnetstamp != logsima_tool_16->netstamp && ii->okay) {
- reconnectgate(g);
- if (ii->okay)
- ii->oldnetstamp = logsima_tool_16->netstamp;
+
+ ii->recstamp = currecstamp;
+ if (ii->attrchg)
+ { /*circuit has changed*/
+ i = findgattr(g, "inst-of", "CA", 0);
+ if (i == 0)
+ {
+ sprintf(STR2, "\"%s\"", g->kind->name);
+ ii->hdef = findhdef(STR2, true);
+ }
+ else
+ {
+ ii->hdef = findhdef(g->attr[i - 1].UU.c, true);
+ if (ii->hdef != NULL && strcmp(ii->hdef->name, g->attr[i - 1].UU.c))
+ {
+ strcpy(g->attr[i - 1].UU.c, ii->hdef->name);
+ g->attr[i - 1].changed = true;
+ ii->oldattrstamp = 0;
+ }
+ }
+ ii->attrchg = false;
+ }
+ hdef = ii->hdef;
+ if (hdef != NULL)
+ {
+ updatehdef(hdef);
+ if (hdef->defined_)
+ {
+ ii->okay = true;
+ if (hdef->gtempl != g)
+ { /*not the template*/
+ if (ii->hdefstamp != hdef->curstamp)
+ { /*rewire the gate*/
+ reallocgate(g, ii->clearstamp != hdef->clearstamp);
+ if (ii->okay)
+ {
+ ii->hdefstamp = hdef->curstamp;
+ ii->clearstamp = hdef->clearstamp;
+ ii->oldnetstamp = 0;
+ }
+ }
+
+ if (ii->oldnetstamp != logsima_tool_16->netstamp && ii->okay)
+ {
+ reconnectgate(g);
+ if (ii->okay)
+ ii->oldnetstamp = logsima_tool_16->netstamp;
+ }
+ }
+ }
+ else
+ {
+ ii->okay = false;
+ }
+ }
+ else
+ {
+ ii->okay = false;
}
- }
- } else
- ii->okay = false;
- } else
- ii->okay = false;
- ii->recstamp = 0;
+ ii->recstamp = 0;
}
-
-
-
static void initcolors_h()
{
- log_action_t *WITH;
-
- WITH = logsima_action.lact;
- if (WITH->colorstamp == oldcolorstamp)
- return;
- (*WITH->hook.getcolor)("TEMPLATE", &templatecolor, log_pink);
- (*WITH->hook.getcolor)("INSTANCE", &kindcolor, log_dyellow);
- (*WITH->hook.getcolor)("DARKWORD", &darkwordcolor, log_lgray);
- oldcolorstamp = WITH->colorstamp;
+ log_action_t *WITH;
+
+ WITH = logsima_action.lact;
+ if (WITH->colorstamp == oldcolorstamp)
+ return;
+ (*WITH->hook.getcolor)("TEMPLATE", &templatecolor, log_pink);
+ (*WITH->hook.getcolor)("INSTANCE", &kindcolor, log_dyellow);
+ (*WITH->hook.getcolor)("DARKWORD", &darkwordcolor, log_lgray);
+ oldcolorstamp = WITH->colorstamp;
}
@@ -4879,510 +5157,559 @@ static void initcolors_h()
-static void showinstpins(g)
-log_grec *g;
+static void showinstpins(log_grec *g)
{
- instinfo *ii;
- short i;
- log_krec *k;
- short *pnum;
- long lastnorth, lasteast, lastsouth, numports;
- short FORLIM;
- char STR1[256];
-
- k = g->kind;
- ii = (instinfo *)g->info;
- pnum = (short *)Malloc(k->numpins * 2);
- examinetemplate(g, NULL, (long)k->numpins, isgenericinstgate(g), &pnum, &lastnorth,
- &lasteast, &lastsouth, &numports);
- FORLIM = numports;
- for (i = 1; i <= FORLIM; i++) {
- sprintf(STR1, "%d", i);
- (*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
- logsima_action.lact->color.backgr, STR1);
- }
- FORLIM = numports;
- for (i = 1; i <= FORLIM; i++) {
- sprintf(STR1, "%d", i);
- (*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
- logsima_action.lact->color.pinnum, STR1);
- }
- Free(pnum);
+ instinfo *ii;
+ short i;
+ log_krec *k;
+ short *pnum;
+ long lastnorth, lasteast, lastsouth, numports;
+ short FORLIM;
+ char STR1[256];
+
+ k = g->kind;
+ ii = (instinfo *)g->info;
+ pnum = (short *)Malloc(k->numpins * 2);
+ examinetemplate(g, NULL, (long)k->numpins, isgenericinstgate(g), &pnum, &lastnorth,
+ &lasteast, &lastsouth, &numports);
+ FORLIM = numports;
+ for (i = 1; i <= FORLIM; i++)
+ {
+ sprintf(STR1, "%d", i);
+ (*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
+ logsima_action.lact->color.backgr, STR1);
+ }
+ FORLIM = numports;
+ for (i = 1; i <= FORLIM; i++)
+ {
+ sprintf(STR1, "%d", i);
+ (*logsima_action.lact->hook2->showpinname)(g, pnum[i - 1],
+ logsima_action.lact->color.pinnum, STR1);
+ }
+ Free(pnum);
}
#undef nummap
-
-
-void Log_16_inst(act)
-log_16_action *act;
+void Log_16_inst(log_16_action *act)
{
- log_grec *curgate;
- instinfo *ii, *ii2;
- long i, j;
- short drawx, drawy;
- int drawflag, attr2;
- char attr1[256];
- hdefrec *hdef;
- na_strlist_t *sl1;
- log_action_t *WITH;
- log_grec *WITH1;
- log_gattrrec *WITH2;
- char STR1[256];
- char STR2[256];
- long FORLIM;
- log_nrec *WITH3;
- char STR3[256];
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_newkind:
- if (WITH->runstamp != currunstamp) {
- currunstamp = WITH->runstamp;
- WITH->curstamp = 0;
- currecstamp = 0;
- hdefbase = NULL;
- viserrorstamp = 0;
- viserrors = NULL;
- vddsig = NULL;
- gndsig = NULL;
- oldcolorstamp = 0;
- showstamp = 1;
- hier_init(act->lact);
- }
- break;
-
- case act_16_new:
- case act_16_copy:
- ii = (instinfo *)Malloc(sizeof(instinfo));
- ii->attrchg = true;
- ii->okay = false;
- ii->wasokay = true;
- ii->hdef = NULL;
- ii->hdefstamp = 0;
- ii->clearstamp = 0;
- ii->oldnetstamp = 0;
- ii->numppins = 0;
- ii->numpins = 0;
- ii->wasdrawn = NULL;
- ii->oldattrstamp = 0;
- ii->instattr = findgattr(WITH->actgate, "inst-of", "CA", 0);
- ii->nameattr = findgattr(WITH->actgate, "gate-name", "CA", 0);
- ii->dispattr = findgattr(WITH->actgate, "disp-inst-name", "B", 0);
- if (act->action == act_16_copy) {
- ii2 = (instinfo *)WITH->actgate2->info;
- ii->numpvars = ii2->numpvars;
- if (ii->numpvars > 0) {
- ii->ginfo.pvars = (char *)Malloc(ii->numpvars);
- memmove((void *)ii->ginfo.pvars, (void *)ii2->ginfo.pvars,
- ii->numpvars);
- }
- } else
- ii->numpvars = 0;
- ii->recstamp = 0;
- WITH1->info = (void *)ii;
- initcolors_h();
- break;
-
- case act_16_dispose:
- ii = (instinfo *)WITH1->info;
- if (ii->numppins > 0)
- Free(ii->ginfo.ppins);
- if (ii->numpvars > 0)
- Free(ii->ginfo.pvars);
- if (ii->numpins > 0)
- Free(ii->pins);
- Free(ii);
- break;
-
- case act_16_configgate:
- break;
- /*first pass only*/
- /* update display of attributes */
-
- case act_16_configchgate:
- WITH2 = &WITH1->attr[WITH->actx - 1];
- ii = (instinfo *)WITH1->info;
- ii->attrchg = true;
- if (WITH->actx == ii->instattr) {
- if (*WITH2->UU.c != '\0' && *WITH2->UU.c != '"' &&
- !strends(WITH2->UU.c, "\"")) {
- sprintf(STR2, "\"%s\"", WITH2->UU.c);
- (*WITH->hook2->setgattr)(WITH->actgate, (int)WITH->actx, STR2);
- }
- }
- break;
-
- case act_16_configrelgate:
- /* blank case */
- break;
-
- /* nothing to do */
- case act_16_sim:
- curgate = WITH->actgate; /*save because of reentrancy*/
- currecstamp++;
- updateinstance(curgate);
- ii = (instinfo *)WITH1->info;
- if (ii->okay && ii->hdef->gtempl != curgate)
- executeprog(ii->hdef->proc, ii->pins, &ii->ginfo, &WITH1->vars);
- if (ii->okay != ii->wasokay) {
- (*WITH->hook.setdimgate)(curgate, !ii->okay);
- ii->wasokay = ii->okay;
- ii->oldattrstamp = 0;
- }
- break;
-
- case act_16_draw:
- ii = (instinfo *)WITH1->info;
- if (ii->instattr > 0 || ii->nameattr > 0) {
- if (WITH->gattrstamp != ii->oldattrstamp) {
- ii->oldattrstamp = WITH->gattrstamp;
- j = ii->nameattr;
- if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0')
- strcpy(attr1, WITH1->attr[j - 1].UU.c);
- else {
- j = ii->instattr;
- if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0') {
- strcpy(attr1, WITH1->attr[j - 1].UU.c);
- if (*attr1 == '"' && strends(attr1, "\""))
- strcpy(attr1,
- strpart(STR1, attr1, 2, (int)(strlen(attr1) - 1L)));
- } else
- *attr1 = '\0';
+ log_grec *curgate;
+ instinfo *ii, *ii2;
+ long i, j;
+ short drawx, drawy;
+ int drawflag, attr2;
+ char attr1[256];
+ hdefrec *hdef;
+ na_strlist_t *sl1;
+ log_action_t *WITH;
+ log_grec *WITH1;
+ log_gattrrec *WITH2;
+ char STR1[256];
+ char STR2[256];
+ long FORLIM;
+ log_nrec *WITH3;
+ char STR3[256];
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+
+ case act_16_newkind:
+ if (WITH->runstamp != currunstamp)
+ {
+ currunstamp = WITH->runstamp;
+ WITH->curstamp = 0;
+ currecstamp = 0;
+ hdefbase = NULL;
+ viserrorstamp = 0;
+ viserrors = NULL;
+ vddsig = NULL;
+ gndsig = NULL;
+ oldcolorstamp = 0;
+ showstamp = 1;
+ hier_init(act->lact);
+ }
+ break;
+
+ case act_16_new:
+ case act_16_copy:
+ ii = (instinfo *)Malloc(sizeof(instinfo));
+ ii->attrchg = true;
+ ii->okay = false;
+ ii->wasokay = true;
+ ii->hdef = NULL;
+ ii->hdefstamp = 0;
+ ii->clearstamp = 0;
+ ii->oldnetstamp = 0;
+ ii->numppins = 0;
+ ii->numpins = 0;
+ ii->wasdrawn = NULL;
+ ii->oldattrstamp = 0;
+ ii->instattr = findgattr(WITH->actgate, "inst-of", "CA", 0);
+ ii->nameattr = findgattr(WITH->actgate, "gate-name", "CA", 0);
+ ii->dispattr = findgattr(WITH->actgate, "disp-inst-name", "B", 0);
+ if (act->action == act_16_copy)
+ {
+ ii2 = (instinfo *)WITH->actgate2->info;
+ ii->numpvars = ii2->numpvars;
+ if (ii->numpvars > 0)
+ {
+ ii->ginfo.pvars = (char *)Malloc(ii->numpvars);
+ memmove((void *)ii->ginfo.pvars, (void *)ii2->ginfo.pvars,
+ ii->numpvars);
+ }
+ }
+ else
+ ii->numpvars = 0;
+
+ ii->recstamp = 0;
+ WITH1->info = (void *)ii;
+ initcolors_h();
+ break;
+
+ case act_16_dispose:
+ ii = (instinfo *)WITH1->info;
+ if (ii->numppins > 0)
+ Free(ii->ginfo.ppins);
+ if (ii->numpvars > 0)
+ Free(ii->ginfo.pvars);
+ if (ii->numpins > 0)
+ Free(ii->pins);
+ Free(ii);
+ break;
+
+ case act_16_configgate:
+ break;
+ /*first pass only*/
+ /* update display of attributes */
+
+ case act_16_configchgate:
+ WITH2 = &WITH1->attr[WITH->actx - 1];
+ ii = (instinfo *)WITH1->info;
+ ii->attrchg = true;
+ if (WITH->actx == ii->instattr)
+ {
+ if (*WITH2->UU.c != '\0' && *WITH2->UU.c != '"' &&
+ !strends(WITH2->UU.c, "\""))
+ {
+ sprintf(STR2, "\"%s\"", WITH2->UU.c);
+ (*WITH->hook2->setgattr)(WITH->actgate, (int)WITH->actx, STR2);
+ }
+ }
+ break;
+
+ case act_16_configrelgate:
+ /* blank case */
+ break;
+
+ /* nothing to do */
+ case act_16_sim:
+ curgate = WITH->actgate; /*save because of reentrancy*/
+ currecstamp++;
+ updateinstance(curgate);
+ ii = (instinfo *)WITH1->info;
+ if (ii->okay && ii->hdef->gtempl != curgate)
+ executeprog(ii->hdef->proc, ii->pins, &ii->ginfo, &WITH1->vars);
+ if (ii->okay != ii->wasokay)
+ {
+ (*WITH->hook.setdimgate)(curgate, !ii->okay);
+ ii->wasokay = ii->okay;
+ ii->oldattrstamp = 0;
+ }
+ break;
+
+ case act_16_draw:
+ ii = (instinfo *)WITH1->info;
+ if (ii->instattr > 0 || ii->nameattr > 0)
+ {
+ if (WITH->gattrstamp != ii->oldattrstamp)
+ {
+ ii->oldattrstamp = WITH->gattrstamp;
+ j = ii->nameattr;
+ if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0')
+ {
+ strcpy(attr1, WITH1->attr[j - 1].UU.c);
+ }
+ else
+ {
+ j = ii->instattr;
+ if (j > 0 && *WITH1->attr[j - 1].UU.c != '\0')
+ {
+ strcpy(attr1, WITH1->attr[j - 1].UU.c);
+ if (*attr1 == '"' && strends(attr1, "\""))
+ strcpy(attr1,
+ strpart(STR1, attr1, 2, (int)(strlen(attr1) - 1L)));
+ }
+ else
+ {
+ *attr1 = '\0';
+ }
+ }
+ if (*attr1 == '\0')
+ {
+ attr2 = false;
+ }
+ else
+ {
+ j = ii->dispattr;
+ if (j == 0 || WITH1->attr[j - 1].blnk)
+ {
+ if (WITH1->rot & 1)
+ attr2 = (m_strwidth(NULL, attr1) <=
+ WITH1->kind->y2 - WITH1->kind->y1 - 3);
+ else
+ attr2 = (m_strwidth(NULL, attr1) <=
+ WITH1->kind->x2 - WITH1->kind->x1 - 3);
+ }
+ else
+ {
+ attr2 = WITH1->attr[j - 1].UU.b;
+ }
+ }
+
+ if (!attr2)
+ drawflag = (ii->wasdrawn != NULL);
+ else
+ drawflag = (ii->wasdrawn == NULL || strcmp(ii->wasdrawn, attr1));
+
+ if (drawflag && ii->wasdrawn != NULL)
+ {
+ drawx = 0;
+ drawy = 0;
+ (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
+ (*WITH->hook.hidecursor)();
+ m_color((long)WITH->color.backgr);
+ m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
+ (*WITH->hook.unhidecursor)();
+ }
+
+ if (attr2)
+ strchange(&ii->wasdrawn, attr1);
+ else
+ strdispose(&ii->wasdrawn);
+ }
+ else
+ {
+ drawflag = false;
+ }
+
+ if ((WITH->refrflag || drawflag) && ii->wasdrawn != NULL)
+ {
+ drawx = 0;
+ drawy = 0;
+ (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
+ initcolors_h();
+ (*WITH->hook.hidecursor)();
+ if (ii->hdef != NULL && ii->hdef->gtempl == WITH->actgate)
+ m_color((long)templatecolor);
+ else
+ m_color((long)kindcolor);
+ m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
+ (*WITH->hook.unhidecursor)();
+ }
+ }
+ break;
+
+ case act_16_erase:
+ ii = (instinfo *)WITH1->info;
+ if (ii->wasdrawn != NULL)
+ {
+ drawx = 0;
+ drawy = 0;
+ (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
+ (*WITH->hook.hidecursor)();
+ m_color((long)WITH->color.backgr);
+ m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
+ (*WITH->hook.unhidecursor)();
+ }
+ break;
+
+ case act_16_refnodes: /*garbage collection*/
+ ii = (instinfo *)WITH1->info;
+ FORLIM = ii->numppins;
+ for (i = 0; i < FORLIM; i++)
+ {
+ WITH3 = ii->ginfo.ppins[i];
+ WITH3->ref++;
+ }
+ break;
+
+ case act_16_func:
+ if (!strcmp(WITH->func, "DS"))
+ { /*show debugging stuff*/
+ showstamp++;
+ hdef = hdefbase;
+ while (hdef != NULL)
+ {
+ hdef->oldpagestamp = 0; /*force recompile*/
+ hdef = hdef->next;
+ }
+ (*WITH->hook.clearfunc)();
+ }
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "PLOT"))
+ {
+ ii = (instinfo *)WITH1->info;
+ if (ii->wasdrawn != NULL)
+ {
+ sl1 = strlist_append(&WITH->actstrlist, "color gate");
+ drawx = 0;
+ drawy = 0;
+ (*WITH->hook2->plainxform)(WITH->actgate, &drawx, &drawy);
+ sprintf(STR3, "text %d %d 60 CC \"%s\"", drawx, drawy, ii->wasdrawn);
+ sl1 = strlist_append(&WITH->actstrlist, STR3);
+ }
+ }
+ else if (!strcmp(WITH->genfunc, "DUMPKIND"))
+ {
+ ii = (instinfo *)WITH1->info;
+ if (ii->hdef != NULL)
+ {
+ sprintf(STR2, "Digital hierarchical definition %s:", ii->hdef->name);
+ sl1 = strlist_append(&WITH->actstrlist, STR2);
+ if (ii->okay)
+ dump_16(&ii->hdef->proc, &sl1->next, true);
+ else
+ sl1 = strlist_append(&WITH->actstrlist,
+ "(Definition is not complete)");
+ }
+ }
+ else if (!strcmp(WITH->genfunc, "SHOWPINS"))
+ {
+ ii = (instinfo *)WITH1->info;
+ if (ii->hdef != NULL && ii->hdef->gtempl != NULL)
+ {
+ showinstpins(WITH->actgate); /* show special pin numbering */
+ WITH->actflag = true;
+ }
+ }
+ break;
+
+ default:
+ break;
}
- if (*attr1 == '\0')
- attr2 = false;
- else {
- j = ii->dispattr;
- if (j == 0 || WITH1->attr[j - 1].blnk) {
- if (WITH1->rot & 1)
- attr2 = (m_strwidth(NULL, attr1) <=
- WITH1->kind->y2 - WITH1->kind->y1 - 3);
- else
- attr2 = (m_strwidth(NULL, attr1) <=
- WITH1->kind->x2 - WITH1->kind->x1 - 3);
- } else
- attr2 = WITH1->attr[j - 1].UU.b;
- }
- if (!attr2)
- drawflag = (ii->wasdrawn != NULL);
- else
- drawflag = (ii->wasdrawn == NULL || strcmp(ii->wasdrawn, attr1));
- if (drawflag && ii->wasdrawn != NULL) {
- drawx = 0;
- drawy = 0;
- (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
- (*WITH->hook.hidecursor)();
- m_color((long)WITH->color.backgr);
- m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
- (*WITH->hook.unhidecursor)();
- }
- if (attr2)
- strchange(&ii->wasdrawn, attr1);
- else
- strdispose(&ii->wasdrawn);
- } else
- drawflag = false;
- if ((WITH->refrflag || drawflag) && ii->wasdrawn != NULL) {
- drawx = 0;
- drawy = 0;
- (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
- initcolors_h();
- (*WITH->hook.hidecursor)();
- if (ii->hdef != NULL && ii->hdef->gtempl == WITH->actgate)
- m_color((long)templatecolor);
- else
- m_color((long)kindcolor);
- m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
- (*WITH->hook.unhidecursor)();
- }
- }
- break;
-
- case act_16_erase:
- ii = (instinfo *)WITH1->info;
- if (ii->wasdrawn != NULL) {
- drawx = 0;
- drawy = 0;
- (*WITH->hook.xform)(WITH->actgate, &drawx, &drawy);
- (*WITH->hook.hidecursor)();
- m_color((long)WITH->color.backgr);
- m_centerstr((long)drawx, drawy - 4L, NULL, ii->wasdrawn);
- (*WITH->hook.unhidecursor)();
- }
- break;
-
- case act_16_refnodes: /*garbage collection*/
- ii = (instinfo *)WITH1->info;
- FORLIM = ii->numppins;
- for (i = 0; i < FORLIM; i++) {
- WITH3 = ii->ginfo.ppins[i];
- WITH3->ref++;
- }
- break;
-
- case act_16_func:
- if (!strcmp(WITH->func, "DS")) { /*show debugging stuff*/
- showstamp++;
- hdef = hdefbase;
- while (hdef != NULL) {
- hdef->oldpagestamp = 0; /*force recompile*/
- hdef = hdef->next;
- }
- (*WITH->hook.clearfunc)();
- }
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "PLOT")) {
- ii = (instinfo *)WITH1->info;
- if (ii->wasdrawn != NULL) {
- sl1 = strlist_append(&WITH->actstrlist, "color gate");
- drawx = 0;
- drawy = 0;
- (*WITH->hook2->plainxform)(WITH->actgate, &drawx, &drawy);
- sprintf(STR3, "text %d %d 60 CC \"%s\"", drawx, drawy, ii->wasdrawn);
- sl1 = strlist_append(&WITH->actstrlist, STR3);
- }
- } else if (!strcmp(WITH->genfunc, "DUMPKIND")) {
- ii = (instinfo *)WITH1->info;
- if (ii->hdef != NULL) {
- sprintf(STR2, "Digital hierarchical definition %s:", ii->hdef->name);
- sl1 = strlist_append(&WITH->actstrlist, STR2);
- if (ii->okay)
- dump_16(&ii->hdef->proc, &sl1->next, true);
- else
- sl1 = strlist_append(&WITH->actstrlist,
- "(Definition is not complete)");
- }
- } else if (!strcmp(WITH->genfunc, "SHOWPINS")) {
- ii = (instinfo *)WITH1->info;
- if (ii->hdef != NULL && ii->hdef->gtempl != NULL) {
- showinstpins(WITH->actgate); /* show special pin numbering */
- WITH->actflag = true;
- }
- }
- break;
-
- default:
- break;
- }
}
-
-void Log_dig_inst(act)
-log_16_action *act;
+void Log_dig_inst(log_16_action *act)
{
- Log_16_inst(act);
+ Log_16_inst(act);
}
-void Log_16_digh(act)
-log_16_action *act;
+void Log_16_digh(log_16_action *act)
{
- controlinfo *cip;
- char aname[256];
- log_action_t *WITH;
- log_grec *WITH1;
- log_gattrrec *WITH2;
- char STR1[256];
-
- WITH = act->lact;
- WITH1 = WITH->actgate;
- switch (act->action) {
-
- case act_16_newkind:
- hier_init(act->lact);
- break;
-
- case act_16_new:
- case act_16_copy:
- cip = (controlinfo *)Malloc(sizeof(controlinfo));
- WITH1->info = (void *)cip;
- cip->hdef = NULL;
- cip->pgnum = -99;
- *cip->message = '\0';
- *cip->oldmessage = '\0';
- *cip->message2 = '\0';
- *cip->oldmessage2 = '\0';
- cip->oldoptcolor = -1;
- cip->olddumpcolor = -1;
- cip->olddumpmode = dump_none;
- cip->welcomeflag = true;
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
- break;
-
- case act_16_read:
- WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
- break;
-
- case act_16_dispose:
- cip = (controlinfo *)WITH1->info;
- if (cip->hdef != NULL) {
- cip->hdef->gcontrol = NULL;
- cip->hdef = NULL;
- }
- Free(cip);
- break;
-
- case act_16_connect:
- cip = (controlinfo *)WITH1->info;
- cip->pgnum = WITH->curpage;
- break;
-
- case act_16_disconnect:
- cip = (controlinfo *)WITH1->info;
- if (cip->hdef != NULL) {
- cip->hdef->gcontrol = NULL;
- cip->hdef = NULL;
- }
- cip->pgnum = -99;
- break;
-
- case act_16_draw:
- cip = (controlinfo *)WITH1->info;
- if (cip->hdef != NULL && cip->hdef->defined_) {
- sprintf(STR1, "Definition for %s", cip->hdef->name);
- strcpy(cip->message, STR1);
- *cip->message2 = '\0';
- }
- if (WITH->refrflag)
- refrcontrol(WITH->actgate, 1);
- else
- refrcontrol(WITH->actgate, 0);
- break;
-
- case act_16_erase:
- refrcontrol(WITH->actgate, -1);
- break;
-
- case act_16_touch:
- cip = (controlinfo *)WITH1->info;
- if (WITH->actx >= -3 && WITH->actx <= 3 && WITH->acty >= -2 &&
- WITH->acty <= 2) {
- if (cip->hdef != NULL && cip->hdef->defined_) {
- if (WITH->acty <= 0) {
- cip->hdef->nextoptflag = true;
- cip->hdef->optflag = true;
- refrcontrol(WITH->actgate, 0);
- sprintf(STR1, "Optimizing %s", cip->hdef->name);
- (*WITH->hook.vmessage)(STR1);
- cip->hdef->oldpagestamp = 0; /*force recompile*/
- /* updatehdef(cip^.hdef); */
- } else {
- if (cip->hdef->dumpmode == dump_write &&
- *cip->hdef->writefile == '\0')
- (*WITH->hook.message)("No file name specified");
- else if (cip->hdef->dumpmode == dump_none)
- (*WITH->hook.message)("Dumping is not enabled");
- else {
- cip->hdef->dumphighlight = true;
- cip->hdef->oldshowstamp = -1;
- if (cip->hdef->optmode == opt_dump)
- cip->hdef->optflag = true;
- cip->hdef->nextoptflag = cip->hdef->optflag;
- refrcontrol(WITH->actgate, 0);
- /* call(hook.vmessage, 'Dumping ' + cip^.hdef^.name^); */
- cip->hdef->oldpagestamp = 0; /*force recompile*/
- }
- }
- } else
- (*WITH->hook.message)("Definition is not complete");
- WITH->actflag = true;
- }
- break;
-
- case act_16_configgate:
- cip = (controlinfo *)WITH1->info;
- if (WITH->actflag) /*first pass only*/
- storecontrolattrs(cip->hdef, WITH->actgate);
- break;
-
- case act_16_configchgate:
- WITH2 = &WITH1->attr[WITH->actx - 1];
- cip = (controlinfo *)WITH1->info;
- if (cip->hdef == NULL)
- WITH->actflag = false;
- else {
- namegattr(aname, WITH->actgate, (int)WITH->actx);
- if (!strcmp(aname, "opt")) {
- if (WITH2->UU.U73.i1 < 0)
- WITH2->UU.U73.i1 = 0;
- if (WITH2->UU.U73.i1 >= 1000)
- WITH2->blnk = true;
- if (WITH2->blnk)
- WITH2->UU.U73.i1 = 1000;
- cip->hdef->optlevel = WITH2->UU.U73.i1;
- } else if (!strcmp(aname, "opt-when")) {
- switch (WITH2->UU.nv) {
-
- case 1:
- cip->hdef->optmode = opt_dump;
- break;
-
- case 2:
- cip->hdef->optmode = opt_request;
- break;
-
- default:
- cip->hdef->optmode = opt_always;
- break;
- }
- } else if (!strcmp(aname, "opt-delay"))
- cip->hdef->optdelay = WITH2->UU.b;
- else if (!strcmp(aname, "disp"))
- cip->hdef->wantnote = WITH2->UU.b;
- else if (!strcmp(aname, "stats"))
- cip->hdef->wantstats = WITH2->UU.b;
- else if (!strcmp(aname, "dump")) {
- switch (WITH2->UU.nv) {
-
- case 1:
- cip->hdef->dumpmode = dump_dump;
- break;
-
- case 2:
- cip->hdef->dumpmode = dump_big;
- break;
-
- case 3:
- cip->hdef->dumpmode = dump_write;
- break;
-
- default:
- cip->hdef->dumpmode = dump_none;
- break;
+ controlinfo *cip;
+ char aname[256];
+ log_action_t *WITH;
+ log_grec *WITH1;
+ log_gattrrec *WITH2;
+ char STR1[256];
+
+ WITH = act->lact;
+ WITH1 = WITH->actgate;
+ switch (act->action)
+ {
+ case act_16_newkind:
+ hier_init(act->lact);
+ break;
+
+ case act_16_new:
+ case act_16_copy:
+ cip = (controlinfo *)Malloc(sizeof(controlinfo));
+ WITH1->info = (void *)cip;
+ cip->hdef = NULL;
+ cip->pgnum = -99;
+ *cip->message = '\0';
+ *cip->oldmessage = '\0';
+ *cip->message2 = '\0';
+ *cip->oldmessage2 = '\0';
+ cip->oldoptcolor = -1;
+ cip->olddumpcolor = -1;
+ cip->olddumpmode = dump_none;
+ cip->welcomeflag = true;
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) & (~(1L << 0)));
+ break;
+
+ case act_16_read:
+ WITH1->vars = (na_long)(((unsigned long)WITH1->vars) | (1L << 0));
+ break;
+
+ case act_16_dispose:
+ cip = (controlinfo *)WITH1->info;
+ if (cip->hdef != NULL) {
+ cip->hdef->gcontrol = NULL;
+ cip->hdef = NULL;
+ }
+ Free(cip);
+ break;
+
+ case act_16_connect:
+ cip = (controlinfo *)WITH1->info;
+ cip->pgnum = WITH->curpage;
+ break;
+
+ case act_16_disconnect:
+ cip = (controlinfo *)WITH1->info;
+ if (cip->hdef != NULL) {
+ cip->hdef->gcontrol = NULL;
+ cip->hdef = NULL;
+ }
+ cip->pgnum = -99;
+ break;
+
+ case act_16_draw:
+ cip = (controlinfo *)WITH1->info;
+ if (cip->hdef != NULL && cip->hdef->defined_) {
+ sprintf(STR1, "Definition for %s", cip->hdef->name);
+ strcpy(cip->message, STR1);
+ *cip->message2 = '\0';
+ }
+ if (WITH->refrflag)
+ refrcontrol(WITH->actgate, 1);
+ else
+ refrcontrol(WITH->actgate, 0);
+ break;
+
+ case act_16_erase:
+ refrcontrol(WITH->actgate, -1);
+ break;
+
+ case act_16_touch:
+ cip = (controlinfo *)WITH1->info;
+ if (WITH->actx >= -3 && WITH->actx <= 3 && WITH->acty >= -2 &&
+ WITH->acty <= 2)
+ {
+ if (cip->hdef != NULL && cip->hdef->defined_)
+ {
+ if (WITH->acty <= 0)
+ {
+ cip->hdef->nextoptflag = true;
+ cip->hdef->optflag = true;
+ refrcontrol(WITH->actgate, 0);
+ sprintf(STR1, "Optimizing %s", cip->hdef->name);
+ (*WITH->hook.vmessage)(STR1);
+ cip->hdef->oldpagestamp = 0; /*force recompile*/
+ /* updatehdef(cip^.hdef); */
+ }
+ else
+ {
+ if (cip->hdef->dumpmode == dump_write &&
+ *cip->hdef->writefile == '\0')
+ (*WITH->hook.message)("No file name specified");
+ else if (cip->hdef->dumpmode == dump_none)
+ (*WITH->hook.message)("Dumping is not enabled");
+ else
+ {
+ cip->hdef->dumphighlight = true;
+ cip->hdef->oldshowstamp = -1;
+ if (cip->hdef->optmode == opt_dump)
+ cip->hdef->optflag = true;
+ cip->hdef->nextoptflag = cip->hdef->optflag;
+ refrcontrol(WITH->actgate, 0);
+ /* call(hook.vmessage, 'Dumping ' + cip^.hdef^.name^); */
+ cip->hdef->oldpagestamp = 0; /*force recompile*/
+ }
+ }
+ }
+ else
+ (*WITH->hook.message)("Definition is not complete");
+ WITH->actflag = true;
+ }
+ break;
+
+ case act_16_configgate:
+ cip = (controlinfo *)WITH1->info;
+ if (WITH->actflag) /*first pass only*/
+ storecontrolattrs(cip->hdef, WITH->actgate);
+ break;
+
+ case act_16_configchgate:
+ WITH2 = &WITH1->attr[WITH->actx - 1];
+ cip = (controlinfo *)WITH1->info;
+ if (cip->hdef == NULL)
+ WITH->actflag = false;
+ else
+ {
+ namegattr(aname, WITH->actgate, (int)WITH->actx);
+ if (!strcmp(aname, "opt"))
+ {
+ if (WITH2->UU.U73.i1 < 0)
+ WITH2->UU.U73.i1 = 0;
+ if (WITH2->UU.U73.i1 >= 1000)
+ WITH2->blnk = true;
+ if (WITH2->blnk)
+ WITH2->UU.U73.i1 = 1000;
+ cip->hdef->optlevel = WITH2->UU.U73.i1;
+ }
+ else if (!strcmp(aname, "opt-when"))
+ {
+ switch (WITH2->UU.nv)
+ {
+ case 1:
+ cip->hdef->optmode = opt_dump;
+ break;
+
+ case 2:
+ cip->hdef->optmode = opt_request;
+ break;
+
+ default:
+ cip->hdef->optmode = opt_always;
+ break;
+ }
+ }
+ else if (!strcmp(aname, "opt-delay"))
+ cip->hdef->optdelay = WITH2->UU.b;
+ else if (!strcmp(aname, "disp"))
+ cip->hdef->wantnote = WITH2->UU.b;
+ else if (!strcmp(aname, "stats"))
+ cip->hdef->wantstats = WITH2->UU.b;
+ else if (!strcmp(aname, "dump"))
+ {
+ switch (WITH2->UU.nv)
+ {
+
+ case 1:
+ cip->hdef->dumpmode = dump_dump;
+ break;
+
+ case 2:
+ cip->hdef->dumpmode = dump_big;
+ break;
+
+ case 3:
+ cip->hdef->dumpmode = dump_write;
+ break;
+
+ default:
+ cip->hdef->dumpmode = dump_none;
+ break;
+ }
+ }
+ else if (!strcmp(aname, "write-file"))
+ {
+ strcpy(aname, WITH2->UU.sp);
+ newci_fixfname(aname, "def", "");
+ strchange(&WITH2->UU.sp, aname);
+ strchange(&cip->hdef->writefile, aname);
+ }
+ }
+ break;
+
+ case act_16_gengate:
+ if (!strcmp(WITH->genfunc, "INERT"))
+ WITH->actx = -42; /*kludge!*/
+ break;
+
+ default:
+ break;
}
- } else if (!strcmp(aname, "write-file")) {
- strcpy(aname, WITH2->UU.sp);
- newci_fixfname(aname, "def", "");
- strchange(&WITH2->UU.sp, aname);
- strchange(&cip->hdef->writefile, aname);
- }
- }
- break;
-
- case act_16_gengate:
- if (!strcmp(WITH->genfunc, "INERT"))
- WITH->actx = -42; /*kludge!*/
- break;
-
- default:
- break;
- }
}
-
-
-
-
-
-
-
-
/* End. */